mirror of
https://github.com/sehugg/8bitworkshop.git
synced 2024-06-18 10:29:37 +00:00
21379 lines
651 KiB
JavaScript
21379 lines
651 KiB
JavaScript
var PLASM = function(Module) {
|
|
Module = Module || {};
|
|
|
|
// The Module object: Our interface to the outside world. We import
|
|
// and export values on it, and do the work to get that through
|
|
// closure compiler if necessary. There are various ways Module can be used:
|
|
// 1. Not defined. We create it here
|
|
// 2. A function parameter, function(Module) { ..generated code.. }
|
|
// 3. pre-run appended it, var Module = {}; ..generated code..
|
|
// 4. External script tag defines var Module.
|
|
// We need to do an eval in order to handle the closure compiler
|
|
// case, where this code here is minified but Module was defined
|
|
// elsewhere (e.g. case 4 above). We also need to check if Module
|
|
// already exists (e.g. case 3 above).
|
|
// Note that if you want to run closure, and also to use Module
|
|
// after the generated code, you will need to define var Module = {};
|
|
// before the code. Then that object will be used in the code, and you
|
|
// can continue to use Module afterwards as well.
|
|
var Module;
|
|
if (!Module) Module = (typeof PLASM !== 'undefined' ? PLASM : null) || {};
|
|
|
|
// Sometimes an existing Module object exists with properties
|
|
// meant to overwrite the default module functionality. Here
|
|
// we collect those properties and reapply _after_ we configure
|
|
// the current environment's defaults to avoid having to be so
|
|
// defensive during initialization.
|
|
var moduleOverrides = {};
|
|
for (var key in Module) {
|
|
if (Module.hasOwnProperty(key)) {
|
|
moduleOverrides[key] = Module[key];
|
|
}
|
|
}
|
|
|
|
// The environment setup code below is customized to use Module.
|
|
// *** Environment setup code ***
|
|
var ENVIRONMENT_IS_WEB = false;
|
|
var ENVIRONMENT_IS_WORKER = false;
|
|
var ENVIRONMENT_IS_NODE = false;
|
|
var ENVIRONMENT_IS_SHELL = false;
|
|
|
|
// Three configurations we can be running in:
|
|
// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
|
|
// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
|
|
// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
|
|
|
|
if (Module['ENVIRONMENT']) {
|
|
if (Module['ENVIRONMENT'] === 'WEB') {
|
|
ENVIRONMENT_IS_WEB = true;
|
|
} else if (Module['ENVIRONMENT'] === 'WORKER') {
|
|
ENVIRONMENT_IS_WORKER = true;
|
|
} else if (Module['ENVIRONMENT'] === 'NODE') {
|
|
ENVIRONMENT_IS_NODE = true;
|
|
} else if (Module['ENVIRONMENT'] === 'SHELL') {
|
|
ENVIRONMENT_IS_SHELL = true;
|
|
} else {
|
|
throw new Error('The provided Module[\'ENVIRONMENT\'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.');
|
|
}
|
|
} else {
|
|
ENVIRONMENT_IS_WEB = typeof window === 'object';
|
|
ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
|
|
ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
|
|
ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
|
|
}
|
|
|
|
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
// Expose functionality in the same simple way that the shells work
|
|
// Note that we pollute the global namespace here, otherwise we break in node
|
|
if (!Module['print']) Module['print'] = console.log;
|
|
if (!Module['printErr']) Module['printErr'] = console.warn;
|
|
|
|
var nodeFS;
|
|
var nodePath;
|
|
|
|
Module['read'] = function read(filename, binary) {
|
|
if (!nodeFS) nodeFS = require('fs');
|
|
if (!nodePath) nodePath = require('path');
|
|
filename = nodePath['normalize'](filename);
|
|
var ret = nodeFS['readFileSync'](filename);
|
|
return binary ? ret : ret.toString();
|
|
};
|
|
|
|
Module['readBinary'] = function readBinary(filename) {
|
|
var ret = Module['read'](filename, true);
|
|
if (!ret.buffer) {
|
|
ret = new Uint8Array(ret);
|
|
}
|
|
assert(ret.buffer);
|
|
return ret;
|
|
};
|
|
|
|
Module['load'] = function load(f) {
|
|
globalEval(read(f));
|
|
};
|
|
|
|
if (!Module['thisProgram']) {
|
|
if (process['argv'].length > 1) {
|
|
Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
|
|
} else {
|
|
Module['thisProgram'] = 'unknown-program';
|
|
}
|
|
}
|
|
|
|
Module['arguments'] = process['argv'].slice(2);
|
|
|
|
if (typeof module !== 'undefined') {
|
|
module['exports'] = Module;
|
|
}
|
|
|
|
process['on']('uncaughtException', function(ex) {
|
|
// suppress ExitStatus exceptions from showing an error
|
|
if (!(ex instanceof ExitStatus)) {
|
|
throw ex;
|
|
}
|
|
});
|
|
|
|
Module['inspect'] = function () { return '[Emscripten Module object]'; };
|
|
}
|
|
else if (ENVIRONMENT_IS_SHELL) {
|
|
if (!Module['print']) Module['print'] = print;
|
|
if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm
|
|
|
|
if (typeof read != 'undefined') {
|
|
Module['read'] = read;
|
|
} else {
|
|
Module['read'] = function read() { throw 'no read() available (jsc?)' };
|
|
}
|
|
|
|
Module['readBinary'] = function readBinary(f) {
|
|
if (typeof readbuffer === 'function') {
|
|
return new Uint8Array(readbuffer(f));
|
|
}
|
|
var data = read(f, 'binary');
|
|
assert(typeof data === 'object');
|
|
return data;
|
|
};
|
|
|
|
if (typeof scriptArgs != 'undefined') {
|
|
Module['arguments'] = scriptArgs;
|
|
} else if (typeof arguments != 'undefined') {
|
|
Module['arguments'] = arguments;
|
|
}
|
|
|
|
}
|
|
else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
|
|
Module['read'] = function read(url) {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, false);
|
|
xhr.send(null);
|
|
return xhr.responseText;
|
|
};
|
|
|
|
Module['readAsync'] = function readAsync(url, onload, onerror) {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, true);
|
|
xhr.responseType = 'arraybuffer';
|
|
xhr.onload = function xhr_onload() {
|
|
if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
|
|
onload(xhr.response);
|
|
} else {
|
|
onerror();
|
|
}
|
|
};
|
|
xhr.onerror = onerror;
|
|
xhr.send(null);
|
|
};
|
|
|
|
if (typeof arguments != 'undefined') {
|
|
Module['arguments'] = arguments;
|
|
}
|
|
|
|
if (typeof console !== 'undefined') {
|
|
if (!Module['print']) Module['print'] = function print(x) {
|
|
console.log(x);
|
|
};
|
|
if (!Module['printErr']) Module['printErr'] = function printErr(x) {
|
|
console.warn(x);
|
|
};
|
|
} else {
|
|
// Probably a worker, and without console.log. We can do very little here...
|
|
var TRY_USE_DUMP = false;
|
|
if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) {
|
|
dump(x);
|
|
}) : (function(x) {
|
|
// self.postMessage(x); // enable this if you want stdout to be sent as messages
|
|
}));
|
|
}
|
|
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
Module['load'] = importScripts;
|
|
}
|
|
|
|
if (typeof Module['setWindowTitle'] === 'undefined') {
|
|
Module['setWindowTitle'] = function(title) { document.title = title };
|
|
}
|
|
}
|
|
else {
|
|
// Unreachable because SHELL is dependant on the others
|
|
throw 'Unknown runtime environment. Where are we?';
|
|
}
|
|
|
|
function globalEval(x) {
|
|
eval.call(null, x);
|
|
}
|
|
if (!Module['load'] && Module['read']) {
|
|
Module['load'] = function load(f) {
|
|
globalEval(Module['read'](f));
|
|
};
|
|
}
|
|
if (!Module['print']) {
|
|
Module['print'] = function(){};
|
|
}
|
|
if (!Module['printErr']) {
|
|
Module['printErr'] = Module['print'];
|
|
}
|
|
if (!Module['arguments']) {
|
|
Module['arguments'] = [];
|
|
}
|
|
if (!Module['thisProgram']) {
|
|
Module['thisProgram'] = './this.program';
|
|
}
|
|
|
|
// *** Environment setup code ***
|
|
|
|
// Closure helpers
|
|
Module.print = Module['print'];
|
|
Module.printErr = Module['printErr'];
|
|
|
|
// Callbacks
|
|
Module['preRun'] = [];
|
|
Module['postRun'] = [];
|
|
|
|
// Merge back in the overrides
|
|
for (var key in moduleOverrides) {
|
|
if (moduleOverrides.hasOwnProperty(key)) {
|
|
Module[key] = moduleOverrides[key];
|
|
}
|
|
}
|
|
// Free the object hierarchy contained in the overrides, this lets the GC
|
|
// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
|
|
moduleOverrides = undefined;
|
|
|
|
|
|
|
|
// {{PREAMBLE_ADDITIONS}}
|
|
|
|
// === Preamble library stuff ===
|
|
|
|
// Documentation for the public APIs defined in this file must be updated in:
|
|
// site/source/docs/api_reference/preamble.js.rst
|
|
// A prebuilt local version of the documentation is available at:
|
|
// site/build/text/docs/api_reference/preamble.js.txt
|
|
// You can also build docs locally as HTML or other formats in site/
|
|
// An online HTML version (which may be of a different version of Emscripten)
|
|
// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
|
|
|
|
//========================================
|
|
// Runtime code shared with compiler
|
|
//========================================
|
|
|
|
var Runtime = {
|
|
setTempRet0: function (value) {
|
|
tempRet0 = value;
|
|
},
|
|
getTempRet0: function () {
|
|
return tempRet0;
|
|
},
|
|
stackSave: function () {
|
|
return STACKTOP;
|
|
},
|
|
stackRestore: function (stackTop) {
|
|
STACKTOP = stackTop;
|
|
},
|
|
getNativeTypeSize: function (type) {
|
|
switch (type) {
|
|
case 'i1': case 'i8': return 1;
|
|
case 'i16': return 2;
|
|
case 'i32': return 4;
|
|
case 'i64': return 8;
|
|
case 'float': return 4;
|
|
case 'double': return 8;
|
|
default: {
|
|
if (type[type.length-1] === '*') {
|
|
return Runtime.QUANTUM_SIZE; // A pointer
|
|
} else if (type[0] === 'i') {
|
|
var bits = parseInt(type.substr(1));
|
|
assert(bits % 8 === 0);
|
|
return bits/8;
|
|
} else {
|
|
return 0;
|
|
}
|
|
}
|
|
}
|
|
},
|
|
getNativeFieldSize: function (type) {
|
|
return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE);
|
|
},
|
|
STACK_ALIGN: 16,
|
|
prepVararg: function (ptr, type) {
|
|
if (type === 'double' || type === 'i64') {
|
|
// move so the load is aligned
|
|
if (ptr & 7) {
|
|
assert((ptr & 7) === 4);
|
|
ptr += 4;
|
|
}
|
|
} else {
|
|
assert((ptr & 3) === 0);
|
|
}
|
|
return ptr;
|
|
},
|
|
getAlignSize: function (type, size, vararg) {
|
|
// we align i64s and doubles on 64-bit boundaries, unlike x86
|
|
if (!vararg && (type == 'i64' || type == 'double')) return 8;
|
|
if (!type) return Math.min(size, 8); // align structures internally to 64 bits
|
|
return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE);
|
|
},
|
|
dynCall: function (sig, ptr, args) {
|
|
if (args && args.length) {
|
|
return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
|
|
} else {
|
|
return Module['dynCall_' + sig].call(null, ptr);
|
|
}
|
|
},
|
|
functionPointers: [],
|
|
addFunction: function (func) {
|
|
for (var i = 0; i < Runtime.functionPointers.length; i++) {
|
|
if (!Runtime.functionPointers[i]) {
|
|
Runtime.functionPointers[i] = func;
|
|
return 2*(1 + i);
|
|
}
|
|
}
|
|
throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
|
|
},
|
|
removeFunction: function (index) {
|
|
Runtime.functionPointers[(index-2)/2] = null;
|
|
},
|
|
warnOnce: function (text) {
|
|
if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
|
|
if (!Runtime.warnOnce.shown[text]) {
|
|
Runtime.warnOnce.shown[text] = 1;
|
|
Module.printErr(text);
|
|
}
|
|
},
|
|
funcWrappers: {},
|
|
getFuncWrapper: function (func, sig) {
|
|
assert(sig);
|
|
if (!Runtime.funcWrappers[sig]) {
|
|
Runtime.funcWrappers[sig] = {};
|
|
}
|
|
var sigCache = Runtime.funcWrappers[sig];
|
|
if (!sigCache[func]) {
|
|
// optimize away arguments usage in common cases
|
|
if (sig.length === 1) {
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return Runtime.dynCall(sig, func);
|
|
};
|
|
} else if (sig.length === 2) {
|
|
sigCache[func] = function dynCall_wrapper(arg) {
|
|
return Runtime.dynCall(sig, func, [arg]);
|
|
};
|
|
} else {
|
|
// general case
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments));
|
|
};
|
|
}
|
|
}
|
|
return sigCache[func];
|
|
},
|
|
getCompilerSetting: function (name) {
|
|
throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work';
|
|
},
|
|
stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16); return ret; },
|
|
staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + size)|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; },
|
|
dynamicAlloc: function (size) { var ret = DYNAMICTOP;DYNAMICTOP = (DYNAMICTOP + size)|0;DYNAMICTOP = (((DYNAMICTOP)+15)&-16); if (DYNAMICTOP >= TOTAL_MEMORY) { var success = enlargeMemory(); if (!success) { DYNAMICTOP = ret; return 0; } }; return ret; },
|
|
alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; },
|
|
makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; },
|
|
GLOBAL_BASE: 8,
|
|
QUANTUM_SIZE: 4,
|
|
__dummy__: 0
|
|
}
|
|
|
|
|
|
|
|
Module["Runtime"] = Runtime;
|
|
|
|
|
|
|
|
//========================================
|
|
// Runtime essentials
|
|
//========================================
|
|
|
|
var ABORT = false; // whether we are quitting the application. no code should run after this. set in exit() and abort()
|
|
var EXITSTATUS = 0;
|
|
|
|
function assert(condition, text) {
|
|
if (!condition) {
|
|
abort('Assertion failed: ' + text);
|
|
}
|
|
}
|
|
|
|
var globalScope = this;
|
|
|
|
// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
|
|
function getCFunc(ident) {
|
|
var func = Module['_' + ident]; // closure exported function
|
|
if (!func) {
|
|
try { func = eval('_' + ident); } catch(e) {}
|
|
}
|
|
assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)');
|
|
return func;
|
|
}
|
|
|
|
var cwrap, ccall;
|
|
(function(){
|
|
var JSfuncs = {
|
|
// Helpers for cwrap -- it can't refer to Runtime directly because it might
|
|
// be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
|
|
// out what the minified function name is.
|
|
'stackSave': function() {
|
|
Runtime.stackSave()
|
|
},
|
|
'stackRestore': function() {
|
|
Runtime.stackRestore()
|
|
},
|
|
// type conversion from js to c
|
|
'arrayToC' : function(arr) {
|
|
var ret = Runtime.stackAlloc(arr.length);
|
|
writeArrayToMemory(arr, ret);
|
|
return ret;
|
|
},
|
|
'stringToC' : function(str) {
|
|
var ret = 0;
|
|
if (str !== null && str !== undefined && str !== 0) { // null string
|
|
// at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
|
|
ret = Runtime.stackAlloc((str.length << 2) + 1);
|
|
writeStringToMemory(str, ret);
|
|
}
|
|
return ret;
|
|
}
|
|
};
|
|
// For fast lookup of conversion functions
|
|
var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']};
|
|
|
|
// C calling interface.
|
|
ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
|
|
var func = getCFunc(ident);
|
|
var cArgs = [];
|
|
var stack = 0;
|
|
if (args) {
|
|
for (var i = 0; i < args.length; i++) {
|
|
var converter = toC[argTypes[i]];
|
|
if (converter) {
|
|
if (stack === 0) stack = Runtime.stackSave();
|
|
cArgs[i] = converter(args[i]);
|
|
} else {
|
|
cArgs[i] = args[i];
|
|
}
|
|
}
|
|
}
|
|
var ret = func.apply(null, cArgs);
|
|
if (returnType === 'string') ret = Pointer_stringify(ret);
|
|
if (stack !== 0) {
|
|
if (opts && opts.async) {
|
|
EmterpreterAsync.asyncFinalizers.push(function() {
|
|
Runtime.stackRestore(stack);
|
|
});
|
|
return;
|
|
}
|
|
Runtime.stackRestore(stack);
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
|
|
function parseJSFunc(jsfunc) {
|
|
// Match the body and the return value of a javascript function source
|
|
var parsed = jsfunc.toString().match(sourceRegex).slice(1);
|
|
return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]}
|
|
}
|
|
|
|
// sources of useful functions. we create this lazily as it can trigger a source decompression on this entire file
|
|
var JSsource = null;
|
|
function ensureJSsource() {
|
|
if (!JSsource) {
|
|
JSsource = {};
|
|
for (var fun in JSfuncs) {
|
|
if (JSfuncs.hasOwnProperty(fun)) {
|
|
// Elements of toCsource are arrays of three items:
|
|
// the code, and the return value
|
|
JSsource[fun] = parseJSFunc(JSfuncs[fun]);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
cwrap = function cwrap(ident, returnType, argTypes) {
|
|
argTypes = argTypes || [];
|
|
var cfunc = getCFunc(ident);
|
|
// When the function takes numbers and returns a number, we can just return
|
|
// the original function
|
|
var numericArgs = argTypes.every(function(type){ return type === 'number'});
|
|
var numericRet = (returnType !== 'string');
|
|
if ( numericRet && numericArgs) {
|
|
return cfunc;
|
|
}
|
|
// Creation of the arguments list (["$1","$2",...,"$nargs"])
|
|
var argNames = argTypes.map(function(x,i){return '$'+i});
|
|
var funcstr = "(function(" + argNames.join(',') + ") {";
|
|
var nargs = argTypes.length;
|
|
if (!numericArgs) {
|
|
// Generate the code needed to convert the arguments from javascript
|
|
// values to pointers
|
|
ensureJSsource();
|
|
funcstr += 'var stack = ' + JSsource['stackSave'].body + ';';
|
|
for (var i = 0; i < nargs; i++) {
|
|
var arg = argNames[i], type = argTypes[i];
|
|
if (type === 'number') continue;
|
|
var convertCode = JSsource[type + 'ToC']; // [code, return]
|
|
funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';';
|
|
funcstr += convertCode.body + ';';
|
|
funcstr += arg + '=(' + convertCode.returnValue + ');';
|
|
}
|
|
}
|
|
|
|
// When the code is compressed, the name of cfunc is not literally 'cfunc' anymore
|
|
var cfuncname = parseJSFunc(function(){return cfunc}).returnValue;
|
|
// Call the function
|
|
funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');';
|
|
if (!numericRet) { // Return type can only by 'string' or 'number'
|
|
// Convert the result to a string
|
|
var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue;
|
|
funcstr += 'ret = ' + strgfy + '(ret);';
|
|
}
|
|
if (!numericArgs) {
|
|
// If we had a stack, restore it
|
|
ensureJSsource();
|
|
funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';';
|
|
}
|
|
funcstr += 'return ret})';
|
|
return eval(funcstr);
|
|
};
|
|
})();
|
|
Module["ccall"] = ccall;
|
|
Module["cwrap"] = cwrap;
|
|
|
|
function setValue(ptr, value, type, noSafe) {
|
|
type = type || 'i8';
|
|
if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
|
|
switch(type) {
|
|
case 'i1': HEAP8[((ptr)>>0)]=value; break;
|
|
case 'i8': HEAP8[((ptr)>>0)]=value; break;
|
|
case 'i16': HEAP16[((ptr)>>1)]=value; break;
|
|
case 'i32': HEAP32[((ptr)>>2)]=value; break;
|
|
case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
|
|
case 'float': HEAPF32[((ptr)>>2)]=value; break;
|
|
case 'double': HEAPF64[((ptr)>>3)]=value; break;
|
|
default: abort('invalid type for setValue: ' + type);
|
|
}
|
|
}
|
|
Module["setValue"] = setValue;
|
|
|
|
|
|
function getValue(ptr, type, noSafe) {
|
|
type = type || 'i8';
|
|
if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
|
|
switch(type) {
|
|
case 'i1': return HEAP8[((ptr)>>0)];
|
|
case 'i8': return HEAP8[((ptr)>>0)];
|
|
case 'i16': return HEAP16[((ptr)>>1)];
|
|
case 'i32': return HEAP32[((ptr)>>2)];
|
|
case 'i64': return HEAP32[((ptr)>>2)];
|
|
case 'float': return HEAPF32[((ptr)>>2)];
|
|
case 'double': return HEAPF64[((ptr)>>3)];
|
|
default: abort('invalid type for setValue: ' + type);
|
|
}
|
|
return null;
|
|
}
|
|
Module["getValue"] = getValue;
|
|
|
|
var ALLOC_NORMAL = 0; // Tries to use _malloc()
|
|
var ALLOC_STACK = 1; // Lives for the duration of the current function call
|
|
var ALLOC_STATIC = 2; // Cannot be freed
|
|
var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
|
|
var ALLOC_NONE = 4; // Do not allocate
|
|
Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
|
|
Module["ALLOC_STACK"] = ALLOC_STACK;
|
|
Module["ALLOC_STATIC"] = ALLOC_STATIC;
|
|
Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
|
|
Module["ALLOC_NONE"] = ALLOC_NONE;
|
|
|
|
// allocate(): This is for internal use. You can use it yourself as well, but the interface
|
|
// is a little tricky (see docs right below). The reason is that it is optimized
|
|
// for multiple syntaxes to save space in generated code. So you should
|
|
// normally not use allocate(), and instead allocate memory using _malloc(),
|
|
// initialize it with setValue(), and so forth.
|
|
// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
|
|
// in *bytes* (note that this is sometimes confusing: the next parameter does not
|
|
// affect this!)
|
|
// @types: Either an array of types, one for each byte (or 0 if no type at that position),
|
|
// or a single type which is used for the entire block. This only matters if there
|
|
// is initial data - if @slab is a number, then this does not matter at all and is
|
|
// ignored.
|
|
// @allocator: How to allocate memory, see ALLOC_*
|
|
function allocate(slab, types, allocator, ptr) {
|
|
var zeroinit, size;
|
|
if (typeof slab === 'number') {
|
|
zeroinit = true;
|
|
size = slab;
|
|
} else {
|
|
zeroinit = false;
|
|
size = slab.length;
|
|
}
|
|
|
|
var singleType = typeof types === 'string' ? types : null;
|
|
|
|
var ret;
|
|
if (allocator == ALLOC_NONE) {
|
|
ret = ptr;
|
|
} else {
|
|
ret = [typeof _malloc === 'function' ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
|
|
}
|
|
|
|
if (zeroinit) {
|
|
var ptr = ret, stop;
|
|
assert((ret & 3) == 0);
|
|
stop = ret + (size & ~3);
|
|
for (; ptr < stop; ptr += 4) {
|
|
HEAP32[((ptr)>>2)]=0;
|
|
}
|
|
stop = ret + size;
|
|
while (ptr < stop) {
|
|
HEAP8[((ptr++)>>0)]=0;
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
if (singleType === 'i8') {
|
|
if (slab.subarray || slab.slice) {
|
|
HEAPU8.set(slab, ret);
|
|
} else {
|
|
HEAPU8.set(new Uint8Array(slab), ret);
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
var i = 0, type, typeSize, previousType;
|
|
while (i < size) {
|
|
var curr = slab[i];
|
|
|
|
if (typeof curr === 'function') {
|
|
curr = Runtime.getFunctionIndex(curr);
|
|
}
|
|
|
|
type = singleType || types[i];
|
|
if (type === 0) {
|
|
i++;
|
|
continue;
|
|
}
|
|
|
|
if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
|
|
|
|
setValue(ret+i, curr, type);
|
|
|
|
// no need to look up size unless type changes, so cache it
|
|
if (previousType !== type) {
|
|
typeSize = Runtime.getNativeTypeSize(type);
|
|
previousType = type;
|
|
}
|
|
i += typeSize;
|
|
}
|
|
|
|
return ret;
|
|
}
|
|
Module["allocate"] = allocate;
|
|
|
|
// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
|
|
function getMemory(size) {
|
|
if (!staticSealed) return Runtime.staticAlloc(size);
|
|
if ((typeof _sbrk !== 'undefined' && !_sbrk.called) || !runtimeInitialized) return Runtime.dynamicAlloc(size);
|
|
return _malloc(size);
|
|
}
|
|
Module["getMemory"] = getMemory;
|
|
|
|
function Pointer_stringify(ptr, /* optional */ length) {
|
|
if (length === 0 || !ptr) return '';
|
|
// TODO: use TextDecoder
|
|
// Find the length, and check for UTF while doing so
|
|
var hasUtf = 0;
|
|
var t;
|
|
var i = 0;
|
|
while (1) {
|
|
t = HEAPU8[(((ptr)+(i))>>0)];
|
|
hasUtf |= t;
|
|
if (t == 0 && !length) break;
|
|
i++;
|
|
if (length && i == length) break;
|
|
}
|
|
if (!length) length = i;
|
|
|
|
var ret = '';
|
|
|
|
if (hasUtf < 128) {
|
|
var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
|
|
var curr;
|
|
while (length > 0) {
|
|
curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
|
|
ret = ret ? ret + curr : curr;
|
|
ptr += MAX_CHUNK;
|
|
length -= MAX_CHUNK;
|
|
}
|
|
return ret;
|
|
}
|
|
return Module['UTF8ToString'](ptr);
|
|
}
|
|
Module["Pointer_stringify"] = Pointer_stringify;
|
|
|
|
// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
|
|
// a copy of that string as a Javascript String object.
|
|
|
|
function AsciiToString(ptr) {
|
|
var str = '';
|
|
while (1) {
|
|
var ch = HEAP8[((ptr++)>>0)];
|
|
if (!ch) return str;
|
|
str += String.fromCharCode(ch);
|
|
}
|
|
}
|
|
Module["AsciiToString"] = AsciiToString;
|
|
|
|
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
|
|
// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
|
|
|
|
function stringToAscii(str, outPtr) {
|
|
return writeAsciiToMemory(str, outPtr, false);
|
|
}
|
|
Module["stringToAscii"] = stringToAscii;
|
|
|
|
// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
|
|
// a copy of that string as a Javascript String object.
|
|
|
|
var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
|
|
function UTF8ArrayToString(u8Array, idx) {
|
|
var endPtr = idx;
|
|
// TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
|
|
// Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
|
|
while (u8Array[endPtr]) ++endPtr;
|
|
|
|
if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
|
|
return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
|
|
} else {
|
|
var u0, u1, u2, u3, u4, u5;
|
|
|
|
var str = '';
|
|
while (1) {
|
|
// For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
|
|
u0 = u8Array[idx++];
|
|
if (!u0) return str;
|
|
if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
|
|
u1 = u8Array[idx++] & 63;
|
|
if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
|
|
u2 = u8Array[idx++] & 63;
|
|
if ((u0 & 0xF0) == 0xE0) {
|
|
u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
|
|
} else {
|
|
u3 = u8Array[idx++] & 63;
|
|
if ((u0 & 0xF8) == 0xF0) {
|
|
u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
|
|
} else {
|
|
u4 = u8Array[idx++] & 63;
|
|
if ((u0 & 0xFC) == 0xF8) {
|
|
u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
|
|
} else {
|
|
u5 = u8Array[idx++] & 63;
|
|
u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
|
|
}
|
|
}
|
|
}
|
|
if (u0 < 0x10000) {
|
|
str += String.fromCharCode(u0);
|
|
} else {
|
|
var ch = u0 - 0x10000;
|
|
str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
|
|
}
|
|
}
|
|
}
|
|
}
|
|
Module["UTF8ArrayToString"] = UTF8ArrayToString;
|
|
|
|
// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
|
|
// a copy of that string as a Javascript String object.
|
|
|
|
function UTF8ToString(ptr) {
|
|
return UTF8ArrayToString(HEAPU8,ptr);
|
|
}
|
|
Module["UTF8ToString"] = UTF8ToString;
|
|
|
|
// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
|
|
// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
|
|
// Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write.
|
|
// Parameters:
|
|
// str: the Javascript string to copy.
|
|
// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
|
|
// outIdx: The starting offset in the array to begin the copying.
|
|
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
|
|
// terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
|
|
// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
|
|
// Returns the number of bytes written, EXCLUDING the null terminator.
|
|
|
|
function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
|
|
if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
|
|
return 0;
|
|
|
|
var startIdx = outIdx;
|
|
var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
// For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
|
|
var u = str.charCodeAt(i); // possibly a lead surrogate
|
|
if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
|
|
if (u <= 0x7F) {
|
|
if (outIdx >= endIdx) break;
|
|
outU8Array[outIdx++] = u;
|
|
} else if (u <= 0x7FF) {
|
|
if (outIdx + 1 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xC0 | (u >> 6);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
} else if (u <= 0xFFFF) {
|
|
if (outIdx + 2 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xE0 | (u >> 12);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
} else if (u <= 0x1FFFFF) {
|
|
if (outIdx + 3 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xF0 | (u >> 18);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
} else if (u <= 0x3FFFFFF) {
|
|
if (outIdx + 4 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xF8 | (u >> 24);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
} else {
|
|
if (outIdx + 5 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xFC | (u >> 30);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
}
|
|
}
|
|
// Null-terminate the pointer to the buffer.
|
|
outU8Array[outIdx] = 0;
|
|
return outIdx - startIdx;
|
|
}
|
|
Module["stringToUTF8Array"] = stringToUTF8Array;
|
|
|
|
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
|
|
// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
|
|
// Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write.
|
|
// Returns the number of bytes written, EXCLUDING the null terminator.
|
|
|
|
function stringToUTF8(str, outPtr, maxBytesToWrite) {
|
|
return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
|
|
}
|
|
Module["stringToUTF8"] = stringToUTF8;
|
|
|
|
// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
|
|
|
|
function lengthBytesUTF8(str) {
|
|
var len = 0;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
var u = str.charCodeAt(i); // possibly a lead surrogate
|
|
if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
|
|
if (u <= 0x7F) {
|
|
++len;
|
|
} else if (u <= 0x7FF) {
|
|
len += 2;
|
|
} else if (u <= 0xFFFF) {
|
|
len += 3;
|
|
} else if (u <= 0x1FFFFF) {
|
|
len += 4;
|
|
} else if (u <= 0x3FFFFFF) {
|
|
len += 5;
|
|
} else {
|
|
len += 6;
|
|
}
|
|
}
|
|
return len;
|
|
}
|
|
Module["lengthBytesUTF8"] = lengthBytesUTF8;
|
|
|
|
// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
|
|
// a copy of that string as a Javascript String object.
|
|
|
|
var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
|
|
function UTF16ToString(ptr) {
|
|
var endPtr = ptr;
|
|
// TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
|
|
// Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
|
|
var idx = endPtr >> 1;
|
|
while (HEAP16[idx]) ++idx;
|
|
endPtr = idx << 1;
|
|
|
|
if (endPtr - ptr > 32 && UTF16Decoder) {
|
|
return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
|
|
} else {
|
|
var i = 0;
|
|
|
|
var str = '';
|
|
while (1) {
|
|
var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
|
|
if (codeUnit == 0) return str;
|
|
++i;
|
|
// fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
|
|
str += String.fromCharCode(codeUnit);
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
|
|
// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
|
|
// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
|
|
// Parameters:
|
|
// str: the Javascript string to copy.
|
|
// outPtr: Byte address in Emscripten HEAP where to write the string to.
|
|
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
|
|
// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
|
|
// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
|
|
// Returns the number of bytes written, EXCLUDING the null terminator.
|
|
|
|
function stringToUTF16(str, outPtr, maxBytesToWrite) {
|
|
// Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
|
|
if (maxBytesToWrite === undefined) {
|
|
maxBytesToWrite = 0x7FFFFFFF;
|
|
}
|
|
if (maxBytesToWrite < 2) return 0;
|
|
maxBytesToWrite -= 2; // Null terminator.
|
|
var startPtr = outPtr;
|
|
var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
|
|
for (var i = 0; i < numCharsToWrite; ++i) {
|
|
// charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
|
|
var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
|
|
HEAP16[((outPtr)>>1)]=codeUnit;
|
|
outPtr += 2;
|
|
}
|
|
// Null-terminate the pointer to the HEAP.
|
|
HEAP16[((outPtr)>>1)]=0;
|
|
return outPtr - startPtr;
|
|
}
|
|
|
|
|
|
// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
|
|
|
|
function lengthBytesUTF16(str) {
|
|
return str.length*2;
|
|
}
|
|
|
|
|
|
function UTF32ToString(ptr) {
|
|
var i = 0;
|
|
|
|
var str = '';
|
|
while (1) {
|
|
var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
|
|
if (utf32 == 0)
|
|
return str;
|
|
++i;
|
|
// Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
if (utf32 >= 0x10000) {
|
|
var ch = utf32 - 0x10000;
|
|
str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
|
|
} else {
|
|
str += String.fromCharCode(utf32);
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
|
|
// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
|
|
// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
|
|
// Parameters:
|
|
// str: the Javascript string to copy.
|
|
// outPtr: Byte address in Emscripten HEAP where to write the string to.
|
|
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
|
|
// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
|
|
// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
|
|
// Returns the number of bytes written, EXCLUDING the null terminator.
|
|
|
|
function stringToUTF32(str, outPtr, maxBytesToWrite) {
|
|
// Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
|
|
if (maxBytesToWrite === undefined) {
|
|
maxBytesToWrite = 0x7FFFFFFF;
|
|
}
|
|
if (maxBytesToWrite < 4) return 0;
|
|
var startPtr = outPtr;
|
|
var endPtr = startPtr + maxBytesToWrite - 4;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
|
|
if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
|
|
var trailSurrogate = str.charCodeAt(++i);
|
|
codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
|
|
}
|
|
HEAP32[((outPtr)>>2)]=codeUnit;
|
|
outPtr += 4;
|
|
if (outPtr + 4 > endPtr) break;
|
|
}
|
|
// Null-terminate the pointer to the HEAP.
|
|
HEAP32[((outPtr)>>2)]=0;
|
|
return outPtr - startPtr;
|
|
}
|
|
|
|
|
|
// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
|
|
|
|
function lengthBytesUTF32(str) {
|
|
var len = 0;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
var codeUnit = str.charCodeAt(i);
|
|
if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
|
|
len += 4;
|
|
}
|
|
|
|
return len;
|
|
}
|
|
|
|
|
|
function demangle(func) {
|
|
var hasLibcxxabi = !!Module['___cxa_demangle'];
|
|
if (hasLibcxxabi) {
|
|
try {
|
|
var buf = _malloc(func.length);
|
|
writeStringToMemory(func.substr(1), buf);
|
|
var status = _malloc(4);
|
|
var ret = Module['___cxa_demangle'](buf, 0, 0, status);
|
|
if (getValue(status, 'i32') === 0 && ret) {
|
|
return Pointer_stringify(ret);
|
|
}
|
|
// otherwise, libcxxabi failed
|
|
} catch(e) {
|
|
// ignore problems here
|
|
} finally {
|
|
if (buf) _free(buf);
|
|
if (status) _free(status);
|
|
if (ret) _free(ret);
|
|
}
|
|
// failure when using libcxxabi, don't demangle
|
|
return func;
|
|
}
|
|
Runtime.warnOnce('warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling');
|
|
return func;
|
|
}
|
|
|
|
function demangleAll(text) {
|
|
return text.replace(/__Z[\w\d_]+/g, function(x) { var y = demangle(x); return x === y ? x : (x + ' [' + y + ']') });
|
|
}
|
|
|
|
function jsStackTrace() {
|
|
var err = new Error();
|
|
if (!err.stack) {
|
|
// IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
|
|
// so try that as a special-case.
|
|
try {
|
|
throw new Error(0);
|
|
} catch(e) {
|
|
err = e;
|
|
}
|
|
if (!err.stack) {
|
|
return '(no stack trace available)';
|
|
}
|
|
}
|
|
return err.stack.toString();
|
|
}
|
|
|
|
function stackTrace() {
|
|
var js = jsStackTrace();
|
|
if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
|
|
return demangleAll(js);
|
|
}
|
|
Module["stackTrace"] = stackTrace;
|
|
|
|
// Memory management
|
|
|
|
var PAGE_SIZE = 4096;
|
|
|
|
function alignMemoryPage(x) {
|
|
if (x % 4096 > 0) {
|
|
x += (4096 - (x % 4096));
|
|
}
|
|
return x;
|
|
}
|
|
|
|
var HEAP;
|
|
var buffer;
|
|
var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
|
|
|
|
function updateGlobalBuffer(buf) {
|
|
Module['buffer'] = buffer = buf;
|
|
}
|
|
|
|
function updateGlobalBufferViews() {
|
|
Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
|
|
Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
|
|
Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
|
|
Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
|
|
Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
|
|
Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
|
|
Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
|
|
Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
|
|
}
|
|
|
|
var STATIC_BASE = 0, STATICTOP = 0, staticSealed = false; // static area
|
|
var STACK_BASE = 0, STACKTOP = 0, STACK_MAX = 0; // stack area
|
|
var DYNAMIC_BASE = 0, DYNAMICTOP = 0; // dynamic area handled by sbrk
|
|
|
|
|
|
|
|
function abortOnCannotGrowMemory() {
|
|
abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ');
|
|
}
|
|
|
|
function enlargeMemory() {
|
|
abortOnCannotGrowMemory();
|
|
}
|
|
|
|
|
|
var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
|
|
var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216;
|
|
|
|
var totalMemory = 64*1024;
|
|
while (totalMemory < TOTAL_MEMORY || totalMemory < 2*TOTAL_STACK) {
|
|
if (totalMemory < 16*1024*1024) {
|
|
totalMemory *= 2;
|
|
} else {
|
|
totalMemory += 16*1024*1024
|
|
}
|
|
}
|
|
if (totalMemory !== TOTAL_MEMORY) {
|
|
TOTAL_MEMORY = totalMemory;
|
|
}
|
|
|
|
// Initialize the runtime's memory
|
|
|
|
|
|
|
|
// Use a provided buffer, if there is one, or else allocate a new one
|
|
if (Module['buffer']) {
|
|
buffer = Module['buffer'];
|
|
} else {
|
|
buffer = new ArrayBuffer(TOTAL_MEMORY);
|
|
}
|
|
updateGlobalBufferViews();
|
|
|
|
|
|
// Endianness check (note: assumes compiler arch was little-endian)
|
|
HEAP32[0] = 0x63736d65; /* 'emsc' */
|
|
HEAP16[1] = 0x6373;
|
|
if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!';
|
|
|
|
Module['HEAP'] = HEAP;
|
|
Module['buffer'] = buffer;
|
|
Module['HEAP8'] = HEAP8;
|
|
Module['HEAP16'] = HEAP16;
|
|
Module['HEAP32'] = HEAP32;
|
|
Module['HEAPU8'] = HEAPU8;
|
|
Module['HEAPU16'] = HEAPU16;
|
|
Module['HEAPU32'] = HEAPU32;
|
|
Module['HEAPF32'] = HEAPF32;
|
|
Module['HEAPF64'] = HEAPF64;
|
|
|
|
function callRuntimeCallbacks(callbacks) {
|
|
while(callbacks.length > 0) {
|
|
var callback = callbacks.shift();
|
|
if (typeof callback == 'function') {
|
|
callback();
|
|
continue;
|
|
}
|
|
var func = callback.func;
|
|
if (typeof func === 'number') {
|
|
if (callback.arg === undefined) {
|
|
Runtime.dynCall('v', func);
|
|
} else {
|
|
Runtime.dynCall('vi', func, [callback.arg]);
|
|
}
|
|
} else {
|
|
func(callback.arg === undefined ? null : callback.arg);
|
|
}
|
|
}
|
|
}
|
|
|
|
var __ATPRERUN__ = []; // functions called before the runtime is initialized
|
|
var __ATINIT__ = []; // functions called during startup
|
|
var __ATMAIN__ = []; // functions called when main() is to be run
|
|
var __ATEXIT__ = []; // functions called during shutdown
|
|
var __ATPOSTRUN__ = []; // functions called after the runtime has exited
|
|
|
|
var runtimeInitialized = false;
|
|
var runtimeExited = false;
|
|
|
|
|
|
function preRun() {
|
|
// compatibility - merge in anything from Module['preRun'] at this time
|
|
if (Module['preRun']) {
|
|
if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
|
|
while (Module['preRun'].length) {
|
|
addOnPreRun(Module['preRun'].shift());
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPRERUN__);
|
|
}
|
|
|
|
function ensureInitRuntime() {
|
|
if (runtimeInitialized) return;
|
|
runtimeInitialized = true;
|
|
callRuntimeCallbacks(__ATINIT__);
|
|
}
|
|
|
|
function preMain() {
|
|
callRuntimeCallbacks(__ATMAIN__);
|
|
}
|
|
|
|
function exitRuntime() {
|
|
callRuntimeCallbacks(__ATEXIT__);
|
|
runtimeExited = true;
|
|
}
|
|
|
|
function postRun() {
|
|
// compatibility - merge in anything from Module['postRun'] at this time
|
|
if (Module['postRun']) {
|
|
if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
|
|
while (Module['postRun'].length) {
|
|
addOnPostRun(Module['postRun'].shift());
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPOSTRUN__);
|
|
}
|
|
|
|
function addOnPreRun(cb) {
|
|
__ATPRERUN__.unshift(cb);
|
|
}
|
|
Module["addOnPreRun"] = addOnPreRun;
|
|
|
|
function addOnInit(cb) {
|
|
__ATINIT__.unshift(cb);
|
|
}
|
|
Module["addOnInit"] = addOnInit;
|
|
|
|
function addOnPreMain(cb) {
|
|
__ATMAIN__.unshift(cb);
|
|
}
|
|
Module["addOnPreMain"] = addOnPreMain;
|
|
|
|
function addOnExit(cb) {
|
|
__ATEXIT__.unshift(cb);
|
|
}
|
|
Module["addOnExit"] = addOnExit;
|
|
|
|
function addOnPostRun(cb) {
|
|
__ATPOSTRUN__.unshift(cb);
|
|
}
|
|
Module["addOnPostRun"] = addOnPostRun;
|
|
|
|
// Tools
|
|
|
|
|
|
function intArrayFromString(stringy, dontAddNull, length /* optional */) {
|
|
var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
|
|
var u8array = new Array(len);
|
|
var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
|
|
if (dontAddNull) u8array.length = numBytesWritten;
|
|
return u8array;
|
|
}
|
|
Module["intArrayFromString"] = intArrayFromString;
|
|
|
|
function intArrayToString(array) {
|
|
var ret = [];
|
|
for (var i = 0; i < array.length; i++) {
|
|
var chr = array[i];
|
|
if (chr > 0xFF) {
|
|
chr &= 0xFF;
|
|
}
|
|
ret.push(String.fromCharCode(chr));
|
|
}
|
|
return ret.join('');
|
|
}
|
|
Module["intArrayToString"] = intArrayToString;
|
|
|
|
function writeStringToMemory(string, buffer, dontAddNull) {
|
|
var array = intArrayFromString(string, dontAddNull);
|
|
var i = 0;
|
|
while (i < array.length) {
|
|
var chr = array[i];
|
|
HEAP8[(((buffer)+(i))>>0)]=chr;
|
|
i = i + 1;
|
|
}
|
|
}
|
|
Module["writeStringToMemory"] = writeStringToMemory;
|
|
|
|
function writeArrayToMemory(array, buffer) {
|
|
for (var i = 0; i < array.length; i++) {
|
|
HEAP8[((buffer++)>>0)]=array[i];
|
|
}
|
|
}
|
|
Module["writeArrayToMemory"] = writeArrayToMemory;
|
|
|
|
function writeAsciiToMemory(str, buffer, dontAddNull) {
|
|
for (var i = 0; i < str.length; ++i) {
|
|
HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
|
|
}
|
|
// Null-terminate the pointer to the HEAP.
|
|
if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
|
|
}
|
|
Module["writeAsciiToMemory"] = writeAsciiToMemory;
|
|
|
|
function unSign(value, bits, ignore) {
|
|
if (value >= 0) {
|
|
return value;
|
|
}
|
|
return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
|
|
: Math.pow(2, bits) + value;
|
|
}
|
|
function reSign(value, bits, ignore) {
|
|
if (value <= 0) {
|
|
return value;
|
|
}
|
|
var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
|
|
: Math.pow(2, bits-1);
|
|
if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
|
|
// but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
|
|
// TODO: In i64 mode 1, resign the two parts separately and safely
|
|
value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
|
|
}
|
|
return value;
|
|
}
|
|
|
|
|
|
// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 )
|
|
if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) {
|
|
var ah = a >>> 16;
|
|
var al = a & 0xffff;
|
|
var bh = b >>> 16;
|
|
var bl = b & 0xffff;
|
|
return (al*bl + ((ah*bl + al*bh) << 16))|0;
|
|
};
|
|
Math.imul = Math['imul'];
|
|
|
|
|
|
if (!Math['clz32']) Math['clz32'] = function(x) {
|
|
x = x >>> 0;
|
|
for (var i = 0; i < 32; i++) {
|
|
if (x & (1 << (31 - i))) return i;
|
|
}
|
|
return 32;
|
|
};
|
|
Math.clz32 = Math['clz32']
|
|
|
|
if (!Math['trunc']) Math['trunc'] = function(x) {
|
|
return x < 0 ? Math.ceil(x) : Math.floor(x);
|
|
};
|
|
Math.trunc = Math['trunc'];
|
|
|
|
var Math_abs = Math.abs;
|
|
var Math_cos = Math.cos;
|
|
var Math_sin = Math.sin;
|
|
var Math_tan = Math.tan;
|
|
var Math_acos = Math.acos;
|
|
var Math_asin = Math.asin;
|
|
var Math_atan = Math.atan;
|
|
var Math_atan2 = Math.atan2;
|
|
var Math_exp = Math.exp;
|
|
var Math_log = Math.log;
|
|
var Math_sqrt = Math.sqrt;
|
|
var Math_ceil = Math.ceil;
|
|
var Math_floor = Math.floor;
|
|
var Math_pow = Math.pow;
|
|
var Math_imul = Math.imul;
|
|
var Math_fround = Math.fround;
|
|
var Math_min = Math.min;
|
|
var Math_clz32 = Math.clz32;
|
|
var Math_trunc = Math.trunc;
|
|
|
|
// A counter of dependencies for calling run(). If we need to
|
|
// do asynchronous work before running, increment this and
|
|
// decrement it. Incrementing must happen in a place like
|
|
// PRE_RUN_ADDITIONS (used by emcc to add file preloading).
|
|
// Note that you can add dependencies in preRun, even though
|
|
// it happens right before run - run will be postponed until
|
|
// the dependencies are met.
|
|
var runDependencies = 0;
|
|
var runDependencyWatcher = null;
|
|
var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
|
|
|
|
function getUniqueRunDependency(id) {
|
|
return id;
|
|
}
|
|
|
|
function addRunDependency(id) {
|
|
runDependencies++;
|
|
if (Module['monitorRunDependencies']) {
|
|
Module['monitorRunDependencies'](runDependencies);
|
|
}
|
|
}
|
|
Module["addRunDependency"] = addRunDependency;
|
|
|
|
function removeRunDependency(id) {
|
|
runDependencies--;
|
|
if (Module['monitorRunDependencies']) {
|
|
Module['monitorRunDependencies'](runDependencies);
|
|
}
|
|
if (runDependencies == 0) {
|
|
if (runDependencyWatcher !== null) {
|
|
clearInterval(runDependencyWatcher);
|
|
runDependencyWatcher = null;
|
|
}
|
|
if (dependenciesFulfilled) {
|
|
var callback = dependenciesFulfilled;
|
|
dependenciesFulfilled = null;
|
|
callback(); // can add another dependenciesFulfilled
|
|
}
|
|
}
|
|
}
|
|
Module["removeRunDependency"] = removeRunDependency;
|
|
|
|
Module["preloadedImages"] = {}; // maps url to image data
|
|
Module["preloadedAudios"] = {}; // maps url to audio data
|
|
|
|
|
|
|
|
var memoryInitializer = null;
|
|
|
|
|
|
|
|
|
|
|
|
// === Body ===
|
|
|
|
var ASM_CONSTS = [];
|
|
|
|
|
|
|
|
|
|
STATIC_BASE = 8;
|
|
|
|
STATICTOP = STATIC_BASE + 114416;
|
|
/* global initializers */ __ATINIT__.push();
|
|
|
|
|
|
/* memory initializer */ allocate([1,0,0,0,220,12,0,0,226,12,0,0,232,12,0,0,196,180,1,0,255,255,255,255,255,255,255,255,40,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,224,182,1,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,156,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,2,0,0,0,232,182,1,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,156,0,0,0,20,1,0,0,9,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,240,186,1,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,67,111,110,115,116,97,110,116,32,99,111,117,110,116,32,111,118,101,114,102,108,111,119,10,0,76,111,99,97,108,32,118,97,114,105,97,98,108,101,32,115,105,122,101,32,111,118,101,114,102,108,111,119,10,0,99,111,110,115,116,47,108,111,99,97,108,32,110,97,109,101,32,99,111,110,102,108,105,99,116,10,0,108,111,99,97,108,32,108,97,98,101,108,32,97,108,114,101,97,100,121,32,100,101,102,105,110,101,100,10,0,71,108,111,98,97,108,32,118,97,114,105,97,98,108,101,32,99,111,117,110,116,32,111,118,101,114,102,108,111,119,10,0,99,111,110,115,116,47,103,108,111,98,97,108,32,110,97,109,101,32,99,111,110,102,108,105,99,116,10,0,103,108,111,98,97,108,32,108,97,98,101,108,32,97,108,114,101,97,100,121,32,100,101,102,105,110,101,100,10,0,9,9,9,9,9,59,32,37,115,32,45,62,32,88,37,48,51,100,10,0,85,110,100,101,99,108,97,114,101,100,32,105,100,101,110,116,105,102,105,101,114,0,85,110,100,101,99,108,97,114,101,100,32,99,111,110,115,116,97,110,116,0,69,120,116,101,114,110,97,108,32,118,97,114,105,97,98,108,101,32,99,111,117,110,116,32,111,118,101,114,102,108,111,119,10,0,95,37,99,37,48,51,100,0,9,59,32,68,67,73,32,83,84,82,73,78,71,58,32,37,115,10,0,9,37,115,9,36,37,48,50,88,0,44,36,37,48,50,88,0,10,0,33,66,89,84,69,0,33,87,79,82,68,0,33,70,73,76,76,0,58,59,32,65,67,77,69,32,67,79,77,80,65,84,73,66,76,69,32,79,85,84,80,85,84,10,0,59,32,67,65,54,53,32,67,79,77,80,65,84,73,66,76,69,32,79,85,84,80,85,84,10,0,9,37,115,9,95,83,69,71,69,78,68,45,95,83,69,71,66,69,71,73,78,9,59,32,76,69,78,71,84,72,32,79,70,32,72,69,65,68,69,82,32,43,32,67,79,68,69,47,68,65,84,65,32,43,32,66,89,84,69,67,79,68,69,32,83,69,71,77,69,78,84,10,0,95,83,69,71,66,69,71,73,78,37,99,10,0,9,37,115,9,36,68,65,55,69,9,9,9,59,32,77,65,71,73,67,32,35,10,0,9,37,115,9,95,83,89,83,70,76,65,71,83,9,9,9,59,32,83,89,83,84,69,77,32,70,76,65,71,83,10,0,9,37,115,9,95,83,85,66,83,69,71,9,9,9,59,32,66,89,84,69,67,79,68,69,32,83,85,66,45,83,69,71,77,69,78,84,10,0,9,37,115,9,95,68,69,70,67,78,84,9,9,9,59,32,66,89,84,69,67,79,68,69,32,68,69,70,32,67,79,85,78,84,10,0,9,37,115,9,95,73,78,73,84,9,9,9,59,32,77,79,68,85,76,69,32,73,78,73,84,73,65,76,73,90,65,84,73,79,78,32,82,79,85,84,73,78,69,10,0,9,74,77,80,9,95,73,78,73,84,9,9,9,59,32,77,79,68,85,76,69,32,73,78,73,84,73,65,76,73,90,65,84,73,79,78,32,82,79,85,84,73,78,69,10,0,59,10,59,32,82,69,45,76,79,67,65,84,69,65,66,76,69,32,68,73,67,84,73,79,78,65,82,89,10,59,10,0,9,37,115,9,36,48,50,9,9,9,59,32,67,79,68,69,32,84,65,66,76,69,32,70,73,88,85,80,10,0,9,37,115,9,95,67,37,48,51,100,9,9,10,0,9,37,115,9,36,48,48,10,0,9,37,115,9,36,37,48,50,88,9,9,9,59,32,69,88,84,69,82,78,65,76,32,70,73,88,85,80,10,0,9,37,115,9,95,70,37,48,51,100,45,95,83,69,71,66,69,71,73,78,9,9,10,0,9,37,115,9,37,100,9,9,9,59,32,69,83,68,32,73,78,68,69,88,10,0,9,37,115,9,36,37,48,50,88,9,9,9,59,32,73,78,84,69,82,78,65,76,32,70,73,88,85,80,10,0,9,37,115,9,36,48,48,9,9,9,59,32,69,78,68,32,79,70,32,82,76,68,10,0,59,10,59,32,69,88,84,69,82,78,65,76,47,69,78,84,82,89,32,83,89,77,66,79,76,32,68,73,67,84,73,79,78,65,82,89,10,59,10,0,9,37,115,9,36,49,48,9,9,9,59,32,69,88,84,69,82,78,65,76,32,83,89,77,66,79,76,32,70,76,65,71,10,0,9,37,115,9,36,48,56,9,9,9,59,32,69,78,84,82,89,32,83,89,77,66,79,76,32,70,76,65,71,10,0,9,37,115,9,37,115,9,9,10,0,9,37,115,9,36,48,48,9,9,9,59,32,69,78,68,32,79,70,32,69,83,68,10,0,95,73,78,73,84,9,61,9,48,10,0,95,83,89,83,70,76,65,71,83,9,61,9,48,10,0,95,68,69,70,67,78,84,9,61,9,37,100,10,0,95,83,69,71,69,78,68,37,99,10,0,9,37,115,9,36,48,48,9,9,9,59,32,69,78,68,32,79,70,32,77,79,68,85,76,69,32,68,69,80,69,78,68,69,78,67,73,69,83,10,0,95,83,89,83,70,76,65,71,83,9,61,9,36,37,48,52,88,9,9,59,32,83,89,83,84,69,77,32,70,76,65,71,83,10,0,95,83,85,66,83,69,71,37,99,9,9,9,9,59,32,66,89,84,69,67,79,68,69,32,83,84,65,82,84,83,10,0,37,115,10,0,9,9,9,9,9,59,32,37,115,32,45,62,32,91,37,100,93,10,0,95,68,37,48,51,100,37,99,9,9,9,9,9,59,32,37,115,10,0,95,68,37,48,51,100,37,99,9,37,115,9,37,100,9,9,9,59,32,37,115,10,0,37,115,37,99,9,9,9,9,9,59,32,37,115,40,41,10,0,9,9,9,9,9,59,32,37,115,32,61,32,37,100,10,0,9,37,115,9,36,37,48,50,88,10,0,95,70,37,48,51,100,37,99,9,37,115,9,48,9,9,9,59,32,37,115,10,0,95,70,37,48,51,100,37,99,9,37,115,9,37,115,10,0,9,37,115,9,36,37,48,52,108,88,10,0,9,37,115,9,36,37,48,50,108,88,10,0,9,74,83,82,9,73,78,84,69,82,80,10,0,95,66,37,48,51,100,37,99,10,0,9,37,115,9,36,48,48,9,9,9,59,32,90,69,82,79,10,0,9,37,115,9,36,50,65,44,36,37,48,50,88,9,9,9,59,32,67,66,9,37,100,10,0,9,37,115,9,36,50,67,44,36,37,48,50,88,44,36,37,48,50,88,9,9,59,32,67,87,9,37,100,10,0,9,37,115,9,36,50,69,9,9,9,59,32,67,83,10,0,9,37,115,9,36,54,48,9,9,9,59,32,76,66,10,0,9,37,115,9,36,54,50,9,9,9,59,32,76,87,10,0,9,37,115,9,36,54,52,44,36,37,48,50,88,9,9,9,59,32,76,76,66,9,91,37,100,93,10,0,9,37,115,9,36,54,54,44,36,37,48,50,88,9,9,9,59,32,76,76,87,9,91,37,100,93,10,0,9,37,115,9,36,54,56,9,9,9,59,32,76,65,66,9,37,115,43,37,100,10,0,95,70,37,48,51,100,37,99,9,37,115,9,37,115,43,37,100,9,9,10,0,48,0,9,37,115,9,36,54,65,9,9,9,59,32,76,65,87,9,37,115,43,37,100,10,0,9,37,115,9,36,55,48,9,9,9,59,32,83,66,10,0,9,37,115,9,36,55,50,9,9,9,59,32,83,87,10,0,9,37,115,9,36,55,52,44,36,37,48,50,88,9,9,9,59,32,83,76,66,9,91,37,100,93,10,0,9,37,115,9,36,55,54,44,36,37,48,50,88,9,9,9,59,32,83,76,87,9,91,37,100,93,10,0,9,37,115,9,36,54,67,44,36,37,48,50,88,9,9,9,59,32,68,76,66,9,91,37,100,93,10,0,9,37,115,9,36,54,69,44,36,37,48,50,88,9,9,9,59,32,68,76,87,9,91,37,100,93,10,0,9,37,115,9,36,55,56,9,9,9,59,32,83,65,66,9,37,115,43,37,100,10,0,9,37,115,9,36,55,65,9,9,9,59,32,83,65,87,9,37,115,43,37,100,10,0,9,37,115,9,36,55,67,9,9,9,59,32,68,65,66,9,37,115,10,0,95,70,37,48,51,100,37,99,9,37,115,9,37,115,9,9,10,0,9,37,115,9,36,55,69,9,9,9,59,32,68,65,87,9,37,115,10,0,9,37,115,9,36,50,56,44,36,37,48,50,88,9,9,9,59,32,76,76,65,9,91,37,100,93,10,0,9,37,115,9,36,50,54,9,9,9,59,32,76,65,9,37,115,43,37,100,10,0,9,37,115,9,36,48,50,9,9,9,59,32,73,68,88,66,10,0,9,37,115,9,36,49,69,9,9,9,59,32,73,68,88,87,10,0,9,37,115,9,36,52,67,9,9,9,59,32,66,82,70,76,83,9,95,66,37,48,51,100,10,0,9,37,115,9,95,66,37,48,51,100,45,42,10,0,9,37,115,9,36,53,48,9,9,9,59,32,66,82,78,67,72,9,95,66,37,48,51,100,10,0,9,37,115,9,36,51,69,9,9,9,59,32,66,82,78,69,9,95,66,37,48,51,100,10,0,9,37,115,9,36,51,56,9,9,9,59,32,66,82,71,84,9,95,66,37,48,51,100,10,0,9,37,115,9,36,51,65,9,9,9,59,32,66,82,76,84,9,95,66,37,48,51,100,10,0,9,37,115,9,36,53,52,9,9,9,59,32,67,65,76,76,9,37,105,10,0,9,37,115,9,37,105,9,9,10,0,9,37,115,9,36,53,52,9,9,9,59,32,67,65,76,76,9,37,115,10,0,9,37,115,9,36,53,54,9,9,9,59,32,73,67,65,76,10,0,9,37,115,9,36,53,65,9,9,9,59,32,76,69,65,86,69,10,0,9,37,115,9,36,53,67,9,9,9,59,32,82,69,84,10,0,9,37,115,9,36,53,56,44,36,37,48,50,88,44,36,37,48,50,88,9,9,59,32,69,78,84,69,82,9,37,100,44,37,100,10,0,95,73,78,73,84,37,99,10,0,9,37,115,9,36,51,50,9,9,9,59,32,68,85,80,10,0,9,37,115,9,36,51,52,9,9,9,59,32,80,85,83,72,10,0,9,37,115,9,36,51,54,9,9,9,59,32,80,85,76,76,10,0,9,37,115,9,36,51,48,9,9,9,59,32,68,82,79,80,10,0,9,37,115,9,36,49,48,9,9,9,59,32,78,69,71,10,0,9,37,115,9,36,49,50,9,9,9,59,32,67,79,77,80,10,0,9,37,115,9,36,50,48,9,9,9,59,32,78,79,84,10,0,9,37,115,9,36,48,67,9,9,9,59,32,73,78,67,82,10,0,9,37,115,9,36,48,69,9,9,9,59,32,68,69,67,82,10,0,101,109,105,116,95,117,110,97,114,121,111,112,40,37,99,41,32,63,63,63,10,0,9,37,115,9,36,48,54,9,9,9,59,32,77,85,76,10,0,9,37,115,9,36,48,56,9,9,9,59,32,68,73,86,10,0,9,37,115,9,36,48,65,9,9,9,59,32,77,79,68,10,0,9,37,115,9,36,48,50,9,9,9,59,32,65,68,68,10,0,9,37,115,9,36,48,52,9,9,9,59,32,83,85,66,10,0,9,37,115,9,36,49,65,9,9,9,59,32,83,72,76,10,0,9,37,115,9,36,49,67,9,9,9,59,32,83,72,82,10,0,9,37,115,9,36,49,52,9,9,9,59,32,65,78,68,10,0,9,37,115,9,36,49,54,9,9,9,59,32,73,79,82,10,0,9,37,115,9,36,49,56,9,9,9,59,32,88,79,82,10,0,9,37,115,9,36,52,48,9,9,9,59,32,73,83,69,81,10,0,9,37,115,9,36,52,50,9,9,9,59,32,73,83,78,69,10,0,9,37,115,9,36,52,56,9,9,9,59,32,73,83,71,69,10,0,9,37,115,9,36,52,54,9,9,9,59,32,73,83,76,84,10,0,9,37,115,9,36,52,52,9,9,9,59,32,73,83,71,84,10,0,9,37,115,9,36,52,65,9,9,9,59,32,73,83,76,69,10,0,9,37,115,9,36,50,50,9,9,9,59,32,76,79,82,10,0,9,37,115,9,36,50,52,9,9,9,59,32,76,65,78,68,10,0,46,66,89,84,69,0,46,87,79,82,68,0,46,82,69,83,0,132,73,70,134,69,76,83,69,133,69,76,83,73,70,135,70,73,78,137,87,72,73,76,69,138,76,79,79,80,139,87,72,69,78,140,73,83,141,79,84,72,69,82,87,73,83,69,142,87,69,78,68,143,70,79,82,144,84,79,145,68,79,87,78,84,79,146,83,84,69,80,147,78,69,88,84,148,82,69,80,69,65,84,149,85,78,84,73,76,157,66,82,69,65,75,160,67,79,78,84,73,78,85,69,152,65,83,77,151,68,69,70,154,69,88,80,79,82,84,153,73,77,80,79,82,84,254,73,78,67,76,85,68,69,156,82,69,84,85,82,78,136,69,78,68,155,68,79,78,69,161,78,79,84,206,65,78,68,207,79,82,130,66,89,84,69,131,87,79,82,68,129,67,79,78,83,84,159,83,84,82,85,67,150,80,82,69,68,69,70,158,83,89,83,70,76,65,71,83,128,10,37,115,32,37,52,100,58,32,37,115,10,37,42,115,32,32,32,32,32,32,32,0,94,10,69,114,114,111,114,58,32,37,115,10,0,66,97,100,32,99,104,97,114,97,99,116,101,114,32,99,111,110,115,116,97,110,116,0,66,97,100,32,115,116,114,105,110,103,32,99,111,110,115,116,97,110,116,0,85,110,116,101,114,109,105,110,97,116,101,100,32,115,116,114,105,110,103,0,60,115,116,100,105,110,62,0,59,32,37,115,58,32,37,48,52,100,58,32,37,115,10,0,77,105,115,115,105,110,103,32,105,110,99,108,117,100,101,32,102,105,108,101,110,97,109,101,0,79,110,108,121,32,111,110,101,32,108,101,118,101,108,32,111,102,32,105,110,99,108,117,100,101,115,32,97,108,108,111,119,101,100,0,114,0,69,114,114,111,114,32,111,112,101,110,105,110,103,32,105,110,99,108,117,100,101,32,102,105,108,101,0,170,175,165,171,173,210,204,166,222,252,190,200,188,194,197,213,206,207,1,1,1,2,2,3,3,4,5,6,7,7,7,7,8,8,9,10,83,116,97,99,107,32,111,118,101,114,102,108,111,119,10,0,83,116,97,99,107,32,117,110,100,101,114,102,108,111,119,10,0,66,97,100,32,99,111,110,115,116,97,110,116,32,111,112,101,114,97,110,100,0,66,97,100,32,101,120,112,114,101,115,115,105,111,110,32,105,110,32,112,97,114,101,110,116,104,101,115,105,115,0,77,105,115,115,105,110,103,32,99,108,111,115,105,110,103,32,112,97,114,101,110,116,104,101,115,105,115,0,58,32,73,110,118,97,108,105,100,32,98,105,110,97,114,121,32,111,112,101,114,97,116,105,111,110,0,77,105,115,115,105,110,103,32,111,112,101,114,97,110,100,0,73,110,118,97,108,105,100,32,115,116,114,105,110,103,32,109,111,100,105,102,105,101,114,115,0,66,97,100,32,73,68,32,116,121,112,101,10,0,66,97,100,32,105,110,100,101,120,32,114,101,102,101,114,101,110,99,101,0,77,105,115,115,105,110,103,32,99,108,111,115,105,110,103,32,98,114,97,99,107,101,116,0,58,32,73,110,118,97,108,105,100,32,117,110,97,114,121,32,111,112,101,114,97,116,105,111,110,0,66,97,100,32,101,120,112,114,101,115,115,105,111,110,0,77,105,115,115,105,110,103,32,73,70,47,70,73,78,0,77,105,115,115,105,110,103,32,87,72,73,76,69,47,69,78,68,0,77,105,115,115,105,110,103,32,82,69,80,69,65,84,47,85,78,84,73,76,0,77,105,115,115,105,110,103,32,70,79,82,32,118,97,114,105,97,98,108,101,0,77,105,115,115,105,110,103,32,70,79,82,32,61,0,66,97,100,32,70,79,82,32,101,120,112,114,101,115,115,105,111,110,0,77,105,115,115,105,110,103,32,70,79,82,32,84,79,0,66,97,100,32,70,79,82,32,84,79,32,101,120,112,114,101,115,115,105,111,110,0,66,97,100,32,70,79,82,32,83,84,69,80,32,101,120,112,114,101,115,115,105,111,110,0,77,105,115,115,105,110,103,32,70,79,82,47,78,69,88,84,32,0,66,97,100,32,67,65,83,69,32,101,120,112,114,101,115,115,105,111,110,0,66,97,100,32,67,65,83,69,32,79,70,32,101,120,112,114,101,115,115,105,111,110,0,66,97,100,32,67,65,83,69,32,68,69,70,65,85,76,84,32,99,108,97,117,115,101,0,66,97,100,32,67,65,83,69,32,99,108,97,117,115,101,0,67,79,78,84,73,78,85,69,32,119,105,116,104,111,117,116,32,108,111,111,112,0,66,82,69,65,75,32,119,105,116,104,111,117,116,32,108,111,111,112,0,83,121,110,116,97,120,32,101,114,114,111,114,0,69,120,116,114,97,110,101,111,117,115,32,99,104,97,114,97,99,116,101,114,115,0,67,97,110,110,111,116,32,105,110,105,116,105,97,108,108,105,122,101,32,108,111,99,97,108,47,101,120,116,101,114,110,97,108,32,118,97,114,105,97,98,108,101,115,0,66,97,100,32,97,114,114,97,121,32,100,101,99,108,97,114,97,116,105,111,110,0,66,97,100,32,118,97,114,105,97,98,108,101,32,105,110,105,116,105,97,108,105,122,101,114,0,115,121,115,102,108,97,103,115,32,109,117,115,116,32,98,101,32,103,108,111,98,97,108,0,66,97,100,32,99,111,110,115,116,97,110,116,0,77,105,115,115,105,110,103,32,118,97,114,105,97,98,108,101,0,66,97,100,32,76,86,97,108,117,101,0,66,97,100,32,115,116,114,117,99,116,117,114,101,32,100,101,102,105,110,105,116,105,111,110,0,67,97,110,110,111,116,32,101,120,112,111,114,116,32,108,111,99,97,108,47,105,109,112,111,114,116,101,100,32,118,97,114,105,97,98,108,101,115,0,66,97,100,32,102,117,110,99,116,105,111,110,32,112,114,101,45,100,101,99,108,97,114,97,116,105,111,110,0,66,97,100,32,105,109,112,111,114,116,32,100,101,102,105,110,105,116,105,111,110,0,66,97,100,32,101,120,112,111,114,116,32,100,101,102,105,110,105,116,105,111,110,0,77,105,115,115,105,110,103,32,102,117,110,99,116,105,111,110,32,110,97,109,101,0,77,105,115,109,97,116,99,104,32,102,117,110,99,116,105,111,110,32,116,121,112,101,0,66,97,100,32,102,117,110,99,116,105,111,110,32,112,97,114,97,109,101,116,101,114,32,108,105,115,116,0,65,83,77,32,99,111,100,101,32,111,110,108,121,32,97,108,108,111,119,101,100,32,98,101,102,111,114,101,32,68,69,70,32,99,111,100,101,0,95,73,78,73,84,0,77,105,115,115,105,110,103,32,68,79,78,69,32,115,116,97,116,101,109,101,110,116,0,67,111,109,112,105,108,97,116,105,111,110,32,99,111,109,112,108,101,116,101,46,10,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,110,97,110,0,78,65,78,0,46,0,114,119,97,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE);
|
|
|
|
|
|
|
|
|
|
|
|
/* no memory initializer */
|
|
var tempDoublePtr = STATICTOP; STATICTOP += 16;
|
|
|
|
function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
|
|
|
|
HEAP8[tempDoublePtr] = HEAP8[ptr];
|
|
|
|
HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
|
|
|
|
HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
|
|
|
|
HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
|
|
|
|
}
|
|
|
|
function copyTempDouble(ptr) {
|
|
|
|
HEAP8[tempDoublePtr] = HEAP8[ptr];
|
|
|
|
HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
|
|
|
|
HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
|
|
|
|
HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
|
|
|
|
HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
|
|
|
|
HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
|
|
|
|
HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
|
|
|
|
HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
|
|
|
|
}
|
|
|
|
// {{PRE_LIBRARY}}
|
|
|
|
|
|
|
|
Module["_i64Subtract"] = _i64Subtract;
|
|
|
|
|
|
Module["_i64Add"] = _i64Add;
|
|
|
|
|
|
Module["_memset"] = _memset;
|
|
|
|
function _pthread_cleanup_push(routine, arg) {
|
|
__ATEXIT__.push(function() { Runtime.dynCall('vi', routine, [arg]) })
|
|
_pthread_cleanup_push.level = __ATEXIT__.length;
|
|
}
|
|
|
|
|
|
Module["_bitshift64Lshr"] = _bitshift64Lshr;
|
|
|
|
|
|
Module["_bitshift64Shl"] = _bitshift64Shl;
|
|
|
|
function _pthread_cleanup_pop() {
|
|
assert(_pthread_cleanup_push.level == __ATEXIT__.length, 'cannot pop if something else added meanwhile!');
|
|
__ATEXIT__.pop();
|
|
_pthread_cleanup_push.level = __ATEXIT__.length;
|
|
}
|
|
|
|
function _abort() {
|
|
Module['abort']();
|
|
}
|
|
|
|
|
|
|
|
|
|
var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
|
|
|
|
var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
|
|
|
|
function ___setErrNo(value) {
|
|
if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
|
|
return value;
|
|
}
|
|
|
|
var PATH={splitPath:function (filename) {
|
|
var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
|
|
return splitPathRe.exec(filename).slice(1);
|
|
},normalizeArray:function (parts, allowAboveRoot) {
|
|
// if the path tries to go above the root, `up` ends up > 0
|
|
var up = 0;
|
|
for (var i = parts.length - 1; i >= 0; i--) {
|
|
var last = parts[i];
|
|
if (last === '.') {
|
|
parts.splice(i, 1);
|
|
} else if (last === '..') {
|
|
parts.splice(i, 1);
|
|
up++;
|
|
} else if (up) {
|
|
parts.splice(i, 1);
|
|
up--;
|
|
}
|
|
}
|
|
// if the path is allowed to go above the root, restore leading ..s
|
|
if (allowAboveRoot) {
|
|
for (; up--; up) {
|
|
parts.unshift('..');
|
|
}
|
|
}
|
|
return parts;
|
|
},normalize:function (path) {
|
|
var isAbsolute = path.charAt(0) === '/',
|
|
trailingSlash = path.substr(-1) === '/';
|
|
// Normalize the path
|
|
path = PATH.normalizeArray(path.split('/').filter(function(p) {
|
|
return !!p;
|
|
}), !isAbsolute).join('/');
|
|
if (!path && !isAbsolute) {
|
|
path = '.';
|
|
}
|
|
if (path && trailingSlash) {
|
|
path += '/';
|
|
}
|
|
return (isAbsolute ? '/' : '') + path;
|
|
},dirname:function (path) {
|
|
var result = PATH.splitPath(path),
|
|
root = result[0],
|
|
dir = result[1];
|
|
if (!root && !dir) {
|
|
// No dirname whatsoever
|
|
return '.';
|
|
}
|
|
if (dir) {
|
|
// It has a dirname, strip trailing slash
|
|
dir = dir.substr(0, dir.length - 1);
|
|
}
|
|
return root + dir;
|
|
},basename:function (path) {
|
|
// EMSCRIPTEN return '/'' for '/', not an empty string
|
|
if (path === '/') return '/';
|
|
var lastSlash = path.lastIndexOf('/');
|
|
if (lastSlash === -1) return path;
|
|
return path.substr(lastSlash+1);
|
|
},extname:function (path) {
|
|
return PATH.splitPath(path)[3];
|
|
},join:function () {
|
|
var paths = Array.prototype.slice.call(arguments, 0);
|
|
return PATH.normalize(paths.join('/'));
|
|
},join2:function (l, r) {
|
|
return PATH.normalize(l + '/' + r);
|
|
},resolve:function () {
|
|
var resolvedPath = '',
|
|
resolvedAbsolute = false;
|
|
for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
|
|
var path = (i >= 0) ? arguments[i] : FS.cwd();
|
|
// Skip empty and invalid entries
|
|
if (typeof path !== 'string') {
|
|
throw new TypeError('Arguments to path.resolve must be strings');
|
|
} else if (!path) {
|
|
return ''; // an invalid portion invalidates the whole thing
|
|
}
|
|
resolvedPath = path + '/' + resolvedPath;
|
|
resolvedAbsolute = path.charAt(0) === '/';
|
|
}
|
|
// At this point the path should be resolved to a full absolute path, but
|
|
// handle relative paths to be safe (might happen when process.cwd() fails)
|
|
resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
|
|
return !!p;
|
|
}), !resolvedAbsolute).join('/');
|
|
return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
|
|
},relative:function (from, to) {
|
|
from = PATH.resolve(from).substr(1);
|
|
to = PATH.resolve(to).substr(1);
|
|
function trim(arr) {
|
|
var start = 0;
|
|
for (; start < arr.length; start++) {
|
|
if (arr[start] !== '') break;
|
|
}
|
|
var end = arr.length - 1;
|
|
for (; end >= 0; end--) {
|
|
if (arr[end] !== '') break;
|
|
}
|
|
if (start > end) return [];
|
|
return arr.slice(start, end - start + 1);
|
|
}
|
|
var fromParts = trim(from.split('/'));
|
|
var toParts = trim(to.split('/'));
|
|
var length = Math.min(fromParts.length, toParts.length);
|
|
var samePartsLength = length;
|
|
for (var i = 0; i < length; i++) {
|
|
if (fromParts[i] !== toParts[i]) {
|
|
samePartsLength = i;
|
|
break;
|
|
}
|
|
}
|
|
var outputParts = [];
|
|
for (var i = samePartsLength; i < fromParts.length; i++) {
|
|
outputParts.push('..');
|
|
}
|
|
outputParts = outputParts.concat(toParts.slice(samePartsLength));
|
|
return outputParts.join('/');
|
|
}};
|
|
|
|
var TTY={ttys:[],init:function () {
|
|
// https://github.com/kripken/emscripten/pull/1555
|
|
// if (ENVIRONMENT_IS_NODE) {
|
|
// // currently, FS.init does not distinguish if process.stdin is a file or TTY
|
|
// // device, it always assumes it's a TTY device. because of this, we're forcing
|
|
// // process.stdin to UTF8 encoding to at least make stdin reading compatible
|
|
// // with text files until FS.init can be refactored.
|
|
// process['stdin']['setEncoding']('utf8');
|
|
// }
|
|
},shutdown:function () {
|
|
// https://github.com/kripken/emscripten/pull/1555
|
|
// if (ENVIRONMENT_IS_NODE) {
|
|
// // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
|
|
// // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
|
|
// // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
|
|
// // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
|
|
// // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
|
|
// process['stdin']['pause']();
|
|
// }
|
|
},register:function (dev, ops) {
|
|
TTY.ttys[dev] = { input: [], output: [], ops: ops };
|
|
FS.registerDevice(dev, TTY.stream_ops);
|
|
},stream_ops:{open:function (stream) {
|
|
var tty = TTY.ttys[stream.node.rdev];
|
|
if (!tty) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
stream.tty = tty;
|
|
stream.seekable = false;
|
|
},close:function (stream) {
|
|
// flush any pending line data
|
|
stream.tty.ops.flush(stream.tty);
|
|
},flush:function (stream) {
|
|
stream.tty.ops.flush(stream.tty);
|
|
},read:function (stream, buffer, offset, length, pos /* ignored */) {
|
|
if (!stream.tty || !stream.tty.ops.get_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
|
|
}
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = stream.tty.ops.get_char(stream.tty);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset+i] = result;
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return bytesRead;
|
|
},write:function (stream, buffer, offset, length, pos) {
|
|
if (!stream.tty || !stream.tty.ops.put_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
|
|
}
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return i;
|
|
}},default_tty_ops:{get_char:function (tty) {
|
|
if (!tty.input.length) {
|
|
var result = null;
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
// we will read data by chunks of BUFSIZE
|
|
var BUFSIZE = 256;
|
|
var buf = new Buffer(BUFSIZE);
|
|
var bytesRead = 0;
|
|
|
|
var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
|
|
|
|
var fd = process.stdin.fd;
|
|
if (isPosixPlatform) {
|
|
// Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
|
|
var usingDevice = false;
|
|
try {
|
|
fd = fs.openSync('/dev/stdin', 'r');
|
|
usingDevice = true;
|
|
} catch (e) {}
|
|
}
|
|
|
|
try {
|
|
bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
|
|
} catch(e) {
|
|
// Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
|
|
// reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
|
|
if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
|
|
else throw e;
|
|
}
|
|
|
|
if (usingDevice) { fs.closeSync(fd); }
|
|
if (bytesRead > 0) {
|
|
result = buf.slice(0, bytesRead).toString('utf-8');
|
|
} else {
|
|
result = null;
|
|
}
|
|
|
|
} else if (typeof window != 'undefined' &&
|
|
typeof window.prompt == 'function') {
|
|
// Browser.
|
|
result = window.prompt('Input: '); // returns null on cancel
|
|
if (result !== null) {
|
|
result += '\n';
|
|
}
|
|
} else if (typeof readline == 'function') {
|
|
// Command line.
|
|
result = readline();
|
|
if (result !== null) {
|
|
result += '\n';
|
|
}
|
|
}
|
|
if (!result) {
|
|
return null;
|
|
}
|
|
tty.input = intArrayFromString(result, true);
|
|
}
|
|
return tty.input.shift();
|
|
},put_char:function (tty, val) {
|
|
if (val === null || val === 10) {
|
|
Module['print'](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
} else {
|
|
if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
|
|
}
|
|
},flush:function (tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
Module['print'](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
}
|
|
}},default_tty1_ops:{put_char:function (tty, val) {
|
|
if (val === null || val === 10) {
|
|
Module['printErr'](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
} else {
|
|
if (val != 0) tty.output.push(val);
|
|
}
|
|
},flush:function (tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
Module['printErr'](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
}
|
|
}}};
|
|
|
|
var MEMFS={ops_table:null,mount:function (mount) {
|
|
return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
|
|
},createNode:function (parent, name, mode, dev) {
|
|
if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
|
|
// no supported
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (!MEMFS.ops_table) {
|
|
MEMFS.ops_table = {
|
|
dir: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
lookup: MEMFS.node_ops.lookup,
|
|
mknod: MEMFS.node_ops.mknod,
|
|
rename: MEMFS.node_ops.rename,
|
|
unlink: MEMFS.node_ops.unlink,
|
|
rmdir: MEMFS.node_ops.rmdir,
|
|
readdir: MEMFS.node_ops.readdir,
|
|
symlink: MEMFS.node_ops.symlink
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek
|
|
}
|
|
},
|
|
file: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek,
|
|
read: MEMFS.stream_ops.read,
|
|
write: MEMFS.stream_ops.write,
|
|
allocate: MEMFS.stream_ops.allocate,
|
|
mmap: MEMFS.stream_ops.mmap,
|
|
msync: MEMFS.stream_ops.msync
|
|
}
|
|
},
|
|
link: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
readlink: MEMFS.node_ops.readlink
|
|
},
|
|
stream: {}
|
|
},
|
|
chrdev: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: FS.chrdev_stream_ops
|
|
}
|
|
};
|
|
}
|
|
var node = FS.createNode(parent, name, mode, dev);
|
|
if (FS.isDir(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.dir.node;
|
|
node.stream_ops = MEMFS.ops_table.dir.stream;
|
|
node.contents = {};
|
|
} else if (FS.isFile(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.file.node;
|
|
node.stream_ops = MEMFS.ops_table.file.stream;
|
|
node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.buffer.byteLength which gives the whole capacity.
|
|
// When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
|
|
// for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
|
|
// penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
|
|
node.contents = null;
|
|
} else if (FS.isLink(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.link.node;
|
|
node.stream_ops = MEMFS.ops_table.link.stream;
|
|
} else if (FS.isChrdev(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.chrdev.node;
|
|
node.stream_ops = MEMFS.ops_table.chrdev.stream;
|
|
}
|
|
node.timestamp = Date.now();
|
|
// add the new node to the parent
|
|
if (parent) {
|
|
parent.contents[name] = node;
|
|
}
|
|
return node;
|
|
},getFileDataAsRegularArray:function (node) {
|
|
if (node.contents && node.contents.subarray) {
|
|
var arr = [];
|
|
for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
|
|
return arr; // Returns a copy of the original data.
|
|
}
|
|
return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
|
|
},getFileDataAsTypedArray:function (node) {
|
|
if (!node.contents) return new Uint8Array;
|
|
if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
|
|
return new Uint8Array(node.contents);
|
|
},expandFileStorage:function (node, newCapacity) {
|
|
// If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
|
|
// instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
|
|
// increase the size.
|
|
if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
|
|
node.contents = MEMFS.getFileDataAsRegularArray(node);
|
|
node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
|
|
}
|
|
|
|
if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
|
|
var prevCapacity = node.contents ? node.contents.buffer.byteLength : 0;
|
|
if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
|
|
// Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
|
|
// For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
|
|
// avoid overshooting the allocation cap by a very large margin.
|
|
var CAPACITY_DOUBLING_MAX = 1024 * 1024;
|
|
newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
|
|
if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(newCapacity); // Allocate new storage.
|
|
if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
|
|
return;
|
|
}
|
|
// Not using a typed array to back the file storage. Use a standard JS array instead.
|
|
if (!node.contents && newCapacity > 0) node.contents = [];
|
|
while (node.contents.length < newCapacity) node.contents.push(0);
|
|
},resizeFileStorage:function (node, newSize) {
|
|
if (node.usedBytes == newSize) return;
|
|
if (newSize == 0) {
|
|
node.contents = null; // Fully decommit when requesting a resize to zero.
|
|
node.usedBytes = 0;
|
|
return;
|
|
}
|
|
if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
|
|
if (oldContents) {
|
|
node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
|
|
}
|
|
node.usedBytes = newSize;
|
|
return;
|
|
}
|
|
// Backing with a JS array.
|
|
if (!node.contents) node.contents = [];
|
|
if (node.contents.length > newSize) node.contents.length = newSize;
|
|
else while (node.contents.length < newSize) node.contents.push(0);
|
|
node.usedBytes = newSize;
|
|
},node_ops:{getattr:function (node) {
|
|
var attr = {};
|
|
// device numbers reuse inode numbers.
|
|
attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
|
|
attr.ino = node.id;
|
|
attr.mode = node.mode;
|
|
attr.nlink = 1;
|
|
attr.uid = 0;
|
|
attr.gid = 0;
|
|
attr.rdev = node.rdev;
|
|
if (FS.isDir(node.mode)) {
|
|
attr.size = 4096;
|
|
} else if (FS.isFile(node.mode)) {
|
|
attr.size = node.usedBytes;
|
|
} else if (FS.isLink(node.mode)) {
|
|
attr.size = node.link.length;
|
|
} else {
|
|
attr.size = 0;
|
|
}
|
|
attr.atime = new Date(node.timestamp);
|
|
attr.mtime = new Date(node.timestamp);
|
|
attr.ctime = new Date(node.timestamp);
|
|
// NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
|
|
// but this is not required by the standard.
|
|
attr.blksize = 4096;
|
|
attr.blocks = Math.ceil(attr.size / attr.blksize);
|
|
return attr;
|
|
},setattr:function (node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp;
|
|
}
|
|
if (attr.size !== undefined) {
|
|
MEMFS.resizeFileStorage(node, attr.size);
|
|
}
|
|
},lookup:function (parent, name) {
|
|
throw FS.genericErrors[ERRNO_CODES.ENOENT];
|
|
},mknod:function (parent, name, mode, dev) {
|
|
return MEMFS.createNode(parent, name, mode, dev);
|
|
},rename:function (old_node, new_dir, new_name) {
|
|
// if we're overwriting a directory at new_name, make sure it's empty.
|
|
if (FS.isDir(old_node.mode)) {
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name);
|
|
} catch (e) {
|
|
}
|
|
if (new_node) {
|
|
for (var i in new_node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
|
|
}
|
|
}
|
|
}
|
|
// do the internal rewiring
|
|
delete old_node.parent.contents[old_node.name];
|
|
old_node.name = new_name;
|
|
new_dir.contents[new_name] = old_node;
|
|
old_node.parent = new_dir;
|
|
},unlink:function (parent, name) {
|
|
delete parent.contents[name];
|
|
},rmdir:function (parent, name) {
|
|
var node = FS.lookupNode(parent, name);
|
|
for (var i in node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
|
|
}
|
|
delete parent.contents[name];
|
|
},readdir:function (node) {
|
|
var entries = ['.', '..']
|
|
for (var key in node.contents) {
|
|
if (!node.contents.hasOwnProperty(key)) {
|
|
continue;
|
|
}
|
|
entries.push(key);
|
|
}
|
|
return entries;
|
|
},symlink:function (parent, newname, oldpath) {
|
|
var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
|
|
node.link = oldpath;
|
|
return node;
|
|
},readlink:function (node) {
|
|
if (!FS.isLink(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return node.link;
|
|
}},stream_ops:{read:function (stream, buffer, offset, length, position) {
|
|
var contents = stream.node.contents;
|
|
if (position >= stream.node.usedBytes) return 0;
|
|
var size = Math.min(stream.node.usedBytes - position, length);
|
|
assert(size >= 0);
|
|
if (size > 8 && contents.subarray) { // non-trivial, and typed array
|
|
buffer.set(contents.subarray(position, position + size), offset);
|
|
} else {
|
|
for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
|
|
}
|
|
return size;
|
|
},write:function (stream, buffer, offset, length, position, canOwn) {
|
|
if (!length) return 0;
|
|
var node = stream.node;
|
|
node.timestamp = Date.now();
|
|
|
|
if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
|
|
if (canOwn) { // Can we just reuse the buffer we are given?
|
|
node.contents = buffer.subarray(offset, offset + length);
|
|
node.usedBytes = length;
|
|
return length;
|
|
} else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
|
|
node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
|
|
node.usedBytes = length;
|
|
return length;
|
|
} else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
|
|
node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
return length;
|
|
}
|
|
}
|
|
|
|
// Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
|
|
MEMFS.expandFileStorage(node, position+length);
|
|
if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
|
|
else {
|
|
for (var i = 0; i < length; i++) {
|
|
node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
|
|
}
|
|
}
|
|
node.usedBytes = Math.max(node.usedBytes, position+length);
|
|
return length;
|
|
},llseek:function (stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) { // SEEK_CUR.
|
|
position += stream.position;
|
|
} else if (whence === 2) { // SEEK_END.
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.usedBytes;
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return position;
|
|
},allocate:function (stream, offset, length) {
|
|
MEMFS.expandFileStorage(stream.node, offset + length);
|
|
stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
|
|
},mmap:function (stream, buffer, offset, length, position, prot, flags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
var ptr;
|
|
var allocated;
|
|
var contents = stream.node.contents;
|
|
// Only make a new copy when MAP_PRIVATE is specified.
|
|
if ( !(flags & 2) &&
|
|
(contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
|
|
// We can't emulate MAP_SHARED when the file is not backed by the buffer
|
|
// we're mapping to (e.g. the HEAP buffer).
|
|
allocated = false;
|
|
ptr = contents.byteOffset;
|
|
} else {
|
|
// Try to avoid unnecessary slices.
|
|
if (position > 0 || position + length < stream.node.usedBytes) {
|
|
if (contents.subarray) {
|
|
contents = contents.subarray(position, position + length);
|
|
} else {
|
|
contents = Array.prototype.slice.call(contents, position, position + length);
|
|
}
|
|
}
|
|
allocated = true;
|
|
ptr = _malloc(length);
|
|
if (!ptr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
|
|
}
|
|
buffer.set(contents, ptr);
|
|
}
|
|
return { ptr: ptr, allocated: allocated };
|
|
},msync:function (stream, buffer, offset, length, mmapFlags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
if (mmapFlags & 2) {
|
|
// MAP_PRIVATE calls need not to be synced back to underlying fs
|
|
return 0;
|
|
}
|
|
|
|
var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
|
|
// should we check if bytesWritten and length are the same?
|
|
return 0;
|
|
}}};
|
|
|
|
var IDBFS={dbs:{},indexedDB:function () {
|
|
if (typeof indexedDB !== 'undefined') return indexedDB;
|
|
var ret = null;
|
|
if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
|
|
assert(ret, 'IDBFS used, but indexedDB not supported');
|
|
return ret;
|
|
},DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
|
|
// reuse all of the core MEMFS functionality
|
|
return MEMFS.mount.apply(null, arguments);
|
|
},syncfs:function (mount, populate, callback) {
|
|
IDBFS.getLocalSet(mount, function(err, local) {
|
|
if (err) return callback(err);
|
|
|
|
IDBFS.getRemoteSet(mount, function(err, remote) {
|
|
if (err) return callback(err);
|
|
|
|
var src = populate ? remote : local;
|
|
var dst = populate ? local : remote;
|
|
|
|
IDBFS.reconcile(src, dst, callback);
|
|
});
|
|
});
|
|
},getDB:function (name, callback) {
|
|
// check the cache first
|
|
var db = IDBFS.dbs[name];
|
|
if (db) {
|
|
return callback(null, db);
|
|
}
|
|
|
|
var req;
|
|
try {
|
|
req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
if (!req) {
|
|
return callback("Unable to connect to IndexedDB");
|
|
}
|
|
req.onupgradeneeded = function(e) {
|
|
var db = e.target.result;
|
|
var transaction = e.target.transaction;
|
|
|
|
var fileStore;
|
|
|
|
if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
|
|
fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
} else {
|
|
fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
|
|
}
|
|
|
|
if (!fileStore.indexNames.contains('timestamp')) {
|
|
fileStore.createIndex('timestamp', 'timestamp', { unique: false });
|
|
}
|
|
};
|
|
req.onsuccess = function() {
|
|
db = req.result;
|
|
|
|
// add to the cache
|
|
IDBFS.dbs[name] = db;
|
|
callback(null, db);
|
|
};
|
|
req.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},getLocalSet:function (mount, callback) {
|
|
var entries = {};
|
|
|
|
function isRealDir(p) {
|
|
return p !== '.' && p !== '..';
|
|
};
|
|
function toAbsolute(root) {
|
|
return function(p) {
|
|
return PATH.join2(root, p);
|
|
}
|
|
};
|
|
|
|
var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
|
|
|
|
while (check.length) {
|
|
var path = check.pop();
|
|
var stat;
|
|
|
|
try {
|
|
stat = FS.stat(path);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
|
|
if (FS.isDir(stat.mode)) {
|
|
check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
|
|
}
|
|
|
|
entries[path] = { timestamp: stat.mtime };
|
|
}
|
|
|
|
return callback(null, { type: 'local', entries: entries });
|
|
},getRemoteSet:function (mount, callback) {
|
|
var entries = {};
|
|
|
|
IDBFS.getDB(mount.mountpoint, function(err, db) {
|
|
if (err) return callback(err);
|
|
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
|
|
transaction.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
var index = store.index('timestamp');
|
|
|
|
index.openKeyCursor().onsuccess = function(event) {
|
|
var cursor = event.target.result;
|
|
|
|
if (!cursor) {
|
|
return callback(null, { type: 'remote', db: db, entries: entries });
|
|
}
|
|
|
|
entries[cursor.primaryKey] = { timestamp: cursor.key };
|
|
|
|
cursor.continue();
|
|
};
|
|
});
|
|
},loadLocalEntry:function (path, callback) {
|
|
var stat, node;
|
|
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
node = lookup.node;
|
|
stat = FS.stat(path);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
|
|
if (FS.isDir(stat.mode)) {
|
|
return callback(null, { timestamp: stat.mtime, mode: stat.mode });
|
|
} else if (FS.isFile(stat.mode)) {
|
|
// Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
|
|
// Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
|
|
node.contents = MEMFS.getFileDataAsTypedArray(node);
|
|
return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
|
|
} else {
|
|
return callback(new Error('node type not supported'));
|
|
}
|
|
},storeLocalEntry:function (path, entry, callback) {
|
|
try {
|
|
if (FS.isDir(entry.mode)) {
|
|
FS.mkdir(path, entry.mode);
|
|
} else if (FS.isFile(entry.mode)) {
|
|
FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true });
|
|
} else {
|
|
return callback(new Error('node type not supported'));
|
|
}
|
|
|
|
FS.chmod(path, entry.mode);
|
|
FS.utime(path, entry.timestamp, entry.timestamp);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
|
|
callback(null);
|
|
},removeLocalEntry:function (path, callback) {
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
var stat = FS.stat(path);
|
|
|
|
if (FS.isDir(stat.mode)) {
|
|
FS.rmdir(path);
|
|
} else if (FS.isFile(stat.mode)) {
|
|
FS.unlink(path);
|
|
}
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
|
|
callback(null);
|
|
},loadRemoteEntry:function (store, path, callback) {
|
|
var req = store.get(path);
|
|
req.onsuccess = function(event) { callback(null, event.target.result); };
|
|
req.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},storeRemoteEntry:function (store, path, entry, callback) {
|
|
var req = store.put(entry, path);
|
|
req.onsuccess = function() { callback(null); };
|
|
req.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},removeRemoteEntry:function (store, path, callback) {
|
|
var req = store.delete(path);
|
|
req.onsuccess = function() { callback(null); };
|
|
req.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},reconcile:function (src, dst, callback) {
|
|
var total = 0;
|
|
|
|
var create = [];
|
|
Object.keys(src.entries).forEach(function (key) {
|
|
var e = src.entries[key];
|
|
var e2 = dst.entries[key];
|
|
if (!e2 || e.timestamp > e2.timestamp) {
|
|
create.push(key);
|
|
total++;
|
|
}
|
|
});
|
|
|
|
var remove = [];
|
|
Object.keys(dst.entries).forEach(function (key) {
|
|
var e = dst.entries[key];
|
|
var e2 = src.entries[key];
|
|
if (!e2) {
|
|
remove.push(key);
|
|
total++;
|
|
}
|
|
});
|
|
|
|
if (!total) {
|
|
return callback(null);
|
|
}
|
|
|
|
var errored = false;
|
|
var completed = 0;
|
|
var db = src.type === 'remote' ? src.db : dst.db;
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return callback(err);
|
|
}
|
|
return;
|
|
}
|
|
if (++completed >= total) {
|
|
return callback(null);
|
|
}
|
|
};
|
|
|
|
transaction.onerror = function(e) {
|
|
done(this.error);
|
|
e.preventDefault();
|
|
};
|
|
|
|
// sort paths in ascending order so directory entries are created
|
|
// before the files inside them
|
|
create.sort().forEach(function (path) {
|
|
if (dst.type === 'local') {
|
|
IDBFS.loadRemoteEntry(store, path, function (err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeLocalEntry(path, entry, done);
|
|
});
|
|
} else {
|
|
IDBFS.loadLocalEntry(path, function (err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeRemoteEntry(store, path, entry, done);
|
|
});
|
|
}
|
|
});
|
|
|
|
// sort paths in descending order so files are deleted before their
|
|
// parent directories
|
|
remove.sort().reverse().forEach(function(path) {
|
|
if (dst.type === 'local') {
|
|
IDBFS.removeLocalEntry(path, done);
|
|
} else {
|
|
IDBFS.removeRemoteEntry(store, path, done);
|
|
}
|
|
});
|
|
}};
|
|
|
|
var NODEFS={isWindows:false,staticInit:function () {
|
|
NODEFS.isWindows = !!process.platform.match(/^win/);
|
|
},mount:function (mount) {
|
|
assert(ENVIRONMENT_IS_NODE);
|
|
return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
|
|
},createNode:function (parent, name, mode, dev) {
|
|
if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.node_ops = NODEFS.node_ops;
|
|
node.stream_ops = NODEFS.stream_ops;
|
|
return node;
|
|
},getMode:function (path) {
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path);
|
|
if (NODEFS.isWindows) {
|
|
// On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so
|
|
// propagate write bits to execute bits.
|
|
stat.mode = stat.mode | ((stat.mode & 146) >> 1);
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
return stat.mode;
|
|
},realPath:function (node) {
|
|
var parts = [];
|
|
while (node.parent !== node) {
|
|
parts.push(node.name);
|
|
node = node.parent;
|
|
}
|
|
parts.push(node.mount.opts.root);
|
|
parts.reverse();
|
|
return PATH.join.apply(null, parts);
|
|
},flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) {
|
|
flags &= ~010000000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
|
|
flags &= ~00004000 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
|
|
flags &= ~0100000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
|
|
flags &= ~02000000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
|
|
if (flags in NODEFS.flagsToPermissionStringMap) {
|
|
return NODEFS.flagsToPermissionStringMap[flags];
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
},node_ops:{getattr:function (node) {
|
|
var path = NODEFS.realPath(node);
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
// node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
|
|
// See http://support.microsoft.com/kb/140365
|
|
if (NODEFS.isWindows && !stat.blksize) {
|
|
stat.blksize = 4096;
|
|
}
|
|
if (NODEFS.isWindows && !stat.blocks) {
|
|
stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
|
|
}
|
|
return {
|
|
dev: stat.dev,
|
|
ino: stat.ino,
|
|
mode: stat.mode,
|
|
nlink: stat.nlink,
|
|
uid: stat.uid,
|
|
gid: stat.gid,
|
|
rdev: stat.rdev,
|
|
size: stat.size,
|
|
atime: stat.atime,
|
|
mtime: stat.mtime,
|
|
ctime: stat.ctime,
|
|
blksize: stat.blksize,
|
|
blocks: stat.blocks
|
|
};
|
|
},setattr:function (node, attr) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (attr.mode !== undefined) {
|
|
fs.chmodSync(path, attr.mode);
|
|
// update the common node structure mode as well
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
var date = new Date(attr.timestamp);
|
|
fs.utimesSync(path, date, date);
|
|
}
|
|
if (attr.size !== undefined) {
|
|
fs.truncateSync(path, attr.size);
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},lookup:function (parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
var mode = NODEFS.getMode(path);
|
|
return NODEFS.createNode(parent, name, mode);
|
|
},mknod:function (parent, name, mode, dev) {
|
|
var node = NODEFS.createNode(parent, name, mode, dev);
|
|
// create the backing node for this in the fs root as well
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (FS.isDir(node.mode)) {
|
|
fs.mkdirSync(path, node.mode);
|
|
} else {
|
|
fs.writeFileSync(path, '', { mode: node.mode });
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
return node;
|
|
},rename:function (oldNode, newDir, newName) {
|
|
var oldPath = NODEFS.realPath(oldNode);
|
|
var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
|
|
try {
|
|
fs.renameSync(oldPath, newPath);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},unlink:function (parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.unlinkSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},rmdir:function (parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.rmdirSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},readdir:function (node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
return fs.readdirSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},symlink:function (parent, newName, oldPath) {
|
|
var newPath = PATH.join2(NODEFS.realPath(parent), newName);
|
|
try {
|
|
fs.symlinkSync(oldPath, newPath);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},readlink:function (node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
path = fs.readlinkSync(path);
|
|
path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
|
|
return path;
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
}},stream_ops:{open:function (stream) {
|
|
var path = NODEFS.realPath(stream.node);
|
|
try {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags));
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},close:function (stream) {
|
|
try {
|
|
if (FS.isFile(stream.node.mode) && stream.nfd) {
|
|
fs.closeSync(stream.nfd);
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},read:function (stream, buffer, offset, length, position) {
|
|
if (length === 0) return 0; // node errors on 0 length reads
|
|
// FIXME this is terrible.
|
|
var nbuffer = new Buffer(length);
|
|
var res;
|
|
try {
|
|
res = fs.readSync(stream.nfd, nbuffer, 0, length, position);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
if (res > 0) {
|
|
for (var i = 0; i < res; i++) {
|
|
buffer[offset + i] = nbuffer[i];
|
|
}
|
|
}
|
|
return res;
|
|
},write:function (stream, buffer, offset, length, position) {
|
|
// FIXME this is terrible.
|
|
var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
|
|
var res;
|
|
try {
|
|
res = fs.writeSync(stream.nfd, nbuffer, 0, length, position);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
return res;
|
|
},llseek:function (stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) { // SEEK_CUR.
|
|
position += stream.position;
|
|
} else if (whence === 2) { // SEEK_END.
|
|
if (FS.isFile(stream.node.mode)) {
|
|
try {
|
|
var stat = fs.fstatSync(stream.nfd);
|
|
position += stat.size;
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
}
|
|
}
|
|
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
|
|
return position;
|
|
}}};
|
|
|
|
var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
|
|
assert(ENVIRONMENT_IS_WORKER);
|
|
if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
|
|
var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
|
|
var createdParents = {};
|
|
function ensureParent(path) {
|
|
// return the parent node, creating subdirs as necessary
|
|
var parts = path.split('/');
|
|
var parent = root;
|
|
for (var i = 0; i < parts.length-1; i++) {
|
|
var curr = parts.slice(0, i+1).join('/');
|
|
// Issue 4254: Using curr as a node name will prevent the node
|
|
// from being found in FS.nameTable when FS.open is called on
|
|
// a path which holds a child of this node,
|
|
// given that all FS functions assume node names
|
|
// are just their corresponding parts within their given path,
|
|
// rather than incremental aggregates which include their parent's
|
|
// directories.
|
|
if (!createdParents[curr]) {
|
|
createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
|
|
}
|
|
parent = createdParents[curr];
|
|
}
|
|
return parent;
|
|
}
|
|
function base(path) {
|
|
var parts = path.split('/');
|
|
return parts[parts.length-1];
|
|
}
|
|
// We also accept FileList here, by using Array.prototype
|
|
Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
|
|
WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
|
|
});
|
|
(mount.opts["blobs"] || []).forEach(function(obj) {
|
|
WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
|
|
});
|
|
(mount.opts["packages"] || []).forEach(function(pack) {
|
|
pack['metadata'].files.forEach(function(file) {
|
|
var name = file.filename.substr(1); // remove initial slash
|
|
WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
|
|
});
|
|
});
|
|
return root;
|
|
},createNode:function (parent, name, mode, dev, contents, mtime) {
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.mode = mode;
|
|
node.node_ops = WORKERFS.node_ops;
|
|
node.stream_ops = WORKERFS.stream_ops;
|
|
node.timestamp = (mtime || new Date).getTime();
|
|
assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
|
|
if (mode === WORKERFS.FILE_MODE) {
|
|
node.size = contents.size;
|
|
node.contents = contents;
|
|
} else {
|
|
node.size = 4096;
|
|
node.contents = {};
|
|
}
|
|
if (parent) {
|
|
parent.contents[name] = node;
|
|
}
|
|
return node;
|
|
},node_ops:{getattr:function (node) {
|
|
return {
|
|
dev: 1,
|
|
ino: undefined,
|
|
mode: node.mode,
|
|
nlink: 1,
|
|
uid: 0,
|
|
gid: 0,
|
|
rdev: undefined,
|
|
size: node.size,
|
|
atime: new Date(node.timestamp),
|
|
mtime: new Date(node.timestamp),
|
|
ctime: new Date(node.timestamp),
|
|
blksize: 4096,
|
|
blocks: Math.ceil(node.size / 4096),
|
|
};
|
|
},setattr:function (node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp;
|
|
}
|
|
},lookup:function (parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
},mknod:function (parent, name, mode, dev) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},rename:function (oldNode, newDir, newName) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},unlink:function (parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},rmdir:function (parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},readdir:function (node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},symlink:function (parent, newName, oldPath) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},readlink:function (node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}},stream_ops:{read:function (stream, buffer, offset, length, position) {
|
|
if (position >= stream.node.size) return 0;
|
|
var chunk = stream.node.contents.slice(position, position + length);
|
|
var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
|
|
buffer.set(new Uint8Array(ab), offset);
|
|
return chunk.size;
|
|
},write:function (stream, buffer, offset, length, position) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
},llseek:function (stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) { // SEEK_CUR.
|
|
position += stream.position;
|
|
} else if (whence === 2) { // SEEK_END.
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.size;
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return position;
|
|
}}};
|
|
|
|
var _stdin=STATICTOP; STATICTOP += 16;;
|
|
|
|
var _stdout=STATICTOP; STATICTOP += 16;;
|
|
|
|
var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
|
|
if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
|
|
return ___setErrNo(e.errno);
|
|
},lookupPath:function (path, opts) {
|
|
path = PATH.resolve(FS.cwd(), path);
|
|
opts = opts || {};
|
|
|
|
if (!path) return { path: '', node: null };
|
|
|
|
var defaults = {
|
|
follow_mount: true,
|
|
recurse_count: 0
|
|
};
|
|
for (var key in defaults) {
|
|
if (opts[key] === undefined) {
|
|
opts[key] = defaults[key];
|
|
}
|
|
}
|
|
|
|
if (opts.recurse_count > 8) { // max recursive lookup of 8
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
|
|
}
|
|
|
|
// split the path
|
|
var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
|
|
return !!p;
|
|
}), false);
|
|
|
|
// start at the root
|
|
var current = FS.root;
|
|
var current_path = '/';
|
|
|
|
for (var i = 0; i < parts.length; i++) {
|
|
var islast = (i === parts.length-1);
|
|
if (islast && opts.parent) {
|
|
// stop resolving
|
|
break;
|
|
}
|
|
|
|
current = FS.lookupNode(current, parts[i]);
|
|
current_path = PATH.join2(current_path, parts[i]);
|
|
|
|
// jump to the mount's root node if this is a mountpoint
|
|
if (FS.isMountpoint(current)) {
|
|
if (!islast || (islast && opts.follow_mount)) {
|
|
current = current.mounted.root;
|
|
}
|
|
}
|
|
|
|
// by default, lookupPath will not follow a symlink if it is the final path component.
|
|
// setting opts.follow = true will override this behavior.
|
|
if (!islast || opts.follow) {
|
|
var count = 0;
|
|
while (FS.isLink(current.mode)) {
|
|
var link = FS.readlink(current_path);
|
|
current_path = PATH.resolve(PATH.dirname(current_path), link);
|
|
|
|
var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
|
|
current = lookup.node;
|
|
|
|
if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return { path: current_path, node: current };
|
|
},getPath:function (node) {
|
|
var path;
|
|
while (true) {
|
|
if (FS.isRoot(node)) {
|
|
var mount = node.mount.mountpoint;
|
|
if (!path) return mount;
|
|
return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
|
|
}
|
|
path = path ? node.name + '/' + path : node.name;
|
|
node = node.parent;
|
|
}
|
|
},hashName:function (parentid, name) {
|
|
var hash = 0;
|
|
|
|
|
|
for (var i = 0; i < name.length; i++) {
|
|
hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
|
|
}
|
|
return ((parentid + hash) >>> 0) % FS.nameTable.length;
|
|
},hashAddNode:function (node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
node.name_next = FS.nameTable[hash];
|
|
FS.nameTable[hash] = node;
|
|
},hashRemoveNode:function (node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
if (FS.nameTable[hash] === node) {
|
|
FS.nameTable[hash] = node.name_next;
|
|
} else {
|
|
var current = FS.nameTable[hash];
|
|
while (current) {
|
|
if (current.name_next === node) {
|
|
current.name_next = node.name_next;
|
|
break;
|
|
}
|
|
current = current.name_next;
|
|
}
|
|
}
|
|
},lookupNode:function (parent, name) {
|
|
var err = FS.mayLookup(parent);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err, parent);
|
|
}
|
|
var hash = FS.hashName(parent.id, name);
|
|
for (var node = FS.nameTable[hash]; node; node = node.name_next) {
|
|
var nodeName = node.name;
|
|
if (node.parent.id === parent.id && nodeName === name) {
|
|
return node;
|
|
}
|
|
}
|
|
// if we failed to find it in the cache, call into the VFS
|
|
return FS.lookup(parent, name);
|
|
},createNode:function (parent, name, mode, rdev) {
|
|
if (!FS.FSNode) {
|
|
FS.FSNode = function(parent, name, mode, rdev) {
|
|
if (!parent) {
|
|
parent = this; // root node sets parent to itself
|
|
}
|
|
this.parent = parent;
|
|
this.mount = parent.mount;
|
|
this.mounted = null;
|
|
this.id = FS.nextInode++;
|
|
this.name = name;
|
|
this.mode = mode;
|
|
this.node_ops = {};
|
|
this.stream_ops = {};
|
|
this.rdev = rdev;
|
|
};
|
|
|
|
FS.FSNode.prototype = {};
|
|
|
|
// compatibility
|
|
var readMode = 292 | 73;
|
|
var writeMode = 146;
|
|
|
|
// NOTE we must use Object.defineProperties instead of individual calls to
|
|
// Object.defineProperty in order to make closure compiler happy
|
|
Object.defineProperties(FS.FSNode.prototype, {
|
|
read: {
|
|
get: function() { return (this.mode & readMode) === readMode; },
|
|
set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
|
|
},
|
|
write: {
|
|
get: function() { return (this.mode & writeMode) === writeMode; },
|
|
set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
|
|
},
|
|
isFolder: {
|
|
get: function() { return FS.isDir(this.mode); }
|
|
},
|
|
isDevice: {
|
|
get: function() { return FS.isChrdev(this.mode); }
|
|
}
|
|
});
|
|
}
|
|
|
|
var node = new FS.FSNode(parent, name, mode, rdev);
|
|
|
|
FS.hashAddNode(node);
|
|
|
|
return node;
|
|
},destroyNode:function (node) {
|
|
FS.hashRemoveNode(node);
|
|
},isRoot:function (node) {
|
|
return node === node.parent;
|
|
},isMountpoint:function (node) {
|
|
return !!node.mounted;
|
|
},isFile:function (mode) {
|
|
return (mode & 61440) === 32768;
|
|
},isDir:function (mode) {
|
|
return (mode & 61440) === 16384;
|
|
},isLink:function (mode) {
|
|
return (mode & 61440) === 40960;
|
|
},isChrdev:function (mode) {
|
|
return (mode & 61440) === 8192;
|
|
},isBlkdev:function (mode) {
|
|
return (mode & 61440) === 24576;
|
|
},isFIFO:function (mode) {
|
|
return (mode & 61440) === 4096;
|
|
},isSocket:function (mode) {
|
|
return (mode & 49152) === 49152;
|
|
},flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
|
|
var flags = FS.flagModes[str];
|
|
if (typeof flags === 'undefined') {
|
|
throw new Error('Unknown file open mode: ' + str);
|
|
}
|
|
return flags;
|
|
},flagsToPermissionString:function (flag) {
|
|
var perms = ['r', 'w', 'rw'][flag & 3];
|
|
if ((flag & 512)) {
|
|
perms += 'w';
|
|
}
|
|
return perms;
|
|
},nodePermissions:function (node, perms) {
|
|
if (FS.ignorePermissions) {
|
|
return 0;
|
|
}
|
|
// return 0 if any user, group or owner bits are set.
|
|
if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
|
|
return ERRNO_CODES.EACCES;
|
|
} else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
|
|
return ERRNO_CODES.EACCES;
|
|
} else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
|
|
return ERRNO_CODES.EACCES;
|
|
}
|
|
return 0;
|
|
},mayLookup:function (dir) {
|
|
var err = FS.nodePermissions(dir, 'x');
|
|
if (err) return err;
|
|
if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
|
|
return 0;
|
|
},mayCreate:function (dir, name) {
|
|
try {
|
|
var node = FS.lookupNode(dir, name);
|
|
return ERRNO_CODES.EEXIST;
|
|
} catch (e) {
|
|
}
|
|
return FS.nodePermissions(dir, 'wx');
|
|
},mayDelete:function (dir, name, isdir) {
|
|
var node;
|
|
try {
|
|
node = FS.lookupNode(dir, name);
|
|
} catch (e) {
|
|
return e.errno;
|
|
}
|
|
var err = FS.nodePermissions(dir, 'wx');
|
|
if (err) {
|
|
return err;
|
|
}
|
|
if (isdir) {
|
|
if (!FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.ENOTDIR;
|
|
}
|
|
if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
|
|
return ERRNO_CODES.EBUSY;
|
|
}
|
|
} else {
|
|
if (FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.EISDIR;
|
|
}
|
|
}
|
|
return 0;
|
|
},mayOpen:function (node, flags) {
|
|
if (!node) {
|
|
return ERRNO_CODES.ENOENT;
|
|
}
|
|
if (FS.isLink(node.mode)) {
|
|
return ERRNO_CODES.ELOOP;
|
|
} else if (FS.isDir(node.mode)) {
|
|
if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
|
|
(flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
|
|
return ERRNO_CODES.EISDIR;
|
|
}
|
|
}
|
|
return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
|
|
},MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
|
|
fd_start = fd_start || 0;
|
|
fd_end = fd_end || FS.MAX_OPEN_FDS;
|
|
for (var fd = fd_start; fd <= fd_end; fd++) {
|
|
if (!FS.streams[fd]) {
|
|
return fd;
|
|
}
|
|
}
|
|
throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
|
|
},getStream:function (fd) {
|
|
return FS.streams[fd];
|
|
},createStream:function (stream, fd_start, fd_end) {
|
|
if (!FS.FSStream) {
|
|
FS.FSStream = function(){};
|
|
FS.FSStream.prototype = {};
|
|
// compatibility
|
|
Object.defineProperties(FS.FSStream.prototype, {
|
|
object: {
|
|
get: function() { return this.node; },
|
|
set: function(val) { this.node = val; }
|
|
},
|
|
isRead: {
|
|
get: function() { return (this.flags & 2097155) !== 1; }
|
|
},
|
|
isWrite: {
|
|
get: function() { return (this.flags & 2097155) !== 0; }
|
|
},
|
|
isAppend: {
|
|
get: function() { return (this.flags & 1024); }
|
|
}
|
|
});
|
|
}
|
|
// clone it, so we can return an instance of FSStream
|
|
var newStream = new FS.FSStream();
|
|
for (var p in stream) {
|
|
newStream[p] = stream[p];
|
|
}
|
|
stream = newStream;
|
|
var fd = FS.nextfd(fd_start, fd_end);
|
|
stream.fd = fd;
|
|
FS.streams[fd] = stream;
|
|
return stream;
|
|
},closeStream:function (fd) {
|
|
FS.streams[fd] = null;
|
|
},chrdev_stream_ops:{open:function (stream) {
|
|
var device = FS.getDevice(stream.node.rdev);
|
|
// override node's stream ops with the device's
|
|
stream.stream_ops = device.stream_ops;
|
|
// forward the open call
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream);
|
|
}
|
|
},llseek:function () {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}},major:function (dev) {
|
|
return ((dev) >> 8);
|
|
},minor:function (dev) {
|
|
return ((dev) & 0xff);
|
|
},makedev:function (ma, mi) {
|
|
return ((ma) << 8 | (mi));
|
|
},registerDevice:function (dev, ops) {
|
|
FS.devices[dev] = { stream_ops: ops };
|
|
},getDevice:function (dev) {
|
|
return FS.devices[dev];
|
|
},getMounts:function (mount) {
|
|
var mounts = [];
|
|
var check = [mount];
|
|
|
|
while (check.length) {
|
|
var m = check.pop();
|
|
|
|
mounts.push(m);
|
|
|
|
check.push.apply(check, m.mounts);
|
|
}
|
|
|
|
return mounts;
|
|
},syncfs:function (populate, callback) {
|
|
if (typeof(populate) === 'function') {
|
|
callback = populate;
|
|
populate = false;
|
|
}
|
|
|
|
FS.syncFSRequests++;
|
|
|
|
if (FS.syncFSRequests > 1) {
|
|
console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
|
|
}
|
|
|
|
var mounts = FS.getMounts(FS.root.mount);
|
|
var completed = 0;
|
|
|
|
function doCallback(err) {
|
|
assert(FS.syncFSRequests > 0);
|
|
FS.syncFSRequests--;
|
|
return callback(err);
|
|
}
|
|
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return doCallback(err);
|
|
}
|
|
return;
|
|
}
|
|
if (++completed >= mounts.length) {
|
|
doCallback(null);
|
|
}
|
|
};
|
|
|
|
// sync all mounts
|
|
mounts.forEach(function (mount) {
|
|
if (!mount.type.syncfs) {
|
|
return done(null);
|
|
}
|
|
mount.type.syncfs(mount, populate, done);
|
|
});
|
|
},mount:function (type, opts, mountpoint) {
|
|
var root = mountpoint === '/';
|
|
var pseudo = !mountpoint;
|
|
var node;
|
|
|
|
if (root && FS.root) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
} else if (!root && !pseudo) {
|
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
|
|
|
|
mountpoint = lookup.path; // use the absolute path
|
|
node = lookup.node;
|
|
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
|
|
if (!FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
}
|
|
|
|
var mount = {
|
|
type: type,
|
|
opts: opts,
|
|
mountpoint: mountpoint,
|
|
mounts: []
|
|
};
|
|
|
|
// create a root node for the fs
|
|
var mountRoot = type.mount(mount);
|
|
mountRoot.mount = mount;
|
|
mount.root = mountRoot;
|
|
|
|
if (root) {
|
|
FS.root = mountRoot;
|
|
} else if (node) {
|
|
// set as a mountpoint
|
|
node.mounted = mount;
|
|
|
|
// add the new mount to the current mount's children
|
|
if (node.mount) {
|
|
node.mount.mounts.push(mount);
|
|
}
|
|
}
|
|
|
|
return mountRoot;
|
|
},unmount:function (mountpoint) {
|
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
|
|
|
|
if (!FS.isMountpoint(lookup.node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
|
|
// destroy the nodes for this mount, and all its child mounts
|
|
var node = lookup.node;
|
|
var mount = node.mounted;
|
|
var mounts = FS.getMounts(mount);
|
|
|
|
Object.keys(FS.nameTable).forEach(function (hash) {
|
|
var current = FS.nameTable[hash];
|
|
|
|
while (current) {
|
|
var next = current.name_next;
|
|
|
|
if (mounts.indexOf(current.mount) !== -1) {
|
|
FS.destroyNode(current);
|
|
}
|
|
|
|
current = next;
|
|
}
|
|
});
|
|
|
|
// no longer a mountpoint
|
|
node.mounted = null;
|
|
|
|
// remove this mount from the child mounts
|
|
var idx = node.mount.mounts.indexOf(mount);
|
|
assert(idx !== -1);
|
|
node.mount.mounts.splice(idx, 1);
|
|
},lookup:function (parent, name) {
|
|
return parent.node_ops.lookup(parent, name);
|
|
},mknod:function (path, mode, dev) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
if (!name || name === '.' || name === '..') {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var err = FS.mayCreate(parent, name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.mknod) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
return parent.node_ops.mknod(parent, name, mode, dev);
|
|
},create:function (path, mode) {
|
|
mode = mode !== undefined ? mode : 438 /* 0666 */;
|
|
mode &= 4095;
|
|
mode |= 32768;
|
|
return FS.mknod(path, mode, 0);
|
|
},mkdir:function (path, mode) {
|
|
mode = mode !== undefined ? mode : 511 /* 0777 */;
|
|
mode &= 511 | 512;
|
|
mode |= 16384;
|
|
return FS.mknod(path, mode, 0);
|
|
},mkdev:function (path, mode, dev) {
|
|
if (typeof(dev) === 'undefined') {
|
|
dev = mode;
|
|
mode = 438 /* 0666 */;
|
|
}
|
|
mode |= 8192;
|
|
return FS.mknod(path, mode, dev);
|
|
},symlink:function (oldpath, newpath) {
|
|
if (!PATH.resolve(oldpath)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
var lookup = FS.lookupPath(newpath, { parent: true });
|
|
var parent = lookup.node;
|
|
if (!parent) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
var newname = PATH.basename(newpath);
|
|
var err = FS.mayCreate(parent, newname);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.symlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
return parent.node_ops.symlink(parent, newname, oldpath);
|
|
},rename:function (old_path, new_path) {
|
|
var old_dirname = PATH.dirname(old_path);
|
|
var new_dirname = PATH.dirname(new_path);
|
|
var old_name = PATH.basename(old_path);
|
|
var new_name = PATH.basename(new_path);
|
|
// parents must exist
|
|
var lookup, old_dir, new_dir;
|
|
try {
|
|
lookup = FS.lookupPath(old_path, { parent: true });
|
|
old_dir = lookup.node;
|
|
lookup = FS.lookupPath(new_path, { parent: true });
|
|
new_dir = lookup.node;
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
// need to be part of the same mount
|
|
if (old_dir.mount !== new_dir.mount) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
|
|
}
|
|
// source must exist
|
|
var old_node = FS.lookupNode(old_dir, old_name);
|
|
// old path should not be an ancestor of the new path
|
|
var relative = PATH.relative(old_path, new_dirname);
|
|
if (relative.charAt(0) !== '.') {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
// new path should not be an ancestor of the old path
|
|
relative = PATH.relative(new_path, old_dirname);
|
|
if (relative.charAt(0) !== '.') {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
|
|
}
|
|
// see if the new path already exists
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name);
|
|
} catch (e) {
|
|
// not fatal
|
|
}
|
|
// early out if nothing needs to change
|
|
if (old_node === new_node) {
|
|
return;
|
|
}
|
|
// we'll need to delete the old entry
|
|
var isdir = FS.isDir(old_node.mode);
|
|
var err = FS.mayDelete(old_dir, old_name, isdir);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
// need delete permissions if we'll be overwriting.
|
|
// need create permissions if new doesn't already exist.
|
|
err = new_node ?
|
|
FS.mayDelete(new_dir, new_name, isdir) :
|
|
FS.mayCreate(new_dir, new_name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!old_dir.node_ops.rename) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
// if we are going to change the parent, check write permissions
|
|
if (new_dir !== old_dir) {
|
|
err = FS.nodePermissions(old_dir, 'w');
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['willMovePath']) {
|
|
FS.trackingDelegate['willMovePath'](old_path, new_path);
|
|
}
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
|
|
}
|
|
// remove the node from the lookup hash
|
|
FS.hashRemoveNode(old_node);
|
|
// do the underlying fs rename
|
|
try {
|
|
old_dir.node_ops.rename(old_node, new_dir, new_name);
|
|
} catch (e) {
|
|
throw e;
|
|
} finally {
|
|
// add the node back to the hash (in case node_ops.rename
|
|
// changed its name)
|
|
FS.hashAddNode(old_node);
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
|
|
}
|
|
},rmdir:function (path) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, true);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.rmdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['willDeletePath']) {
|
|
FS.trackingDelegate['willDeletePath'](path);
|
|
}
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
parent.node_ops.rmdir(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
},readdir:function (path) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
var node = lookup.node;
|
|
if (!node.node_ops.readdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
return node.node_ops.readdir(node);
|
|
},unlink:function (path) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, false);
|
|
if (err) {
|
|
// According to POSIX, we should map EISDIR to EPERM, but
|
|
// we instead do what Linux does (and we must, as we use
|
|
// the musl linux libc).
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.unlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['willDeletePath']) {
|
|
FS.trackingDelegate['willDeletePath'](path);
|
|
}
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
parent.node_ops.unlink(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
},readlink:function (path) {
|
|
var lookup = FS.lookupPath(path);
|
|
var link = lookup.node;
|
|
if (!link) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
if (!link.node_ops.readlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
|
|
},stat:function (path, dontFollow) {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
var node = lookup.node;
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
if (!node.node_ops.getattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
return node.node_ops.getattr(node);
|
|
},lstat:function (path) {
|
|
return FS.stat(path, true);
|
|
},chmod:function (path, mode, dontFollow) {
|
|
var node;
|
|
if (typeof path === 'string') {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
mode: (mode & 4095) | (node.mode & ~4095),
|
|
timestamp: Date.now()
|
|
});
|
|
},lchmod:function (path, mode) {
|
|
FS.chmod(path, mode, true);
|
|
},fchmod:function (fd, mode) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
FS.chmod(stream.node, mode);
|
|
},chown:function (path, uid, gid, dontFollow) {
|
|
var node;
|
|
if (typeof path === 'string') {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Date.now()
|
|
// we ignore the uid / gid for now
|
|
});
|
|
},lchown:function (path, uid, gid) {
|
|
FS.chown(path, uid, gid, true);
|
|
},fchown:function (fd, uid, gid) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
FS.chown(stream.node, uid, gid);
|
|
},truncate:function (path, len) {
|
|
if (len < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var node;
|
|
if (typeof path === 'string') {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
|
|
}
|
|
if (!FS.isFile(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var err = FS.nodePermissions(node, 'w');
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
size: len,
|
|
timestamp: Date.now()
|
|
});
|
|
},ftruncate:function (fd, len) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
FS.truncate(stream.node, len);
|
|
},utime:function (path, atime, mtime) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
var node = lookup.node;
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Math.max(atime, mtime)
|
|
});
|
|
},open:function (path, flags, mode, fd_start, fd_end) {
|
|
if (path === "") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
|
|
mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
|
|
if ((flags & 64)) {
|
|
mode = (mode & 4095) | 32768;
|
|
} else {
|
|
mode = 0;
|
|
}
|
|
var node;
|
|
if (typeof path === 'object') {
|
|
node = path;
|
|
} else {
|
|
path = PATH.normalize(path);
|
|
try {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !(flags & 131072)
|
|
});
|
|
node = lookup.node;
|
|
} catch (e) {
|
|
// ignore
|
|
}
|
|
}
|
|
// perhaps we need to create the node
|
|
var created = false;
|
|
if ((flags & 64)) {
|
|
if (node) {
|
|
// if O_CREAT and O_EXCL are set, error out if the node already exists
|
|
if ((flags & 128)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
|
|
}
|
|
} else {
|
|
// node doesn't exist, try to create it
|
|
node = FS.mknod(path, mode, 0);
|
|
created = true;
|
|
}
|
|
}
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
// can't truncate a device
|
|
if (FS.isChrdev(node.mode)) {
|
|
flags &= ~512;
|
|
}
|
|
// if asked only for a directory, then this must be one
|
|
if ((flags & 65536) && !FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
// check permissions, if this is not a file we just created now (it is ok to
|
|
// create and write to a file with read-only permissions; it is read-only
|
|
// for later use)
|
|
if (!created) {
|
|
var err = FS.mayOpen(node, flags);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
}
|
|
// do truncation if necessary
|
|
if ((flags & 512)) {
|
|
FS.truncate(node, 0);
|
|
}
|
|
// we've already handled these, don't pass down to the underlying vfs
|
|
flags &= ~(128 | 512);
|
|
|
|
// register the stream with the filesystem
|
|
var stream = FS.createStream({
|
|
node: node,
|
|
path: FS.getPath(node), // we want the absolute path to the node
|
|
flags: flags,
|
|
seekable: true,
|
|
position: 0,
|
|
stream_ops: node.stream_ops,
|
|
// used by the file family libc calls (fopen, fwrite, ferror, etc.)
|
|
ungotten: [],
|
|
error: false
|
|
}, fd_start, fd_end);
|
|
// call the new stream's open function
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream);
|
|
}
|
|
if (Module['logReadFiles'] && !(flags & 1)) {
|
|
if (!FS.readFiles) FS.readFiles = {};
|
|
if (!(path in FS.readFiles)) {
|
|
FS.readFiles[path] = 1;
|
|
Module['printErr']('read file: ' + path);
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['onOpenFile']) {
|
|
var trackingFlags = 0;
|
|
if ((flags & 2097155) !== 1) {
|
|
trackingFlags |= FS.tracking.openFlags.READ;
|
|
}
|
|
if ((flags & 2097155) !== 0) {
|
|
trackingFlags |= FS.tracking.openFlags.WRITE;
|
|
}
|
|
FS.trackingDelegate['onOpenFile'](path, trackingFlags);
|
|
}
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
|
|
}
|
|
return stream;
|
|
},close:function (stream) {
|
|
if (stream.getdents) stream.getdents = null; // free readdir state
|
|
try {
|
|
if (stream.stream_ops.close) {
|
|
stream.stream_ops.close(stream);
|
|
}
|
|
} catch (e) {
|
|
throw e;
|
|
} finally {
|
|
FS.closeStream(stream.fd);
|
|
}
|
|
},llseek:function (stream, offset, whence) {
|
|
if (!stream.seekable || !stream.stream_ops.llseek) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}
|
|
stream.position = stream.stream_ops.llseek(stream, offset, whence);
|
|
stream.ungotten = [];
|
|
return stream.position;
|
|
},read:function (stream, buffer, offset, length, position) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
|
|
}
|
|
if (!stream.stream_ops.read) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var seeking = true;
|
|
if (typeof position === 'undefined') {
|
|
position = stream.position;
|
|
seeking = false;
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}
|
|
var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
|
|
if (!seeking) stream.position += bytesRead;
|
|
return bytesRead;
|
|
},write:function (stream, buffer, offset, length, position, canOwn) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
|
|
}
|
|
if (!stream.stream_ops.write) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if (stream.flags & 1024) {
|
|
// seek to the end before writing in append mode
|
|
FS.llseek(stream, 0, 2);
|
|
}
|
|
var seeking = true;
|
|
if (typeof position === 'undefined') {
|
|
position = stream.position;
|
|
seeking = false;
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}
|
|
var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
|
|
if (!seeking) stream.position += bytesWritten;
|
|
try {
|
|
if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
return bytesWritten;
|
|
},allocate:function (stream, offset, length) {
|
|
if (offset < 0 || length <= 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
if (!stream.stream_ops.allocate) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
|
|
}
|
|
stream.stream_ops.allocate(stream, offset, length);
|
|
},mmap:function (stream, buffer, offset, length, position, prot, flags) {
|
|
// TODO if PROT is PROT_WRITE, make sure we have write access
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EACCES);
|
|
}
|
|
if (!stream.stream_ops.mmap) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
|
|
},msync:function (stream, buffer, offset, length, mmapFlags) {
|
|
if (!stream || !stream.stream_ops.msync) {
|
|
return 0;
|
|
}
|
|
return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
|
|
},munmap:function (stream) {
|
|
return 0;
|
|
},ioctl:function (stream, cmd, arg) {
|
|
if (!stream.stream_ops.ioctl) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
|
|
}
|
|
return stream.stream_ops.ioctl(stream, cmd, arg);
|
|
},readFile:function (path, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || 'r';
|
|
opts.encoding = opts.encoding || 'binary';
|
|
if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
|
|
throw new Error('Invalid encoding type "' + opts.encoding + '"');
|
|
}
|
|
var ret;
|
|
var stream = FS.open(path, opts.flags);
|
|
var stat = FS.stat(path);
|
|
var length = stat.size;
|
|
var buf = new Uint8Array(length);
|
|
FS.read(stream, buf, 0, length, 0);
|
|
if (opts.encoding === 'utf8') {
|
|
ret = UTF8ArrayToString(buf, 0);
|
|
} else if (opts.encoding === 'binary') {
|
|
ret = buf;
|
|
}
|
|
FS.close(stream);
|
|
return ret;
|
|
},writeFile:function (path, data, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || 'w';
|
|
opts.encoding = opts.encoding || 'utf8';
|
|
if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
|
|
throw new Error('Invalid encoding type "' + opts.encoding + '"');
|
|
}
|
|
var stream = FS.open(path, opts.flags, opts.mode);
|
|
if (opts.encoding === 'utf8') {
|
|
var buf = new Uint8Array(lengthBytesUTF8(data)+1);
|
|
var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
|
|
FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn);
|
|
} else if (opts.encoding === 'binary') {
|
|
FS.write(stream, data, 0, data.length, 0, opts.canOwn);
|
|
}
|
|
FS.close(stream);
|
|
},cwd:function () {
|
|
return FS.currentPath;
|
|
},chdir:function (path) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
if (!FS.isDir(lookup.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
var err = FS.nodePermissions(lookup.node, 'x');
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
FS.currentPath = lookup.path;
|
|
},createDefaultDirectories:function () {
|
|
FS.mkdir('/tmp');
|
|
FS.mkdir('/home');
|
|
FS.mkdir('/home/web_user');
|
|
},createDefaultDevices:function () {
|
|
// create /dev
|
|
FS.mkdir('/dev');
|
|
// setup /dev/null
|
|
FS.registerDevice(FS.makedev(1, 3), {
|
|
read: function() { return 0; },
|
|
write: function(stream, buffer, offset, length, pos) { return length; }
|
|
});
|
|
FS.mkdev('/dev/null', FS.makedev(1, 3));
|
|
// setup /dev/tty and /dev/tty1
|
|
// stderr needs to print output using Module['printErr']
|
|
// so we register a second tty just for it.
|
|
TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
|
|
TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
|
|
FS.mkdev('/dev/tty', FS.makedev(5, 0));
|
|
FS.mkdev('/dev/tty1', FS.makedev(6, 0));
|
|
// setup /dev/[u]random
|
|
var random_device;
|
|
if (typeof crypto !== 'undefined') {
|
|
// for modern web browsers
|
|
var randomBuffer = new Uint8Array(1);
|
|
random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
|
|
} else if (ENVIRONMENT_IS_NODE) {
|
|
// for nodejs
|
|
random_device = function() { return require('crypto').randomBytes(1)[0]; };
|
|
} else {
|
|
// default for ES5 platforms
|
|
random_device = function() { return (Math.random()*256)|0; };
|
|
}
|
|
FS.createDevice('/dev', 'random', random_device);
|
|
FS.createDevice('/dev', 'urandom', random_device);
|
|
// we're not going to emulate the actual shm device,
|
|
// just create the tmp dirs that reside in it commonly
|
|
FS.mkdir('/dev/shm');
|
|
FS.mkdir('/dev/shm/tmp');
|
|
},createSpecialDirectories:function () {
|
|
// create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
|
|
FS.mkdir('/proc');
|
|
FS.mkdir('/proc/self');
|
|
FS.mkdir('/proc/self/fd');
|
|
FS.mount({
|
|
mount: function() {
|
|
var node = FS.createNode('/proc/self', 'fd', 16384 | 0777, 73);
|
|
node.node_ops = {
|
|
lookup: function(parent, name) {
|
|
var fd = +name;
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
var ret = {
|
|
parent: null,
|
|
mount: { mountpoint: 'fake' },
|
|
node_ops: { readlink: function() { return stream.path } }
|
|
};
|
|
ret.parent = ret; // make it look like a simple root node
|
|
return ret;
|
|
}
|
|
};
|
|
return node;
|
|
}
|
|
}, {}, '/proc/self/fd');
|
|
},createStandardStreams:function () {
|
|
// TODO deprecate the old functionality of a single
|
|
// input / output callback and that utilizes FS.createDevice
|
|
// and instead require a unique set of stream ops
|
|
|
|
// by default, we symlink the standard streams to the
|
|
// default tty devices. however, if the standard streams
|
|
// have been overwritten we create a unique device for
|
|
// them instead.
|
|
if (Module['stdin']) {
|
|
FS.createDevice('/dev', 'stdin', Module['stdin']);
|
|
} else {
|
|
FS.symlink('/dev/tty', '/dev/stdin');
|
|
}
|
|
if (Module['stdout']) {
|
|
FS.createDevice('/dev', 'stdout', null, Module['stdout']);
|
|
} else {
|
|
FS.symlink('/dev/tty', '/dev/stdout');
|
|
}
|
|
if (Module['stderr']) {
|
|
FS.createDevice('/dev', 'stderr', null, Module['stderr']);
|
|
} else {
|
|
FS.symlink('/dev/tty1', '/dev/stderr');
|
|
}
|
|
|
|
// open default streams for the stdin, stdout and stderr devices
|
|
var stdin = FS.open('/dev/stdin', 'r');
|
|
assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
|
|
|
|
var stdout = FS.open('/dev/stdout', 'w');
|
|
assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
|
|
|
|
var stderr = FS.open('/dev/stderr', 'w');
|
|
assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
|
|
},ensureErrnoError:function () {
|
|
if (FS.ErrnoError) return;
|
|
FS.ErrnoError = function ErrnoError(errno, node) {
|
|
//Module.printErr(stackTrace()); // useful for debugging
|
|
this.node = node;
|
|
this.setErrno = function(errno) {
|
|
this.errno = errno;
|
|
for (var key in ERRNO_CODES) {
|
|
if (ERRNO_CODES[key] === errno) {
|
|
this.code = key;
|
|
break;
|
|
}
|
|
}
|
|
};
|
|
this.setErrno(errno);
|
|
this.message = ERRNO_MESSAGES[errno];
|
|
};
|
|
FS.ErrnoError.prototype = new Error();
|
|
FS.ErrnoError.prototype.constructor = FS.ErrnoError;
|
|
// Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
|
|
[ERRNO_CODES.ENOENT].forEach(function(code) {
|
|
FS.genericErrors[code] = new FS.ErrnoError(code);
|
|
FS.genericErrors[code].stack = '<generic error, no stack>';
|
|
});
|
|
},staticInit:function () {
|
|
FS.ensureErrnoError();
|
|
|
|
FS.nameTable = new Array(4096);
|
|
|
|
FS.mount(MEMFS, {}, '/');
|
|
|
|
FS.createDefaultDirectories();
|
|
FS.createDefaultDevices();
|
|
FS.createSpecialDirectories();
|
|
|
|
FS.filesystems = {
|
|
'MEMFS': MEMFS,
|
|
'IDBFS': IDBFS,
|
|
'NODEFS': NODEFS,
|
|
'WORKERFS': WORKERFS,
|
|
};
|
|
},init:function (input, output, error) {
|
|
assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
|
|
FS.init.initialized = true;
|
|
|
|
FS.ensureErrnoError();
|
|
|
|
// Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
|
|
Module['stdin'] = input || Module['stdin'];
|
|
Module['stdout'] = output || Module['stdout'];
|
|
Module['stderr'] = error || Module['stderr'];
|
|
|
|
FS.createStandardStreams();
|
|
},quit:function () {
|
|
FS.init.initialized = false;
|
|
// force-flush all streams, so we get musl std streams printed out
|
|
var fflush = Module['_fflush'];
|
|
if (fflush) fflush(0);
|
|
// close all of our streams
|
|
for (var i = 0; i < FS.streams.length; i++) {
|
|
var stream = FS.streams[i];
|
|
if (!stream) {
|
|
continue;
|
|
}
|
|
FS.close(stream);
|
|
}
|
|
},getMode:function (canRead, canWrite) {
|
|
var mode = 0;
|
|
if (canRead) mode |= 292 | 73;
|
|
if (canWrite) mode |= 146;
|
|
return mode;
|
|
},joinPath:function (parts, forceRelative) {
|
|
var path = PATH.join.apply(null, parts);
|
|
if (forceRelative && path[0] == '/') path = path.substr(1);
|
|
return path;
|
|
},absolutePath:function (relative, base) {
|
|
return PATH.resolve(base, relative);
|
|
},standardizePath:function (path) {
|
|
return PATH.normalize(path);
|
|
},findObject:function (path, dontResolveLastLink) {
|
|
var ret = FS.analyzePath(path, dontResolveLastLink);
|
|
if (ret.exists) {
|
|
return ret.object;
|
|
} else {
|
|
___setErrNo(ret.error);
|
|
return null;
|
|
}
|
|
},analyzePath:function (path, dontResolveLastLink) {
|
|
// operate from within the context of the symlink's target
|
|
try {
|
|
var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
|
|
path = lookup.path;
|
|
} catch (e) {
|
|
}
|
|
var ret = {
|
|
isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
|
|
parentExists: false, parentPath: null, parentObject: null
|
|
};
|
|
try {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
ret.parentExists = true;
|
|
ret.parentPath = lookup.path;
|
|
ret.parentObject = lookup.node;
|
|
ret.name = PATH.basename(path);
|
|
lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
|
|
ret.exists = true;
|
|
ret.path = lookup.path;
|
|
ret.object = lookup.node;
|
|
ret.name = lookup.node.name;
|
|
ret.isRoot = lookup.path === '/';
|
|
} catch (e) {
|
|
ret.error = e.errno;
|
|
};
|
|
return ret;
|
|
},createFolder:function (parent, name, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.mkdir(path, mode);
|
|
},createPath:function (parent, path, canRead, canWrite) {
|
|
parent = typeof parent === 'string' ? parent : FS.getPath(parent);
|
|
var parts = path.split('/').reverse();
|
|
while (parts.length) {
|
|
var part = parts.pop();
|
|
if (!part) continue;
|
|
var current = PATH.join2(parent, part);
|
|
try {
|
|
FS.mkdir(current);
|
|
} catch (e) {
|
|
// ignore EEXIST
|
|
}
|
|
parent = current;
|
|
}
|
|
return current;
|
|
},createFile:function (parent, name, properties, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.create(path, mode);
|
|
},createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
|
|
var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
var node = FS.create(path, mode);
|
|
if (data) {
|
|
if (typeof data === 'string') {
|
|
var arr = new Array(data.length);
|
|
for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
|
|
data = arr;
|
|
}
|
|
// make sure we can write to the file
|
|
FS.chmod(node, mode | 146);
|
|
var stream = FS.open(node, 'w');
|
|
FS.write(stream, data, 0, data.length, 0, canOwn);
|
|
FS.close(stream);
|
|
FS.chmod(node, mode);
|
|
}
|
|
return node;
|
|
},createDevice:function (parent, name, input, output) {
|
|
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(!!input, !!output);
|
|
if (!FS.createDevice.major) FS.createDevice.major = 64;
|
|
var dev = FS.makedev(FS.createDevice.major++, 0);
|
|
// Create a fake device that a set of stream ops to emulate
|
|
// the old behavior.
|
|
FS.registerDevice(dev, {
|
|
open: function(stream) {
|
|
stream.seekable = false;
|
|
},
|
|
close: function(stream) {
|
|
// flush any pending line data
|
|
if (output && output.buffer && output.buffer.length) {
|
|
output(10);
|
|
}
|
|
},
|
|
read: function(stream, buffer, offset, length, pos /* ignored */) {
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = input();
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset+i] = result;
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return bytesRead;
|
|
},
|
|
write: function(stream, buffer, offset, length, pos) {
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
output(buffer[offset+i]);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return i;
|
|
}
|
|
});
|
|
return FS.mkdev(path, mode, dev);
|
|
},createLink:function (parent, name, target, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
|
|
return FS.symlink(target, path);
|
|
},forceLoadFile:function (obj) {
|
|
if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
|
|
var success = true;
|
|
if (typeof XMLHttpRequest !== 'undefined') {
|
|
throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
|
|
} else if (Module['read']) {
|
|
// Command-line.
|
|
try {
|
|
// WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
|
|
// read() will try to parse UTF8.
|
|
obj.contents = intArrayFromString(Module['read'](obj.url), true);
|
|
obj.usedBytes = obj.contents.length;
|
|
} catch (e) {
|
|
success = false;
|
|
}
|
|
} else {
|
|
throw new Error('Cannot load without read() or XMLHttpRequest.');
|
|
}
|
|
if (!success) ___setErrNo(ERRNO_CODES.EIO);
|
|
return success;
|
|
},createLazyFile:function (parent, name, url, canRead, canWrite) {
|
|
// Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
|
|
function LazyUint8Array() {
|
|
this.lengthKnown = false;
|
|
this.chunks = []; // Loaded chunks. Index is the chunk number
|
|
}
|
|
LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
|
|
if (idx > this.length-1 || idx < 0) {
|
|
return undefined;
|
|
}
|
|
var chunkOffset = idx % this.chunkSize;
|
|
var chunkNum = (idx / this.chunkSize)|0;
|
|
return this.getter(chunkNum)[chunkOffset];
|
|
}
|
|
LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
|
|
this.getter = getter;
|
|
}
|
|
LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
|
|
// Find length
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('HEAD', url, false);
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
var datalength = Number(xhr.getResponseHeader("Content-length"));
|
|
var header;
|
|
var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
|
|
var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
|
|
|
|
var chunkSize = 1024*1024; // Chunk size in bytes
|
|
|
|
if (!hasByteServing) chunkSize = datalength;
|
|
|
|
// Function to get a range from the remote URL.
|
|
var doXHR = (function(from, to) {
|
|
if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
|
|
if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
|
|
|
|
// TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, false);
|
|
if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
|
|
|
|
// Some hints to the browser that we want binary data.
|
|
if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
|
|
if (xhr.overrideMimeType) {
|
|
xhr.overrideMimeType('text/plain; charset=x-user-defined');
|
|
}
|
|
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
if (xhr.response !== undefined) {
|
|
return new Uint8Array(xhr.response || []);
|
|
} else {
|
|
return intArrayFromString(xhr.responseText || '', true);
|
|
}
|
|
});
|
|
var lazyArray = this;
|
|
lazyArray.setDataGetter(function(chunkNum) {
|
|
var start = chunkNum * chunkSize;
|
|
var end = (chunkNum+1) * chunkSize - 1; // including this byte
|
|
end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
|
|
if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
|
|
lazyArray.chunks[chunkNum] = doXHR(start, end);
|
|
}
|
|
if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
|
|
return lazyArray.chunks[chunkNum];
|
|
});
|
|
|
|
if (usesGzip || !datalength) {
|
|
// if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
|
|
chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
|
|
datalength = this.getter(0).length;
|
|
chunkSize = datalength;
|
|
console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
|
|
}
|
|
|
|
this._length = datalength;
|
|
this._chunkSize = chunkSize;
|
|
this.lengthKnown = true;
|
|
}
|
|
if (typeof XMLHttpRequest !== 'undefined') {
|
|
if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
|
|
var lazyArray = new LazyUint8Array();
|
|
Object.defineProperties(lazyArray, {
|
|
length: {
|
|
get: function() {
|
|
if(!this.lengthKnown) {
|
|
this.cacheLength();
|
|
}
|
|
return this._length;
|
|
}
|
|
},
|
|
chunkSize: {
|
|
get: function() {
|
|
if(!this.lengthKnown) {
|
|
this.cacheLength();
|
|
}
|
|
return this._chunkSize;
|
|
}
|
|
}
|
|
});
|
|
|
|
var properties = { isDevice: false, contents: lazyArray };
|
|
} else {
|
|
var properties = { isDevice: false, url: url };
|
|
}
|
|
|
|
var node = FS.createFile(parent, name, properties, canRead, canWrite);
|
|
// This is a total hack, but I want to get this lazy file code out of the
|
|
// core of MEMFS. If we want to keep this lazy file concept I feel it should
|
|
// be its own thin LAZYFS proxying calls to MEMFS.
|
|
if (properties.contents) {
|
|
node.contents = properties.contents;
|
|
} else if (properties.url) {
|
|
node.contents = null;
|
|
node.url = properties.url;
|
|
}
|
|
// Add a function that defers querying the file size until it is asked the first time.
|
|
Object.defineProperties(node, {
|
|
usedBytes: {
|
|
get: function() { return this.contents.length; }
|
|
}
|
|
});
|
|
// override each stream op with one that tries to force load the lazy file first
|
|
var stream_ops = {};
|
|
var keys = Object.keys(node.stream_ops);
|
|
keys.forEach(function(key) {
|
|
var fn = node.stream_ops[key];
|
|
stream_ops[key] = function forceLoadLazyFile() {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
return fn.apply(null, arguments);
|
|
};
|
|
});
|
|
// use a custom read function
|
|
stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
var contents = stream.node.contents;
|
|
if (position >= contents.length)
|
|
return 0;
|
|
var size = Math.min(contents.length - position, length);
|
|
assert(size >= 0);
|
|
if (contents.slice) { // normal array
|
|
for (var i = 0; i < size; i++) {
|
|
buffer[offset + i] = contents[position + i];
|
|
}
|
|
} else {
|
|
for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
|
|
buffer[offset + i] = contents.get(position + i);
|
|
}
|
|
}
|
|
return size;
|
|
};
|
|
node.stream_ops = stream_ops;
|
|
return node;
|
|
},createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
|
|
Browser.init(); // XXX perhaps this method should move onto Browser?
|
|
// TODO we should allow people to just pass in a complete filename instead
|
|
// of parent and name being that we just join them anyways
|
|
var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
|
|
var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
|
|
function processData(byteArray) {
|
|
function finish(byteArray) {
|
|
if (preFinish) preFinish();
|
|
if (!dontCreateFile) {
|
|
FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
|
|
}
|
|
if (onload) onload();
|
|
removeRunDependency(dep);
|
|
}
|
|
var handled = false;
|
|
Module['preloadPlugins'].forEach(function(plugin) {
|
|
if (handled) return;
|
|
if (plugin['canHandle'](fullname)) {
|
|
plugin['handle'](byteArray, fullname, finish, function() {
|
|
if (onerror) onerror();
|
|
removeRunDependency(dep);
|
|
});
|
|
handled = true;
|
|
}
|
|
});
|
|
if (!handled) finish(byteArray);
|
|
}
|
|
addRunDependency(dep);
|
|
if (typeof url == 'string') {
|
|
Browser.asyncLoad(url, function(byteArray) {
|
|
processData(byteArray);
|
|
}, onerror);
|
|
} else {
|
|
processData(url);
|
|
}
|
|
},indexedDB:function () {
|
|
return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
|
|
},DB_NAME:function () {
|
|
return 'EM_FS_' + window.location.pathname;
|
|
},DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
|
|
onload = onload || function(){};
|
|
onerror = onerror || function(){};
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
|
|
} catch (e) {
|
|
return onerror(e);
|
|
}
|
|
openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
|
|
console.log('creating db');
|
|
var db = openRequest.result;
|
|
db.createObjectStore(FS.DB_STORE_NAME);
|
|
};
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0, fail = 0, total = paths.length;
|
|
function finish() {
|
|
if (fail == 0) onload(); else onerror();
|
|
}
|
|
paths.forEach(function(path) {
|
|
var putRequest = files.put(FS.analyzePath(path).object.contents, path);
|
|
putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
|
|
putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
|
|
});
|
|
transaction.onerror = onerror;
|
|
};
|
|
openRequest.onerror = onerror;
|
|
},loadFilesFromDB:function (paths, onload, onerror) {
|
|
onload = onload || function(){};
|
|
onerror = onerror || function(){};
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
|
|
} catch (e) {
|
|
return onerror(e);
|
|
}
|
|
openRequest.onupgradeneeded = onerror; // no database to load from
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
try {
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
|
|
} catch(e) {
|
|
onerror(e);
|
|
return;
|
|
}
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0, fail = 0, total = paths.length;
|
|
function finish() {
|
|
if (fail == 0) onload(); else onerror();
|
|
}
|
|
paths.forEach(function(path) {
|
|
var getRequest = files.get(path);
|
|
getRequest.onsuccess = function getRequest_onsuccess() {
|
|
if (FS.analyzePath(path).exists) {
|
|
FS.unlink(path);
|
|
}
|
|
FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
|
|
ok++;
|
|
if (ok + fail == total) finish();
|
|
};
|
|
getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
|
|
});
|
|
transaction.onerror = onerror;
|
|
};
|
|
openRequest.onerror = onerror;
|
|
}};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
|
|
if (path[0] !== '/') {
|
|
// relative path
|
|
var dir;
|
|
if (dirfd === -100) {
|
|
dir = FS.cwd();
|
|
} else {
|
|
var dirstream = FS.getStream(dirfd);
|
|
if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
dir = dirstream.path;
|
|
}
|
|
path = PATH.join2(dir, path);
|
|
}
|
|
return path;
|
|
},doStat:function (func, path, buf) {
|
|
try {
|
|
var stat = func(path);
|
|
} catch (e) {
|
|
if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
|
|
// an error occurred while trying to look up the path; we should just report ENOTDIR
|
|
return -ERRNO_CODES.ENOTDIR;
|
|
}
|
|
throw e;
|
|
}
|
|
HEAP32[((buf)>>2)]=stat.dev;
|
|
HEAP32[(((buf)+(4))>>2)]=0;
|
|
HEAP32[(((buf)+(8))>>2)]=stat.ino;
|
|
HEAP32[(((buf)+(12))>>2)]=stat.mode;
|
|
HEAP32[(((buf)+(16))>>2)]=stat.nlink;
|
|
HEAP32[(((buf)+(20))>>2)]=stat.uid;
|
|
HEAP32[(((buf)+(24))>>2)]=stat.gid;
|
|
HEAP32[(((buf)+(28))>>2)]=stat.rdev;
|
|
HEAP32[(((buf)+(32))>>2)]=0;
|
|
HEAP32[(((buf)+(36))>>2)]=stat.size;
|
|
HEAP32[(((buf)+(40))>>2)]=4096;
|
|
HEAP32[(((buf)+(44))>>2)]=stat.blocks;
|
|
HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
|
|
HEAP32[(((buf)+(52))>>2)]=0;
|
|
HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
|
|
HEAP32[(((buf)+(60))>>2)]=0;
|
|
HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
|
|
HEAP32[(((buf)+(68))>>2)]=0;
|
|
HEAP32[(((buf)+(72))>>2)]=stat.ino;
|
|
return 0;
|
|
},doMsync:function (addr, stream, len, flags) {
|
|
var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
|
|
FS.msync(stream, buffer, 0, len, flags);
|
|
},doMkdir:function (path, mode) {
|
|
// remove a trailing slash, if one - /a/b/ has basename of '', but
|
|
// we want to create b in the context of this function
|
|
path = PATH.normalize(path);
|
|
if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
|
|
FS.mkdir(path, mode, 0);
|
|
return 0;
|
|
},doMknod:function (path, mode, dev) {
|
|
// we don't want this in the JS API as it uses mknod to create all nodes.
|
|
switch (mode & 61440) {
|
|
case 32768:
|
|
case 8192:
|
|
case 24576:
|
|
case 4096:
|
|
case 49152:
|
|
break;
|
|
default: return -ERRNO_CODES.EINVAL;
|
|
}
|
|
FS.mknod(path, mode, dev);
|
|
return 0;
|
|
},doReadlink:function (path, buf, bufsize) {
|
|
if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
|
|
var ret = FS.readlink(path);
|
|
ret = ret.slice(0, Math.max(0, bufsize));
|
|
writeStringToMemory(ret, buf, true);
|
|
return ret.length;
|
|
},doAccess:function (path, amode) {
|
|
if (amode & ~7) {
|
|
// need a valid mode
|
|
return -ERRNO_CODES.EINVAL;
|
|
}
|
|
var node;
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
node = lookup.node;
|
|
var perms = '';
|
|
if (amode & 4) perms += 'r';
|
|
if (amode & 2) perms += 'w';
|
|
if (amode & 1) perms += 'x';
|
|
if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
|
|
return -ERRNO_CODES.EACCES;
|
|
}
|
|
return 0;
|
|
},doDup:function (path, flags, suggestFD) {
|
|
var suggest = FS.getStream(suggestFD);
|
|
if (suggest) FS.close(suggest);
|
|
return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
|
|
},doReadv:function (stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[(((iov)+(i*8))>>2)];
|
|
var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
|
|
var curr = FS.read(stream, HEAP8,ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
if (curr < len) break; // nothing more to read
|
|
}
|
|
return ret;
|
|
},doWritev:function (stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[(((iov)+(i*8))>>2)];
|
|
var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
|
|
var curr = FS.write(stream, HEAP8,ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
}
|
|
return ret;
|
|
},varargs:0,get:function (varargs) {
|
|
SYSCALLS.varargs += 4;
|
|
var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
|
|
return ret;
|
|
},getStr:function () {
|
|
var ret = Pointer_stringify(SYSCALLS.get());
|
|
return ret;
|
|
},getStreamFromFD:function () {
|
|
var stream = FS.getStream(SYSCALLS.get());
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return stream;
|
|
},getSocketFromFD:function () {
|
|
var socket = SOCKFS.getSocket(SYSCALLS.get());
|
|
if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return socket;
|
|
},getSocketAddress:function (allowNull) {
|
|
var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
|
|
if (allowNull && addrp === 0) return null;
|
|
var info = __read_sockaddr(addrp, addrlen);
|
|
if (info.errno) throw new FS.ErrnoError(info.errno);
|
|
info.addr = DNS.lookup_addr(info.addr) || info.addr;
|
|
return info;
|
|
},get64:function () {
|
|
var low = SYSCALLS.get(), high = SYSCALLS.get();
|
|
if (low >= 0) assert(high === 0);
|
|
else assert(high === -1);
|
|
return low;
|
|
},getZero:function () {
|
|
assert(SYSCALLS.get() === 0);
|
|
}};function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
|
|
try {
|
|
// open
|
|
var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
|
|
var stream = FS.open(pathname, flags, mode);
|
|
return stream.fd;
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___lock() {}
|
|
|
|
function ___unlock() {}
|
|
|
|
function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
|
|
try {
|
|
// close
|
|
var stream = SYSCALLS.getStreamFromFD();
|
|
FS.close(stream);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
|
|
|
|
var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_STATIC);
|
|
Module["_llvm_cttz_i32"] = _llvm_cttz_i32;
|
|
Module["___udivmoddi4"] = ___udivmoddi4;
|
|
Module["___udivdi3"] = ___udivdi3;
|
|
|
|
function _sbrk(bytes) {
|
|
// Implement a Linux-like 'memory area' for our 'process'.
|
|
// Changes the size of the memory area by |bytes|; returns the
|
|
// address of the previous top ('break') of the memory area
|
|
// We control the "dynamic" memory - DYNAMIC_BASE to DYNAMICTOP
|
|
var self = _sbrk;
|
|
if (!self.called) {
|
|
DYNAMICTOP = alignMemoryPage(DYNAMICTOP); // make sure we start out aligned
|
|
self.called = true;
|
|
assert(Runtime.dynamicAlloc);
|
|
self.alloc = Runtime.dynamicAlloc;
|
|
Runtime.dynamicAlloc = function() { abort('cannot dynamically allocate, sbrk now has control') };
|
|
}
|
|
var ret = DYNAMICTOP;
|
|
if (bytes != 0) {
|
|
var success = self.alloc(bytes);
|
|
if (!success) return -1 >>> 0; // sbrk failure code
|
|
}
|
|
return ret; // Previous break location.
|
|
}
|
|
|
|
|
|
Module["___uremdi3"] = ___uremdi3;
|
|
|
|
|
|
function _emscripten_memcpy_big(dest, src, num) {
|
|
HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
|
|
return dest;
|
|
}
|
|
Module["_memcpy"] = _memcpy;
|
|
|
|
|
|
function __exit(status) {
|
|
// void _exit(int status);
|
|
// http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
|
|
Module['exit'](status);
|
|
}function _exit(status) {
|
|
__exit(status);
|
|
}
|
|
|
|
|
|
Module["_pthread_self"] = _pthread_self;
|
|
|
|
function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
|
|
try {
|
|
// llseek
|
|
var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
|
|
var offset = offset_low;
|
|
assert(offset_high === 0);
|
|
FS.llseek(stream, offset, whence);
|
|
HEAP32[((result)>>2)]=stream.position;
|
|
if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
|
|
try {
|
|
// writev
|
|
var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
|
|
return SYSCALLS.doWritev(stream, iov, iovcnt);
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
|
|
try {
|
|
// ioctl
|
|
var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
|
|
switch (op) {
|
|
case 21505: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0;
|
|
}
|
|
case 21506: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0; // no-op, not actually adjusting terminal settings
|
|
}
|
|
case 21519: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
var argp = SYSCALLS.get();
|
|
HEAP32[((argp)>>2)]=0;
|
|
return 0;
|
|
}
|
|
case 21520: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return -ERRNO_CODES.EINVAL; // not supported
|
|
}
|
|
case 21531: {
|
|
var argp = SYSCALLS.get();
|
|
return FS.ioctl(stream, op, argp);
|
|
}
|
|
default: abort('bad ioctl syscall ' + op);
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
|
|
try {
|
|
// fcntl64
|
|
var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
|
|
switch (cmd) {
|
|
case 0: {
|
|
var arg = SYSCALLS.get();
|
|
if (arg < 0) {
|
|
return -ERRNO_CODES.EINVAL;
|
|
}
|
|
var newStream;
|
|
newStream = FS.open(stream.path, stream.flags, 0, arg);
|
|
return newStream.fd;
|
|
}
|
|
case 1:
|
|
case 2:
|
|
return 0; // FD_CLOEXEC makes no sense for a single process.
|
|
case 3:
|
|
return stream.flags;
|
|
case 4: {
|
|
var arg = SYSCALLS.get();
|
|
stream.flags |= arg;
|
|
return 0;
|
|
}
|
|
case 12:
|
|
case 12: {
|
|
var arg = SYSCALLS.get();
|
|
var offset = 0;
|
|
// We're always unlocked.
|
|
HEAP16[(((arg)+(offset))>>1)]=2;
|
|
return 0;
|
|
}
|
|
case 13:
|
|
case 14:
|
|
case 13:
|
|
case 14:
|
|
return 0; // Pretend that the locking is successful.
|
|
case 16:
|
|
case 8:
|
|
return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
|
|
case 9:
|
|
// musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
default: {
|
|
return -ERRNO_CODES.EINVAL;
|
|
}
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
|
|
try {
|
|
// readv
|
|
var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
|
|
return SYSCALLS.doReadv(stream, iov, iovcnt);
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
|
|
__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
|
|
if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
|
|
STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);
|
|
|
|
staticSealed = true; // seal the static portion of memory
|
|
|
|
STACK_MAX = STACK_BASE + TOTAL_STACK;
|
|
|
|
DYNAMIC_BASE = DYNAMICTOP = Runtime.alignMemory(STACK_MAX);
|
|
|
|
|
|
|
|
function invoke_ii(index,a1) {
|
|
try {
|
|
return Module["dynCall_ii"](index,a1);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
asm["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_iiii(index,a1,a2,a3) {
|
|
try {
|
|
return Module["dynCall_iiii"](index,a1,a2,a3);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
asm["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vi(index,a1) {
|
|
try {
|
|
Module["dynCall_vi"](index,a1);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
asm["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity };
|
|
|
|
Module.asmLibraryArg = { "abort": abort, "assert": assert, "invoke_ii": invoke_ii, "invoke_iiii": invoke_iiii, "invoke_vi": invoke_vi, "_pthread_cleanup_pop": _pthread_cleanup_pop, "___syscall221": ___syscall221, "___lock": ___lock, "_abort": _abort, "___setErrNo": ___setErrNo, "___syscall6": ___syscall6, "_sbrk": _sbrk, "___syscall140": ___syscall140, "___syscall5": ___syscall5, "_emscripten_memcpy_big": _emscripten_memcpy_big, "___syscall54": ___syscall54, "___unlock": ___unlock, "_exit": _exit, "_pthread_cleanup_push": _pthread_cleanup_push, "__exit": __exit, "___syscall145": ___syscall145, "___syscall146": ___syscall146, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "cttz_i8": cttz_i8 };
|
|
// EMSCRIPTEN_START_ASM
|
|
var asm = (function(global, env, buffer) {
|
|
'use asm';
|
|
|
|
|
|
var HEAP8 = new global.Int8Array(buffer);
|
|
var HEAP16 = new global.Int16Array(buffer);
|
|
var HEAP32 = new global.Int32Array(buffer);
|
|
var HEAPU8 = new global.Uint8Array(buffer);
|
|
var HEAPU16 = new global.Uint16Array(buffer);
|
|
var HEAPU32 = new global.Uint32Array(buffer);
|
|
var HEAPF32 = new global.Float32Array(buffer);
|
|
var HEAPF64 = new global.Float64Array(buffer);
|
|
|
|
|
|
var STACKTOP=env.STACKTOP|0;
|
|
var STACK_MAX=env.STACK_MAX|0;
|
|
var tempDoublePtr=env.tempDoublePtr|0;
|
|
var ABORT=env.ABORT|0;
|
|
var cttz_i8=env.cttz_i8|0;
|
|
|
|
var __THREW__ = 0;
|
|
var threwValue = 0;
|
|
var setjmpId = 0;
|
|
var undef = 0;
|
|
var nan = global.NaN, inf = global.Infinity;
|
|
var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0;
|
|
var tempRet0 = 0;
|
|
|
|
var Math_floor=global.Math.floor;
|
|
var Math_abs=global.Math.abs;
|
|
var Math_sqrt=global.Math.sqrt;
|
|
var Math_pow=global.Math.pow;
|
|
var Math_cos=global.Math.cos;
|
|
var Math_sin=global.Math.sin;
|
|
var Math_tan=global.Math.tan;
|
|
var Math_acos=global.Math.acos;
|
|
var Math_asin=global.Math.asin;
|
|
var Math_atan=global.Math.atan;
|
|
var Math_atan2=global.Math.atan2;
|
|
var Math_exp=global.Math.exp;
|
|
var Math_log=global.Math.log;
|
|
var Math_ceil=global.Math.ceil;
|
|
var Math_imul=global.Math.imul;
|
|
var Math_min=global.Math.min;
|
|
var Math_max=global.Math.max;
|
|
var Math_clz32=global.Math.clz32;
|
|
var abort=env.abort;
|
|
var assert=env.assert;
|
|
var invoke_ii=env.invoke_ii;
|
|
var invoke_iiii=env.invoke_iiii;
|
|
var invoke_vi=env.invoke_vi;
|
|
var _pthread_cleanup_pop=env._pthread_cleanup_pop;
|
|
var ___syscall221=env.___syscall221;
|
|
var ___lock=env.___lock;
|
|
var _abort=env._abort;
|
|
var ___setErrNo=env.___setErrNo;
|
|
var ___syscall6=env.___syscall6;
|
|
var _sbrk=env._sbrk;
|
|
var ___syscall140=env.___syscall140;
|
|
var ___syscall5=env.___syscall5;
|
|
var _emscripten_memcpy_big=env._emscripten_memcpy_big;
|
|
var ___syscall54=env.___syscall54;
|
|
var ___unlock=env.___unlock;
|
|
var _exit=env._exit;
|
|
var _pthread_cleanup_push=env._pthread_cleanup_push;
|
|
var __exit=env.__exit;
|
|
var ___syscall145=env.___syscall145;
|
|
var ___syscall146=env.___syscall146;
|
|
var tempFloat = 0.0;
|
|
|
|
// EMSCRIPTEN_START_FUNCS
|
|
|
|
function stackAlloc(size) {
|
|
size = size|0;
|
|
var ret = 0;
|
|
ret = STACKTOP;
|
|
STACKTOP = (STACKTOP + size)|0;
|
|
STACKTOP = (STACKTOP + 15)&-16;
|
|
|
|
return ret|0;
|
|
}
|
|
function stackSave() {
|
|
return STACKTOP|0;
|
|
}
|
|
function stackRestore(top) {
|
|
top = top|0;
|
|
STACKTOP = top;
|
|
}
|
|
function establishStackSpace(stackBase, stackMax) {
|
|
stackBase = stackBase|0;
|
|
stackMax = stackMax|0;
|
|
STACKTOP = stackBase;
|
|
STACK_MAX = stackMax;
|
|
}
|
|
|
|
function setThrew(threw, value) {
|
|
threw = threw|0;
|
|
value = value|0;
|
|
if ((__THREW__|0) == 0) {
|
|
__THREW__ = threw;
|
|
threwValue = value;
|
|
}
|
|
}
|
|
|
|
function setTempRet0(value) {
|
|
value = value|0;
|
|
tempRet0 = value;
|
|
}
|
|
function getTempRet0() {
|
|
return tempRet0|0;
|
|
}
|
|
|
|
function _id_match($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
|
|
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$3 = sp + 12|0;
|
|
$4 = sp + 8|0;
|
|
$5 = sp + 4|0;
|
|
$6 = sp;
|
|
HEAP32[$4>>2] = $0;
|
|
HEAP32[$5>>2] = $1;
|
|
HEAP32[$6>>2] = $2;
|
|
$7 = HEAP32[$5>>2]|0;
|
|
$8 = HEAP32[$6>>2]|0;
|
|
$9 = HEAP8[$8>>0]|0;
|
|
$10 = $9 << 24 >> 24;
|
|
$11 = ($7|0)==($10|0);
|
|
if (!($11)) {
|
|
HEAP32[$3>>2] = 0;
|
|
$29 = HEAP32[$3>>2]|0;
|
|
STACKTOP = sp;return ($29|0);
|
|
}
|
|
$12 = HEAP32[$5>>2]|0;
|
|
$13 = ($12|0)>(16);
|
|
if ($13) {
|
|
HEAP32[$5>>2] = 16;
|
|
}
|
|
while(1) {
|
|
$14 = HEAP32[$5>>2]|0;
|
|
$15 = (($14) + -1)|0;
|
|
HEAP32[$5>>2] = $15;
|
|
$16 = ($14|0)!=(0);
|
|
if (!($16)) {
|
|
label = 7;
|
|
break;
|
|
}
|
|
$17 = HEAP32[$5>>2]|0;
|
|
$18 = HEAP32[$4>>2]|0;
|
|
$19 = (($18) + ($17)|0);
|
|
$20 = HEAP8[$19>>0]|0;
|
|
$21 = $20 << 24 >> 24;
|
|
$22 = HEAP32[$5>>2]|0;
|
|
$23 = (1 + ($22))|0;
|
|
$24 = HEAP32[$6>>2]|0;
|
|
$25 = (($24) + ($23)|0);
|
|
$26 = HEAP8[$25>>0]|0;
|
|
$27 = $26 << 24 >> 24;
|
|
$28 = ($21|0)!=($27|0);
|
|
if ($28) {
|
|
label = 6;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 6) {
|
|
HEAP32[$3>>2] = 0;
|
|
$29 = HEAP32[$3>>2]|0;
|
|
STACKTOP = sp;return ($29|0);
|
|
}
|
|
else if ((label|0) == 7) {
|
|
HEAP32[$3>>2] = 1;
|
|
$29 = HEAP32[$3>>2]|0;
|
|
STACKTOP = sp;return ($29|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _idconst_lookup($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = 0;
|
|
while(1) {
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = HEAP32[1817]|0;
|
|
$8 = ($6|0)<($7|0);
|
|
if (!($8)) {
|
|
label = 6;
|
|
break;
|
|
}
|
|
$9 = HEAP32[$3>>2]|0;
|
|
$10 = HEAP32[$4>>2]|0;
|
|
$11 = HEAP32[$5>>2]|0;
|
|
$12 = (37860 + (($11*33)|0)|0);
|
|
$13 = (_id_match($9,$10,$12)|0);
|
|
$14 = ($13|0)!=(0);
|
|
$15 = HEAP32[$5>>2]|0;
|
|
if ($14) {
|
|
label = 4;
|
|
break;
|
|
}
|
|
$16 = (($15) + 1)|0;
|
|
HEAP32[$5>>2] = $16;
|
|
}
|
|
if ((label|0) == 4) {
|
|
HEAP32[$2>>2] = $15;
|
|
$17 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
else if ((label|0) == 6) {
|
|
HEAP32[$2>>2] = -1;
|
|
$17 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _idlocal_lookup($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = 0;
|
|
while(1) {
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = HEAP32[1818]|0;
|
|
$8 = ($6|0)<($7|0);
|
|
if (!($8)) {
|
|
label = 6;
|
|
break;
|
|
}
|
|
$9 = HEAP32[$3>>2]|0;
|
|
$10 = HEAP32[$4>>2]|0;
|
|
$11 = HEAP32[$5>>2]|0;
|
|
$12 = (71652 + (($11*33)|0)|0);
|
|
$13 = (_id_match($9,$10,$12)|0);
|
|
$14 = ($13|0)!=(0);
|
|
$15 = HEAP32[$5>>2]|0;
|
|
if ($14) {
|
|
label = 4;
|
|
break;
|
|
}
|
|
$16 = (($15) + 1)|0;
|
|
HEAP32[$5>>2] = $16;
|
|
}
|
|
if ((label|0) == 4) {
|
|
HEAP32[$2>>2] = $15;
|
|
$17 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
else if ((label|0) == 6) {
|
|
HEAP32[$2>>2] = -1;
|
|
$17 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _idglobal_lookup($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = 0;
|
|
while(1) {
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = HEAP32[1819]|0;
|
|
$8 = ($6|0)<($7|0);
|
|
if (!($8)) {
|
|
label = 6;
|
|
break;
|
|
}
|
|
$9 = HEAP32[$3>>2]|0;
|
|
$10 = HEAP32[$4>>2]|0;
|
|
$11 = HEAP32[$5>>2]|0;
|
|
$12 = (75876 + (($11*33)|0)|0);
|
|
$13 = (_id_match($9,$10,$12)|0);
|
|
$14 = ($13|0)!=(0);
|
|
$15 = HEAP32[$5>>2]|0;
|
|
if ($14) {
|
|
label = 4;
|
|
break;
|
|
}
|
|
$16 = (($15) + 1)|0;
|
|
HEAP32[$5>>2] = $16;
|
|
}
|
|
if ((label|0) == 4) {
|
|
HEAP32[$2>>2] = $15;
|
|
$17 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
else if ((label|0) == 6) {
|
|
HEAP32[$2>>2] = -1;
|
|
$17 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _idconst_add($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
|
|
var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 16|0;
|
|
$4 = sp + 12|0;
|
|
$5 = sp + 8|0;
|
|
$6 = sp + 4|0;
|
|
$7 = sp + 20|0;
|
|
HEAP32[$4>>2] = $0;
|
|
HEAP32[$5>>2] = $1;
|
|
HEAP32[$6>>2] = $2;
|
|
$8 = HEAP32[$5>>2]|0;
|
|
$9 = HEAP32[$4>>2]|0;
|
|
$10 = (($9) + ($8)|0);
|
|
$11 = HEAP8[$10>>0]|0;
|
|
HEAP8[$7>>0] = $11;
|
|
$12 = HEAP32[1817]|0;
|
|
$13 = ($12|0)>(1024);
|
|
if ($13) {
|
|
(_printf(500,$vararg_buffer)|0);
|
|
HEAP32[$3>>2] = 0;
|
|
$46 = HEAP32[$3>>2]|0;
|
|
STACKTOP = sp;return ($46|0);
|
|
}
|
|
$14 = HEAP32[$5>>2]|0;
|
|
$15 = HEAP32[$4>>2]|0;
|
|
$16 = (($15) + ($14)|0);
|
|
HEAP8[$16>>0] = 0;
|
|
$17 = HEAP32[$4>>2]|0;
|
|
$18 = HEAP32[$6>>2]|0;
|
|
_emit_idconst($17,$18);
|
|
$19 = HEAP8[$7>>0]|0;
|
|
$20 = HEAP32[$5>>2]|0;
|
|
$21 = HEAP32[$4>>2]|0;
|
|
$22 = (($21) + ($20)|0);
|
|
HEAP8[$22>>0] = $19;
|
|
$23 = HEAP32[$5>>2]|0;
|
|
$24 = $23&255;
|
|
$25 = HEAP32[1817]|0;
|
|
$26 = (37860 + (($25*33)|0)|0);
|
|
HEAP8[$26>>0] = $24;
|
|
$27 = HEAP32[$5>>2]|0;
|
|
$28 = ($27|0)>(32);
|
|
if ($28) {
|
|
HEAP32[$5>>2] = 32;
|
|
}
|
|
while(1) {
|
|
$29 = HEAP32[$5>>2]|0;
|
|
$30 = (($29) + -1)|0;
|
|
HEAP32[$5>>2] = $30;
|
|
$31 = ($29|0)!=(0);
|
|
if (!($31)) {
|
|
break;
|
|
}
|
|
$32 = HEAP32[$5>>2]|0;
|
|
$33 = HEAP32[$4>>2]|0;
|
|
$34 = (($33) + ($32)|0);
|
|
$35 = HEAP8[$34>>0]|0;
|
|
$36 = HEAP32[$5>>2]|0;
|
|
$37 = (1 + ($36))|0;
|
|
$38 = HEAP32[1817]|0;
|
|
$39 = (37860 + (($38*33)|0)|0);
|
|
$40 = (($39) + ($37)|0);
|
|
HEAP8[$40>>0] = $35;
|
|
}
|
|
$41 = HEAP32[$6>>2]|0;
|
|
$42 = HEAP32[1817]|0;
|
|
$43 = (7280 + ($42<<2)|0);
|
|
HEAP32[$43>>2] = $41;
|
|
$44 = HEAP32[1817]|0;
|
|
$45 = (($44) + 1)|0;
|
|
HEAP32[1817] = $45;
|
|
HEAP32[$3>>2] = 1;
|
|
$46 = HEAP32[$3>>2]|0;
|
|
STACKTOP = sp;return ($46|0);
|
|
}
|
|
function _emit_idconst($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = HEAP32[$2>>2]|0;
|
|
$5 = HEAP32[$3>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $4;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $5;
|
|
(_printf(1814,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _idlocal_add($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
|
|
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
|
|
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $7 = 0, $8 = 0, $9 = 0;
|
|
var $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer = sp;
|
|
$4 = sp + 20|0;
|
|
$5 = sp + 16|0;
|
|
$6 = sp + 12|0;
|
|
$7 = sp + 8|0;
|
|
$8 = sp + 4|0;
|
|
$9 = sp + 24|0;
|
|
HEAP32[$5>>2] = $0;
|
|
HEAP32[$6>>2] = $1;
|
|
HEAP32[$7>>2] = $2;
|
|
HEAP32[$8>>2] = $3;
|
|
$10 = HEAP32[$6>>2]|0;
|
|
$11 = HEAP32[$5>>2]|0;
|
|
$12 = (($11) + ($10)|0);
|
|
$13 = HEAP8[$12>>0]|0;
|
|
HEAP8[$9>>0] = $13;
|
|
$14 = HEAP32[2844]|0;
|
|
$15 = ($14|0)>(255);
|
|
if ($15) {
|
|
(_printf(525,$vararg_buffer)|0);
|
|
HEAP32[$4>>2] = 0;
|
|
$63 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($63|0);
|
|
}
|
|
$16 = HEAP32[$5>>2]|0;
|
|
$17 = HEAP32[$6>>2]|0;
|
|
$18 = (_idconst_lookup($16,$17)|0);
|
|
$19 = ($18|0)>(0);
|
|
if ($19) {
|
|
_parse_error(555);
|
|
HEAP32[$4>>2] = 0;
|
|
$63 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($63|0);
|
|
}
|
|
$20 = HEAP32[$5>>2]|0;
|
|
$21 = HEAP32[$6>>2]|0;
|
|
$22 = (_idlocal_lookup($20,$21)|0);
|
|
$23 = ($22|0)>(0);
|
|
if ($23) {
|
|
_parse_error(582);
|
|
HEAP32[$4>>2] = 0;
|
|
$63 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($63|0);
|
|
}
|
|
$24 = HEAP32[$6>>2]|0;
|
|
$25 = HEAP32[$5>>2]|0;
|
|
$26 = (($25) + ($24)|0);
|
|
HEAP8[$26>>0] = 0;
|
|
$27 = HEAP32[$5>>2]|0;
|
|
$28 = HEAP32[2844]|0;
|
|
_emit_idlocal($27,$28);
|
|
$29 = HEAP8[$9>>0]|0;
|
|
$30 = HEAP32[$6>>2]|0;
|
|
$31 = HEAP32[$5>>2]|0;
|
|
$32 = (($31) + ($30)|0);
|
|
HEAP8[$32>>0] = $29;
|
|
$33 = HEAP32[$6>>2]|0;
|
|
$34 = $33&255;
|
|
$35 = HEAP32[1818]|0;
|
|
$36 = (71652 + (($35*33)|0)|0);
|
|
HEAP8[$36>>0] = $34;
|
|
$37 = HEAP32[$6>>2]|0;
|
|
$38 = ($37|0)>(32);
|
|
if ($38) {
|
|
HEAP32[$6>>2] = 32;
|
|
}
|
|
while(1) {
|
|
$39 = HEAP32[$6>>2]|0;
|
|
$40 = (($39) + -1)|0;
|
|
HEAP32[$6>>2] = $40;
|
|
$41 = ($39|0)!=(0);
|
|
if (!($41)) {
|
|
break;
|
|
}
|
|
$42 = HEAP32[$6>>2]|0;
|
|
$43 = HEAP32[$5>>2]|0;
|
|
$44 = (($43) + ($42)|0);
|
|
$45 = HEAP8[$44>>0]|0;
|
|
$46 = HEAP32[$6>>2]|0;
|
|
$47 = (1 + ($46))|0;
|
|
$48 = HEAP32[1818]|0;
|
|
$49 = (71652 + (($48*33)|0)|0);
|
|
$50 = (($49) + ($47)|0);
|
|
HEAP8[$50>>0] = $45;
|
|
}
|
|
$51 = HEAP32[$7>>2]|0;
|
|
$52 = $51 | 64;
|
|
$53 = HEAP32[1818]|0;
|
|
$54 = (11380 + ($53<<2)|0);
|
|
HEAP32[$54>>2] = $52;
|
|
$55 = HEAP32[2844]|0;
|
|
$56 = HEAP32[1818]|0;
|
|
$57 = (11892 + ($56<<2)|0);
|
|
HEAP32[$57>>2] = $55;
|
|
$58 = HEAP32[$8>>2]|0;
|
|
$59 = HEAP32[2844]|0;
|
|
$60 = (($59) + ($58))|0;
|
|
HEAP32[2844] = $60;
|
|
$61 = HEAP32[1818]|0;
|
|
$62 = (($61) + 1)|0;
|
|
HEAP32[1818] = $62;
|
|
HEAP32[$4>>2] = 1;
|
|
$63 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($63|0);
|
|
}
|
|
function _emit_idlocal($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = HEAP32[$2>>2]|0;
|
|
$5 = HEAP32[$3>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $4;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $5;
|
|
(_printf(1736,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _idglobal_add($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
|
|
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
|
|
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
|
|
var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_ptr3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$4 = sp + 32|0;
|
|
$5 = sp + 28|0;
|
|
$6 = sp + 24|0;
|
|
$7 = sp + 20|0;
|
|
$8 = sp + 16|0;
|
|
$9 = sp + 36|0;
|
|
HEAP32[$5>>2] = $0;
|
|
HEAP32[$6>>2] = $1;
|
|
HEAP32[$7>>2] = $2;
|
|
HEAP32[$8>>2] = $3;
|
|
$10 = HEAP32[$6>>2]|0;
|
|
$11 = HEAP32[$5>>2]|0;
|
|
$12 = (($11) + ($10)|0);
|
|
$13 = HEAP8[$12>>0]|0;
|
|
HEAP8[$9>>0] = $13;
|
|
$14 = HEAP32[1819]|0;
|
|
$15 = ($14|0)>(1024);
|
|
if ($15) {
|
|
(_printf(611,$vararg_buffer)|0);
|
|
HEAP32[$4>>2] = 0;
|
|
$71 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($71|0);
|
|
}
|
|
$16 = HEAP32[$5>>2]|0;
|
|
$17 = HEAP32[$6>>2]|0;
|
|
$18 = (_idconst_lookup($16,$17)|0);
|
|
$19 = ($18|0)>(0);
|
|
if ($19) {
|
|
_parse_error(643);
|
|
HEAP32[$4>>2] = 0;
|
|
$71 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($71|0);
|
|
}
|
|
$20 = HEAP32[$5>>2]|0;
|
|
$21 = HEAP32[$6>>2]|0;
|
|
$22 = (_idglobal_lookup($20,$21)|0);
|
|
$23 = ($22|0)>(0);
|
|
if ($23) {
|
|
_parse_error(671);
|
|
HEAP32[$4>>2] = 0;
|
|
$71 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($71|0);
|
|
}
|
|
$24 = HEAP32[$6>>2]|0;
|
|
$25 = HEAP32[$5>>2]|0;
|
|
$26 = (($25) + ($24)|0);
|
|
HEAP8[$26>>0] = 0;
|
|
$27 = HEAP8[$9>>0]|0;
|
|
$28 = HEAP32[$6>>2]|0;
|
|
$29 = HEAP32[$5>>2]|0;
|
|
$30 = (($29) + ($28)|0);
|
|
HEAP8[$30>>0] = $27;
|
|
$31 = HEAP32[$6>>2]|0;
|
|
$32 = $31&255;
|
|
$33 = HEAP32[1819]|0;
|
|
$34 = (75876 + (($33*33)|0)|0);
|
|
HEAP8[$34>>0] = $32;
|
|
$35 = HEAP32[$6>>2]|0;
|
|
$36 = ($35|0)>(32);
|
|
if ($36) {
|
|
HEAP32[$6>>2] = 32;
|
|
}
|
|
while(1) {
|
|
$37 = HEAP32[$6>>2]|0;
|
|
$38 = (($37) + -1)|0;
|
|
HEAP32[$6>>2] = $38;
|
|
$39 = ($37|0)!=(0);
|
|
if (!($39)) {
|
|
break;
|
|
}
|
|
$40 = HEAP32[$6>>2]|0;
|
|
$41 = HEAP32[$5>>2]|0;
|
|
$42 = (($41) + ($40)|0);
|
|
$43 = HEAP8[$42>>0]|0;
|
|
$44 = HEAP32[$6>>2]|0;
|
|
$45 = (1 + ($44))|0;
|
|
$46 = HEAP32[1819]|0;
|
|
$47 = (75876 + (($46*33)|0)|0);
|
|
$48 = (($47) + ($45)|0);
|
|
HEAP8[$48>>0] = $43;
|
|
}
|
|
$49 = HEAP32[$7>>2]|0;
|
|
$50 = HEAP32[1819]|0;
|
|
$51 = (12404 + ($50<<2)|0);
|
|
HEAP32[$51>>2] = $49;
|
|
$52 = HEAP32[$7>>2]|0;
|
|
$53 = $52 & 128;
|
|
$54 = ($53|0)!=(0);
|
|
$55 = HEAP32[1819]|0;
|
|
if ($54) {
|
|
$63 = (75876 + (($55*33)|0)|0);
|
|
$64 = ((($63)) + 1|0);
|
|
$65 = HEAP32[5149]|0;
|
|
HEAP32[$vararg_buffer1>>2] = $64;
|
|
$vararg_ptr3 = ((($vararg_buffer1)) + 4|0);
|
|
HEAP32[$vararg_ptr3>>2] = $65;
|
|
(_printf(701,$vararg_buffer1)|0);
|
|
$66 = HEAP32[5149]|0;
|
|
$67 = (($66) + 1)|0;
|
|
HEAP32[5149] = $67;
|
|
$68 = HEAP32[1819]|0;
|
|
$69 = (($68) + 1)|0;
|
|
HEAP32[1819] = $69;
|
|
$70 = (16500 + ($68<<2)|0);
|
|
HEAP32[$70>>2] = $66;
|
|
} else {
|
|
$56 = HEAP32[$8>>2]|0;
|
|
$57 = HEAP32[$5>>2]|0;
|
|
_emit_idglobal($55,$56,$57);
|
|
$58 = HEAP32[1819]|0;
|
|
$59 = HEAP32[1819]|0;
|
|
$60 = (16500 + ($59<<2)|0);
|
|
HEAP32[$60>>2] = $58;
|
|
$61 = HEAP32[1819]|0;
|
|
$62 = (($61) + 1)|0;
|
|
HEAP32[1819] = $62;
|
|
}
|
|
HEAP32[$4>>2] = 1;
|
|
$71 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($71|0);
|
|
}
|
|
function _emit_idglobal($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 44|0;
|
|
$4 = sp + 40|0;
|
|
$5 = sp + 36|0;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$6 = HEAP32[$4>>2]|0;
|
|
$7 = ($6|0)==(0);
|
|
$8 = HEAP32[$3>>2]|0;
|
|
$9 = HEAP8[861]|0;
|
|
$10 = $9 << 24 >> 24;
|
|
if ($7) {
|
|
$11 = HEAP32[$5>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $8;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $10;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $11;
|
|
(_printf(1755,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
$12 = HEAP32[5]|0;
|
|
$13 = HEAP32[$4>>2]|0;
|
|
$14 = HEAP32[$5>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $8;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $10;
|
|
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
|
|
HEAP32[$vararg_ptr7>>2] = $12;
|
|
$vararg_ptr8 = ((($vararg_buffer3)) + 12|0);
|
|
HEAP32[$vararg_ptr8>>2] = $13;
|
|
$vararg_ptr9 = ((($vararg_buffer3)) + 16|0);
|
|
HEAP32[$vararg_ptr9>>2] = $14;
|
|
(_printf(1774,$vararg_buffer3)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _id_add($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$4 = sp + 12|0;
|
|
$5 = sp + 8|0;
|
|
$6 = sp + 4|0;
|
|
$7 = sp;
|
|
HEAP32[$4>>2] = $0;
|
|
HEAP32[$5>>2] = $1;
|
|
HEAP32[$6>>2] = $2;
|
|
HEAP32[$7>>2] = $3;
|
|
$8 = HEAP32[$6>>2]|0;
|
|
$9 = $8 & 64;
|
|
$10 = ($9|0)!=(0);
|
|
$11 = HEAP32[$4>>2]|0;
|
|
$12 = HEAP32[$5>>2]|0;
|
|
$13 = HEAP32[$6>>2]|0;
|
|
$14 = HEAP32[$7>>2]|0;
|
|
if ($10) {
|
|
$15 = (_idlocal_add($11,$12,$13,$14)|0);
|
|
$17 = $15;
|
|
STACKTOP = sp;return ($17|0);
|
|
} else {
|
|
$16 = (_idglobal_add($11,$12,$13,$14)|0);
|
|
$17 = $16;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _idfunc_add($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
|
|
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_ptr3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$4 = sp + 32|0;
|
|
$5 = sp + 28|0;
|
|
$6 = sp + 24|0;
|
|
$7 = sp + 20|0;
|
|
$8 = sp + 16|0;
|
|
HEAP32[$5>>2] = $0;
|
|
HEAP32[$6>>2] = $1;
|
|
HEAP32[$7>>2] = $2;
|
|
HEAP32[$8>>2] = $3;
|
|
$9 = HEAP32[1819]|0;
|
|
$10 = ($9|0)>(1024);
|
|
if ($10) {
|
|
(_printf(611,$vararg_buffer)|0);
|
|
HEAP32[$4>>2] = 0;
|
|
$44 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($44|0);
|
|
}
|
|
$11 = HEAP32[$6>>2]|0;
|
|
$12 = $11&255;
|
|
$13 = HEAP32[1819]|0;
|
|
$14 = (75876 + (($13*33)|0)|0);
|
|
HEAP8[$14>>0] = $12;
|
|
$15 = HEAP32[$6>>2]|0;
|
|
$16 = ($15|0)>(32);
|
|
if ($16) {
|
|
HEAP32[$6>>2] = 32;
|
|
}
|
|
while(1) {
|
|
$17 = HEAP32[$6>>2]|0;
|
|
$18 = (($17) + -1)|0;
|
|
HEAP32[$6>>2] = $18;
|
|
$19 = ($17|0)!=(0);
|
|
if (!($19)) {
|
|
break;
|
|
}
|
|
$20 = HEAP32[$6>>2]|0;
|
|
$21 = HEAP32[$5>>2]|0;
|
|
$22 = (($21) + ($20)|0);
|
|
$23 = HEAP8[$22>>0]|0;
|
|
$24 = HEAP32[$6>>2]|0;
|
|
$25 = (1 + ($24))|0;
|
|
$26 = HEAP32[1819]|0;
|
|
$27 = (75876 + (($26*33)|0)|0);
|
|
$28 = (($27) + ($25)|0);
|
|
HEAP8[$28>>0] = $23;
|
|
}
|
|
$29 = HEAP32[$7>>2]|0;
|
|
$30 = HEAP32[1819]|0;
|
|
$31 = (12404 + ($30<<2)|0);
|
|
HEAP32[$31>>2] = $29;
|
|
$32 = HEAP32[$8>>2]|0;
|
|
$33 = HEAP32[1819]|0;
|
|
$34 = (($33) + 1)|0;
|
|
HEAP32[1819] = $34;
|
|
$35 = (16500 + ($33<<2)|0);
|
|
HEAP32[$35>>2] = $32;
|
|
$36 = HEAP32[$7>>2]|0;
|
|
$37 = $36 & 128;
|
|
$38 = ($37|0)!=(0);
|
|
if ($38) {
|
|
$39 = HEAP32[1819]|0;
|
|
$40 = (($39) - 1)|0;
|
|
$41 = (75876 + (($40*33)|0)|0);
|
|
$42 = ((($41)) + 1|0);
|
|
$43 = HEAP32[$8>>2]|0;
|
|
HEAP32[$vararg_buffer1>>2] = $42;
|
|
$vararg_ptr3 = ((($vararg_buffer1)) + 4|0);
|
|
HEAP32[$vararg_ptr3>>2] = $43;
|
|
(_printf(701,$vararg_buffer1)|0);
|
|
}
|
|
HEAP32[$4>>2] = 1;
|
|
$44 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($44|0);
|
|
}
|
|
function _idfunc_set($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $4 = 0, $5 = 0, $6 = 0;
|
|
var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$4 = sp + 20|0;
|
|
$5 = sp + 16|0;
|
|
$6 = sp + 12|0;
|
|
$7 = sp + 8|0;
|
|
$8 = sp + 4|0;
|
|
$9 = sp;
|
|
HEAP32[$5>>2] = $0;
|
|
HEAP32[$6>>2] = $1;
|
|
HEAP32[$7>>2] = $2;
|
|
HEAP32[$8>>2] = $3;
|
|
$10 = HEAP32[$5>>2]|0;
|
|
$11 = HEAP32[$6>>2]|0;
|
|
$12 = (_idglobal_lookup($10,$11)|0);
|
|
HEAP32[$9>>2] = $12;
|
|
$13 = ($12|0)>=(0);
|
|
if ($13) {
|
|
$14 = HEAP32[$9>>2]|0;
|
|
$15 = (12404 + ($14<<2)|0);
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $16 & 8216;
|
|
$18 = ($17|0)!=(0);
|
|
if ($18) {
|
|
$19 = HEAP32[$8>>2]|0;
|
|
$20 = HEAP32[$9>>2]|0;
|
|
$21 = (16500 + ($20<<2)|0);
|
|
HEAP32[$21>>2] = $19;
|
|
$22 = HEAP32[$7>>2]|0;
|
|
$23 = HEAP32[$9>>2]|0;
|
|
$24 = (12404 + ($23<<2)|0);
|
|
HEAP32[$24>>2] = $22;
|
|
$25 = HEAP32[$7>>2]|0;
|
|
HEAP32[$4>>2] = $25;
|
|
$26 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($26|0);
|
|
}
|
|
}
|
|
_parse_error(721);
|
|
HEAP32[$4>>2] = 0;
|
|
$26 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($26|0);
|
|
}
|
|
function _idglobal_size($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$6 = HEAP32[$4>>2]|0;
|
|
$7 = HEAP32[$5>>2]|0;
|
|
$8 = ($6|0)>($7|0);
|
|
$9 = HEAP32[$4>>2]|0;
|
|
if ($8) {
|
|
$10 = HEAP32[$5>>2]|0;
|
|
$11 = (($9) - ($10))|0;
|
|
(_emit_data(0,0,0,$11)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
$12 = ($9|0)!=(0);
|
|
if (!($12)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$13 = HEAP32[$4>>2]|0;
|
|
(_emit_data(0,0,0,$13)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_data($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
|
|
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
|
|
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
|
|
var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $9 = 0, $vararg_buffer = 0;
|
|
var $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer15 = 0, $vararg_buffer2 = 0, $vararg_buffer21 = 0, $vararg_buffer27 = 0, $vararg_buffer33 = 0, $vararg_buffer39 = 0, $vararg_buffer43 = 0, $vararg_buffer6 = 0, $vararg_ptr1 = 0, $vararg_ptr18 = 0, $vararg_ptr19 = 0, $vararg_ptr20 = 0, $vararg_ptr24 = 0, $vararg_ptr25 = 0, $vararg_ptr26 = 0, $vararg_ptr30 = 0, $vararg_ptr31 = 0, $vararg_ptr32 = 0;
|
|
var $vararg_ptr36 = 0, $vararg_ptr37 = 0, $vararg_ptr38 = 0, $vararg_ptr42 = 0, $vararg_ptr46 = 0, $vararg_ptr5 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 160|0;
|
|
$vararg_buffer43 = sp + 112|0;
|
|
$vararg_buffer39 = sp + 104|0;
|
|
$vararg_buffer33 = sp + 88|0;
|
|
$vararg_buffer27 = sp + 72|0;
|
|
$vararg_buffer21 = sp + 56|0;
|
|
$vararg_buffer15 = sp + 40|0;
|
|
$vararg_buffer13 = sp + 32|0;
|
|
$vararg_buffer10 = sp + 24|0;
|
|
$vararg_buffer6 = sp + 16|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$4 = sp + 152|0;
|
|
$5 = sp + 148|0;
|
|
$6 = sp + 144|0;
|
|
$7 = sp + 140|0;
|
|
$8 = sp + 136|0;
|
|
$9 = sp + 132|0;
|
|
$10 = sp + 128|0;
|
|
$11 = sp + 124|0;
|
|
$12 = sp + 120|0;
|
|
HEAP32[$4>>2] = $0;
|
|
HEAP32[$5>>2] = $1;
|
|
HEAP32[$6>>2] = $2;
|
|
HEAP32[$7>>2] = $3;
|
|
$13 = HEAP32[$5>>2]|0;
|
|
$14 = ($13|0)==(0);
|
|
if ($14) {
|
|
$15 = HEAP32[$7>>2]|0;
|
|
HEAP32[$8>>2] = $15;
|
|
$16 = HEAP32[5]|0;
|
|
$17 = HEAP32[$7>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $16;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $17;
|
|
(_printf(1830,$vararg_buffer)|0);
|
|
$82 = HEAP32[$8>>2]|0;
|
|
STACKTOP = sp;return ($82|0);
|
|
}
|
|
$18 = HEAP32[$5>>2]|0;
|
|
$19 = $18 & 1024;
|
|
$20 = ($19|0)!=(0);
|
|
if ($20) {
|
|
$21 = HEAP32[$7>>2]|0;
|
|
HEAP32[$8>>2] = $21;
|
|
$22 = HEAP32[$6>>2]|0;
|
|
$23 = $22;
|
|
HEAP32[$10>>2] = $23;
|
|
$24 = HEAP32[3]|0;
|
|
$25 = HEAP32[$7>>2]|0;
|
|
$26 = (($25) + -1)|0;
|
|
HEAP32[$7>>2] = $26;
|
|
HEAP32[$vararg_buffer2>>2] = $24;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $26;
|
|
(_printf(1830,$vararg_buffer2)|0);
|
|
while(1) {
|
|
$27 = HEAP32[$7>>2]|0;
|
|
$28 = (($27) + -1)|0;
|
|
HEAP32[$7>>2] = $28;
|
|
$29 = ($27|0)>(0);
|
|
if (!($29)) {
|
|
break;
|
|
}
|
|
$30 = HEAP32[3]|0;
|
|
$31 = HEAP32[$10>>2]|0;
|
|
$32 = ((($31)) + 1|0);
|
|
HEAP32[$10>>2] = $32;
|
|
$33 = HEAP8[$31>>0]|0;
|
|
$34 = $33 << 24 >> 24;
|
|
HEAP32[$vararg_buffer6>>2] = $30;
|
|
$vararg_ptr9 = ((($vararg_buffer6)) + 4|0);
|
|
HEAP32[$vararg_ptr9>>2] = $34;
|
|
(_printf(824,$vararg_buffer6)|0);
|
|
HEAP32[$9>>2] = 0;
|
|
while(1) {
|
|
$35 = HEAP32[$9>>2]|0;
|
|
$36 = ($35|0)<(7);
|
|
if (!($36)) {
|
|
break;
|
|
}
|
|
$37 = HEAP32[$7>>2]|0;
|
|
$38 = (($37) + -1)|0;
|
|
HEAP32[$7>>2] = $38;
|
|
$39 = ($37|0)>(0);
|
|
if (!($39)) {
|
|
break;
|
|
}
|
|
$40 = HEAP32[$10>>2]|0;
|
|
$41 = ((($40)) + 1|0);
|
|
HEAP32[$10>>2] = $41;
|
|
$42 = HEAP8[$40>>0]|0;
|
|
$43 = $42 << 24 >> 24;
|
|
HEAP32[$vararg_buffer10>>2] = $43;
|
|
(_printf(834,$vararg_buffer10)|0);
|
|
$44 = HEAP32[$9>>2]|0;
|
|
$45 = (($44) + 1)|0;
|
|
HEAP32[$9>>2] = $45;
|
|
}
|
|
(_printf(841,$vararg_buffer13)|0);
|
|
}
|
|
$82 = HEAP32[$8>>2]|0;
|
|
STACKTOP = sp;return ($82|0);
|
|
}
|
|
$46 = HEAP32[$5>>2]|0;
|
|
$47 = $46 & 8350;
|
|
$48 = ($47|0)!=(0);
|
|
$49 = HEAP32[$4>>2]|0;
|
|
$50 = $49 & 2;
|
|
$51 = ($50|0)!=(0);
|
|
if (!($48)) {
|
|
if ($51) {
|
|
HEAP32[$8>>2] = 2;
|
|
$76 = HEAP32[4]|0;
|
|
$77 = HEAP32[$6>>2]|0;
|
|
$78 = $77 & 65535;
|
|
HEAP32[$vararg_buffer39>>2] = $76;
|
|
$vararg_ptr42 = ((($vararg_buffer39)) + 4|0);
|
|
HEAP32[$vararg_ptr42>>2] = $78;
|
|
(_printf(1879,$vararg_buffer39)|0);
|
|
$82 = HEAP32[$8>>2]|0;
|
|
STACKTOP = sp;return ($82|0);
|
|
} else {
|
|
HEAP32[$8>>2] = 1;
|
|
$79 = HEAP32[3]|0;
|
|
$80 = HEAP32[$6>>2]|0;
|
|
$81 = $80 & 255;
|
|
HEAP32[$vararg_buffer43>>2] = $79;
|
|
$vararg_ptr46 = ((($vararg_buffer43)) + 4|0);
|
|
HEAP32[$vararg_ptr46>>2] = $81;
|
|
(_printf(1891,$vararg_buffer43)|0);
|
|
$82 = HEAP32[$8>>2]|0;
|
|
STACKTOP = sp;return ($82|0);
|
|
}
|
|
}
|
|
$52 = HEAP32[$6>>2]|0;
|
|
$53 = HEAP32[$5>>2]|0;
|
|
if ($51) {
|
|
$54 = (_fixup_new($52,$53,128)|0);
|
|
HEAP32[$11>>2] = $54;
|
|
HEAP32[$8>>2] = 2;
|
|
$55 = HEAP32[$5>>2]|0;
|
|
$56 = $55 & 128;
|
|
$57 = ($56|0)!=(0);
|
|
$58 = HEAP32[$11>>2]|0;
|
|
$59 = HEAP8[861]|0;
|
|
$60 = $59 << 24 >> 24;
|
|
$61 = HEAP32[4]|0;
|
|
$62 = HEAP32[$6>>2]|0;
|
|
$63 = HEAP32[$5>>2]|0;
|
|
$64 = (_tag_string($62,$63)|0);
|
|
if ($57) {
|
|
HEAP32[$vararg_buffer15>>2] = $58;
|
|
$vararg_ptr18 = ((($vararg_buffer15)) + 4|0);
|
|
HEAP32[$vararg_ptr18>>2] = $60;
|
|
$vararg_ptr19 = ((($vararg_buffer15)) + 8|0);
|
|
HEAP32[$vararg_ptr19>>2] = $61;
|
|
$vararg_ptr20 = ((($vararg_buffer15)) + 12|0);
|
|
HEAP32[$vararg_ptr20>>2] = $64;
|
|
(_printf(1841,$vararg_buffer15)|0);
|
|
$82 = HEAP32[$8>>2]|0;
|
|
STACKTOP = sp;return ($82|0);
|
|
} else {
|
|
HEAP32[$vararg_buffer21>>2] = $58;
|
|
$vararg_ptr24 = ((($vararg_buffer21)) + 4|0);
|
|
HEAP32[$vararg_ptr24>>2] = $60;
|
|
$vararg_ptr25 = ((($vararg_buffer21)) + 8|0);
|
|
HEAP32[$vararg_ptr25>>2] = $61;
|
|
$vararg_ptr26 = ((($vararg_buffer21)) + 12|0);
|
|
HEAP32[$vararg_ptr26>>2] = $64;
|
|
(_printf(1863,$vararg_buffer21)|0);
|
|
$82 = HEAP32[$8>>2]|0;
|
|
STACKTOP = sp;return ($82|0);
|
|
}
|
|
} else {
|
|
$65 = (_fixup_new($52,$53,0)|0);
|
|
HEAP32[$12>>2] = $65;
|
|
HEAP32[$8>>2] = 1;
|
|
$66 = HEAP32[$5>>2]|0;
|
|
$67 = $66 & 128;
|
|
$68 = ($67|0)!=(0);
|
|
$69 = HEAP32[$12>>2]|0;
|
|
$70 = HEAP8[861]|0;
|
|
$71 = $70 << 24 >> 24;
|
|
$72 = HEAP32[3]|0;
|
|
$73 = HEAP32[$6>>2]|0;
|
|
$74 = HEAP32[$5>>2]|0;
|
|
$75 = (_tag_string($73,$74)|0);
|
|
if ($68) {
|
|
HEAP32[$vararg_buffer27>>2] = $69;
|
|
$vararg_ptr30 = ((($vararg_buffer27)) + 4|0);
|
|
HEAP32[$vararg_ptr30>>2] = $71;
|
|
$vararg_ptr31 = ((($vararg_buffer27)) + 8|0);
|
|
HEAP32[$vararg_ptr31>>2] = $72;
|
|
$vararg_ptr32 = ((($vararg_buffer27)) + 12|0);
|
|
HEAP32[$vararg_ptr32>>2] = $75;
|
|
(_printf(1841,$vararg_buffer27)|0);
|
|
$82 = HEAP32[$8>>2]|0;
|
|
STACKTOP = sp;return ($82|0);
|
|
} else {
|
|
HEAP32[$vararg_buffer33>>2] = $69;
|
|
$vararg_ptr36 = ((($vararg_buffer33)) + 4|0);
|
|
HEAP32[$vararg_ptr36>>2] = $71;
|
|
$vararg_ptr37 = ((($vararg_buffer33)) + 8|0);
|
|
HEAP32[$vararg_ptr37>>2] = $72;
|
|
$vararg_ptr38 = ((($vararg_buffer33)) + 12|0);
|
|
HEAP32[$vararg_ptr38>>2] = $75;
|
|
(_printf(1863,$vararg_buffer33)|0);
|
|
$82 = HEAP32[$8>>2]|0;
|
|
STACKTOP = sp;return ($82|0);
|
|
}
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _id_tag($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
$6 = HEAP32[$3>>2]|0;
|
|
$7 = HEAP32[$4>>2]|0;
|
|
$8 = (_idlocal_lookup($6,$7)|0);
|
|
HEAP32[$5>>2] = $8;
|
|
$9 = ($8|0)>=(0);
|
|
if ($9) {
|
|
$10 = HEAP32[$5>>2]|0;
|
|
$11 = (11892 + ($10<<2)|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
HEAP32[$2>>2] = $12;
|
|
$20 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($20|0);
|
|
}
|
|
$13 = HEAP32[$3>>2]|0;
|
|
$14 = HEAP32[$4>>2]|0;
|
|
$15 = (_idglobal_lookup($13,$14)|0);
|
|
HEAP32[$5>>2] = $15;
|
|
$16 = ($15|0)>=(0);
|
|
if ($16) {
|
|
$17 = HEAP32[$5>>2]|0;
|
|
$18 = (16500 + ($17<<2)|0);
|
|
$19 = HEAP32[$18>>2]|0;
|
|
HEAP32[$2>>2] = $19;
|
|
$20 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($20|0);
|
|
} else {
|
|
HEAP32[$2>>2] = -1;
|
|
$20 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($20|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _id_const($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
$6 = HEAP32[$3>>2]|0;
|
|
$7 = HEAP32[$4>>2]|0;
|
|
$8 = (_idconst_lookup($6,$7)|0);
|
|
HEAP32[$5>>2] = $8;
|
|
$9 = ($8|0)>=(0);
|
|
if ($9) {
|
|
$10 = HEAP32[$5>>2]|0;
|
|
$11 = (7280 + ($10<<2)|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
HEAP32[$2>>2] = $12;
|
|
$13 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($13|0);
|
|
} else {
|
|
_parse_error(743);
|
|
HEAP32[$2>>2] = 0;
|
|
$13 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($13|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _id_type($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0, $4 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
$6 = HEAP32[$3>>2]|0;
|
|
$7 = HEAP32[$4>>2]|0;
|
|
$8 = (_idconst_lookup($6,$7)|0);
|
|
HEAP32[$5>>2] = $8;
|
|
$9 = ($8|0)>=(0);
|
|
do {
|
|
if ($9) {
|
|
HEAP32[$2>>2] = 1;
|
|
} else {
|
|
$10 = HEAP32[$3>>2]|0;
|
|
$11 = HEAP32[$4>>2]|0;
|
|
$12 = (_idlocal_lookup($10,$11)|0);
|
|
HEAP32[$5>>2] = $12;
|
|
$13 = ($12|0)>=(0);
|
|
if ($13) {
|
|
$14 = HEAP32[$5>>2]|0;
|
|
$15 = (11380 + ($14<<2)|0);
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $16 | 64;
|
|
HEAP32[$2>>2] = $17;
|
|
break;
|
|
}
|
|
$18 = HEAP32[$3>>2]|0;
|
|
$19 = HEAP32[$4>>2]|0;
|
|
$20 = (_idglobal_lookup($18,$19)|0);
|
|
HEAP32[$5>>2] = $20;
|
|
$21 = ($20|0)>=(0);
|
|
if ($21) {
|
|
$22 = HEAP32[$5>>2]|0;
|
|
$23 = (12404 + ($22<<2)|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
HEAP32[$2>>2] = $24;
|
|
break;
|
|
} else {
|
|
_parse_error(721);
|
|
HEAP32[$2>>2] = 0;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$25 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($25|0);
|
|
}
|
|
function _tag_new($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp + 4|0;
|
|
$2 = sp;
|
|
HEAP32[$2>>2] = $0;
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = $3 & 128;
|
|
$5 = ($4|0)!=(0);
|
|
do {
|
|
if ($5) {
|
|
$6 = HEAP32[5149]|0;
|
|
$7 = ($6|0)>(254);
|
|
if ($7) {
|
|
_parse_error(763);
|
|
}
|
|
$8 = HEAP32[5149]|0;
|
|
$9 = (($8) + 1)|0;
|
|
HEAP32[5149] = $9;
|
|
HEAP32[$1>>2] = $8;
|
|
} else {
|
|
$10 = HEAP32[$2>>2]|0;
|
|
$11 = $10 & 8192;
|
|
$12 = ($11|0)!=(0);
|
|
if ($12) {
|
|
$13 = HEAP32[5150]|0;
|
|
$14 = (($13) + 1)|0;
|
|
HEAP32[5150] = $14;
|
|
HEAP32[$1>>2] = $13;
|
|
break;
|
|
}
|
|
$15 = HEAP32[$2>>2]|0;
|
|
$16 = $15 & 8;
|
|
$17 = ($16|0)!=(0);
|
|
if ($17) {
|
|
$18 = HEAP32[5151]|0;
|
|
$19 = (($18) + 1)|0;
|
|
HEAP32[5151] = $19;
|
|
HEAP32[$1>>2] = $18;
|
|
break;
|
|
}
|
|
$20 = HEAP32[$2>>2]|0;
|
|
$21 = $20 & 16;
|
|
$22 = ($21|0)!=(0);
|
|
if ($22) {
|
|
$23 = HEAP32[5152]|0;
|
|
$24 = (($23) + 1)|0;
|
|
HEAP32[5152] = $24;
|
|
HEAP32[$1>>2] = $23;
|
|
break;
|
|
}
|
|
$25 = HEAP32[$2>>2]|0;
|
|
$26 = $25 & 32;
|
|
$27 = ($26|0)!=(0);
|
|
if ($27) {
|
|
$28 = HEAP32[2]|0;
|
|
$29 = (($28) + 1)|0;
|
|
HEAP32[2] = $29;
|
|
HEAP32[$1>>2] = $28;
|
|
break;
|
|
} else {
|
|
$30 = HEAP32[1819]|0;
|
|
$31 = (($30) + 1)|0;
|
|
HEAP32[1819] = $31;
|
|
HEAP32[$1>>2] = $30;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$32 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($32|0);
|
|
}
|
|
function _fixup_new($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$6 = HEAP32[$3>>2]|0;
|
|
$7 = HEAP32[5153]|0;
|
|
$8 = (20616 + ($7<<2)|0);
|
|
HEAP32[$8>>2] = $6;
|
|
$9 = HEAP32[$4>>2]|0;
|
|
$10 = HEAP32[5153]|0;
|
|
$11 = (28808 + ($10<<2)|0);
|
|
HEAP32[$11>>2] = $9;
|
|
$12 = HEAP32[$5>>2]|0;
|
|
$13 = $12&255;
|
|
$14 = HEAP32[5153]|0;
|
|
$15 = (109668 + ($14)|0);
|
|
HEAP8[$15>>0] = $13;
|
|
$16 = HEAP32[5153]|0;
|
|
$17 = (($16) + 1)|0;
|
|
HEAP32[5153] = $17;
|
|
STACKTOP = sp;return ($16|0);
|
|
}
|
|
function _supper($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp + 4|0;
|
|
$2 = sp;
|
|
HEAP32[$1>>2] = $0;
|
|
HEAP32[$2>>2] = 0;
|
|
while(1) {
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = HEAP32[$1>>2]|0;
|
|
$5 = (($4) + ($3)|0);
|
|
$6 = HEAP8[$5>>0]|0;
|
|
$7 = ($6<<24>>24)!=(0);
|
|
$8 = HEAP32[$2>>2]|0;
|
|
if (!($7)) {
|
|
break;
|
|
}
|
|
$9 = HEAP32[$1>>2]|0;
|
|
$10 = (($9) + ($8)|0);
|
|
$11 = HEAP8[$10>>0]|0;
|
|
$12 = $11 << 24 >> 24;
|
|
$13 = (_toupper($12)|0);
|
|
$14 = $13&255;
|
|
$15 = HEAP32[$2>>2]|0;
|
|
$16 = (111716 + ($15)|0);
|
|
HEAP8[$16>>0] = $14;
|
|
$17 = HEAP32[$2>>2]|0;
|
|
$18 = (($17) + 1)|0;
|
|
HEAP32[$2>>2] = $18;
|
|
}
|
|
$19 = (111716 + ($8)|0);
|
|
HEAP8[$19>>0] = 0;
|
|
STACKTOP = sp;return (111716|0);
|
|
}
|
|
function _tag_string($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 16|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$5 = HEAP32[$3>>2]|0;
|
|
$6 = $5 & 128;
|
|
$7 = ($6|0)!=(0);
|
|
do {
|
|
if ($7) {
|
|
HEAP8[$4>>0] = 88;
|
|
} else {
|
|
$8 = HEAP32[$3>>2]|0;
|
|
$9 = $8 & 16;
|
|
$10 = ($9|0)!=(0);
|
|
if ($10) {
|
|
HEAP8[$4>>0] = 67;
|
|
break;
|
|
}
|
|
$11 = HEAP32[$3>>2]|0;
|
|
$12 = $11 & 8;
|
|
$13 = ($12|0)!=(0);
|
|
if ($13) {
|
|
HEAP8[$4>>0] = 65;
|
|
break;
|
|
}
|
|
$14 = HEAP32[$3>>2]|0;
|
|
$15 = $14 & 32;
|
|
$16 = ($15|0)!=(0);
|
|
if ($16) {
|
|
HEAP8[$4>>0] = 66;
|
|
break;
|
|
}
|
|
$17 = HEAP32[$3>>2]|0;
|
|
$18 = $17 & 8192;
|
|
$19 = ($18|0)!=(0);
|
|
if ($19) {
|
|
HEAP8[$4>>0] = 80;
|
|
break;
|
|
} else {
|
|
HEAP8[$4>>0] = 68;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$20 = HEAP8[$4>>0]|0;
|
|
$21 = $20 << 24 >> 24;
|
|
$22 = HEAP32[$2>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $21;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $22;
|
|
(_sprintf(111796,797,$vararg_buffer)|0);
|
|
STACKTOP = sp;return (111796|0);
|
|
}
|
|
function _emit_dci($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
|
|
var $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer5 = 0, $vararg_buffer8 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer8 = sp + 24|0;
|
|
$vararg_buffer5 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 32|0;
|
|
$3 = sp + 28|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = (($4) + -1)|0;
|
|
HEAP32[$3>>2] = $5;
|
|
$6 = ($4|0)!=(0);
|
|
if (!($6)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$7 = HEAP32[$2>>2]|0;
|
|
$8 = (_supper($7)|0);
|
|
HEAP32[$vararg_buffer>>2] = $8;
|
|
(_printf(805,$vararg_buffer)|0);
|
|
$9 = HEAP32[3]|0;
|
|
$10 = HEAP32[$2>>2]|0;
|
|
$11 = ((($10)) + 1|0);
|
|
HEAP32[$2>>2] = $11;
|
|
$12 = HEAP8[$10>>0]|0;
|
|
$13 = $12 << 24 >> 24;
|
|
$14 = (_toupper($13)|0);
|
|
$15 = HEAP32[$3>>2]|0;
|
|
$16 = ($15|0)!=(0);
|
|
$17 = $16 ? 128 : 0;
|
|
$18 = $14 | $17;
|
|
HEAP32[$vararg_buffer1>>2] = $9;
|
|
$vararg_ptr4 = ((($vararg_buffer1)) + 4|0);
|
|
HEAP32[$vararg_ptr4>>2] = $18;
|
|
(_printf(824,$vararg_buffer1)|0);
|
|
while(1) {
|
|
$19 = HEAP32[$3>>2]|0;
|
|
$20 = (($19) + -1)|0;
|
|
HEAP32[$3>>2] = $20;
|
|
$21 = ($19|0)!=(0);
|
|
if (!($21)) {
|
|
break;
|
|
}
|
|
$22 = HEAP32[$2>>2]|0;
|
|
$23 = ((($22)) + 1|0);
|
|
HEAP32[$2>>2] = $23;
|
|
$24 = HEAP8[$22>>0]|0;
|
|
$25 = $24 << 24 >> 24;
|
|
$26 = (_toupper($25)|0);
|
|
$27 = HEAP32[$3>>2]|0;
|
|
$28 = ($27|0)!=(0);
|
|
$29 = $28 ? 128 : 0;
|
|
$30 = $26 | $29;
|
|
HEAP32[$vararg_buffer5>>2] = $30;
|
|
(_printf(834,$vararg_buffer5)|0);
|
|
}
|
|
(_printf(841,$vararg_buffer8)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_flags($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[$1>>2]|0;
|
|
HEAP32[9250] = $2;
|
|
$3 = HEAP32[9250]|0;
|
|
$4 = $3 & 1;
|
|
$5 = ($4|0)!=(0);
|
|
if (!($5)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
HEAP32[3] = 843;
|
|
HEAP32[4] = 849;
|
|
HEAP32[5] = 855;
|
|
HEAP8[861] = 32;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_header() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer14 = 0, $vararg_buffer17 = 0, $vararg_buffer20 = 0;
|
|
var $vararg_buffer23 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer8 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 80|0;
|
|
$vararg_buffer23 = sp + 72|0;
|
|
$vararg_buffer20 = sp + 64|0;
|
|
$vararg_buffer17 = sp + 56|0;
|
|
$vararg_buffer14 = sp + 48|0;
|
|
$vararg_buffer11 = sp + 40|0;
|
|
$vararg_buffer8 = sp + 32|0;
|
|
$vararg_buffer5 = sp + 24|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[9250]|0;
|
|
$1 = $0 & 1;
|
|
$2 = ($1|0)!=(0);
|
|
if ($2) {
|
|
(_printf(862,$vararg_buffer)|0);
|
|
} else {
|
|
(_printf(888,$vararg_buffer1)|0);
|
|
}
|
|
$3 = HEAP32[9250]|0;
|
|
$4 = $3 & 2;
|
|
$5 = ($4|0)!=(0);
|
|
if ($5) {
|
|
$6 = HEAP32[4]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $6;
|
|
(_printf(914,$vararg_buffer3)|0);
|
|
$7 = HEAP8[861]|0;
|
|
$8 = $7 << 24 >> 24;
|
|
HEAP32[$vararg_buffer5>>2] = $8;
|
|
(_printf(987,$vararg_buffer5)|0);
|
|
$9 = HEAP32[4]|0;
|
|
HEAP32[$vararg_buffer8>>2] = $9;
|
|
(_printf(1000,$vararg_buffer8)|0);
|
|
$10 = HEAP32[4]|0;
|
|
HEAP32[$vararg_buffer11>>2] = $10;
|
|
(_printf(1023,$vararg_buffer11)|0);
|
|
$11 = HEAP32[4]|0;
|
|
HEAP32[$vararg_buffer14>>2] = $11;
|
|
(_printf(1055,$vararg_buffer14)|0);
|
|
$12 = HEAP32[4]|0;
|
|
HEAP32[$vararg_buffer17>>2] = $12;
|
|
(_printf(1093,$vararg_buffer17)|0);
|
|
$13 = HEAP32[4]|0;
|
|
HEAP32[$vararg_buffer20>>2] = $13;
|
|
(_printf(1129,$vararg_buffer20)|0);
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
(_printf(1174,$vararg_buffer23)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _emit_rld() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer22 = 0, $vararg_buffer26 = 0, $vararg_buffer3 = 0, $vararg_buffer30 = 0;
|
|
var $vararg_buffer33 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr21 = 0, $vararg_ptr25 = 0, $vararg_ptr29 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0;
|
|
$vararg_buffer33 = sp + 80|0;
|
|
$vararg_buffer30 = sp + 72|0;
|
|
$vararg_buffer26 = sp + 64|0;
|
|
$vararg_buffer22 = sp + 56|0;
|
|
$vararg_buffer18 = sp + 48|0;
|
|
$vararg_buffer14 = sp + 40|0;
|
|
$vararg_buffer10 = sp + 32|0;
|
|
$vararg_buffer7 = sp + 24|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$0 = sp + 84|0;
|
|
(_printf(1220,$vararg_buffer)|0);
|
|
HEAP32[$0>>2] = 0;
|
|
while(1) {
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = HEAP32[1819]|0;
|
|
$3 = ($1|0)<($2|0);
|
|
if (!($3)) {
|
|
break;
|
|
}
|
|
$4 = HEAP32[$0>>2]|0;
|
|
$5 = (12404 + ($4<<2)|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = $6 & 128;
|
|
$8 = ($7|0)!=(0);
|
|
if (!($8)) {
|
|
$9 = HEAP32[$0>>2]|0;
|
|
$10 = (12404 + ($9<<2)|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = $11 & 16;
|
|
$13 = ($12|0)!=(0);
|
|
if ($13) {
|
|
$14 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer1>>2] = $14;
|
|
(_printf(1252,$vararg_buffer1)|0);
|
|
$15 = HEAP32[4]|0;
|
|
$16 = HEAP32[$0>>2]|0;
|
|
$17 = (16500 + ($16<<2)|0);
|
|
$18 = HEAP32[$17>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $15;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $18;
|
|
(_printf(1282,$vararg_buffer3)|0);
|
|
$19 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer7>>2] = $19;
|
|
(_printf(1296,$vararg_buffer7)|0);
|
|
}
|
|
}
|
|
$20 = HEAP32[$0>>2]|0;
|
|
$21 = (($20) + 1)|0;
|
|
HEAP32[$0>>2] = $21;
|
|
}
|
|
HEAP32[$0>>2] = 0;
|
|
while(1) {
|
|
$22 = HEAP32[$0>>2]|0;
|
|
$23 = HEAP32[5153]|0;
|
|
$24 = ($22|0)<($23|0);
|
|
if (!($24)) {
|
|
break;
|
|
}
|
|
$25 = HEAP32[$0>>2]|0;
|
|
$26 = (28808 + ($25<<2)|0);
|
|
$27 = HEAP32[$26>>2]|0;
|
|
$28 = $27 & 128;
|
|
$29 = ($28|0)!=(0);
|
|
$30 = HEAP32[3]|0;
|
|
$31 = HEAP32[$0>>2]|0;
|
|
$32 = (109668 + ($31)|0);
|
|
$33 = HEAP8[$32>>0]|0;
|
|
$34 = $33 << 24 >> 24;
|
|
if ($29) {
|
|
$35 = (17 + ($34))|0;
|
|
$36 = $35 & 255;
|
|
HEAP32[$vararg_buffer10>>2] = $30;
|
|
$vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
|
|
HEAP32[$vararg_ptr13>>2] = $36;
|
|
(_printf(1305,$vararg_buffer10)|0);
|
|
$37 = HEAP32[4]|0;
|
|
$38 = HEAP32[$0>>2]|0;
|
|
HEAP32[$vararg_buffer14>>2] = $37;
|
|
$vararg_ptr17 = ((($vararg_buffer14)) + 4|0);
|
|
HEAP32[$vararg_ptr17>>2] = $38;
|
|
(_printf(1335,$vararg_buffer14)|0);
|
|
$39 = HEAP32[3]|0;
|
|
$40 = HEAP32[$0>>2]|0;
|
|
$41 = (20616 + ($40<<2)|0);
|
|
$42 = HEAP32[$41>>2]|0;
|
|
HEAP32[$vararg_buffer18>>2] = $39;
|
|
$vararg_ptr21 = ((($vararg_buffer18)) + 4|0);
|
|
HEAP32[$vararg_ptr21>>2] = $42;
|
|
(_printf(1359,$vararg_buffer18)|0);
|
|
} else {
|
|
$43 = (1 + ($34))|0;
|
|
$44 = $43 & 255;
|
|
HEAP32[$vararg_buffer22>>2] = $30;
|
|
$vararg_ptr25 = ((($vararg_buffer22)) + 4|0);
|
|
HEAP32[$vararg_ptr25>>2] = $44;
|
|
(_printf(1381,$vararg_buffer22)|0);
|
|
$45 = HEAP32[4]|0;
|
|
$46 = HEAP32[$0>>2]|0;
|
|
HEAP32[$vararg_buffer26>>2] = $45;
|
|
$vararg_ptr29 = ((($vararg_buffer26)) + 4|0);
|
|
HEAP32[$vararg_ptr29>>2] = $46;
|
|
(_printf(1335,$vararg_buffer26)|0);
|
|
$47 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer30>>2] = $47;
|
|
(_printf(1296,$vararg_buffer30)|0);
|
|
}
|
|
$48 = HEAP32[$0>>2]|0;
|
|
$49 = (($48) + 1)|0;
|
|
HEAP32[$0>>2] = $49;
|
|
}
|
|
$50 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer33>>2] = $50;
|
|
(_printf(1411,$vararg_buffer33)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_esd() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer14 = sp + 40|0;
|
|
$vararg_buffer10 = sp + 32|0;
|
|
$vararg_buffer7 = sp + 24|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$0 = sp + 44|0;
|
|
(_printf(1435,$vararg_buffer)|0);
|
|
HEAP32[$0>>2] = 0;
|
|
while(1) {
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = HEAP32[1819]|0;
|
|
$3 = ($1|0)<($2|0);
|
|
if (!($3)) {
|
|
break;
|
|
}
|
|
$4 = HEAP32[$0>>2]|0;
|
|
$5 = (12404 + ($4<<2)|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = $6 & 128;
|
|
$8 = ($7|0)!=(0);
|
|
$9 = HEAP32[$0>>2]|0;
|
|
if ($8) {
|
|
$10 = (75876 + (($9*33)|0)|0);
|
|
$11 = ((($10)) + 1|0);
|
|
$12 = HEAP32[$0>>2]|0;
|
|
$13 = (75876 + (($12*33)|0)|0);
|
|
$14 = HEAP8[$13>>0]|0;
|
|
$15 = $14 << 24 >> 24;
|
|
_emit_dci($11,$15);
|
|
$16 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer1>>2] = $16;
|
|
(_printf(1475,$vararg_buffer1)|0);
|
|
$17 = HEAP32[4]|0;
|
|
$18 = HEAP32[$0>>2]|0;
|
|
$19 = (16500 + ($18<<2)|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $17;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $20;
|
|
(_printf(1359,$vararg_buffer3)|0);
|
|
} else {
|
|
$21 = (12404 + ($9<<2)|0);
|
|
$22 = HEAP32[$21>>2]|0;
|
|
$23 = $22 & 4096;
|
|
$24 = ($23|0)!=(0);
|
|
if ($24) {
|
|
$25 = HEAP32[$0>>2]|0;
|
|
$26 = (75876 + (($25*33)|0)|0);
|
|
$27 = ((($26)) + 1|0);
|
|
$28 = HEAP32[$0>>2]|0;
|
|
$29 = (75876 + (($28*33)|0)|0);
|
|
$30 = HEAP8[$29>>0]|0;
|
|
$31 = $30 << 24 >> 24;
|
|
_emit_dci($27,$31);
|
|
$32 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer7>>2] = $32;
|
|
(_printf(1509,$vararg_buffer7)|0);
|
|
$33 = HEAP32[4]|0;
|
|
$34 = HEAP32[$0>>2]|0;
|
|
$35 = (16500 + ($34<<2)|0);
|
|
$36 = HEAP32[$35>>2]|0;
|
|
$37 = HEAP32[$0>>2]|0;
|
|
$38 = (12404 + ($37<<2)|0);
|
|
$39 = HEAP32[$38>>2]|0;
|
|
$40 = (_tag_string($36,$39)|0);
|
|
HEAP32[$vararg_buffer10>>2] = $33;
|
|
$vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
|
|
HEAP32[$vararg_ptr13>>2] = $40;
|
|
(_printf(1540,$vararg_buffer10)|0);
|
|
}
|
|
}
|
|
$41 = HEAP32[$0>>2]|0;
|
|
$42 = (($41) + 1)|0;
|
|
HEAP32[$0>>2] = $42;
|
|
}
|
|
$43 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer14>>2] = $43;
|
|
(_printf(1550,$vararg_buffer14)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_trailer() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer5 = sp + 24|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[9250]|0;
|
|
$1 = $0 & 8;
|
|
$2 = ($1|0)!=(0);
|
|
if (!($2)) {
|
|
_emit_bytecode_seg();
|
|
}
|
|
$3 = HEAP32[9250]|0;
|
|
$4 = $3 & 16;
|
|
$5 = ($4|0)!=(0);
|
|
if (!($5)) {
|
|
(_printf(1574,$vararg_buffer)|0);
|
|
}
|
|
$6 = HEAP32[9250]|0;
|
|
$7 = $6 & 32;
|
|
$8 = ($7|0)!=(0);
|
|
if (!($8)) {
|
|
(_printf(1585,$vararg_buffer1)|0);
|
|
}
|
|
$9 = HEAP32[9250]|0;
|
|
$10 = $9 & 2;
|
|
$11 = ($10|0)!=(0);
|
|
if (!($11)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$12 = HEAP32[5152]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $12;
|
|
(_printf(1600,$vararg_buffer3)|0);
|
|
$13 = HEAP8[861]|0;
|
|
$14 = $13 << 24 >> 24;
|
|
HEAP32[$vararg_buffer5>>2] = $14;
|
|
(_printf(1614,$vararg_buffer5)|0);
|
|
_emit_rld();
|
|
_emit_esd();
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_bytecode_seg() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[9250]|0;
|
|
$1 = $0 & 2;
|
|
$2 = ($1|0)!=(0);
|
|
if ($2) {
|
|
$3 = HEAP32[9250]|0;
|
|
$4 = $3 & 8;
|
|
$5 = ($4|0)!=(0);
|
|
if (!($5)) {
|
|
$6 = HEAP8[861]|0;
|
|
$7 = $6 << 24 >> 24;
|
|
HEAP32[$vararg_buffer>>2] = $7;
|
|
(_printf(1700,$vararg_buffer)|0);
|
|
}
|
|
}
|
|
$8 = HEAP32[9250]|0;
|
|
$9 = $8 | 8;
|
|
HEAP32[9250] = $9;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_moddep($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 8|0;
|
|
$3 = sp + 4|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = HEAP32[9250]|0;
|
|
$5 = $4 & 2;
|
|
$6 = ($5|0)!=(0);
|
|
if (!($6)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$7 = HEAP32[$2>>2]|0;
|
|
$8 = ($7|0)!=(0|0);
|
|
if ($8) {
|
|
$9 = HEAP32[$2>>2]|0;
|
|
$10 = HEAP32[$3>>2]|0;
|
|
_emit_dci($9,$10);
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
$11 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $11;
|
|
(_printf(1625,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _emit_sysflags($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 4|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
(_printf(1665,$vararg_buffer)|0);
|
|
$3 = HEAP32[9250]|0;
|
|
$4 = $3 | 32;
|
|
HEAP32[9250] = $4;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_asm($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 4|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
(_printf(1732,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_idfunc($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 20|0;
|
|
$4 = sp + 16|0;
|
|
$5 = sp + 12|0;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$6 = HEAP32[$3>>2]|0;
|
|
$7 = HEAP32[$4>>2]|0;
|
|
$8 = (_tag_string($6,$7)|0);
|
|
$9 = HEAP8[861]|0;
|
|
$10 = $9 << 24 >> 24;
|
|
$11 = HEAP32[$5>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $8;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $10;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $11;
|
|
(_printf(1797,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_def($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $or$cond = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 8|0;
|
|
$3 = sp + 4|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = HEAP32[9250]|0;
|
|
$5 = $4 & 2;
|
|
$6 = ($5|0)==(0);
|
|
$7 = HEAP32[$3>>2]|0;
|
|
$8 = ($7|0)!=(0);
|
|
$or$cond = $6 & $8;
|
|
if (!($or$cond)) {
|
|
HEAP32[1818] = 0;
|
|
HEAP32[2844] = 0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
(_printf(1903,$vararg_buffer)|0);
|
|
HEAP32[1818] = 0;
|
|
HEAP32[2844] = 0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_codetag($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 8|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = HEAP8[861]|0;
|
|
$4 = $3 << 24 >> 24;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $4;
|
|
(_printf(1916,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_const($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $vararg_buffer = 0, $vararg_buffer2 = 0, $vararg_buffer7 = 0;
|
|
var $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr12 = 0, $vararg_ptr5 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer7 = sp + 24|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 40|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ($2|0)==(0);
|
|
if ($3) {
|
|
$4 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $4;
|
|
(_printf(1926,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
$5 = HEAP32[$1>>2]|0;
|
|
$6 = ($5|0)>(0);
|
|
$7 = HEAP32[$1>>2]|0;
|
|
$8 = ($7|0)<(256);
|
|
$or$cond = $6 & $8;
|
|
$9 = HEAP32[3]|0;
|
|
$10 = HEAP32[$1>>2]|0;
|
|
if ($or$cond) {
|
|
$11 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer2>>2] = $9;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $10;
|
|
$vararg_ptr6 = ((($vararg_buffer2)) + 8|0);
|
|
HEAP32[$vararg_ptr6>>2] = $11;
|
|
(_printf(1944,$vararg_buffer2)|0);
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
$12 = $10 & 255;
|
|
$13 = HEAP32[$1>>2]|0;
|
|
$14 = $13 >> 8;
|
|
$15 = $14 & 255;
|
|
$16 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer7>>2] = $9;
|
|
$vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
|
|
HEAP32[$vararg_ptr10>>2] = $12;
|
|
$vararg_ptr11 = ((($vararg_buffer7)) + 8|0);
|
|
HEAP32[$vararg_ptr11>>2] = $15;
|
|
$vararg_ptr12 = ((($vararg_buffer7)) + 12|0);
|
|
HEAP32[$vararg_ptr12>>2] = $16;
|
|
(_printf(1969,$vararg_buffer7)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _emit_conststr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 8|0;
|
|
$3 = sp + 4|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $4;
|
|
(_printf(1999,$vararg_buffer)|0);
|
|
$5 = HEAP32[$2>>2]|0;
|
|
$6 = HEAP32[$3>>2]|0;
|
|
(_emit_data(0,1024,$5,$6)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_lb() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2015,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_lw() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2031,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_llb($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 12|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $4;
|
|
(_printf(2047,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_llw($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 12|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $4;
|
|
(_printf(2075,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_lab($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 52|0;
|
|
$4 = sp + 48|0;
|
|
$5 = sp + 44|0;
|
|
$6 = sp + 40|0;
|
|
$7 = sp + 36|0;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$8 = HEAP32[$3>>2]|0;
|
|
$9 = HEAP32[$5>>2]|0;
|
|
$10 = (_fixup_new($8,$9,128)|0);
|
|
HEAP32[$6>>2] = $10;
|
|
$11 = HEAP32[$3>>2]|0;
|
|
$12 = HEAP32[$5>>2]|0;
|
|
$13 = (_tag_string($11,$12)|0);
|
|
HEAP32[$7>>2] = $13;
|
|
$14 = HEAP32[3]|0;
|
|
$15 = HEAP32[$7>>2]|0;
|
|
$16 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $14;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $15;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $16;
|
|
(_printf(2103,$vararg_buffer)|0);
|
|
$17 = HEAP32[$6>>2]|0;
|
|
$18 = HEAP8[861]|0;
|
|
$19 = $18 << 24 >> 24;
|
|
$20 = HEAP32[4]|0;
|
|
$21 = HEAP32[$5>>2]|0;
|
|
$22 = $21 & 128;
|
|
$23 = ($22|0)!=(0);
|
|
$24 = HEAP32[$7>>2]|0;
|
|
$25 = $23 ? 2147 : $24;
|
|
$26 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $17;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $19;
|
|
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
|
|
HEAP32[$vararg_ptr7>>2] = $20;
|
|
$vararg_ptr8 = ((($vararg_buffer3)) + 12|0);
|
|
HEAP32[$vararg_ptr8>>2] = $25;
|
|
$vararg_ptr9 = ((($vararg_buffer3)) + 16|0);
|
|
HEAP32[$vararg_ptr9>>2] = $26;
|
|
(_printf(2126,$vararg_buffer3)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_law($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 52|0;
|
|
$4 = sp + 48|0;
|
|
$5 = sp + 44|0;
|
|
$6 = sp + 40|0;
|
|
$7 = sp + 36|0;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$8 = HEAP32[$3>>2]|0;
|
|
$9 = HEAP32[$5>>2]|0;
|
|
$10 = (_fixup_new($8,$9,128)|0);
|
|
HEAP32[$6>>2] = $10;
|
|
$11 = HEAP32[$3>>2]|0;
|
|
$12 = HEAP32[$5>>2]|0;
|
|
$13 = (_tag_string($11,$12)|0);
|
|
HEAP32[$7>>2] = $13;
|
|
$14 = HEAP32[3]|0;
|
|
$15 = HEAP32[$7>>2]|0;
|
|
$16 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $14;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $15;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $16;
|
|
(_printf(2149,$vararg_buffer)|0);
|
|
$17 = HEAP32[$6>>2]|0;
|
|
$18 = HEAP8[861]|0;
|
|
$19 = $18 << 24 >> 24;
|
|
$20 = HEAP32[4]|0;
|
|
$21 = HEAP32[$5>>2]|0;
|
|
$22 = $21 & 128;
|
|
$23 = ($22|0)!=(0);
|
|
$24 = HEAP32[$7>>2]|0;
|
|
$25 = $23 ? 2147 : $24;
|
|
$26 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $17;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $19;
|
|
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
|
|
HEAP32[$vararg_ptr7>>2] = $20;
|
|
$vararg_ptr8 = ((($vararg_buffer3)) + 12|0);
|
|
HEAP32[$vararg_ptr8>>2] = $25;
|
|
$vararg_ptr9 = ((($vararg_buffer3)) + 16|0);
|
|
HEAP32[$vararg_ptr9>>2] = $26;
|
|
(_printf(2126,$vararg_buffer3)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_sb() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2172,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_sw() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2188,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_slb($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 12|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $4;
|
|
(_printf(2204,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_slw($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 12|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $4;
|
|
(_printf(2232,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_dlb($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 12|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $4;
|
|
(_printf(2260,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_dlw($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 12|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $4;
|
|
(_printf(2288,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_sab($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 52|0;
|
|
$4 = sp + 48|0;
|
|
$5 = sp + 44|0;
|
|
$6 = sp + 40|0;
|
|
$7 = sp + 36|0;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$8 = HEAP32[$3>>2]|0;
|
|
$9 = HEAP32[$5>>2]|0;
|
|
$10 = (_fixup_new($8,$9,128)|0);
|
|
HEAP32[$6>>2] = $10;
|
|
$11 = HEAP32[$3>>2]|0;
|
|
$12 = HEAP32[$5>>2]|0;
|
|
$13 = (_tag_string($11,$12)|0);
|
|
HEAP32[$7>>2] = $13;
|
|
$14 = HEAP32[3]|0;
|
|
$15 = HEAP32[$7>>2]|0;
|
|
$16 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $14;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $15;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $16;
|
|
(_printf(2316,$vararg_buffer)|0);
|
|
$17 = HEAP32[$6>>2]|0;
|
|
$18 = HEAP8[861]|0;
|
|
$19 = $18 << 24 >> 24;
|
|
$20 = HEAP32[4]|0;
|
|
$21 = HEAP32[$5>>2]|0;
|
|
$22 = $21 & 128;
|
|
$23 = ($22|0)!=(0);
|
|
$24 = HEAP32[$7>>2]|0;
|
|
$25 = $23 ? 2147 : $24;
|
|
$26 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $17;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $19;
|
|
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
|
|
HEAP32[$vararg_ptr7>>2] = $20;
|
|
$vararg_ptr8 = ((($vararg_buffer3)) + 12|0);
|
|
HEAP32[$vararg_ptr8>>2] = $25;
|
|
$vararg_ptr9 = ((($vararg_buffer3)) + 16|0);
|
|
HEAP32[$vararg_ptr9>>2] = $26;
|
|
(_printf(2126,$vararg_buffer3)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_saw($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 52|0;
|
|
$4 = sp + 48|0;
|
|
$5 = sp + 44|0;
|
|
$6 = sp + 40|0;
|
|
$7 = sp + 36|0;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$8 = HEAP32[$3>>2]|0;
|
|
$9 = HEAP32[$5>>2]|0;
|
|
$10 = (_fixup_new($8,$9,128)|0);
|
|
HEAP32[$6>>2] = $10;
|
|
$11 = HEAP32[$3>>2]|0;
|
|
$12 = HEAP32[$5>>2]|0;
|
|
$13 = (_tag_string($11,$12)|0);
|
|
HEAP32[$7>>2] = $13;
|
|
$14 = HEAP32[3]|0;
|
|
$15 = HEAP32[$7>>2]|0;
|
|
$16 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $14;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $15;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $16;
|
|
(_printf(2339,$vararg_buffer)|0);
|
|
$17 = HEAP32[$6>>2]|0;
|
|
$18 = HEAP8[861]|0;
|
|
$19 = $18 << 24 >> 24;
|
|
$20 = HEAP32[4]|0;
|
|
$21 = HEAP32[$5>>2]|0;
|
|
$22 = $21 & 128;
|
|
$23 = ($22|0)!=(0);
|
|
$24 = HEAP32[$7>>2]|0;
|
|
$25 = $23 ? 2147 : $24;
|
|
$26 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $17;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $19;
|
|
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
|
|
HEAP32[$vararg_ptr7>>2] = $20;
|
|
$vararg_ptr8 = ((($vararg_buffer3)) + 12|0);
|
|
HEAP32[$vararg_ptr8>>2] = $25;
|
|
$vararg_ptr9 = ((($vararg_buffer3)) + 16|0);
|
|
HEAP32[$vararg_ptr9>>2] = $26;
|
|
(_printf(2126,$vararg_buffer3)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_dab($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, $vararg_buffer = 0, $vararg_buffer2 = 0, $vararg_ptr1 = 0, $vararg_ptr5 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 36|0;
|
|
$3 = sp + 32|0;
|
|
$4 = sp + 28|0;
|
|
$5 = sp + 24|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$6 = HEAP32[$2>>2]|0;
|
|
$7 = HEAP32[$3>>2]|0;
|
|
$8 = (_fixup_new($6,$7,128)|0);
|
|
HEAP32[$4>>2] = $8;
|
|
$9 = HEAP32[$2>>2]|0;
|
|
$10 = HEAP32[$3>>2]|0;
|
|
$11 = (_tag_string($9,$10)|0);
|
|
HEAP32[$5>>2] = $11;
|
|
$12 = HEAP32[3]|0;
|
|
$13 = HEAP32[$5>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $12;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $13;
|
|
(_printf(2362,$vararg_buffer)|0);
|
|
$14 = HEAP32[$4>>2]|0;
|
|
$15 = HEAP8[861]|0;
|
|
$16 = $15 << 24 >> 24;
|
|
$17 = HEAP32[4]|0;
|
|
$18 = HEAP32[$3>>2]|0;
|
|
$19 = $18 & 128;
|
|
$20 = ($19|0)!=(0);
|
|
$21 = HEAP32[$5>>2]|0;
|
|
$22 = $20 ? 2147 : $21;
|
|
HEAP32[$vararg_buffer2>>2] = $14;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $16;
|
|
$vararg_ptr6 = ((($vararg_buffer2)) + 8|0);
|
|
HEAP32[$vararg_ptr6>>2] = $17;
|
|
$vararg_ptr7 = ((($vararg_buffer2)) + 12|0);
|
|
HEAP32[$vararg_ptr7>>2] = $22;
|
|
(_printf(2382,$vararg_buffer2)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_daw($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, $vararg_buffer = 0, $vararg_buffer2 = 0, $vararg_ptr1 = 0, $vararg_ptr5 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 36|0;
|
|
$3 = sp + 32|0;
|
|
$4 = sp + 28|0;
|
|
$5 = sp + 24|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$6 = HEAP32[$2>>2]|0;
|
|
$7 = HEAP32[$3>>2]|0;
|
|
$8 = (_fixup_new($6,$7,128)|0);
|
|
HEAP32[$4>>2] = $8;
|
|
$9 = HEAP32[$2>>2]|0;
|
|
$10 = HEAP32[$3>>2]|0;
|
|
$11 = (_tag_string($9,$10)|0);
|
|
HEAP32[$5>>2] = $11;
|
|
$12 = HEAP32[3]|0;
|
|
$13 = HEAP32[$5>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $12;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $13;
|
|
(_printf(2400,$vararg_buffer)|0);
|
|
$14 = HEAP32[$4>>2]|0;
|
|
$15 = HEAP8[861]|0;
|
|
$16 = $15 << 24 >> 24;
|
|
$17 = HEAP32[4]|0;
|
|
$18 = HEAP32[$3>>2]|0;
|
|
$19 = $18 & 128;
|
|
$20 = ($19|0)!=(0);
|
|
$21 = HEAP32[$5>>2]|0;
|
|
$22 = $20 ? 2147 : $21;
|
|
HEAP32[$vararg_buffer2>>2] = $14;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $16;
|
|
$vararg_ptr6 = ((($vararg_buffer2)) + 8|0);
|
|
HEAP32[$vararg_ptr6>>2] = $17;
|
|
$vararg_ptr7 = ((($vararg_buffer2)) + 12|0);
|
|
HEAP32[$vararg_ptr7>>2] = $22;
|
|
(_printf(2382,$vararg_buffer2)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_localaddr($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 12|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $4;
|
|
(_printf(2420,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_globaladdr($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 52|0;
|
|
$4 = sp + 48|0;
|
|
$5 = sp + 44|0;
|
|
$6 = sp + 40|0;
|
|
$7 = sp + 36|0;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$8 = HEAP32[$3>>2]|0;
|
|
$9 = HEAP32[$5>>2]|0;
|
|
$10 = (_fixup_new($8,$9,128)|0);
|
|
HEAP32[$6>>2] = $10;
|
|
$11 = HEAP32[$3>>2]|0;
|
|
$12 = HEAP32[$5>>2]|0;
|
|
$13 = (_tag_string($11,$12)|0);
|
|
HEAP32[$7>>2] = $13;
|
|
$14 = HEAP32[3]|0;
|
|
$15 = HEAP32[$7>>2]|0;
|
|
$16 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $14;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $15;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $16;
|
|
(_printf(2448,$vararg_buffer)|0);
|
|
$17 = HEAP32[$6>>2]|0;
|
|
$18 = HEAP8[861]|0;
|
|
$19 = $18 << 24 >> 24;
|
|
$20 = HEAP32[4]|0;
|
|
$21 = HEAP32[$5>>2]|0;
|
|
$22 = $21 & 128;
|
|
$23 = ($22|0)!=(0);
|
|
$24 = HEAP32[$7>>2]|0;
|
|
$25 = $23 ? 2147 : $24;
|
|
$26 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $17;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $19;
|
|
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
|
|
HEAP32[$vararg_ptr7>>2] = $20;
|
|
$vararg_ptr8 = ((($vararg_buffer3)) + 12|0);
|
|
HEAP32[$vararg_ptr8>>2] = $25;
|
|
$vararg_ptr9 = ((($vararg_buffer3)) + 16|0);
|
|
HEAP32[$vararg_ptr9>>2] = $26;
|
|
(_printf(2126,$vararg_buffer3)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_indexbyte() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2470,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_indexword() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2488,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_brfls($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, $vararg_buffer2 = 0, $vararg_ptr1 = 0, $vararg_ptr5 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 16|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
(_printf(2506,$vararg_buffer)|0);
|
|
$4 = HEAP32[4]|0;
|
|
$5 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer2>>2] = $4;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $5;
|
|
(_printf(2532,$vararg_buffer2)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_brnch($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, $vararg_buffer2 = 0, $vararg_ptr1 = 0, $vararg_ptr5 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 16|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
(_printf(2546,$vararg_buffer)|0);
|
|
$4 = HEAP32[4]|0;
|
|
$5 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer2>>2] = $4;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $5;
|
|
(_printf(2532,$vararg_buffer2)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_brne($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, $vararg_buffer2 = 0, $vararg_ptr1 = 0, $vararg_ptr5 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 16|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
(_printf(2572,$vararg_buffer)|0);
|
|
$4 = HEAP32[4]|0;
|
|
$5 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer2>>2] = $4;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $5;
|
|
(_printf(2532,$vararg_buffer2)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_brgt($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, $vararg_buffer2 = 0, $vararg_ptr1 = 0, $vararg_ptr5 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 16|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
(_printf(2597,$vararg_buffer)|0);
|
|
$4 = HEAP32[4]|0;
|
|
$5 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer2>>2] = $4;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $5;
|
|
(_printf(2532,$vararg_buffer2)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_brlt($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, $vararg_buffer2 = 0, $vararg_ptr1 = 0, $vararg_ptr5 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 16|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[3]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
(_printf(2622,$vararg_buffer)|0);
|
|
$4 = HEAP32[4]|0;
|
|
$5 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer2>>2] = $4;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $5;
|
|
(_printf(2532,$vararg_buffer2)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_call($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
|
|
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer10 = 0, $vararg_buffer2 = 0, $vararg_buffer6 = 0, $vararg_ptr1 = 0, $vararg_ptr13 = 0, $vararg_ptr14 = 0, $vararg_ptr15 = 0, $vararg_ptr5 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0;
|
|
$vararg_buffer10 = sp + 24|0;
|
|
$vararg_buffer6 = sp + 16|0;
|
|
$vararg_buffer2 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 52|0;
|
|
$3 = sp + 48|0;
|
|
$4 = sp + 44|0;
|
|
$5 = sp + 40|0;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$6 = HEAP32[$3>>2]|0;
|
|
$7 = ($6|0)==(1);
|
|
if ($7) {
|
|
$8 = HEAP32[3]|0;
|
|
$9 = HEAP32[$2>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $8;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $9;
|
|
(_printf(2647,$vararg_buffer)|0);
|
|
$10 = HEAP32[4]|0;
|
|
$11 = HEAP32[$2>>2]|0;
|
|
HEAP32[$vararg_buffer2>>2] = $10;
|
|
$vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $11;
|
|
(_printf(2668,$vararg_buffer2)|0);
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
$12 = HEAP32[$2>>2]|0;
|
|
$13 = HEAP32[$3>>2]|0;
|
|
$14 = (_fixup_new($12,$13,128)|0);
|
|
HEAP32[$4>>2] = $14;
|
|
$15 = HEAP32[$2>>2]|0;
|
|
$16 = HEAP32[$3>>2]|0;
|
|
$17 = (_tag_string($15,$16)|0);
|
|
HEAP32[$5>>2] = $17;
|
|
$18 = HEAP32[3]|0;
|
|
$19 = HEAP32[$5>>2]|0;
|
|
HEAP32[$vararg_buffer6>>2] = $18;
|
|
$vararg_ptr9 = ((($vararg_buffer6)) + 4|0);
|
|
HEAP32[$vararg_ptr9>>2] = $19;
|
|
(_printf(2678,$vararg_buffer6)|0);
|
|
$20 = HEAP32[$4>>2]|0;
|
|
$21 = HEAP8[861]|0;
|
|
$22 = $21 << 24 >> 24;
|
|
$23 = HEAP32[4]|0;
|
|
$24 = HEAP32[$3>>2]|0;
|
|
$25 = $24 & 128;
|
|
$26 = ($25|0)!=(0);
|
|
$27 = HEAP32[$5>>2]|0;
|
|
$28 = $26 ? 2147 : $27;
|
|
HEAP32[$vararg_buffer10>>2] = $20;
|
|
$vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
|
|
HEAP32[$vararg_ptr13>>2] = $22;
|
|
$vararg_ptr14 = ((($vararg_buffer10)) + 8|0);
|
|
HEAP32[$vararg_ptr14>>2] = $23;
|
|
$vararg_ptr15 = ((($vararg_buffer10)) + 12|0);
|
|
HEAP32[$vararg_ptr15>>2] = $28;
|
|
(_printf(2382,$vararg_buffer10)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _emit_ical() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2699,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_leave() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[2844]|0;
|
|
$1 = ($0|0)!=(0);
|
|
$2 = HEAP32[3]|0;
|
|
if ($1) {
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
(_printf(2717,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
HEAP32[$vararg_buffer1>>2] = $2;
|
|
(_printf(2736,$vararg_buffer1)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _emit_ret() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2736,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_enter($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 20|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[2844]|0;
|
|
$3 = ($2|0)!=(0);
|
|
if (!($3)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$4 = HEAP32[3]|0;
|
|
$5 = HEAP32[2844]|0;
|
|
$6 = HEAP32[$1>>2]|0;
|
|
$7 = HEAP32[2844]|0;
|
|
$8 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $4;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $5;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $6;
|
|
$vararg_ptr3 = ((($vararg_buffer)) + 12|0);
|
|
HEAP32[$vararg_ptr3>>2] = $7;
|
|
$vararg_ptr4 = ((($vararg_buffer)) + 16|0);
|
|
HEAP32[$vararg_ptr4>>2] = $8;
|
|
(_printf(2753,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_start() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP8[861]|0;
|
|
$1 = $0 << 24 >> 24;
|
|
HEAP32[$vararg_buffer>>2] = $1;
|
|
(_printf(2789,$vararg_buffer)|0);
|
|
$2 = HEAP32[9250]|0;
|
|
$3 = $2 | 16;
|
|
HEAP32[9250] = $3;
|
|
$4 = HEAP32[5152]|0;
|
|
$5 = (($4) + 1)|0;
|
|
HEAP32[5152] = $5;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_dup() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2798,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_push() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2815,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_pull() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2833,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_drop() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
(_printf(2851,$vararg_buffer)|0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _emit_unaryop($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0;
|
|
$vararg_buffer13 = sp + 40|0;
|
|
$vararg_buffer10 = sp + 32|0;
|
|
$vararg_buffer7 = sp + 24|0;
|
|
$vararg_buffer4 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 48|0;
|
|
$2 = sp + 44|0;
|
|
HEAP32[$2>>2] = $0;
|
|
$3 = HEAP32[$2>>2]|0;
|
|
switch ($3|0) {
|
|
case 173: {
|
|
$4 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $4;
|
|
(_printf(2869,$vararg_buffer)|0);
|
|
break;
|
|
}
|
|
case 254: {
|
|
$5 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer1>>2] = $5;
|
|
(_printf(2886,$vararg_buffer1)|0);
|
|
break;
|
|
}
|
|
case 161: {
|
|
$6 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer4>>2] = $6;
|
|
(_printf(2904,$vararg_buffer4)|0);
|
|
break;
|
|
}
|
|
case 208: {
|
|
$7 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer7>>2] = $7;
|
|
(_printf(2921,$vararg_buffer7)|0);
|
|
break;
|
|
}
|
|
case 203: {
|
|
$8 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer10>>2] = $8;
|
|
(_printf(2939,$vararg_buffer10)|0);
|
|
break;
|
|
}
|
|
case 222: {
|
|
_emit_lb();
|
|
break;
|
|
}
|
|
case 170: {
|
|
_emit_lw();
|
|
break;
|
|
}
|
|
default: {
|
|
$9 = HEAP32[$2>>2]|0;
|
|
$10 = $9 & 127;
|
|
HEAP32[$vararg_buffer13>>2] = $10;
|
|
(_printf(2957,$vararg_buffer13)|0);
|
|
HEAP32[$1>>2] = 0;
|
|
$11 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($11|0);
|
|
}
|
|
}
|
|
HEAP32[$1>>2] = 1;
|
|
$11 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($11|0);
|
|
}
|
|
function _emit_op($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
|
|
var $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0, $vararg_buffer22 = 0, $vararg_buffer25 = 0, $vararg_buffer28 = 0, $vararg_buffer31 = 0, $vararg_buffer34 = 0, $vararg_buffer37 = 0, $vararg_buffer4 = 0, $vararg_buffer40 = 0, $vararg_buffer43 = 0, $vararg_buffer46 = 0, $vararg_buffer49 = 0;
|
|
var $vararg_buffer7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 160|0;
|
|
$vararg_buffer49 = sp + 136|0;
|
|
$vararg_buffer46 = sp + 128|0;
|
|
$vararg_buffer43 = sp + 120|0;
|
|
$vararg_buffer40 = sp + 112|0;
|
|
$vararg_buffer37 = sp + 104|0;
|
|
$vararg_buffer34 = sp + 96|0;
|
|
$vararg_buffer31 = sp + 88|0;
|
|
$vararg_buffer28 = sp + 80|0;
|
|
$vararg_buffer25 = sp + 72|0;
|
|
$vararg_buffer22 = sp + 64|0;
|
|
$vararg_buffer19 = sp + 56|0;
|
|
$vararg_buffer16 = sp + 48|0;
|
|
$vararg_buffer13 = sp + 40|0;
|
|
$vararg_buffer10 = sp + 32|0;
|
|
$vararg_buffer7 = sp + 24|0;
|
|
$vararg_buffer4 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 140|0;
|
|
$2 = sp + 144|0;
|
|
HEAP8[$2>>0] = $0;
|
|
$3 = HEAP8[$2>>0]|0;
|
|
$4 = $3&255;
|
|
do {
|
|
switch ($4|0) {
|
|
case 170: {
|
|
$5 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer>>2] = $5;
|
|
(_printf(2979,$vararg_buffer)|0);
|
|
break;
|
|
}
|
|
case 175: {
|
|
$6 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer1>>2] = $6;
|
|
(_printf(2996,$vararg_buffer1)|0);
|
|
break;
|
|
}
|
|
case 165: {
|
|
$7 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer4>>2] = $7;
|
|
(_printf(3013,$vararg_buffer4)|0);
|
|
break;
|
|
}
|
|
case 171: {
|
|
$8 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer7>>2] = $8;
|
|
(_printf(3030,$vararg_buffer7)|0);
|
|
break;
|
|
}
|
|
case 173: {
|
|
$9 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer10>>2] = $9;
|
|
(_printf(3047,$vararg_buffer10)|0);
|
|
break;
|
|
}
|
|
case 204: {
|
|
$10 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer13>>2] = $10;
|
|
(_printf(3064,$vararg_buffer13)|0);
|
|
break;
|
|
}
|
|
case 210: {
|
|
$11 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer16>>2] = $11;
|
|
(_printf(3081,$vararg_buffer16)|0);
|
|
break;
|
|
}
|
|
case 166: {
|
|
$12 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer19>>2] = $12;
|
|
(_printf(3098,$vararg_buffer19)|0);
|
|
break;
|
|
}
|
|
case 252: {
|
|
$13 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer22>>2] = $13;
|
|
(_printf(3115,$vararg_buffer22)|0);
|
|
break;
|
|
}
|
|
case 222: {
|
|
$14 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer25>>2] = $14;
|
|
(_printf(3132,$vararg_buffer25)|0);
|
|
break;
|
|
}
|
|
case 197: {
|
|
$15 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer28>>2] = $15;
|
|
(_printf(3149,$vararg_buffer28)|0);
|
|
break;
|
|
}
|
|
case 213: {
|
|
$16 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer31>>2] = $16;
|
|
(_printf(3167,$vararg_buffer31)|0);
|
|
break;
|
|
}
|
|
case 200: {
|
|
$17 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer34>>2] = $17;
|
|
(_printf(3185,$vararg_buffer34)|0);
|
|
break;
|
|
}
|
|
case 188: {
|
|
$18 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer37>>2] = $18;
|
|
(_printf(3203,$vararg_buffer37)|0);
|
|
break;
|
|
}
|
|
case 190: {
|
|
$19 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer40>>2] = $19;
|
|
(_printf(3221,$vararg_buffer40)|0);
|
|
break;
|
|
}
|
|
case 194: {
|
|
$20 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer43>>2] = $20;
|
|
(_printf(3239,$vararg_buffer43)|0);
|
|
break;
|
|
}
|
|
case 207: {
|
|
$21 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer46>>2] = $21;
|
|
(_printf(3257,$vararg_buffer46)|0);
|
|
break;
|
|
}
|
|
case 206: {
|
|
$22 = HEAP32[3]|0;
|
|
HEAP32[$vararg_buffer49>>2] = $22;
|
|
(_printf(3274,$vararg_buffer49)|0);
|
|
break;
|
|
}
|
|
case 172: {
|
|
break;
|
|
}
|
|
default: {
|
|
HEAP32[$1>>2] = 0;
|
|
$23 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($23|0);
|
|
}
|
|
}
|
|
} while(0);
|
|
HEAP32[$1>>2] = 1;
|
|
$23 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($23|0);
|
|
}
|
|
function _parse_error($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
|
|
var $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer5 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer5 = sp + 24|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 32|0;
|
|
$2 = sp + 28|0;
|
|
HEAP32[$1>>2] = $0;
|
|
$3 = HEAP32[9253]|0;
|
|
HEAP32[$2>>2] = $3;
|
|
$4 = HEAP32[9]|0;
|
|
$5 = HEAP32[9254]|0;
|
|
$6 = HEAP32[9251]|0;
|
|
$7 = HEAP32[9253]|0;
|
|
$8 = HEAP32[9254]|0;
|
|
$9 = (_strlen($8)|0);
|
|
HEAP32[$vararg_buffer>>2] = $5;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $6;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $7;
|
|
$vararg_ptr3 = ((($vararg_buffer)) + 12|0);
|
|
HEAP32[$vararg_ptr3>>2] = $9;
|
|
$vararg_ptr4 = ((($vararg_buffer)) + 16|0);
|
|
HEAP32[$vararg_ptr4>>2] = 111812;
|
|
(_fprintf($4,3509,$vararg_buffer)|0);
|
|
$10 = HEAP32[9253]|0;
|
|
HEAP32[$2>>2] = $10;
|
|
while(1) {
|
|
$11 = HEAP32[$2>>2]|0;
|
|
$12 = HEAP32[9255]|0;
|
|
$13 = ($11|0)!=($12|0);
|
|
if (!($13)) {
|
|
break;
|
|
}
|
|
$14 = HEAP32[$2>>2]|0;
|
|
$15 = HEAP8[$14>>0]|0;
|
|
$16 = $15 << 24 >> 24;
|
|
$17 = ($16|0)==(9);
|
|
$18 = $17 ? 9 : 32;
|
|
$19 = HEAP32[9]|0;
|
|
(_putc($18,$19)|0);
|
|
$20 = HEAP32[$2>>2]|0;
|
|
$21 = ((($20)) + 1|0);
|
|
HEAP32[$2>>2] = $21;
|
|
}
|
|
$22 = HEAP32[9]|0;
|
|
$23 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer5>>2] = $23;
|
|
(_fprintf($22,3532,$vararg_buffer5)|0);
|
|
_exit(1);
|
|
// unreachable;
|
|
}
|
|
function _hexdigit($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $3 = 0;
|
|
var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp;
|
|
$2 = sp + 4|0;
|
|
HEAP8[$2>>0] = $0;
|
|
$3 = HEAP8[$2>>0]|0;
|
|
$4 = $3 << 24 >> 24;
|
|
$5 = (_toupper($4)|0);
|
|
$6 = $5&255;
|
|
HEAP8[$2>>0] = $6;
|
|
$7 = HEAP8[$2>>0]|0;
|
|
$8 = $7 << 24 >> 24;
|
|
$9 = ($8|0)>=(48);
|
|
if ($9) {
|
|
$10 = HEAP8[$2>>0]|0;
|
|
$11 = $10 << 24 >> 24;
|
|
$12 = ($11|0)<=(57);
|
|
if ($12) {
|
|
$13 = HEAP8[$2>>0]|0;
|
|
$14 = $13 << 24 >> 24;
|
|
$15 = (($14) - 48)|0;
|
|
HEAP32[$1>>2] = $15;
|
|
$26 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($26|0);
|
|
}
|
|
}
|
|
$16 = HEAP8[$2>>0]|0;
|
|
$17 = $16 << 24 >> 24;
|
|
$18 = ($17|0)>=(65);
|
|
if ($18) {
|
|
$19 = HEAP8[$2>>0]|0;
|
|
$20 = $19 << 24 >> 24;
|
|
$21 = ($20|0)<=(70);
|
|
if ($21) {
|
|
$22 = HEAP8[$2>>0]|0;
|
|
$23 = $22 << 24 >> 24;
|
|
$24 = (($23) - 65)|0;
|
|
$25 = (($24) + 10)|0;
|
|
HEAP32[$1>>2] = $25;
|
|
$26 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($26|0);
|
|
}
|
|
}
|
|
HEAP32[$1>>2] = -1;
|
|
$26 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($26|0);
|
|
}
|
|
function _scan() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
|
|
var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
|
|
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
|
|
var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
|
|
var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
|
|
var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0;
|
|
var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0;
|
|
var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0;
|
|
var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0;
|
|
var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0;
|
|
var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0;
|
|
var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0;
|
|
var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0;
|
|
var $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0;
|
|
var $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0;
|
|
var $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $39 = 0, $4 = 0, $40 = 0;
|
|
var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0;
|
|
var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
|
|
var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0;
|
|
var $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$0 = sp + 16|0;
|
|
$1 = sp + 12|0;
|
|
$2 = sp + 8|0;
|
|
$3 = sp + 4|0;
|
|
$4 = sp;
|
|
while(1) {
|
|
$5 = HEAP32[6]|0;
|
|
$6 = HEAP8[$5>>0]|0;
|
|
$7 = $6 << 24 >> 24;
|
|
$8 = ($7|0)!=(0);
|
|
if ($8) {
|
|
$9 = HEAP32[6]|0;
|
|
$10 = HEAP8[$9>>0]|0;
|
|
$11 = $10 << 24 >> 24;
|
|
$12 = ($11|0)==(32);
|
|
if ($12) {
|
|
$382 = 1;
|
|
} else {
|
|
$13 = HEAP32[6]|0;
|
|
$14 = HEAP8[$13>>0]|0;
|
|
$15 = $14 << 24 >> 24;
|
|
$16 = ($15|0)==(9);
|
|
$382 = $16;
|
|
}
|
|
} else {
|
|
$382 = 0;
|
|
}
|
|
$17 = HEAP32[6]|0;
|
|
if (!($382)) {
|
|
break;
|
|
}
|
|
$18 = ((($17)) + 1|0);
|
|
HEAP32[6] = $18;
|
|
}
|
|
HEAP32[9255] = $17;
|
|
$19 = HEAP8[111813]|0;
|
|
$20 = $19&255;
|
|
$21 = ($20|0)==(255);
|
|
L9: do {
|
|
if (!($21)) {
|
|
$22 = HEAP32[6]|0;
|
|
$23 = HEAP8[$22>>0]|0;
|
|
$24 = $23 << 24 >> 24;
|
|
$25 = ($24|0)==(0);
|
|
if (!($25)) {
|
|
$26 = HEAP32[6]|0;
|
|
$27 = HEAP8[$26>>0]|0;
|
|
$28 = $27 << 24 >> 24;
|
|
$29 = ($28|0)==(10);
|
|
if (!($29)) {
|
|
$30 = HEAP32[6]|0;
|
|
$31 = HEAP8[$30>>0]|0;
|
|
$32 = $31 << 24 >> 24;
|
|
$33 = ($32|0)==(59);
|
|
if (!($33)) {
|
|
$34 = HEAP32[6]|0;
|
|
$35 = HEAP8[$34>>0]|0;
|
|
$36 = $35 << 24 >> 24;
|
|
$37 = ($36|0)>=(97);
|
|
if ($37) {
|
|
$38 = HEAP32[6]|0;
|
|
$39 = HEAP8[$38>>0]|0;
|
|
$40 = $39 << 24 >> 24;
|
|
$41 = ($40|0)<=(122);
|
|
if (!($41)) {
|
|
label = 14;
|
|
}
|
|
} else {
|
|
label = 14;
|
|
}
|
|
do {
|
|
if ((label|0) == 14) {
|
|
$42 = HEAP32[6]|0;
|
|
$43 = HEAP8[$42>>0]|0;
|
|
$44 = $43 << 24 >> 24;
|
|
$45 = ($44|0)>=(65);
|
|
if ($45) {
|
|
$46 = HEAP32[6]|0;
|
|
$47 = HEAP8[$46>>0]|0;
|
|
$48 = $47 << 24 >> 24;
|
|
$49 = ($48|0)<=(90);
|
|
if ($49) {
|
|
break;
|
|
}
|
|
}
|
|
$50 = HEAP32[6]|0;
|
|
$51 = HEAP8[$50>>0]|0;
|
|
$52 = $51 << 24 >> 24;
|
|
$53 = ($52|0)==(95);
|
|
if (!($53)) {
|
|
$138 = HEAP32[6]|0;
|
|
$139 = HEAP8[$138>>0]|0;
|
|
$140 = $139 << 24 >> 24;
|
|
$141 = ($140|0)>=(48);
|
|
if ($141) {
|
|
$142 = HEAP32[6]|0;
|
|
$143 = HEAP8[$142>>0]|0;
|
|
$144 = $143 << 24 >> 24;
|
|
$145 = ($144|0)<=(57);
|
|
if ($145) {
|
|
HEAP32[9257] = 0;
|
|
while(1) {
|
|
$146 = HEAP32[6]|0;
|
|
$147 = HEAP8[$146>>0]|0;
|
|
$148 = $147 << 24 >> 24;
|
|
$149 = ($148|0)>=(48);
|
|
if (!($149)) {
|
|
break;
|
|
}
|
|
$150 = HEAP32[6]|0;
|
|
$151 = HEAP8[$150>>0]|0;
|
|
$152 = $151 << 24 >> 24;
|
|
$153 = ($152|0)<=(57);
|
|
if (!($153)) {
|
|
break;
|
|
}
|
|
$154 = HEAP32[9257]|0;
|
|
$155 = ($154*10)|0;
|
|
$156 = HEAP32[6]|0;
|
|
$157 = HEAP8[$156>>0]|0;
|
|
$158 = $157 << 24 >> 24;
|
|
$159 = (($155) + ($158))|0;
|
|
$160 = (($159) - 48)|0;
|
|
HEAP32[9257] = $160;
|
|
$161 = HEAP32[6]|0;
|
|
$162 = ((($161)) + 1|0);
|
|
HEAP32[6] = $162;
|
|
}
|
|
HEAP8[111813] = -38;
|
|
break L9;
|
|
}
|
|
}
|
|
$163 = HEAP32[6]|0;
|
|
$164 = HEAP8[$163>>0]|0;
|
|
$165 = $164 << 24 >> 24;
|
|
$166 = ($165|0)==(36);
|
|
if ($166) {
|
|
HEAP32[9257] = 0;
|
|
while(1) {
|
|
$167 = HEAP32[6]|0;
|
|
$168 = ((($167)) + 1|0);
|
|
HEAP32[6] = $168;
|
|
$169 = ($167|0)!=(0|0);
|
|
if (!($169)) {
|
|
break;
|
|
}
|
|
$170 = HEAP32[6]|0;
|
|
$171 = HEAP8[$170>>0]|0;
|
|
$172 = (_hexdigit($171)|0);
|
|
$173 = ($172|0)>=(0);
|
|
if (!($173)) {
|
|
break;
|
|
}
|
|
$174 = HEAP32[9257]|0;
|
|
$175 = $174<<4;
|
|
$176 = HEAP32[6]|0;
|
|
$177 = HEAP8[$176>>0]|0;
|
|
$178 = (_hexdigit($177)|0);
|
|
$179 = (($175) + ($178))|0;
|
|
HEAP32[9257] = $179;
|
|
}
|
|
HEAP8[111813] = -38;
|
|
break L9;
|
|
}
|
|
$180 = HEAP32[6]|0;
|
|
$181 = HEAP8[$180>>0]|0;
|
|
$182 = $181 << 24 >> 24;
|
|
$183 = ($182|0)==(39);
|
|
if ($183) {
|
|
HEAP8[111813] = -39;
|
|
$184 = HEAP32[6]|0;
|
|
$185 = ((($184)) + 1|0);
|
|
$186 = HEAP8[$185>>0]|0;
|
|
$187 = $186 << 24 >> 24;
|
|
$188 = ($187|0)!=(92);
|
|
$189 = HEAP32[6]|0;
|
|
if ($188) {
|
|
$190 = ((($189)) + 1|0);
|
|
$191 = HEAP8[$190>>0]|0;
|
|
$192 = $191 << 24 >> 24;
|
|
HEAP32[9257] = $192;
|
|
$193 = HEAP32[6]|0;
|
|
$194 = ((($193)) + 2|0);
|
|
$195 = HEAP8[$194>>0]|0;
|
|
$196 = $195 << 24 >> 24;
|
|
$197 = ($196|0)!=(39);
|
|
if (!($197)) {
|
|
$198 = HEAP32[6]|0;
|
|
$199 = ((($198)) + 3|0);
|
|
HEAP32[6] = $199;
|
|
break L9;
|
|
}
|
|
_parse_error(3545);
|
|
HEAP8[$0>>0] = -1;
|
|
$381 = HEAP8[$0>>0]|0;
|
|
STACKTOP = sp;return ($381|0);
|
|
}
|
|
$200 = ((($189)) + 2|0);
|
|
$201 = HEAP8[$200>>0]|0;
|
|
$202 = $201 << 24 >> 24;
|
|
switch ($202|0) {
|
|
case 110: {
|
|
HEAP32[9257] = 13;
|
|
break;
|
|
}
|
|
case 114: {
|
|
HEAP32[9257] = 10;
|
|
break;
|
|
}
|
|
case 116: {
|
|
HEAP32[9257] = 9;
|
|
break;
|
|
}
|
|
case 39: {
|
|
HEAP32[9257] = 39;
|
|
break;
|
|
}
|
|
case 92: {
|
|
HEAP32[9257] = 92;
|
|
break;
|
|
}
|
|
case 48: {
|
|
HEAP32[9257] = 0;
|
|
break;
|
|
}
|
|
default: {
|
|
_parse_error(3545);
|
|
HEAP8[$0>>0] = -1;
|
|
$381 = HEAP8[$0>>0]|0;
|
|
STACKTOP = sp;return ($381|0);
|
|
}
|
|
}
|
|
$203 = HEAP32[6]|0;
|
|
$204 = ((($203)) + 3|0);
|
|
$205 = HEAP8[$204>>0]|0;
|
|
$206 = $205 << 24 >> 24;
|
|
$207 = ($206|0)!=(39);
|
|
if (!($207)) {
|
|
$208 = HEAP32[6]|0;
|
|
$209 = ((($208)) + 4|0);
|
|
HEAP32[6] = $209;
|
|
break L9;
|
|
}
|
|
_parse_error(3545);
|
|
HEAP8[$0>>0] = -1;
|
|
$381 = HEAP8[$0>>0]|0;
|
|
STACKTOP = sp;return ($381|0);
|
|
}
|
|
$210 = HEAP32[6]|0;
|
|
$211 = HEAP8[$210>>0]|0;
|
|
$212 = $211 << 24 >> 24;
|
|
$213 = ($212|0)==(34);
|
|
if ($213) {
|
|
HEAP8[111813] = -45;
|
|
$214 = HEAP32[6]|0;
|
|
$215 = ((($214)) + 1|0);
|
|
HEAP32[6] = $215;
|
|
$216 = $215;
|
|
HEAP32[9257] = $216;
|
|
L66: while(1) {
|
|
$217 = HEAP32[6]|0;
|
|
$218 = HEAP8[$217>>0]|0;
|
|
$219 = $218 << 24 >> 24;
|
|
$220 = ($219|0)!=(0);
|
|
if ($220) {
|
|
$221 = HEAP32[6]|0;
|
|
$222 = HEAP8[$221>>0]|0;
|
|
$223 = $222 << 24 >> 24;
|
|
$224 = ($223|0)!=(34);
|
|
$383 = $224;
|
|
} else {
|
|
$383 = 0;
|
|
}
|
|
$225 = HEAP32[6]|0;
|
|
if (!($383)) {
|
|
label = 87;
|
|
break;
|
|
}
|
|
$226 = HEAP8[$225>>0]|0;
|
|
$227 = $226 << 24 >> 24;
|
|
$228 = ($227|0)==(92);
|
|
L72: do {
|
|
if ($228) {
|
|
HEAP32[$4>>2] = 1;
|
|
$229 = HEAP32[6]|0;
|
|
$230 = ((($229)) + 1|0);
|
|
$231 = HEAP8[$230>>0]|0;
|
|
$232 = $231 << 24 >> 24;
|
|
switch ($232|0) {
|
|
case 110: {
|
|
$233 = HEAP32[6]|0;
|
|
HEAP8[$233>>0] = 13;
|
|
break;
|
|
}
|
|
case 114: {
|
|
$234 = HEAP32[6]|0;
|
|
HEAP8[$234>>0] = 10;
|
|
break;
|
|
}
|
|
case 116: {
|
|
$235 = HEAP32[6]|0;
|
|
HEAP8[$235>>0] = 9;
|
|
break;
|
|
}
|
|
case 39: {
|
|
$236 = HEAP32[6]|0;
|
|
HEAP8[$236>>0] = 39;
|
|
break;
|
|
}
|
|
case 34: {
|
|
$237 = HEAP32[6]|0;
|
|
HEAP8[$237>>0] = 34;
|
|
break;
|
|
}
|
|
case 92: {
|
|
$238 = HEAP32[6]|0;
|
|
HEAP8[$238>>0] = 92;
|
|
break;
|
|
}
|
|
case 48: {
|
|
$239 = HEAP32[6]|0;
|
|
HEAP8[$239>>0] = 0;
|
|
break;
|
|
}
|
|
case 36: {
|
|
$240 = HEAP32[6]|0;
|
|
$241 = ((($240)) + 2|0);
|
|
$242 = HEAP8[$241>>0]|0;
|
|
$243 = (_hexdigit($242)|0);
|
|
$244 = ($243|0)<(0);
|
|
if ($244) {
|
|
label = 80;
|
|
break L66;
|
|
}
|
|
$245 = HEAP32[6]|0;
|
|
$246 = ((($245)) + 3|0);
|
|
$247 = HEAP8[$246>>0]|0;
|
|
$248 = (_hexdigit($247)|0);
|
|
$249 = ($248|0)<(0);
|
|
if ($249) {
|
|
label = 80;
|
|
break L66;
|
|
}
|
|
$250 = HEAP32[6]|0;
|
|
$251 = ((($250)) + 2|0);
|
|
$252 = HEAP8[$251>>0]|0;
|
|
$253 = (_hexdigit($252)|0);
|
|
$254 = $253<<4;
|
|
$255 = HEAP32[6]|0;
|
|
$256 = ((($255)) + 3|0);
|
|
$257 = HEAP8[$256>>0]|0;
|
|
$258 = (_hexdigit($257)|0);
|
|
$259 = (($254) + ($258))|0;
|
|
$260 = $259&255;
|
|
$261 = HEAP32[6]|0;
|
|
HEAP8[$261>>0] = $260;
|
|
HEAP32[$4>>2] = 3;
|
|
break;
|
|
}
|
|
default: {
|
|
label = 82;
|
|
break L66;
|
|
}
|
|
}
|
|
$262 = HEAP32[6]|0;
|
|
$263 = ((($262)) + 1|0);
|
|
HEAP32[$3>>2] = $263;
|
|
while(1) {
|
|
$264 = HEAP32[$3>>2]|0;
|
|
$265 = HEAP8[$264>>0]|0;
|
|
$266 = ($265<<24>>24)!=(0);
|
|
if (!($266)) {
|
|
break L72;
|
|
}
|
|
$267 = HEAP32[$4>>2]|0;
|
|
$268 = HEAP32[$3>>2]|0;
|
|
$269 = (($268) + ($267)|0);
|
|
$270 = HEAP8[$269>>0]|0;
|
|
$271 = HEAP32[$3>>2]|0;
|
|
HEAP8[$271>>0] = $270;
|
|
$272 = HEAP32[$3>>2]|0;
|
|
$273 = ((($272)) + 1|0);
|
|
HEAP32[$3>>2] = $273;
|
|
}
|
|
}
|
|
} while(0);
|
|
$274 = HEAP32[6]|0;
|
|
$275 = ((($274)) + 1|0);
|
|
HEAP32[6] = $275;
|
|
}
|
|
if ((label|0) == 80) {
|
|
_parse_error(3568);
|
|
HEAP8[$0>>0] = -1;
|
|
$381 = HEAP8[$0>>0]|0;
|
|
STACKTOP = sp;return ($381|0);
|
|
}
|
|
else if ((label|0) == 82) {
|
|
_parse_error(3568);
|
|
HEAP8[$0>>0] = -1;
|
|
$381 = HEAP8[$0>>0]|0;
|
|
STACKTOP = sp;return ($381|0);
|
|
}
|
|
else if ((label|0) == 87) {
|
|
$276 = ((($225)) + 1|0);
|
|
HEAP32[6] = $276;
|
|
$277 = HEAP8[$225>>0]|0;
|
|
$278 = ($277<<24>>24)!=(0);
|
|
if ($278) {
|
|
break L9;
|
|
}
|
|
_parse_error(3588);
|
|
HEAP8[$0>>0] = -1;
|
|
$381 = HEAP8[$0>>0]|0;
|
|
STACKTOP = sp;return ($381|0);
|
|
}
|
|
}
|
|
$279 = HEAP32[6]|0;
|
|
$280 = HEAP8[$279>>0]|0;
|
|
$281 = $280 << 24 >> 24;
|
|
switch ($281|0) {
|
|
case 62: {
|
|
$282 = HEAP32[6]|0;
|
|
$283 = ((($282)) + 1|0);
|
|
$284 = HEAP8[$283>>0]|0;
|
|
$285 = $284 << 24 >> 24;
|
|
$286 = ($285|0)==(62);
|
|
if ($286) {
|
|
HEAP8[111813] = -46;
|
|
$287 = HEAP32[6]|0;
|
|
$288 = ((($287)) + 2|0);
|
|
HEAP32[6] = $288;
|
|
break L9;
|
|
}
|
|
$289 = HEAP32[6]|0;
|
|
$290 = ((($289)) + 1|0);
|
|
$291 = HEAP8[$290>>0]|0;
|
|
$292 = $291 << 24 >> 24;
|
|
$293 = ($292|0)==(61);
|
|
if ($293) {
|
|
HEAP8[111813] = -56;
|
|
$294 = HEAP32[6]|0;
|
|
$295 = ((($294)) + 2|0);
|
|
HEAP32[6] = $295;
|
|
break L9;
|
|
} else {
|
|
HEAP8[111813] = -66;
|
|
$296 = HEAP32[6]|0;
|
|
$297 = ((($296)) + 1|0);
|
|
HEAP32[6] = $297;
|
|
break L9;
|
|
}
|
|
break;
|
|
}
|
|
case 60: {
|
|
$298 = HEAP32[6]|0;
|
|
$299 = ((($298)) + 1|0);
|
|
$300 = HEAP8[$299>>0]|0;
|
|
$301 = $300 << 24 >> 24;
|
|
$302 = ($301|0)==(60);
|
|
if ($302) {
|
|
HEAP8[111813] = -52;
|
|
$303 = HEAP32[6]|0;
|
|
$304 = ((($303)) + 2|0);
|
|
HEAP32[6] = $304;
|
|
break L9;
|
|
}
|
|
$305 = HEAP32[6]|0;
|
|
$306 = ((($305)) + 1|0);
|
|
$307 = HEAP8[$306>>0]|0;
|
|
$308 = $307 << 24 >> 24;
|
|
$309 = ($308|0)==(61);
|
|
if ($309) {
|
|
HEAP8[111813] = -62;
|
|
$310 = HEAP32[6]|0;
|
|
$311 = ((($310)) + 2|0);
|
|
HEAP32[6] = $311;
|
|
break L9;
|
|
}
|
|
$312 = HEAP32[6]|0;
|
|
$313 = ((($312)) + 1|0);
|
|
$314 = HEAP8[$313>>0]|0;
|
|
$315 = $314 << 24 >> 24;
|
|
$316 = ($315|0)==(62);
|
|
if ($316) {
|
|
HEAP8[111813] = -43;
|
|
$317 = HEAP32[6]|0;
|
|
$318 = ((($317)) + 2|0);
|
|
HEAP32[6] = $318;
|
|
break L9;
|
|
} else {
|
|
HEAP8[111813] = -68;
|
|
$319 = HEAP32[6]|0;
|
|
$320 = ((($319)) + 1|0);
|
|
HEAP32[6] = $320;
|
|
break L9;
|
|
}
|
|
break;
|
|
}
|
|
case 61: {
|
|
$321 = HEAP32[6]|0;
|
|
$322 = ((($321)) + 1|0);
|
|
$323 = HEAP8[$322>>0]|0;
|
|
$324 = $323 << 24 >> 24;
|
|
$325 = ($324|0)==(61);
|
|
if ($325) {
|
|
HEAP8[111813] = -59;
|
|
$326 = HEAP32[6]|0;
|
|
$327 = ((($326)) + 2|0);
|
|
HEAP32[6] = $327;
|
|
break L9;
|
|
}
|
|
$328 = HEAP32[6]|0;
|
|
$329 = ((($328)) + 1|0);
|
|
$330 = HEAP8[$329>>0]|0;
|
|
$331 = $330 << 24 >> 24;
|
|
$332 = ($331|0)==(62);
|
|
if ($332) {
|
|
HEAP8[111813] = -9;
|
|
$333 = HEAP32[6]|0;
|
|
$334 = ((($333)) + 2|0);
|
|
HEAP32[6] = $334;
|
|
break L9;
|
|
} else {
|
|
HEAP8[111813] = -67;
|
|
$335 = HEAP32[6]|0;
|
|
$336 = ((($335)) + 1|0);
|
|
HEAP32[6] = $336;
|
|
break L9;
|
|
}
|
|
break;
|
|
}
|
|
case 43: {
|
|
$337 = HEAP32[6]|0;
|
|
$338 = ((($337)) + 1|0);
|
|
$339 = HEAP8[$338>>0]|0;
|
|
$340 = $339 << 24 >> 24;
|
|
$341 = ($340|0)==(43);
|
|
if ($341) {
|
|
HEAP8[111813] = -48;
|
|
$342 = HEAP32[6]|0;
|
|
$343 = ((($342)) + 2|0);
|
|
HEAP32[6] = $343;
|
|
break L9;
|
|
} else {
|
|
HEAP8[111813] = -85;
|
|
$344 = HEAP32[6]|0;
|
|
$345 = ((($344)) + 1|0);
|
|
HEAP32[6] = $345;
|
|
break L9;
|
|
}
|
|
break;
|
|
}
|
|
case 45: {
|
|
$346 = HEAP32[6]|0;
|
|
$347 = ((($346)) + 1|0);
|
|
$348 = HEAP8[$347>>0]|0;
|
|
$349 = $348 << 24 >> 24;
|
|
$350 = ($349|0)==(45);
|
|
if ($350) {
|
|
HEAP8[111813] = -53;
|
|
$351 = HEAP32[6]|0;
|
|
$352 = ((($351)) + 2|0);
|
|
HEAP32[6] = $352;
|
|
break L9;
|
|
}
|
|
$353 = HEAP32[6]|0;
|
|
$354 = ((($353)) + 1|0);
|
|
$355 = HEAP8[$354>>0]|0;
|
|
$356 = $355 << 24 >> 24;
|
|
$357 = ($356|0)==(62);
|
|
if ($357) {
|
|
HEAP8[111813] = -30;
|
|
$358 = HEAP32[6]|0;
|
|
$359 = ((($358)) + 2|0);
|
|
HEAP32[6] = $359;
|
|
break L9;
|
|
} else {
|
|
HEAP8[111813] = -83;
|
|
$360 = HEAP32[6]|0;
|
|
$361 = ((($360)) + 1|0);
|
|
HEAP32[6] = $361;
|
|
break L9;
|
|
}
|
|
break;
|
|
}
|
|
case 47: {
|
|
$362 = HEAP32[6]|0;
|
|
$363 = ((($362)) + 1|0);
|
|
$364 = HEAP8[$363>>0]|0;
|
|
$365 = $364 << 24 >> 24;
|
|
$366 = ($365|0)==(47);
|
|
if ($366) {
|
|
HEAP8[111813] = -128;
|
|
break L9;
|
|
} else {
|
|
HEAP8[111813] = -81;
|
|
$367 = HEAP32[6]|0;
|
|
$368 = ((($367)) + 1|0);
|
|
HEAP32[6] = $368;
|
|
break L9;
|
|
}
|
|
break;
|
|
}
|
|
default: {
|
|
$369 = HEAP32[6]|0;
|
|
$370 = ((($369)) + 1|0);
|
|
HEAP32[6] = $370;
|
|
$371 = HEAP8[$369>>0]|0;
|
|
$372 = $371 << 24 >> 24;
|
|
$373 = 128 | $372;
|
|
$374 = $373&255;
|
|
HEAP8[111813] = $374;
|
|
break L9;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
HEAP32[$1>>2] = 0;
|
|
HEAP32[$2>>2] = 0;
|
|
while(1) {
|
|
$54 = HEAP32[6]|0;
|
|
$55 = ((($54)) + 1|0);
|
|
HEAP32[6] = $55;
|
|
$56 = HEAP32[6]|0;
|
|
$57 = HEAP8[$56>>0]|0;
|
|
$58 = $57 << 24 >> 24;
|
|
$59 = ($58|0)>=(97);
|
|
if ($59) {
|
|
$60 = HEAP32[6]|0;
|
|
$61 = HEAP8[$60>>0]|0;
|
|
$62 = $61 << 24 >> 24;
|
|
$63 = ($62|0)<=(122);
|
|
if ($63) {
|
|
continue;
|
|
}
|
|
}
|
|
$64 = HEAP32[6]|0;
|
|
$65 = HEAP8[$64>>0]|0;
|
|
$66 = $65 << 24 >> 24;
|
|
$67 = ($66|0)>=(65);
|
|
if ($67) {
|
|
$68 = HEAP32[6]|0;
|
|
$69 = HEAP8[$68>>0]|0;
|
|
$70 = $69 << 24 >> 24;
|
|
$71 = ($70|0)<=(90);
|
|
if ($71) {
|
|
continue;
|
|
}
|
|
}
|
|
$72 = HEAP32[6]|0;
|
|
$73 = HEAP8[$72>>0]|0;
|
|
$74 = $73 << 24 >> 24;
|
|
$75 = ($74|0)==(95);
|
|
if ($75) {
|
|
continue;
|
|
}
|
|
$76 = HEAP32[6]|0;
|
|
$77 = HEAP8[$76>>0]|0;
|
|
$78 = $77 << 24 >> 24;
|
|
$79 = ($78|0)>=(48);
|
|
if (!($79)) {
|
|
break;
|
|
}
|
|
$80 = HEAP32[6]|0;
|
|
$81 = HEAP8[$80>>0]|0;
|
|
$82 = $81 << 24 >> 24;
|
|
$83 = ($82|0)<=(57);
|
|
if (!($83)) {
|
|
break;
|
|
}
|
|
}
|
|
HEAP8[111813] = -42;
|
|
$84 = HEAP32[6]|0;
|
|
$85 = HEAP32[9255]|0;
|
|
$86 = $84;
|
|
$87 = $85;
|
|
$88 = (($86) - ($87))|0;
|
|
HEAP32[9256] = $88;
|
|
L152: while(1) {
|
|
$89 = HEAP32[$1>>2]|0;
|
|
$90 = (3309 + ($89)|0);
|
|
$91 = HEAP8[$90>>0]|0;
|
|
$92 = $91&255;
|
|
$93 = ($92|0)!=(128);
|
|
if (!($93)) {
|
|
break L9;
|
|
}
|
|
while(1) {
|
|
$94 = HEAP32[$1>>2]|0;
|
|
$95 = (($94) + 1)|0;
|
|
$96 = HEAP32[$2>>2]|0;
|
|
$97 = (($95) + ($96))|0;
|
|
$98 = (3309 + ($97)|0);
|
|
$99 = HEAP8[$98>>0]|0;
|
|
$100 = $99&255;
|
|
$101 = HEAP32[$2>>2]|0;
|
|
$102 = HEAP32[9255]|0;
|
|
$103 = (($102) + ($101)|0);
|
|
$104 = HEAP8[$103>>0]|0;
|
|
$105 = $104 << 24 >> 24;
|
|
$106 = (_toupper($105)|0);
|
|
$107 = ($100|0)==($106|0);
|
|
if (!($107)) {
|
|
break;
|
|
}
|
|
$108 = HEAP32[$2>>2]|0;
|
|
$109 = (($108) + 1)|0;
|
|
HEAP32[$2>>2] = $109;
|
|
}
|
|
$110 = HEAP32[$1>>2]|0;
|
|
$111 = (($110) + 1)|0;
|
|
$112 = HEAP32[$2>>2]|0;
|
|
$113 = (($111) + ($112))|0;
|
|
$114 = (3309 + ($113)|0);
|
|
$115 = HEAP8[$114>>0]|0;
|
|
$116 = $115&255;
|
|
$117 = 128 & $116;
|
|
$118 = ($117|0)!=(0);
|
|
if ($118) {
|
|
$119 = HEAP32[$2>>2]|0;
|
|
$120 = HEAP32[9256]|0;
|
|
$121 = ($119|0)==($120|0);
|
|
if ($121) {
|
|
break;
|
|
}
|
|
}
|
|
$125 = HEAP32[$2>>2]|0;
|
|
$126 = (($125) + 1)|0;
|
|
$127 = HEAP32[$1>>2]|0;
|
|
$128 = (($127) + ($126))|0;
|
|
HEAP32[$1>>2] = $128;
|
|
HEAP32[$2>>2] = 0;
|
|
while(1) {
|
|
$129 = HEAP32[$1>>2]|0;
|
|
$130 = (3309 + ($129)|0);
|
|
$131 = HEAP8[$130>>0]|0;
|
|
$132 = $131&255;
|
|
$133 = 128 & $132;
|
|
$134 = ($133|0)!=(0);
|
|
$135 = $134 ^ 1;
|
|
if (!($135)) {
|
|
continue L152;
|
|
}
|
|
$136 = HEAP32[$1>>2]|0;
|
|
$137 = (($136) + 1)|0;
|
|
HEAP32[$1>>2] = $137;
|
|
}
|
|
}
|
|
$122 = HEAP32[$1>>2]|0;
|
|
$123 = (3309 + ($122)|0);
|
|
$124 = HEAP8[$123>>0]|0;
|
|
HEAP8[111813] = $124;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
HEAP8[111813] = -128;
|
|
}
|
|
} while(0);
|
|
$375 = HEAP32[6]|0;
|
|
$376 = HEAP32[9255]|0;
|
|
$377 = $375;
|
|
$378 = $376;
|
|
$379 = (($377) - ($378))|0;
|
|
HEAP32[9256] = $379;
|
|
$380 = HEAP8[111813]|0;
|
|
HEAP8[$0>>0] = $380;
|
|
$381 = HEAP8[$0>>0]|0;
|
|
STACKTOP = sp;return ($381|0);
|
|
}
|
|
function _scan_rewind($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[$1>>2]|0;
|
|
HEAP32[6] = $2;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _scan_lookahead() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$0 = sp + 16|0;
|
|
$1 = sp + 12|0;
|
|
$2 = sp + 8|0;
|
|
$3 = sp + 4|0;
|
|
$4 = sp;
|
|
$5 = HEAP32[6]|0;
|
|
HEAP32[$0>>2] = $5;
|
|
$6 = HEAP32[9255]|0;
|
|
HEAP32[$1>>2] = $6;
|
|
$7 = HEAP8[111813]|0;
|
|
$8 = $7&255;
|
|
HEAP32[$2>>2] = $8;
|
|
$9 = HEAP32[9256]|0;
|
|
HEAP32[$3>>2] = $9;
|
|
$10 = (_scan()|0);
|
|
$11 = $10&255;
|
|
HEAP32[$4>>2] = $11;
|
|
$12 = HEAP32[$0>>2]|0;
|
|
HEAP32[6] = $12;
|
|
$13 = HEAP32[$1>>2]|0;
|
|
HEAP32[9255] = $13;
|
|
$14 = HEAP32[$2>>2]|0;
|
|
$15 = $14&255;
|
|
HEAP8[111813] = $15;
|
|
$16 = HEAP32[$3>>2]|0;
|
|
HEAP32[9256] = $16;
|
|
$17 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
function _next_line() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
|
|
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer = sp;
|
|
$0 = sp + 20|0;
|
|
$1 = sp + 16|0;
|
|
$2 = sp + 24|0;
|
|
$3 = sp + 12|0;
|
|
$4 = HEAP32[9258]|0;
|
|
$5 = ($4|0)==(0|0);
|
|
if ($5) {
|
|
$6 = HEAP32[68]|0;
|
|
HEAP32[9258] = $6;
|
|
HEAP32[9254] = 3608;
|
|
}
|
|
$7 = HEAP32[6]|0;
|
|
$8 = HEAP8[$7>>0]|0;
|
|
$9 = $8 << 24 >> 24;
|
|
$10 = ($9|0)==(59);
|
|
if ($10) {
|
|
$11 = HEAP32[6]|0;
|
|
$12 = ((($11)) + 1|0);
|
|
HEAP32[6] = $12;
|
|
HEAP32[9253] = $12;
|
|
HEAP8[111813] = -128;
|
|
} else {
|
|
HEAP32[9253] = 111814;
|
|
HEAP32[6] = 111814;
|
|
$13 = HEAP32[9258]|0;
|
|
$14 = (_fgets(111814,512,$13)|0);
|
|
$15 = ($14|0)==(0|0);
|
|
do {
|
|
if ($15) {
|
|
HEAP8[111814] = 0;
|
|
$16 = HEAP32[9252]|0;
|
|
$17 = ($16|0)!=(0|0);
|
|
if ($17) {
|
|
$18 = HEAP32[9258]|0;
|
|
(_fclose($18)|0);
|
|
$19 = HEAP32[9254]|0;
|
|
_free($19);
|
|
$20 = HEAP32[9252]|0;
|
|
HEAP32[9258] = $20;
|
|
$21 = HEAP32[9259]|0;
|
|
HEAP32[9254] = $21;
|
|
$22 = HEAP32[9260]|0;
|
|
$23 = (($22) - 1)|0;
|
|
HEAP32[9251] = $23;
|
|
HEAP32[9252] = 0;
|
|
break;
|
|
}
|
|
HEAP8[111813] = -1;
|
|
HEAP32[$0>>2] = 255;
|
|
$73 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
} while(0);
|
|
$24 = (_strlen(111814)|0);
|
|
HEAP32[$1>>2] = $24;
|
|
$25 = HEAP32[$1>>2]|0;
|
|
$26 = ($25|0)>(0);
|
|
if ($26) {
|
|
$27 = HEAP32[$1>>2]|0;
|
|
$28 = (($27) - 1)|0;
|
|
$29 = (111814 + ($28)|0);
|
|
$30 = HEAP8[$29>>0]|0;
|
|
$31 = $30 << 24 >> 24;
|
|
$32 = ($31|0)==(10);
|
|
if ($32) {
|
|
$33 = HEAP32[$1>>2]|0;
|
|
$34 = (($33) - 1)|0;
|
|
$35 = (111814 + ($34)|0);
|
|
HEAP8[$35>>0] = 0;
|
|
}
|
|
}
|
|
$36 = HEAP32[9251]|0;
|
|
$37 = (($36) + 1)|0;
|
|
HEAP32[9251] = $37;
|
|
HEAP8[111813] = -128;
|
|
$38 = HEAP32[9254]|0;
|
|
$39 = HEAP32[9251]|0;
|
|
HEAP32[$vararg_buffer>>2] = $38;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $39;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = 111814;
|
|
(_printf(3616,$vararg_buffer)|0);
|
|
}
|
|
$40 = (_scan()|0);
|
|
HEAP8[$2>>0] = $40;
|
|
$41 = HEAP8[$2>>0]|0;
|
|
$42 = $41&255;
|
|
$43 = ($42|0)==(254);
|
|
if (!($43)) {
|
|
$71 = HEAP8[$2>>0]|0;
|
|
$72 = $71&255;
|
|
HEAP32[$0>>2] = $72;
|
|
$73 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
$44 = (_scan()|0);
|
|
HEAP8[$2>>0] = $44;
|
|
$45 = HEAP8[$2>>0]|0;
|
|
$46 = $45&255;
|
|
$47 = ($46|0)!=(211);
|
|
if ($47) {
|
|
_parse_error(3632);
|
|
HEAP8[111813] = -1;
|
|
HEAP32[$0>>2] = 255;
|
|
$73 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
$48 = HEAP32[9252]|0;
|
|
$49 = ($48|0)!=(0|0);
|
|
if ($49) {
|
|
_parse_error(3657);
|
|
HEAP8[111813] = -1;
|
|
HEAP32[$0>>2] = 255;
|
|
$73 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
$50 = HEAP32[9258]|0;
|
|
HEAP32[9252] = $50;
|
|
$51 = HEAP32[9254]|0;
|
|
HEAP32[9259] = $51;
|
|
$52 = HEAP32[9251]|0;
|
|
HEAP32[9260] = $52;
|
|
$53 = HEAP32[9256]|0;
|
|
$54 = (($53) - 1)|0;
|
|
$55 = (_malloc($54)|0);
|
|
HEAP32[$3>>2] = $55;
|
|
$56 = HEAP32[$3>>2]|0;
|
|
$57 = HEAP32[9257]|0;
|
|
$58 = $57;
|
|
$59 = HEAP32[9256]|0;
|
|
$60 = (($59) - 2)|0;
|
|
(_strncpy($56,$58,$60)|0);
|
|
$61 = HEAP32[9256]|0;
|
|
$62 = (($61) - 2)|0;
|
|
$63 = HEAP32[$3>>2]|0;
|
|
$64 = (($63) + ($62)|0);
|
|
HEAP8[$64>>0] = 0;
|
|
$65 = HEAP32[$3>>2]|0;
|
|
$66 = (_fopen($65,3692)|0);
|
|
HEAP32[9258] = $66;
|
|
$67 = HEAP32[9258]|0;
|
|
$68 = ($67|0)==(0|0);
|
|
if ($68) {
|
|
_parse_error(3694);
|
|
HEAP8[111813] = -1;
|
|
HEAP32[$0>>2] = 255;
|
|
$73 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
} else {
|
|
$69 = HEAP32[$3>>2]|0;
|
|
HEAP32[9254] = $69;
|
|
HEAP32[9251] = 0;
|
|
$70 = (_next_line()|0);
|
|
HEAP32[$0>>2] = $70;
|
|
$73 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _push_op($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp + 4|0;
|
|
$3 = sp;
|
|
HEAP8[$2>>0] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = HEAP32[7]|0;
|
|
$5 = (($4) + 1)|0;
|
|
HEAP32[7] = $5;
|
|
$6 = ($5|0)==(16);
|
|
if ($6) {
|
|
_parse_error(3757);
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
$7 = HEAP8[$2>>0]|0;
|
|
$8 = HEAP32[7]|0;
|
|
$9 = (112326 + ($8)|0);
|
|
HEAP8[$9>>0] = $7;
|
|
$10 = HEAP32[$3>>2]|0;
|
|
$11 = HEAP32[7]|0;
|
|
$12 = (37060 + ($11<<2)|0);
|
|
HEAP32[$12>>2] = $10;
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _pop_op() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$0 = sp;
|
|
$1 = HEAP32[7]|0;
|
|
$2 = ($1|0)<(0);
|
|
if ($2) {
|
|
_parse_error(3773);
|
|
HEAP8[$0>>0] = 0;
|
|
$7 = HEAP8[$0>>0]|0;
|
|
STACKTOP = sp;return ($7|0);
|
|
} else {
|
|
$3 = HEAP32[7]|0;
|
|
$4 = (($3) + -1)|0;
|
|
HEAP32[7] = $4;
|
|
$5 = (112326 + ($3)|0);
|
|
$6 = HEAP8[$5>>0]|0;
|
|
HEAP8[$0>>0] = $6;
|
|
$7 = HEAP8[$0>>0]|0;
|
|
STACKTOP = sp;return ($7|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _tos_op() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[7]|0;
|
|
$1 = ($0|0)<(0);
|
|
if ($1) {
|
|
$7 = 0;
|
|
} else {
|
|
$2 = HEAP32[7]|0;
|
|
$3 = (112326 + ($2)|0);
|
|
$4 = HEAP8[$3>>0]|0;
|
|
$5 = $4&255;
|
|
$7 = $5;
|
|
}
|
|
$6 = $7&255;
|
|
return ($6|0);
|
|
}
|
|
function _tos_op_prec($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = HEAP32[7]|0;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = ($2|0)<=($3|0);
|
|
if ($4) {
|
|
$8 = 100;
|
|
STACKTOP = sp;return ($8|0);
|
|
}
|
|
$5 = HEAP32[7]|0;
|
|
$6 = (37060 + ($5<<2)|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = $7;
|
|
STACKTOP = sp;return ($8|0);
|
|
}
|
|
function _push_val($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$5>>2] = $2;
|
|
$6 = HEAP32[8]|0;
|
|
$7 = (($6) + 1)|0;
|
|
HEAP32[8] = $7;
|
|
$8 = ($7|0)==(16);
|
|
if ($8) {
|
|
_parse_error(3757);
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
$9 = HEAP32[$3>>2]|0;
|
|
$10 = HEAP32[8]|0;
|
|
$11 = (37124 + ($10<<2)|0);
|
|
HEAP32[$11>>2] = $9;
|
|
$12 = HEAP32[$4>>2]|0;
|
|
$13 = HEAP32[8]|0;
|
|
$14 = (37188 + ($13<<2)|0);
|
|
HEAP32[$14>>2] = $12;
|
|
$15 = HEAP32[$5>>2]|0;
|
|
$16 = HEAP32[8]|0;
|
|
$17 = (37252 + ($16<<2)|0);
|
|
HEAP32[$17>>2] = $15;
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _pop_val($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$3 = sp + 12|0;
|
|
$4 = sp + 8|0;
|
|
$5 = sp + 4|0;
|
|
$6 = sp;
|
|
HEAP32[$4>>2] = $0;
|
|
HEAP32[$5>>2] = $1;
|
|
HEAP32[$6>>2] = $2;
|
|
$7 = HEAP32[8]|0;
|
|
$8 = ($7|0)<(0);
|
|
if ($8) {
|
|
_parse_error(3773);
|
|
HEAP32[$3>>2] = -1;
|
|
$23 = HEAP32[$3>>2]|0;
|
|
STACKTOP = sp;return ($23|0);
|
|
} else {
|
|
$9 = HEAP32[8]|0;
|
|
$10 = (37124 + ($9<<2)|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = HEAP32[$4>>2]|0;
|
|
HEAP32[$12>>2] = $11;
|
|
$13 = HEAP32[8]|0;
|
|
$14 = (37188 + ($13<<2)|0);
|
|
$15 = HEAP32[$14>>2]|0;
|
|
$16 = HEAP32[$5>>2]|0;
|
|
HEAP32[$16>>2] = $15;
|
|
$17 = HEAP32[8]|0;
|
|
$18 = (37252 + ($17<<2)|0);
|
|
$19 = HEAP32[$18>>2]|0;
|
|
$20 = HEAP32[$6>>2]|0;
|
|
HEAP32[$20>>2] = $19;
|
|
$21 = HEAP32[8]|0;
|
|
$22 = (($21) + -1)|0;
|
|
HEAP32[8] = $22;
|
|
HEAP32[$3>>2] = $21;
|
|
$23 = HEAP32[$3>>2]|0;
|
|
STACKTOP = sp;return ($23|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _calc_op($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
|
|
var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$1 = sp + 24|0;
|
|
$2 = sp + 28|0;
|
|
$3 = sp + 20|0;
|
|
$4 = sp + 16|0;
|
|
$5 = sp + 12|0;
|
|
$6 = sp + 8|0;
|
|
$7 = sp + 4|0;
|
|
$8 = sp;
|
|
HEAP8[$2>>0] = $0;
|
|
$9 = (_pop_val($4,$6,$8)|0);
|
|
$10 = ($9|0)!=(0);
|
|
if (!($10)) {
|
|
HEAP32[$1>>2] = 0;
|
|
$56 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($56|0);
|
|
}
|
|
(_pop_val($3,$5,$7)|0);
|
|
$11 = HEAP32[$7>>2]|0;
|
|
$12 = ($11|0)!=(1);
|
|
$13 = HEAP32[$8>>2]|0;
|
|
$14 = ($13|0)!=(1);
|
|
$or$cond = $12 | $14;
|
|
if ($or$cond) {
|
|
_parse_error(3790);
|
|
HEAP32[$1>>2] = 0;
|
|
$56 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($56|0);
|
|
}
|
|
$15 = HEAP8[$2>>0]|0;
|
|
$16 = $15&255;
|
|
do {
|
|
switch ($16|0) {
|
|
case 170: {
|
|
$17 = HEAP32[$4>>2]|0;
|
|
$18 = HEAP32[$3>>2]|0;
|
|
$19 = Math_imul($18, $17)|0;
|
|
HEAP32[$3>>2] = $19;
|
|
break;
|
|
}
|
|
case 175: {
|
|
$20 = HEAP32[$4>>2]|0;
|
|
$21 = HEAP32[$3>>2]|0;
|
|
$22 = (($21|0) / ($20|0))&-1;
|
|
HEAP32[$3>>2] = $22;
|
|
break;
|
|
}
|
|
case 165: {
|
|
$23 = HEAP32[$4>>2]|0;
|
|
$24 = HEAP32[$3>>2]|0;
|
|
$25 = (($24|0) % ($23|0))&-1;
|
|
HEAP32[$3>>2] = $25;
|
|
break;
|
|
}
|
|
case 171: {
|
|
$26 = HEAP32[$4>>2]|0;
|
|
$27 = HEAP32[$3>>2]|0;
|
|
$28 = (($27) + ($26))|0;
|
|
HEAP32[$3>>2] = $28;
|
|
break;
|
|
}
|
|
case 173: {
|
|
$29 = HEAP32[$4>>2]|0;
|
|
$30 = HEAP32[$3>>2]|0;
|
|
$31 = (($30) - ($29))|0;
|
|
HEAP32[$3>>2] = $31;
|
|
break;
|
|
}
|
|
case 204: {
|
|
$32 = HEAP32[$4>>2]|0;
|
|
$33 = HEAP32[$3>>2]|0;
|
|
$34 = $33 << $32;
|
|
HEAP32[$3>>2] = $34;
|
|
break;
|
|
}
|
|
case 210: {
|
|
$35 = HEAP32[$4>>2]|0;
|
|
$36 = HEAP32[$3>>2]|0;
|
|
$37 = $36 >> $35;
|
|
HEAP32[$3>>2] = $37;
|
|
break;
|
|
}
|
|
case 166: {
|
|
$38 = HEAP32[$4>>2]|0;
|
|
$39 = HEAP32[$3>>2]|0;
|
|
$40 = $39 & $38;
|
|
HEAP32[$3>>2] = $40;
|
|
break;
|
|
}
|
|
case 252: {
|
|
$41 = HEAP32[$4>>2]|0;
|
|
$42 = HEAP32[$3>>2]|0;
|
|
$43 = $42 | $41;
|
|
HEAP32[$3>>2] = $43;
|
|
break;
|
|
}
|
|
case 222: {
|
|
$44 = HEAP32[$4>>2]|0;
|
|
$45 = HEAP32[$3>>2]|0;
|
|
$46 = $45 ^ $44;
|
|
HEAP32[$3>>2] = $46;
|
|
break;
|
|
}
|
|
default: {
|
|
HEAP32[$1>>2] = 0;
|
|
$56 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($56|0);
|
|
}
|
|
}
|
|
} while(0);
|
|
$47 = HEAP32[$5>>2]|0;
|
|
$48 = HEAP32[$6>>2]|0;
|
|
$49 = ($47|0)>($48|0);
|
|
$50 = HEAP32[$5>>2]|0;
|
|
$51 = HEAP32[$6>>2]|0;
|
|
$52 = $49 ? $50 : $51;
|
|
HEAP32[$5>>2] = $52;
|
|
$53 = HEAP32[$3>>2]|0;
|
|
$54 = HEAP32[$5>>2]|0;
|
|
$55 = HEAP32[$7>>2]|0;
|
|
_push_val($53,$54,$55);
|
|
HEAP32[$1>>2] = 1;
|
|
$56 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($56|0);
|
|
}
|
|
function _parse_constterm($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
$6 = (_scan()|0);
|
|
$7 = $6&255;
|
|
HEAP32[$5>>2] = $7;
|
|
L1: do {
|
|
switch ($7|0) {
|
|
case 211: case 214: case 218: case 217: {
|
|
label = 7;
|
|
break;
|
|
}
|
|
case 168: {
|
|
$8 = HEAP32[$3>>2]|0;
|
|
$9 = HEAP32[$4>>2]|0;
|
|
$10 = (_parse_constexpr($8,$9)|0);
|
|
HEAP32[$5>>2] = $10;
|
|
$11 = ($10|0)!=(0);
|
|
if (!($11)) {
|
|
_parse_error(3811);
|
|
HEAP32[$2>>2] = 0;
|
|
break L1;
|
|
}
|
|
$12 = HEAP8[111813]|0;
|
|
$13 = $12&255;
|
|
$14 = ($13|0)!=(169);
|
|
if ($14) {
|
|
_parse_error(3841);
|
|
HEAP32[$2>>2] = 0;
|
|
} else {
|
|
label = 7;
|
|
}
|
|
break;
|
|
}
|
|
default: {
|
|
HEAP32[$2>>2] = 0;
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 7) {
|
|
$15 = HEAP32[$5>>2]|0;
|
|
HEAP32[$2>>2] = $15;
|
|
}
|
|
$16 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($16|0);
|
|
}
|
|
function _parse_constexpr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
|
|
var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
|
|
var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $7 = 0, $8 = 0, $9 = 0;
|
|
var $or$cond = 0, $or$cond3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$2 = sp + 28|0;
|
|
$3 = sp + 24|0;
|
|
$4 = sp + 20|0;
|
|
$5 = sp + 16|0;
|
|
$6 = sp + 12|0;
|
|
$7 = sp + 8|0;
|
|
$8 = sp + 4|0;
|
|
$9 = sp;
|
|
HEAP32[$3>>2] = $0;
|
|
HEAP32[$4>>2] = $1;
|
|
HEAP32[$6>>2] = 0;
|
|
$10 = HEAP32[7]|0;
|
|
HEAP32[$7>>2] = $10;
|
|
HEAP32[$9>>2] = 1;
|
|
$11 = HEAP32[$3>>2]|0;
|
|
HEAP32[$11>>2] = 0;
|
|
$12 = HEAP32[$4>>2]|0;
|
|
HEAP32[$12>>2] = 1;
|
|
L1: while(1) {
|
|
$13 = HEAP32[$6>>2]|0;
|
|
HEAP32[$5>>2] = $13;
|
|
HEAP32[$6>>2] = 0;
|
|
$14 = (_parse_constval()|0);
|
|
$15 = ($14|0)!=(0);
|
|
L3: do {
|
|
if ($15) {
|
|
HEAP32[$6>>2] = 1;
|
|
(_scan()|0);
|
|
HEAP32[$8>>2] = 0;
|
|
while(1) {
|
|
$16 = HEAP32[$8>>2]|0;
|
|
$17 = ($16>>>0)<(18);
|
|
if (!($17)) {
|
|
break L3;
|
|
}
|
|
$18 = HEAP8[111813]|0;
|
|
$19 = $18&255;
|
|
$20 = HEAP32[$8>>2]|0;
|
|
$21 = (3721 + ($20)|0);
|
|
$22 = HEAP8[$21>>0]|0;
|
|
$23 = $22&255;
|
|
$24 = ($19|0)==($23|0);
|
|
if ($24) {
|
|
break;
|
|
}
|
|
$40 = HEAP32[$8>>2]|0;
|
|
$41 = (($40) + 1)|0;
|
|
HEAP32[$8>>2] = $41;
|
|
}
|
|
HEAP32[$6>>2] = 2;
|
|
$25 = HEAP32[$8>>2]|0;
|
|
$26 = (3739 + ($25)|0);
|
|
$27 = HEAP8[$26>>0]|0;
|
|
$28 = $27&255;
|
|
$29 = HEAP32[$7>>2]|0;
|
|
$30 = (_tos_op_prec($29)|0);
|
|
$31 = ($28|0)>=($30|0);
|
|
if ($31) {
|
|
$32 = (_pop_op()|0);
|
|
$33 = (_calc_op($32)|0);
|
|
$34 = ($33|0)!=(0);
|
|
if (!($34)) {
|
|
label = 8;
|
|
break L1;
|
|
}
|
|
}
|
|
$35 = HEAP8[111813]|0;
|
|
$36 = HEAP32[$8>>2]|0;
|
|
$37 = (3739 + ($36)|0);
|
|
$38 = HEAP8[$37>>0]|0;
|
|
$39 = $38&255;
|
|
_push_op($35,$39);
|
|
}
|
|
} while(0);
|
|
$42 = HEAP32[$6>>2]|0;
|
|
$43 = ($42|0)==(2);
|
|
if (!($43)) {
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 8) {
|
|
_parse_error(3869);
|
|
HEAP32[$2>>2] = 0;
|
|
$61 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($61|0);
|
|
}
|
|
$44 = HEAP32[$6>>2]|0;
|
|
$45 = ($44|0)==(0);
|
|
$46 = HEAP32[$5>>2]|0;
|
|
$47 = ($46|0)==(0);
|
|
$or$cond = $45 & $47;
|
|
if ($or$cond) {
|
|
HEAP32[$2>>2] = 0;
|
|
$61 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($61|0);
|
|
}
|
|
$48 = HEAP32[$6>>2]|0;
|
|
$49 = ($48|0)==(0);
|
|
$50 = HEAP32[$5>>2]|0;
|
|
$51 = ($50|0)==(2);
|
|
$or$cond3 = $49 & $51;
|
|
if ($or$cond3) {
|
|
_parse_error(3896);
|
|
HEAP32[$2>>2] = 0;
|
|
$61 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($61|0);
|
|
}
|
|
while(1) {
|
|
$52 = HEAP32[$7>>2]|0;
|
|
$53 = HEAP32[7]|0;
|
|
$54 = ($52|0)<($53|0);
|
|
if (!($54)) {
|
|
label = 19;
|
|
break;
|
|
}
|
|
$55 = (_pop_op()|0);
|
|
$56 = (_calc_op($55)|0);
|
|
$57 = ($56|0)!=(0);
|
|
if (!($57)) {
|
|
label = 18;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 18) {
|
|
_parse_error(3869);
|
|
HEAP32[$2>>2] = 0;
|
|
$61 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($61|0);
|
|
}
|
|
else if ((label|0) == 19) {
|
|
$58 = HEAP32[$3>>2]|0;
|
|
$59 = HEAP32[$4>>2]|0;
|
|
(_pop_val($58,$59,$9)|0);
|
|
$60 = HEAP32[$9>>2]|0;
|
|
HEAP32[$2>>2] = $60;
|
|
$61 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($61|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _parse_constval() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
|
|
var $63 = 0, $64 = 0, $65 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$0 = sp + 16|0;
|
|
$1 = sp + 12|0;
|
|
$2 = sp + 8|0;
|
|
$3 = sp + 4|0;
|
|
$4 = sp;
|
|
HEAP32[$1>>2] = 0;
|
|
HEAP32[$4>>2] = 0;
|
|
HEAP32[$3>>2] = 1;
|
|
L1: while(1) {
|
|
$5 = (_parse_constterm($4,$3)|0);
|
|
HEAP32[$2>>2] = $5;
|
|
$6 = ($5|0)!=(0);
|
|
$7 = $6 ^ 1;
|
|
$8 = HEAP8[111813]|0;
|
|
$9 = $8&255;
|
|
if (!($7)) {
|
|
break;
|
|
}
|
|
switch ($9|0) {
|
|
case 171: {
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 173: {
|
|
$10 = HEAP32[$1>>2]|0;
|
|
$11 = $10 | 1;
|
|
HEAP32[$1>>2] = $11;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 254: {
|
|
$12 = HEAP32[$1>>2]|0;
|
|
$13 = $12 | 2;
|
|
HEAP32[$1>>2] = $13;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 161: {
|
|
$14 = HEAP32[$1>>2]|0;
|
|
$15 = $14 | 4;
|
|
HEAP32[$1>>2] = $15;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 192: {
|
|
$16 = HEAP32[$1>>2]|0;
|
|
$17 = $16 | 8;
|
|
HEAP32[$1>>2] = $17;
|
|
continue L1;
|
|
break;
|
|
}
|
|
default: {
|
|
label = 8;
|
|
break L1;
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 8) {
|
|
HEAP32[$0>>2] = 0;
|
|
$65 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($65|0);
|
|
}
|
|
L13: do {
|
|
switch ($9|0) {
|
|
case 169: {
|
|
break;
|
|
}
|
|
case 211: {
|
|
$18 = HEAP32[9256]|0;
|
|
$19 = (($18) - 1)|0;
|
|
HEAP32[$3>>2] = $19;
|
|
$20 = HEAP32[9257]|0;
|
|
HEAP32[$4>>2] = $20;
|
|
HEAP32[$2>>2] = 1024;
|
|
$21 = HEAP32[$1>>2]|0;
|
|
$22 = ($21|0)!=(0);
|
|
if ($22) {
|
|
_parse_error(3912);
|
|
HEAP32[$0>>2] = 0;
|
|
$65 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($65|0);
|
|
}
|
|
break;
|
|
}
|
|
case 217: {
|
|
HEAP32[$3>>2] = 1;
|
|
$23 = HEAP32[9257]|0;
|
|
HEAP32[$4>>2] = $23;
|
|
HEAP32[$2>>2] = 1;
|
|
break;
|
|
}
|
|
case 218: {
|
|
HEAP32[$3>>2] = 2;
|
|
$24 = HEAP32[9257]|0;
|
|
HEAP32[$4>>2] = $24;
|
|
HEAP32[$2>>2] = 1;
|
|
break;
|
|
}
|
|
case 214: {
|
|
HEAP32[$3>>2] = 2;
|
|
$25 = HEAP32[9255]|0;
|
|
$26 = HEAP32[9256]|0;
|
|
$27 = (_id_type($25,$26)|0);
|
|
HEAP32[$2>>2] = $27;
|
|
$28 = HEAP32[$2>>2]|0;
|
|
$29 = $28 & 1;
|
|
$30 = ($29|0)!=(0);
|
|
if ($30) {
|
|
$31 = HEAP32[9255]|0;
|
|
$32 = HEAP32[9256]|0;
|
|
$33 = (_id_const($31,$32)|0);
|
|
HEAP32[$4>>2] = $33;
|
|
break L13;
|
|
}
|
|
$34 = HEAP32[$2>>2]|0;
|
|
$35 = $34 & 8344;
|
|
$36 = ($35|0)!=(0);
|
|
if (!($36)) {
|
|
$37 = HEAP32[$2>>2]|0;
|
|
$38 = $37 & 8350;
|
|
$39 = ($38|0)!=(0);
|
|
$40 = HEAP32[$1>>2]|0;
|
|
$41 = ($40|0)==(8);
|
|
$or$cond = $39 & $41;
|
|
if (!($or$cond)) {
|
|
HEAP32[$0>>2] = 0;
|
|
$65 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($65|0);
|
|
}
|
|
}
|
|
$42 = HEAP32[9255]|0;
|
|
$43 = HEAP32[9256]|0;
|
|
$44 = (_id_tag($42,$43)|0);
|
|
HEAP32[$4>>2] = $44;
|
|
break;
|
|
}
|
|
default: {
|
|
HEAP32[$0>>2] = 0;
|
|
$65 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($65|0);
|
|
}
|
|
}
|
|
} while(0);
|
|
$45 = HEAP32[$1>>2]|0;
|
|
$46 = $45 & 1;
|
|
$47 = ($46|0)!=(0);
|
|
if ($47) {
|
|
$48 = HEAP32[$4>>2]|0;
|
|
$49 = (0 - ($48))|0;
|
|
HEAP32[$4>>2] = $49;
|
|
}
|
|
$50 = HEAP32[$1>>2]|0;
|
|
$51 = $50 & 2;
|
|
$52 = ($51|0)!=(0);
|
|
if ($52) {
|
|
$53 = HEAP32[$4>>2]|0;
|
|
$54 = $53 ^ -1;
|
|
HEAP32[$4>>2] = $54;
|
|
}
|
|
$55 = HEAP32[$1>>2]|0;
|
|
$56 = $55 & 4;
|
|
$57 = ($56|0)!=(0);
|
|
if ($57) {
|
|
$58 = HEAP32[$4>>2]|0;
|
|
$59 = ($58|0)!=(0);
|
|
$60 = $59 ? 0 : -1;
|
|
HEAP32[$4>>2] = $60;
|
|
}
|
|
$61 = HEAP32[$4>>2]|0;
|
|
$62 = HEAP32[$3>>2]|0;
|
|
$63 = HEAP32[$2>>2]|0;
|
|
_push_val($61,$62,$63);
|
|
$64 = HEAP32[$2>>2]|0;
|
|
HEAP32[$0>>2] = $64;
|
|
$65 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($65|0);
|
|
}
|
|
function _parse_const($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp + 4|0;
|
|
$2 = sp;
|
|
HEAP32[$2>>2] = $0;
|
|
$3 = (_scan()|0);
|
|
$4 = $3&255;
|
|
switch ($4|0) {
|
|
case 218: case 217: {
|
|
$5 = HEAP32[9257]|0;
|
|
$6 = HEAP32[$2>>2]|0;
|
|
HEAP32[$6>>2] = $5;
|
|
label = 6;
|
|
break;
|
|
}
|
|
case 214: {
|
|
$7 = HEAP32[9255]|0;
|
|
$8 = HEAP32[9256]|0;
|
|
$9 = (_id_type($7,$8)|0);
|
|
$10 = $9 & 1;
|
|
$11 = ($10|0)!=(0);
|
|
if ($11) {
|
|
$12 = HEAP32[9255]|0;
|
|
$13 = HEAP32[9256]|0;
|
|
$14 = (_id_const($12,$13)|0);
|
|
$15 = HEAP32[$2>>2]|0;
|
|
HEAP32[$15>>2] = $14;
|
|
label = 6;
|
|
} else {
|
|
label = 5;
|
|
}
|
|
break;
|
|
}
|
|
default: {
|
|
label = 5;
|
|
}
|
|
}
|
|
if ((label|0) == 5) {
|
|
$16 = HEAP32[$2>>2]|0;
|
|
HEAP32[$16>>2] = 0;
|
|
HEAP32[$1>>2] = 0;
|
|
$17 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
else if ((label|0) == 6) {
|
|
HEAP32[$1>>2] = 1;
|
|
$17 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _parse_term() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$0 = sp;
|
|
$1 = (_scan()|0);
|
|
$2 = $1&255;
|
|
L1: do {
|
|
switch ($2|0) {
|
|
case 211: case 214: case 218: case 217: {
|
|
label = 7;
|
|
break;
|
|
}
|
|
case 168: {
|
|
$3 = (_parse_expr()|0);
|
|
$4 = ($3|0)!=(0);
|
|
if (!($4)) {
|
|
_parse_error(3811);
|
|
HEAP32[$0>>2] = 0;
|
|
break L1;
|
|
}
|
|
$5 = HEAP8[111813]|0;
|
|
$6 = $5&255;
|
|
$7 = ($6|0)!=(169);
|
|
if ($7) {
|
|
_parse_error(3841);
|
|
HEAP32[$0>>2] = 0;
|
|
} else {
|
|
label = 7;
|
|
}
|
|
break;
|
|
}
|
|
default: {
|
|
HEAP32[$0>>2] = 0;
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 7) {
|
|
HEAP32[$0>>2] = 1;
|
|
}
|
|
$8 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($8|0);
|
|
}
|
|
function _parse_expr() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$0 = sp + 20|0;
|
|
$1 = sp + 16|0;
|
|
$2 = sp + 12|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 4|0;
|
|
$5 = sp;
|
|
HEAP32[$2>>2] = 0;
|
|
$6 = HEAP32[7]|0;
|
|
HEAP32[$3>>2] = $6;
|
|
HEAP32[$5>>2] = 0;
|
|
L1: while(1) {
|
|
$7 = HEAP32[$2>>2]|0;
|
|
HEAP32[$1>>2] = $7;
|
|
HEAP32[$2>>2] = 0;
|
|
$8 = (_parse_value(1)|0);
|
|
$9 = ($8|0)!=(0);
|
|
L3: do {
|
|
if ($9) {
|
|
HEAP32[$2>>2] = 1;
|
|
HEAP32[$4>>2] = 0;
|
|
while(1) {
|
|
$10 = HEAP32[$4>>2]|0;
|
|
$11 = ($10>>>0)<(18);
|
|
if (!($11)) {
|
|
break L3;
|
|
}
|
|
$12 = HEAP8[111813]|0;
|
|
$13 = $12&255;
|
|
$14 = HEAP32[$4>>2]|0;
|
|
$15 = (3721 + ($14)|0);
|
|
$16 = HEAP8[$15>>0]|0;
|
|
$17 = $16&255;
|
|
$18 = ($13|0)==($17|0);
|
|
if ($18) {
|
|
break;
|
|
}
|
|
$34 = HEAP32[$4>>2]|0;
|
|
$35 = (($34) + 1)|0;
|
|
HEAP32[$4>>2] = $35;
|
|
}
|
|
HEAP32[$2>>2] = 2;
|
|
$19 = HEAP32[$4>>2]|0;
|
|
$20 = (3739 + ($19)|0);
|
|
$21 = HEAP8[$20>>0]|0;
|
|
$22 = $21&255;
|
|
$23 = HEAP32[$3>>2]|0;
|
|
$24 = (_tos_op_prec($23)|0);
|
|
$25 = ($22|0)>=($24|0);
|
|
if ($25) {
|
|
$26 = (_pop_op()|0);
|
|
$27 = (_emit_op($26)|0);
|
|
$28 = ($27|0)!=(0);
|
|
if (!($28)) {
|
|
label = 8;
|
|
break L1;
|
|
}
|
|
}
|
|
$29 = HEAP8[111813]|0;
|
|
$30 = HEAP32[$4>>2]|0;
|
|
$31 = (3739 + ($30)|0);
|
|
$32 = HEAP8[$31>>0]|0;
|
|
$33 = $32&255;
|
|
_push_op($29,$33);
|
|
}
|
|
} while(0);
|
|
$36 = HEAP32[$2>>2]|0;
|
|
$37 = ($36|0)==(2);
|
|
if (!($37)) {
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 8) {
|
|
_parse_error(3869);
|
|
HEAP32[$0>>2] = 0;
|
|
$54 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($54|0);
|
|
}
|
|
$38 = HEAP32[$2>>2]|0;
|
|
$39 = ($38|0)==(0);
|
|
$40 = HEAP32[$1>>2]|0;
|
|
$41 = ($40|0)==(2);
|
|
$or$cond = $39 & $41;
|
|
if ($or$cond) {
|
|
_parse_error(3896);
|
|
HEAP32[$0>>2] = 0;
|
|
$54 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($54|0);
|
|
}
|
|
while(1) {
|
|
$42 = HEAP32[$3>>2]|0;
|
|
$43 = HEAP32[7]|0;
|
|
$44 = ($42|0)<($43|0);
|
|
if (!($44)) {
|
|
label = 17;
|
|
break;
|
|
}
|
|
$45 = (_pop_op()|0);
|
|
$46 = (_emit_op($45)|0);
|
|
$47 = ($46|0)!=(0);
|
|
if (!($47)) {
|
|
label = 16;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 16) {
|
|
_parse_error(3869);
|
|
HEAP32[$0>>2] = 0;
|
|
$54 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($54|0);
|
|
}
|
|
else if ((label|0) == 17) {
|
|
$48 = HEAP32[$2>>2]|0;
|
|
$49 = ($48|0)!=(0);
|
|
$50 = HEAP32[$1>>2]|0;
|
|
$51 = ($50|0)!=(0);
|
|
$52 = $49 ? 1 : $51;
|
|
$53 = $52&1;
|
|
HEAP32[$0>>2] = $53;
|
|
$54 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($54|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _parse_value($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
|
|
var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
|
|
var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
|
|
var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
|
|
var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
|
|
var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
|
|
var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
|
|
var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
|
|
var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
|
|
var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
|
|
var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
|
|
var $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0;
|
|
var $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0;
|
|
var $333 = 0, $334 = 0, $335 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0;
|
|
var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0;
|
|
var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0;
|
|
var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 44|0;
|
|
$2 = sp + 40|0;
|
|
$3 = sp + 36|0;
|
|
$4 = sp + 32|0;
|
|
$5 = sp + 28|0;
|
|
$6 = sp + 24|0;
|
|
$7 = sp + 20|0;
|
|
$8 = sp + 16|0;
|
|
$9 = sp + 12|0;
|
|
$10 = sp + 8|0;
|
|
$11 = sp + 4|0;
|
|
HEAP32[$2>>2] = $0;
|
|
$12 = HEAP32[$2>>2]|0;
|
|
HEAP32[$4>>2] = $12;
|
|
$13 = HEAP32[7]|0;
|
|
HEAP32[$5>>2] = $13;
|
|
HEAP32[$6>>2] = 0;
|
|
HEAP32[$7>>2] = 0;
|
|
HEAP32[$8>>2] = 0;
|
|
L1: while(1) {
|
|
$14 = (_parse_term()|0);
|
|
$15 = ($14|0)!=(0);
|
|
$16 = $15 ^ 1;
|
|
$17 = HEAP8[111813]|0;
|
|
$18 = $17&255;
|
|
if (!($16)) {
|
|
break;
|
|
}
|
|
switch ($18|0) {
|
|
case 171: {
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 222: {
|
|
$19 = HEAP32[$4>>2]|0;
|
|
$20 = ($19|0)!=(0);
|
|
if ($20) {
|
|
$21 = HEAP8[111813]|0;
|
|
_push_op($21,0);
|
|
continue L1;
|
|
} else {
|
|
$22 = HEAP32[$4>>2]|0;
|
|
$23 = (($22) + 1)|0;
|
|
HEAP32[$4>>2] = $23;
|
|
$24 = HEAP32[$6>>2]|0;
|
|
$25 = $24 | 512;
|
|
HEAP32[$6>>2] = $25;
|
|
continue L1;
|
|
}
|
|
break;
|
|
}
|
|
case 170: {
|
|
$26 = HEAP32[$4>>2]|0;
|
|
$27 = ($26|0)!=(0);
|
|
if ($27) {
|
|
$28 = HEAP8[111813]|0;
|
|
_push_op($28,0);
|
|
continue L1;
|
|
} else {
|
|
$29 = HEAP32[$4>>2]|0;
|
|
$30 = (($29) + 1)|0;
|
|
HEAP32[$4>>2] = $30;
|
|
$31 = HEAP32[$6>>2]|0;
|
|
$32 = $31 | 256;
|
|
HEAP32[$6>>2] = $32;
|
|
continue L1;
|
|
}
|
|
break;
|
|
}
|
|
case 192: {
|
|
$33 = HEAP32[$4>>2]|0;
|
|
$34 = (($33) + -1)|0;
|
|
HEAP32[$4>>2] = $34;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 161: case 254: case 173: {
|
|
$35 = HEAP8[111813]|0;
|
|
_push_op($35,0);
|
|
continue L1;
|
|
break;
|
|
}
|
|
default: {
|
|
label = 12;
|
|
break L1;
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 12) {
|
|
HEAP32[$1>>2] = 0;
|
|
$335 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($335|0);
|
|
}
|
|
$36 = ($18|0)==(218);
|
|
do {
|
|
if ($36) {
|
|
label = 15;
|
|
} else {
|
|
$37 = HEAP8[111813]|0;
|
|
$38 = $37&255;
|
|
$39 = ($38|0)==(217);
|
|
if ($39) {
|
|
label = 15;
|
|
} else {
|
|
$43 = HEAP8[111813]|0;
|
|
$44 = $43&255;
|
|
$45 = ($44|0)==(214);
|
|
if (!($45)) {
|
|
$68 = HEAP8[111813]|0;
|
|
$69 = $68&255;
|
|
$70 = ($69|0)==(169);
|
|
if ($70) {
|
|
HEAP32[$8>>2] = 1;
|
|
break;
|
|
}
|
|
$71 = HEAP8[111813]|0;
|
|
$72 = $71&255;
|
|
$73 = ($72|0)==(211);
|
|
if ($73) {
|
|
$74 = HEAP32[9257]|0;
|
|
$75 = HEAP32[9256]|0;
|
|
$76 = (($75) - 1)|0;
|
|
_emit_conststr($74,$76);
|
|
(_scan()|0);
|
|
HEAP32[$1>>2] = 2;
|
|
$335 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($335|0);
|
|
} else {
|
|
HEAP32[$1>>2] = 0;
|
|
$335 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($335|0);
|
|
}
|
|
}
|
|
$46 = HEAP32[9255]|0;
|
|
$47 = HEAP32[9256]|0;
|
|
$48 = (_id_type($46,$47)|0);
|
|
$49 = HEAP32[$6>>2]|0;
|
|
$50 = $49 | $48;
|
|
HEAP32[$6>>2] = $50;
|
|
$51 = $50 & 1;
|
|
$52 = ($51|0)!=(0);
|
|
if ($52) {
|
|
$53 = HEAP32[9255]|0;
|
|
$54 = HEAP32[9256]|0;
|
|
$55 = (_id_const($53,$54)|0);
|
|
HEAP32[$7>>2] = $55;
|
|
break;
|
|
}
|
|
$56 = HEAP32[$6>>2]|0;
|
|
$57 = $56 & 6;
|
|
$58 = ($57|0)!=(0);
|
|
if ($58) {
|
|
$59 = HEAP32[9255]|0;
|
|
$60 = HEAP32[9256]|0;
|
|
$61 = (_id_tag($59,$60)|0);
|
|
HEAP32[$7>>2] = $61;
|
|
break;
|
|
}
|
|
$62 = HEAP32[$6>>2]|0;
|
|
$63 = $62 & 8216;
|
|
$64 = ($63|0)!=(0);
|
|
if ($64) {
|
|
$65 = HEAP32[9255]|0;
|
|
$66 = HEAP32[9256]|0;
|
|
$67 = (_id_tag($65,$66)|0);
|
|
HEAP32[$7>>2] = $67;
|
|
break;
|
|
}
|
|
(_printf(3937,$vararg_buffer)|0);
|
|
HEAP32[$1>>2] = 0;
|
|
$335 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($335|0);
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 15) {
|
|
$40 = HEAP32[9257]|0;
|
|
HEAP32[$7>>2] = $40;
|
|
$41 = HEAP32[$6>>2]|0;
|
|
$42 = $41 | 1;
|
|
HEAP32[$6>>2] = $42;
|
|
}
|
|
$77 = HEAP32[$6>>2]|0;
|
|
$78 = $77 & 1;
|
|
$79 = ($78|0)!=(0);
|
|
L46: do {
|
|
if ($79) {
|
|
L47: while(1) {
|
|
$80 = HEAP32[$5>>2]|0;
|
|
$81 = HEAP32[7]|0;
|
|
$82 = ($80|0)<($81|0);
|
|
if (!($82)) {
|
|
break L46;
|
|
}
|
|
$83 = (_tos_op()|0);
|
|
$84 = $83&255;
|
|
$85 = ($84|0)==(173);
|
|
if (!($85)) {
|
|
$86 = (_tos_op()|0);
|
|
$87 = $86&255;
|
|
$88 = ($87|0)==(254);
|
|
if (!($88)) {
|
|
$89 = (_tos_op()|0);
|
|
$90 = $89&255;
|
|
$91 = ($90|0)==(161);
|
|
if (!($91)) {
|
|
break L46;
|
|
}
|
|
}
|
|
}
|
|
$92 = (_pop_op()|0);
|
|
$93 = $92&255;
|
|
switch ($93|0) {
|
|
case 173: {
|
|
$94 = HEAP32[$7>>2]|0;
|
|
$95 = (0 - ($94))|0;
|
|
HEAP32[$7>>2] = $95;
|
|
continue L47;
|
|
break;
|
|
}
|
|
case 254: {
|
|
$96 = HEAP32[$7>>2]|0;
|
|
$97 = $96 ^ -1;
|
|
HEAP32[$7>>2] = $97;
|
|
continue L47;
|
|
break;
|
|
}
|
|
case 161: {
|
|
$98 = HEAP32[$7>>2]|0;
|
|
$99 = ($98|0)!=(0);
|
|
$100 = $99 ? 0 : -1;
|
|
HEAP32[$7>>2] = $100;
|
|
continue L47;
|
|
break;
|
|
}
|
|
default: {
|
|
continue L47;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$101 = HEAP32[$6>>2]|0;
|
|
$102 = $101 & -769;
|
|
HEAP32[$9>>2] = $102;
|
|
HEAP32[$10>>2] = 0;
|
|
L59: while(1) {
|
|
$103 = (_scan()|0);
|
|
$104 = $103&255;
|
|
$105 = ($104|0)==(168);
|
|
if (!($105)) {
|
|
$106 = HEAP8[111813]|0;
|
|
$107 = $106&255;
|
|
$108 = ($107|0)==(219);
|
|
if (!($108)) {
|
|
$109 = HEAP8[111813]|0;
|
|
$110 = $109&255;
|
|
$111 = ($110|0)==(226);
|
|
if (!($111)) {
|
|
$112 = HEAP8[111813]|0;
|
|
$113 = $112&255;
|
|
$114 = ($113|0)==(247);
|
|
if (!($114)) {
|
|
$115 = HEAP8[111813]|0;
|
|
$116 = $115&255;
|
|
$117 = ($116|0)==(174);
|
|
if (!($117)) {
|
|
$118 = HEAP8[111813]|0;
|
|
$119 = $118&255;
|
|
$120 = ($119|0)==(186);
|
|
if (!($120)) {
|
|
label = 124;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
$121 = HEAP8[111813]|0;
|
|
$122 = $121&255;
|
|
switch ($122|0) {
|
|
case 168: {
|
|
$123 = HEAP32[$8>>2]|0;
|
|
$124 = ($123|0)!=(0);
|
|
if ($124) {
|
|
$125 = HEAP32[$10>>2]|0;
|
|
$126 = ($125|0)!=(0);
|
|
if ($126) {
|
|
$127 = HEAP32[$10>>2]|0;
|
|
_emit_const($127);
|
|
(_emit_op(-85)|0);
|
|
HEAP32[$10>>2] = 0;
|
|
}
|
|
$128 = HEAP32[$9>>2]|0;
|
|
$129 = $128 & 768;
|
|
$130 = ($129|0)!=(0);
|
|
do {
|
|
if ($130) {
|
|
$131 = HEAP32[$9>>2]|0;
|
|
$132 = $131 & 512;
|
|
$133 = ($132|0)!=(0);
|
|
if ($133) {
|
|
_emit_lb();
|
|
break;
|
|
} else {
|
|
_emit_lw();
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$134 = (_scan_lookahead()|0);
|
|
$135 = ($134|0)!=(169);
|
|
if ($135) {
|
|
_emit_push();
|
|
}
|
|
}
|
|
HEAP32[$3>>2] = 0;
|
|
while(1) {
|
|
$136 = (_parse_expr()|0);
|
|
$137 = ($136|0)!=(0);
|
|
if (!($137)) {
|
|
break;
|
|
}
|
|
$138 = HEAP32[$3>>2]|0;
|
|
$139 = (($138) + 1)|0;
|
|
HEAP32[$3>>2] = $139;
|
|
$140 = HEAP8[111813]|0;
|
|
$141 = $140&255;
|
|
$142 = ($141|0)!=(172);
|
|
if ($142) {
|
|
break;
|
|
}
|
|
}
|
|
$143 = HEAP8[111813]|0;
|
|
$144 = $143&255;
|
|
$145 = ($144|0)!=(169);
|
|
if ($145) {
|
|
label = 59;
|
|
break L59;
|
|
}
|
|
$146 = HEAP32[$9>>2]|0;
|
|
$147 = $146 & 8217;
|
|
$148 = ($147|0)!=(0);
|
|
if ($148) {
|
|
$149 = HEAP32[$7>>2]|0;
|
|
$150 = HEAP32[$9>>2]|0;
|
|
_emit_call($149,$150);
|
|
} else {
|
|
$151 = HEAP32[$8>>2]|0;
|
|
$152 = ($151|0)!=(0);
|
|
do {
|
|
if ($152) {
|
|
$167 = HEAP32[$3>>2]|0;
|
|
$168 = ($167|0)!=(0);
|
|
if ($168) {
|
|
_emit_pull();
|
|
}
|
|
} else {
|
|
$153 = HEAP32[$6>>2]|0;
|
|
$154 = $153 & 1;
|
|
$155 = ($154|0)!=(0);
|
|
if ($155) {
|
|
$156 = HEAP32[$7>>2]|0;
|
|
_emit_const($156);
|
|
break;
|
|
}
|
|
$157 = HEAP32[$6>>2]|0;
|
|
$158 = $157 & 6;
|
|
$159 = ($158|0)!=(0);
|
|
if ($159) {
|
|
$160 = HEAP32[$6>>2]|0;
|
|
$161 = $160 & 64;
|
|
$162 = ($161|0)!=(0);
|
|
$163 = HEAP32[$7>>2]|0;
|
|
$164 = HEAP32[$10>>2]|0;
|
|
if ($162) {
|
|
$165 = (($163) + ($164))|0;
|
|
_emit_llw($165);
|
|
} else {
|
|
$166 = HEAP32[$6>>2]|0;
|
|
_emit_law($163,$164,$166);
|
|
}
|
|
HEAP32[$10>>2] = 0;
|
|
}
|
|
}
|
|
} while(0);
|
|
_emit_ical();
|
|
}
|
|
HEAP32[$8>>2] = 1;
|
|
HEAP32[$9>>2] = 0;
|
|
continue L59;
|
|
break;
|
|
}
|
|
case 219: {
|
|
$169 = HEAP32[$8>>2]|0;
|
|
$170 = ($169|0)!=(0);
|
|
if ($170) {
|
|
$185 = HEAP32[$10>>2]|0;
|
|
$186 = ($185|0)!=(0);
|
|
if ($186) {
|
|
$187 = HEAP32[$10>>2]|0;
|
|
_emit_const($187);
|
|
(_emit_op(-85)|0);
|
|
HEAP32[$10>>2] = 0;
|
|
}
|
|
} else {
|
|
$171 = HEAP32[$6>>2]|0;
|
|
$172 = $171 & 1;
|
|
$173 = ($172|0)!=(0);
|
|
if ($173) {
|
|
$174 = HEAP32[$7>>2]|0;
|
|
_emit_const($174);
|
|
} else {
|
|
$175 = HEAP32[$6>>2]|0;
|
|
$176 = $175 & 8350;
|
|
$177 = ($176|0)!=(0);
|
|
if (!($177)) {
|
|
label = 82;
|
|
break L59;
|
|
}
|
|
$178 = HEAP32[$6>>2]|0;
|
|
$179 = $178 & 64;
|
|
$180 = ($179|0)!=(0);
|
|
$181 = HEAP32[$7>>2]|0;
|
|
$182 = HEAP32[$10>>2]|0;
|
|
if ($180) {
|
|
$183 = (($181) + ($182))|0;
|
|
_emit_localaddr($183);
|
|
} else {
|
|
$184 = HEAP32[$6>>2]|0;
|
|
_emit_globaladdr($181,$182,$184);
|
|
}
|
|
HEAP32[$10>>2] = 0;
|
|
}
|
|
HEAP32[$8>>2] = 1;
|
|
}
|
|
while(1) {
|
|
$188 = (_parse_expr()|0);
|
|
$189 = ($188|0)!=(0);
|
|
if (!($189)) {
|
|
break;
|
|
}
|
|
$190 = HEAP8[111813]|0;
|
|
$191 = $190&255;
|
|
$192 = ($191|0)!=(172);
|
|
if ($192) {
|
|
break;
|
|
}
|
|
_emit_indexword();
|
|
_emit_lw();
|
|
}
|
|
$193 = HEAP8[111813]|0;
|
|
$194 = $193&255;
|
|
$195 = ($194|0)!=(221);
|
|
if ($195) {
|
|
label = 90;
|
|
break L59;
|
|
}
|
|
$196 = HEAP32[$9>>2]|0;
|
|
$197 = $196 & 258;
|
|
$198 = ($197|0)!=(0);
|
|
if ($198) {
|
|
_emit_indexword();
|
|
HEAP32[$9>>2] = 256;
|
|
continue L59;
|
|
} else {
|
|
_emit_indexbyte();
|
|
HEAP32[$9>>2] = 512;
|
|
continue L59;
|
|
}
|
|
break;
|
|
}
|
|
case 247: case 226: {
|
|
$199 = HEAP32[$8>>2]|0;
|
|
$200 = ($199|0)!=(0);
|
|
do {
|
|
if ($200) {
|
|
$218 = HEAP32[$10>>2]|0;
|
|
$219 = ($218|0)!=(0);
|
|
if ($219) {
|
|
$220 = HEAP32[$10>>2]|0;
|
|
_emit_const($220);
|
|
(_emit_op(-85)|0);
|
|
}
|
|
$221 = HEAP32[$9>>2]|0;
|
|
$222 = $221 & 768;
|
|
$223 = ($222|0)!=(0);
|
|
if ($223) {
|
|
$224 = HEAP32[$9>>2]|0;
|
|
$225 = $224 & 512;
|
|
$226 = ($225|0)!=(0);
|
|
if ($226) {
|
|
_emit_lb();
|
|
break;
|
|
} else {
|
|
_emit_lw();
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$201 = HEAP32[$6>>2]|0;
|
|
$202 = $201 & 1;
|
|
$203 = ($202|0)!=(0);
|
|
do {
|
|
if ($203) {
|
|
$204 = HEAP32[$7>>2]|0;
|
|
_emit_const($204);
|
|
} else {
|
|
$205 = HEAP32[$6>>2]|0;
|
|
$206 = $205 & 8350;
|
|
$207 = ($206|0)!=(0);
|
|
if ($207) {
|
|
$208 = HEAP32[$6>>2]|0;
|
|
$209 = $208 & 64;
|
|
$210 = ($209|0)!=(0);
|
|
$211 = HEAP32[$9>>2]|0;
|
|
$212 = $211 & 4;
|
|
$213 = ($212|0)!=(0);
|
|
$214 = HEAP32[$7>>2]|0;
|
|
$215 = HEAP32[$10>>2]|0;
|
|
if ($210) {
|
|
$216 = (($214) + ($215))|0;
|
|
if ($213) {
|
|
_emit_llb($216);
|
|
break;
|
|
} else {
|
|
_emit_llw($216);
|
|
break;
|
|
}
|
|
} else {
|
|
$217 = HEAP32[$6>>2]|0;
|
|
if ($213) {
|
|
_emit_lab($214,$215,$217);
|
|
break;
|
|
} else {
|
|
_emit_law($214,$215,$217);
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
HEAP32[$8>>2] = 1;
|
|
}
|
|
} while(0);
|
|
HEAP32[$10>>2] = 0;
|
|
$227 = HEAP8[111813]|0;
|
|
$228 = $227&255;
|
|
$229 = ($228|0)==(226);
|
|
$230 = $229 ? 512 : 256;
|
|
HEAP32[$9>>2] = $230;
|
|
$231 = (_parse_const($10)|0);
|
|
$232 = ($231|0)!=(0);
|
|
if (!($232)) {
|
|
$233 = HEAP32[9255]|0;
|
|
_scan_rewind($233);
|
|
}
|
|
$234 = HEAP32[$10>>2]|0;
|
|
$235 = ($234|0)!=(0);
|
|
if (!($235)) {
|
|
continue L59;
|
|
}
|
|
$236 = HEAP32[$10>>2]|0;
|
|
_emit_const($236);
|
|
(_emit_op(-85)|0);
|
|
HEAP32[$10>>2] = 0;
|
|
continue L59;
|
|
break;
|
|
}
|
|
case 186: case 174: {
|
|
$237 = HEAP32[$9>>2]|0;
|
|
$238 = $237 & 7;
|
|
$239 = ($238|0)!=(0);
|
|
$240 = HEAP8[111813]|0;
|
|
$241 = $240&255;
|
|
$242 = ($241|0)==(174);
|
|
$243 = $242 ? 4 : 2;
|
|
$244 = $242 ? 512 : 256;
|
|
$245 = $239 ? $243 : $244;
|
|
HEAP32[$9>>2] = $245;
|
|
$246 = (_parse_const($11)|0);
|
|
$247 = ($246|0)!=(0);
|
|
if ($247) {
|
|
$248 = HEAP32[$11>>2]|0;
|
|
$249 = HEAP32[$10>>2]|0;
|
|
$250 = (($249) + ($248))|0;
|
|
HEAP32[$10>>2] = $250;
|
|
} else {
|
|
$251 = HEAP32[9255]|0;
|
|
_scan_rewind($251);
|
|
}
|
|
$252 = HEAP32[$8>>2]|0;
|
|
$253 = ($252|0)!=(0);
|
|
if ($253) {
|
|
continue L59;
|
|
}
|
|
$254 = HEAP32[$6>>2]|0;
|
|
$255 = $254 & 1;
|
|
$256 = ($255|0)!=(0);
|
|
if ($256) {
|
|
$257 = HEAP32[$10>>2]|0;
|
|
$258 = HEAP32[$7>>2]|0;
|
|
$259 = (($258) + ($257))|0;
|
|
HEAP32[$7>>2] = $259;
|
|
HEAP32[$10>>2] = 0;
|
|
continue L59;
|
|
}
|
|
$260 = HEAP32[$6>>2]|0;
|
|
$261 = $260 & 8216;
|
|
$262 = ($261|0)!=(0);
|
|
if (!($262)) {
|
|
continue L59;
|
|
}
|
|
$263 = HEAP32[$7>>2]|0;
|
|
$264 = HEAP32[$10>>2]|0;
|
|
$265 = HEAP32[$6>>2]|0;
|
|
_emit_globaladdr($263,$264,$265);
|
|
HEAP32[$10>>2] = 0;
|
|
HEAP32[$8>>2] = 1;
|
|
continue L59;
|
|
break;
|
|
}
|
|
default: {
|
|
continue L59;
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 59) {
|
|
_parse_error(3841);
|
|
HEAP32[$1>>2] = 0;
|
|
$335 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($335|0);
|
|
}
|
|
else if ((label|0) == 82) {
|
|
_parse_error(3950);
|
|
HEAP32[$1>>2] = 0;
|
|
$335 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($335|0);
|
|
}
|
|
else if ((label|0) == 90) {
|
|
_parse_error(3970);
|
|
HEAP32[$1>>2] = 0;
|
|
$335 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($335|0);
|
|
}
|
|
else if ((label|0) == 124) {
|
|
$266 = HEAP32[$8>>2]|0;
|
|
$267 = ($266|0)!=(0);
|
|
do {
|
|
if ($267) {
|
|
$268 = HEAP32[$10>>2]|0;
|
|
$269 = ($268|0)!=(0);
|
|
if ($269) {
|
|
$270 = HEAP32[$10>>2]|0;
|
|
_emit_const($270);
|
|
(_emit_op(-85)|0);
|
|
HEAP32[$10>>2] = 0;
|
|
}
|
|
$271 = HEAP32[$4>>2]|0;
|
|
$272 = ($271|0)!=(0);
|
|
if ($272) {
|
|
$273 = HEAP32[$9>>2]|0;
|
|
$274 = $273 & 512;
|
|
$275 = ($274|0)!=(0);
|
|
if ($275) {
|
|
_emit_lb();
|
|
break;
|
|
}
|
|
$276 = HEAP32[$9>>2]|0;
|
|
$277 = $276 & 256;
|
|
$278 = ($277|0)!=(0);
|
|
if ($278) {
|
|
_emit_lw();
|
|
}
|
|
}
|
|
} else {
|
|
$279 = HEAP32[$4>>2]|0;
|
|
$280 = ($279|0)!=(0);
|
|
$281 = HEAP32[$6>>2]|0;
|
|
$282 = $281 & 1;
|
|
$283 = ($282|0)!=(0);
|
|
if (!($280)) {
|
|
if ($283) {
|
|
$309 = HEAP32[$7>>2]|0;
|
|
_emit_const($309);
|
|
break;
|
|
}
|
|
$310 = HEAP32[$6>>2]|0;
|
|
$311 = $310 & 8350;
|
|
$312 = ($311|0)!=(0);
|
|
if (!($312)) {
|
|
break;
|
|
}
|
|
$313 = HEAP32[$6>>2]|0;
|
|
$314 = $313 & 64;
|
|
$315 = ($314|0)!=(0);
|
|
$316 = HEAP32[$7>>2]|0;
|
|
$317 = HEAP32[$10>>2]|0;
|
|
if ($315) {
|
|
$318 = (($316) + ($317))|0;
|
|
_emit_localaddr($318);
|
|
break;
|
|
} else {
|
|
$319 = HEAP32[$9>>2]|0;
|
|
_emit_globaladdr($316,$317,$319);
|
|
break;
|
|
}
|
|
}
|
|
if ($283) {
|
|
$284 = HEAP32[$7>>2]|0;
|
|
_emit_const($284);
|
|
$285 = HEAP32[$9>>2]|0;
|
|
$286 = $285 & 6;
|
|
$287 = ($286|0)!=(0);
|
|
if (!($287)) {
|
|
break;
|
|
}
|
|
$288 = HEAP32[$9>>2]|0;
|
|
$289 = $288 & 4;
|
|
$290 = ($289|0)!=(0);
|
|
if ($290) {
|
|
_emit_lb();
|
|
break;
|
|
} else {
|
|
_emit_lw();
|
|
break;
|
|
}
|
|
}
|
|
$291 = HEAP32[$6>>2]|0;
|
|
$292 = $291 & 8216;
|
|
$293 = ($292|0)!=(0);
|
|
if ($293) {
|
|
$294 = HEAP32[$7>>2]|0;
|
|
$295 = HEAP32[$9>>2]|0;
|
|
_emit_call($294,$295);
|
|
break;
|
|
}
|
|
$296 = HEAP32[$6>>2]|0;
|
|
$297 = $296 & 6;
|
|
$298 = ($297|0)!=(0);
|
|
if ($298) {
|
|
$299 = HEAP32[$6>>2]|0;
|
|
$300 = $299 & 64;
|
|
$301 = ($300|0)!=(0);
|
|
$302 = HEAP32[$9>>2]|0;
|
|
$303 = $302 & 4;
|
|
$304 = ($303|0)!=(0);
|
|
$305 = HEAP32[$7>>2]|0;
|
|
$306 = HEAP32[$10>>2]|0;
|
|
if ($301) {
|
|
$307 = (($305) + ($306))|0;
|
|
if ($304) {
|
|
_emit_llb($307);
|
|
break;
|
|
} else {
|
|
_emit_llw($307);
|
|
break;
|
|
}
|
|
} else {
|
|
$308 = HEAP32[$9>>2]|0;
|
|
if ($304) {
|
|
_emit_lab($305,$306,$308);
|
|
break;
|
|
} else {
|
|
_emit_law($305,$306,$308);
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
while(1) {
|
|
$320 = HEAP32[$5>>2]|0;
|
|
$321 = HEAP32[7]|0;
|
|
$322 = ($320|0)<($321|0);
|
|
if (!($322)) {
|
|
break;
|
|
}
|
|
$323 = (_pop_op()|0);
|
|
$324 = $323&255;
|
|
$325 = (_emit_unaryop($324)|0);
|
|
$326 = ($325|0)!=(0);
|
|
if (!($326)) {
|
|
label = 156;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 156) {
|
|
_parse_error(3994);
|
|
HEAP32[$1>>2] = 0;
|
|
$335 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($335|0);
|
|
}
|
|
$327 = HEAP32[$6>>2]|0;
|
|
$328 = $327 & 768;
|
|
$329 = ($328|0)!=(0);
|
|
if ($329) {
|
|
$330 = HEAP32[$6>>2]|0;
|
|
HEAP32[$9>>2] = $330;
|
|
}
|
|
$331 = HEAP32[$9>>2]|0;
|
|
$332 = ($331|0)!=(0);
|
|
$333 = HEAP32[$9>>2]|0;
|
|
$334 = $332 ? $333 : 2;
|
|
HEAP32[$1>>2] = $334;
|
|
$335 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($335|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _parse_stmnt() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
|
|
var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
|
|
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
|
|
var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
|
|
var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
|
|
var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0;
|
|
var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0;
|
|
var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0;
|
|
var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0;
|
|
var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0;
|
|
var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0;
|
|
var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0;
|
|
var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0;
|
|
var $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $35 = 0, $36 = 0, $37 = 0;
|
|
var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
|
|
var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0;
|
|
var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0;
|
|
var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 80|0;
|
|
$0 = sp + 68|0;
|
|
$1 = sp + 64|0;
|
|
$2 = sp + 60|0;
|
|
$3 = sp + 56|0;
|
|
$4 = sp + 52|0;
|
|
$5 = sp + 48|0;
|
|
$6 = sp + 44|0;
|
|
$7 = sp + 40|0;
|
|
$8 = sp + 36|0;
|
|
$9 = sp + 32|0;
|
|
$10 = sp + 28|0;
|
|
$11 = sp + 24|0;
|
|
$12 = sp + 20|0;
|
|
$13 = sp + 16|0;
|
|
$14 = sp + 12|0;
|
|
$15 = sp + 8|0;
|
|
$16 = sp + 4|0;
|
|
$17 = sp;
|
|
$18 = HEAP8[111813]|0;
|
|
$19 = $18&255;
|
|
$20 = ($19|0)!=(136);
|
|
if ($20) {
|
|
$21 = HEAP8[111813]|0;
|
|
$22 = $21&255;
|
|
$23 = ($22|0)!=(155);
|
|
if ($23) {
|
|
$24 = HEAP8[111813]|0;
|
|
$25 = $24&255;
|
|
$26 = ($25|0)!=(140);
|
|
if ($26) {
|
|
$27 = HEAP8[111813]|0;
|
|
$28 = $27&255;
|
|
$29 = ($28|0)!=(141);
|
|
if ($29) {
|
|
$30 = HEAP8[111813]|0;
|
|
HEAP8[112342] = $30;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
$31 = HEAP8[111813]|0;
|
|
$32 = $31&255;
|
|
L7: do {
|
|
switch ($32|0) {
|
|
case 132: {
|
|
$33 = (_parse_expr()|0);
|
|
$34 = ($33|0)!=(0);
|
|
if (!($34)) {
|
|
_parse_error(4020);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$35 = (_tag_new(32)|0);
|
|
HEAP32[$3>>2] = $35;
|
|
$36 = (_tag_new(32)|0);
|
|
HEAP32[$4>>2] = $36;
|
|
$37 = HEAP32[$3>>2]|0;
|
|
_emit_brfls($37);
|
|
(_scan()|0);
|
|
while(1) {
|
|
while(1) {
|
|
$38 = (_parse_stmnt()|0);
|
|
$39 = ($38|0)!=(0);
|
|
if (!($39)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$40 = HEAP8[111813]|0;
|
|
$41 = $40&255;
|
|
$42 = ($41|0)!=(133);
|
|
if ($42) {
|
|
break;
|
|
}
|
|
$43 = HEAP32[$4>>2]|0;
|
|
_emit_brnch($43);
|
|
$44 = HEAP32[$3>>2]|0;
|
|
_emit_codetag($44);
|
|
$45 = (_parse_expr()|0);
|
|
$46 = ($45|0)!=(0);
|
|
if (!($46)) {
|
|
label = 15;
|
|
break;
|
|
}
|
|
$47 = (_tag_new(32)|0);
|
|
HEAP32[$3>>2] = $47;
|
|
$48 = HEAP32[$3>>2]|0;
|
|
_emit_brfls($48);
|
|
}
|
|
if ((label|0) == 15) {
|
|
_parse_error(4020);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$49 = HEAP8[111813]|0;
|
|
$50 = $49&255;
|
|
$51 = ($50|0)==(134);
|
|
if ($51) {
|
|
$52 = HEAP32[$4>>2]|0;
|
|
_emit_brnch($52);
|
|
$53 = HEAP32[$3>>2]|0;
|
|
_emit_codetag($53);
|
|
(_scan()|0);
|
|
while(1) {
|
|
$54 = (_parse_stmnt()|0);
|
|
$55 = ($54|0)!=(0);
|
|
if (!($55)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$56 = HEAP32[$4>>2]|0;
|
|
_emit_codetag($56);
|
|
} else {
|
|
$57 = HEAP32[$3>>2]|0;
|
|
_emit_codetag($57);
|
|
$58 = HEAP32[$4>>2]|0;
|
|
_emit_codetag($58);
|
|
}
|
|
$59 = HEAP8[111813]|0;
|
|
$60 = $59&255;
|
|
$61 = ($60|0)!=(135);
|
|
if ($61) {
|
|
_parse_error(4035);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
break;
|
|
}
|
|
case 137: {
|
|
$62 = (_tag_new(32)|0);
|
|
HEAP32[$5>>2] = $62;
|
|
$63 = (_tag_new(32)|0);
|
|
HEAP32[$6>>2] = $63;
|
|
$64 = HEAP32[9263]|0;
|
|
HEAP32[$2>>2] = $64;
|
|
$65 = HEAP32[$5>>2]|0;
|
|
HEAP32[9263] = $65;
|
|
$66 = HEAP32[9262]|0;
|
|
HEAP32[$1>>2] = $66;
|
|
$67 = HEAP32[$6>>2]|0;
|
|
HEAP32[9262] = $67;
|
|
$68 = HEAP32[$5>>2]|0;
|
|
_emit_codetag($68);
|
|
$69 = (_parse_expr()|0);
|
|
$70 = ($69|0)!=(0);
|
|
if (!($70)) {
|
|
_parse_error(4020);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$71 = HEAP32[$6>>2]|0;
|
|
_emit_brfls($71);
|
|
while(1) {
|
|
$72 = (_parse_stmnt()|0);
|
|
$73 = ($72|0)!=(0);
|
|
if (!($73)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$74 = HEAP8[111813]|0;
|
|
$75 = $74&255;
|
|
$76 = ($75|0)!=(138);
|
|
if (!($76)) {
|
|
$77 = HEAP32[$5>>2]|0;
|
|
_emit_brnch($77);
|
|
$78 = HEAP32[$6>>2]|0;
|
|
_emit_codetag($78);
|
|
$79 = HEAP32[$1>>2]|0;
|
|
HEAP32[9262] = $79;
|
|
$80 = HEAP32[$2>>2]|0;
|
|
HEAP32[9263] = $80;
|
|
break L7;
|
|
}
|
|
_parse_error(4050);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
break;
|
|
}
|
|
case 148: {
|
|
$81 = HEAP32[9262]|0;
|
|
HEAP32[$1>>2] = $81;
|
|
$82 = (_tag_new(32)|0);
|
|
HEAP32[9262] = $82;
|
|
$83 = (_tag_new(32)|0);
|
|
HEAP32[$7>>2] = $83;
|
|
$84 = HEAP32[9263]|0;
|
|
HEAP32[$2>>2] = $84;
|
|
$85 = (_tag_new(32)|0);
|
|
HEAP32[9263] = $85;
|
|
$86 = HEAP32[$7>>2]|0;
|
|
_emit_codetag($86);
|
|
(_scan()|0);
|
|
while(1) {
|
|
$87 = (_parse_stmnt()|0);
|
|
$88 = ($87|0)!=(0);
|
|
if (!($88)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$89 = HEAP8[111813]|0;
|
|
$90 = $89&255;
|
|
$91 = ($90|0)!=(149);
|
|
if ($91) {
|
|
_parse_error(4068);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$92 = HEAP32[9263]|0;
|
|
_emit_codetag($92);
|
|
$93 = HEAP32[$2>>2]|0;
|
|
HEAP32[9263] = $93;
|
|
$94 = (_parse_expr()|0);
|
|
$95 = ($94|0)!=(0);
|
|
if ($95) {
|
|
$96 = HEAP32[$7>>2]|0;
|
|
_emit_brfls($96);
|
|
$97 = HEAP32[9262]|0;
|
|
_emit_codetag($97);
|
|
$98 = HEAP32[$1>>2]|0;
|
|
HEAP32[9262] = $98;
|
|
break L7;
|
|
}
|
|
_parse_error(4020);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
break;
|
|
}
|
|
case 143: {
|
|
$99 = HEAP32[9264]|0;
|
|
$100 = (($99) + 1)|0;
|
|
HEAP32[9264] = $100;
|
|
$101 = HEAP32[9262]|0;
|
|
HEAP32[$1>>2] = $101;
|
|
$102 = (_tag_new(32)|0);
|
|
HEAP32[9262] = $102;
|
|
$103 = (_tag_new(32)|0);
|
|
HEAP32[$8>>2] = $103;
|
|
$104 = HEAP32[9263]|0;
|
|
HEAP32[$2>>2] = $104;
|
|
$105 = HEAP32[$8>>2]|0;
|
|
HEAP32[9263] = $105;
|
|
$106 = (_scan()|0);
|
|
$107 = $106&255;
|
|
$108 = ($107|0)!=(214);
|
|
if ($108) {
|
|
_parse_error(4089);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$109 = HEAP32[9255]|0;
|
|
$110 = HEAP32[9256]|0;
|
|
$111 = (_id_type($109,$110)|0);
|
|
HEAP32[$11>>2] = $111;
|
|
$112 = HEAP32[9255]|0;
|
|
$113 = HEAP32[9256]|0;
|
|
$114 = (_id_tag($112,$113)|0);
|
|
HEAP32[$12>>2] = $114;
|
|
$115 = (_scan()|0);
|
|
$116 = $115&255;
|
|
$117 = ($116|0)!=(189);
|
|
if ($117) {
|
|
_parse_error(4110);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$118 = (_parse_expr()|0);
|
|
$119 = ($118|0)!=(0);
|
|
if (!($119)) {
|
|
_parse_error(4124);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$120 = HEAP32[$8>>2]|0;
|
|
_emit_codetag($120);
|
|
$121 = HEAP32[$11>>2]|0;
|
|
$122 = $121 & 64;
|
|
$123 = ($122|0)!=(0);
|
|
$124 = HEAP32[$11>>2]|0;
|
|
$125 = $124 & 4;
|
|
$126 = ($125|0)!=(0);
|
|
$127 = HEAP32[$12>>2]|0;
|
|
do {
|
|
if ($123) {
|
|
if ($126) {
|
|
_emit_dlb($127);
|
|
break;
|
|
} else {
|
|
_emit_dlw($127);
|
|
break;
|
|
}
|
|
} else {
|
|
$128 = HEAP32[$11>>2]|0;
|
|
if ($126) {
|
|
_emit_dab($127,$128);
|
|
break;
|
|
} else {
|
|
_emit_daw($127,$128);
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$129 = HEAP8[111813]|0;
|
|
$130 = $129&255;
|
|
$131 = ($130|0)==(144);
|
|
do {
|
|
if ($131) {
|
|
HEAP32[$13>>2] = 1;
|
|
} else {
|
|
$132 = HEAP8[111813]|0;
|
|
$133 = $132&255;
|
|
$134 = ($133|0)==(145);
|
|
if ($134) {
|
|
HEAP32[$13>>2] = -1;
|
|
break;
|
|
}
|
|
_parse_error(4143);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
} while(0);
|
|
$135 = (_parse_expr()|0);
|
|
$136 = ($135|0)!=(0);
|
|
if (!($136)) {
|
|
_parse_error(4158);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$137 = HEAP32[$13>>2]|0;
|
|
$138 = ($137|0)>(0);
|
|
$139 = HEAP32[9262]|0;
|
|
if ($138) {
|
|
_emit_brgt($139);
|
|
} else {
|
|
_emit_brlt($139);
|
|
}
|
|
$140 = HEAP8[111813]|0;
|
|
$141 = $140&255;
|
|
$142 = ($141|0)==(146);
|
|
do {
|
|
if ($142) {
|
|
$143 = (_parse_expr()|0);
|
|
$144 = ($143|0)!=(0);
|
|
if ($144) {
|
|
$145 = HEAP32[$13>>2]|0;
|
|
$146 = ($145|0)>(0);
|
|
$147 = $146 ? 171 : 173;
|
|
$148 = $147&255;
|
|
(_emit_op($148)|0);
|
|
break;
|
|
}
|
|
_parse_error(4180);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
} else {
|
|
$149 = HEAP32[$13>>2]|0;
|
|
$150 = ($149|0)>(0);
|
|
$151 = $150 ? 208 : 203;
|
|
(_emit_unaryop($151)|0);
|
|
}
|
|
} while(0);
|
|
while(1) {
|
|
$152 = (_parse_stmnt()|0);
|
|
$153 = ($152|0)!=(0);
|
|
if (!($153)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$154 = HEAP8[111813]|0;
|
|
$155 = $154&255;
|
|
$156 = ($155|0)!=(147);
|
|
if (!($156)) {
|
|
$157 = HEAP32[$8>>2]|0;
|
|
_emit_brnch($157);
|
|
$158 = HEAP32[$2>>2]|0;
|
|
HEAP32[9263] = $158;
|
|
$159 = HEAP32[9262]|0;
|
|
_emit_codetag($159);
|
|
_emit_drop();
|
|
$160 = HEAP32[$1>>2]|0;
|
|
HEAP32[9262] = $160;
|
|
$161 = HEAP32[9264]|0;
|
|
$162 = (($161) + -1)|0;
|
|
HEAP32[9264] = $162;
|
|
break L7;
|
|
}
|
|
_parse_error(4204);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
break;
|
|
}
|
|
case 139: {
|
|
$163 = HEAP32[9264]|0;
|
|
$164 = (($163) + 1)|0;
|
|
HEAP32[9264] = $164;
|
|
$165 = HEAP32[9262]|0;
|
|
HEAP32[$1>>2] = $165;
|
|
$166 = (_tag_new(32)|0);
|
|
HEAP32[9262] = $166;
|
|
$167 = (_tag_new(32)|0);
|
|
HEAP32[$9>>2] = $167;
|
|
$168 = (_tag_new(32)|0);
|
|
HEAP32[$10>>2] = $168;
|
|
$169 = (_parse_expr()|0);
|
|
$170 = ($169|0)!=(0);
|
|
if (!($170)) {
|
|
_parse_error(4222);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
(_next_line()|0);
|
|
while(1) {
|
|
$171 = HEAP8[111813]|0;
|
|
$172 = $171&255;
|
|
$173 = ($172|0)!=(142);
|
|
if (!($173)) {
|
|
label = 96;
|
|
break;
|
|
}
|
|
$174 = HEAP8[111813]|0;
|
|
$175 = $174&255;
|
|
$176 = ($175|0)==(140);
|
|
if ($176) {
|
|
$177 = (_parse_expr()|0);
|
|
$178 = ($177|0)!=(0);
|
|
if (!($178)) {
|
|
label = 80;
|
|
break;
|
|
}
|
|
$179 = HEAP32[$9>>2]|0;
|
|
_emit_brne($179);
|
|
$180 = HEAP32[$10>>2]|0;
|
|
_emit_codetag($180);
|
|
while(1) {
|
|
$181 = (_parse_stmnt()|0);
|
|
$182 = ($181|0)!=(0);
|
|
if (!($182)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$183 = (_tag_new(32)|0);
|
|
HEAP32[$10>>2] = $183;
|
|
$184 = HEAP8[112342]|0;
|
|
$185 = $184&255;
|
|
$186 = ($185|0)!=(157);
|
|
if ($186) {
|
|
$187 = HEAP32[$10>>2]|0;
|
|
_emit_brnch($187);
|
|
}
|
|
$188 = HEAP32[$9>>2]|0;
|
|
_emit_codetag($188);
|
|
$189 = (_tag_new(32)|0);
|
|
HEAP32[$9>>2] = $189;
|
|
continue;
|
|
} else {
|
|
$190 = HEAP8[111813]|0;
|
|
$191 = $190&255;
|
|
$192 = ($191|0)==(141);
|
|
if (!($192)) {
|
|
$199 = HEAP8[111813]|0;
|
|
$200 = $199&255;
|
|
$201 = ($200|0)==(128);
|
|
if (!($201)) {
|
|
label = 95;
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
continue;
|
|
}
|
|
$193 = HEAP32[$10>>2]|0;
|
|
_emit_codetag($193);
|
|
HEAP32[$10>>2] = 0;
|
|
(_scan()|0);
|
|
while(1) {
|
|
$194 = (_parse_stmnt()|0);
|
|
$195 = ($194|0)!=(0);
|
|
if (!($195)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$196 = HEAP8[111813]|0;
|
|
$197 = $196&255;
|
|
$198 = ($197|0)!=(142);
|
|
if ($198) {
|
|
label = 92;
|
|
break;
|
|
} else {
|
|
continue;
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 80) {
|
|
_parse_error(4242);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
else if ((label|0) == 92) {
|
|
_parse_error(4265);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
else if ((label|0) == 95) {
|
|
_parse_error(4289);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
else if ((label|0) == 96) {
|
|
$202 = HEAP32[$10>>2]|0;
|
|
$203 = ($202|0)!=(0);
|
|
if ($203) {
|
|
$204 = HEAP32[$10>>2]|0;
|
|
_emit_codetag($204);
|
|
}
|
|
$205 = HEAP32[9262]|0;
|
|
_emit_codetag($205);
|
|
_emit_drop();
|
|
$206 = HEAP32[$1>>2]|0;
|
|
HEAP32[9262] = $206;
|
|
$207 = HEAP32[9264]|0;
|
|
$208 = (($207) + -1)|0;
|
|
HEAP32[9264] = $208;
|
|
break L7;
|
|
}
|
|
break;
|
|
}
|
|
case 160: {
|
|
$209 = HEAP32[9263]|0;
|
|
$210 = ($209|0)!=(0);
|
|
if ($210) {
|
|
$211 = HEAP32[9263]|0;
|
|
_emit_brnch($211);
|
|
break L7;
|
|
}
|
|
_parse_error(4305);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
break;
|
|
}
|
|
case 157: {
|
|
$212 = HEAP32[9262]|0;
|
|
$213 = ($212|0)!=(0);
|
|
if ($213) {
|
|
$214 = HEAP32[9262]|0;
|
|
_emit_brnch($214);
|
|
break L7;
|
|
}
|
|
_parse_error(4327);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
break;
|
|
}
|
|
case 156: {
|
|
$215 = HEAP32[9261]|0;
|
|
$216 = ($215|0)!=(0);
|
|
if (!($216)) {
|
|
$224 = (_parse_expr()|0);
|
|
$225 = ($224|0)!=(0);
|
|
if (!($225)) {
|
|
_emit_const(0);
|
|
}
|
|
_emit_ret();
|
|
break L7;
|
|
}
|
|
HEAP32[$15>>2] = 0;
|
|
while(1) {
|
|
$217 = HEAP32[$15>>2]|0;
|
|
$218 = HEAP32[9264]|0;
|
|
$219 = ($217|0)<($218|0);
|
|
if (!($219)) {
|
|
break;
|
|
}
|
|
_emit_drop();
|
|
$220 = HEAP32[$15>>2]|0;
|
|
$221 = (($220) + 1)|0;
|
|
HEAP32[$15>>2] = $221;
|
|
}
|
|
$222 = (_parse_expr()|0);
|
|
$223 = ($222|0)!=(0);
|
|
if (!($223)) {
|
|
_emit_const(0);
|
|
}
|
|
_emit_leave();
|
|
break;
|
|
}
|
|
case 187: case 128: {
|
|
HEAP32[$0>>2] = 1;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
break;
|
|
}
|
|
case 151: case 155: case 136: case 142: case 141: case 140: case 147: case 149: case 138: case 135: case 133: case 134: {
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
break;
|
|
}
|
|
case 214: {
|
|
$226 = HEAP32[9255]|0;
|
|
HEAP32[$14>>2] = $226;
|
|
$227 = HEAP32[9255]|0;
|
|
$228 = HEAP32[9256]|0;
|
|
$229 = (_id_type($227,$228)|0);
|
|
HEAP32[$11>>2] = $229;
|
|
$230 = HEAP32[9255]|0;
|
|
$231 = HEAP32[9256]|0;
|
|
$232 = (_id_tag($230,$231)|0);
|
|
HEAP32[$12>>2] = $232;
|
|
$233 = HEAP32[$11>>2]|0;
|
|
$234 = $233 & 6;
|
|
$235 = ($234|0)!=(0);
|
|
$236 = HEAP32[$11>>2]|0;
|
|
do {
|
|
if ($235) {
|
|
HEAP32[$16>>2] = $236;
|
|
HEAP32[$17>>2] = 0;
|
|
$237 = (_scan()|0);
|
|
$238 = $237&255;
|
|
$239 = ($238|0)==(174);
|
|
if ($239) {
|
|
label = 120;
|
|
} else {
|
|
$240 = HEAP8[111813]|0;
|
|
$241 = $240&255;
|
|
$242 = ($241|0)==(186);
|
|
if ($242) {
|
|
label = 120;
|
|
}
|
|
}
|
|
do {
|
|
if ((label|0) == 120) {
|
|
$243 = HEAP8[111813]|0;
|
|
$244 = $243&255;
|
|
$245 = ($244|0)==(174);
|
|
$246 = $245 ? 4 : 2;
|
|
HEAP32[$16>>2] = $246;
|
|
$247 = (_parse_const($17)|0);
|
|
$248 = ($247|0)!=(0);
|
|
if ($248) {
|
|
(_scan()|0);
|
|
break;
|
|
} else {
|
|
HEAP8[111813] = -42;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$249 = HEAP8[111813]|0;
|
|
$250 = $249&255;
|
|
$251 = ($250|0)==(189);
|
|
if (!($251)) {
|
|
$264 = HEAP8[111813]|0;
|
|
$265 = $264&255;
|
|
$266 = ($265|0)==(208);
|
|
if (!($266)) {
|
|
$267 = HEAP8[111813]|0;
|
|
$268 = $267&255;
|
|
$269 = ($268|0)==(203);
|
|
if (!($269)) {
|
|
break;
|
|
}
|
|
}
|
|
$270 = HEAP32[$11>>2]|0;
|
|
$271 = $270 & 64;
|
|
$272 = ($271|0)!=(0);
|
|
$273 = HEAP32[$16>>2]|0;
|
|
$274 = $273 & 4;
|
|
$275 = ($274|0)!=(0);
|
|
$276 = HEAP32[$12>>2]|0;
|
|
$277 = HEAP32[$17>>2]|0;
|
|
if ($272) {
|
|
$278 = (($276) + ($277))|0;
|
|
if ($275) {
|
|
_emit_llb($278);
|
|
$279 = HEAP8[111813]|0;
|
|
$280 = $279&255;
|
|
(_emit_unaryop($280)|0);
|
|
$281 = HEAP32[$12>>2]|0;
|
|
$282 = HEAP32[$17>>2]|0;
|
|
$283 = (($281) + ($282))|0;
|
|
_emit_slb($283);
|
|
break L7;
|
|
} else {
|
|
_emit_llw($278);
|
|
$284 = HEAP8[111813]|0;
|
|
$285 = $284&255;
|
|
(_emit_unaryop($285)|0);
|
|
$286 = HEAP32[$12>>2]|0;
|
|
$287 = HEAP32[$17>>2]|0;
|
|
$288 = (($286) + ($287))|0;
|
|
_emit_slw($288);
|
|
break L7;
|
|
}
|
|
} else {
|
|
$289 = HEAP32[$11>>2]|0;
|
|
if ($275) {
|
|
_emit_lab($276,$277,$289);
|
|
$290 = HEAP8[111813]|0;
|
|
$291 = $290&255;
|
|
(_emit_unaryop($291)|0);
|
|
$292 = HEAP32[$12>>2]|0;
|
|
$293 = HEAP32[$17>>2]|0;
|
|
$294 = HEAP32[$11>>2]|0;
|
|
_emit_sab($292,$293,$294);
|
|
break L7;
|
|
} else {
|
|
_emit_law($276,$277,$289);
|
|
$295 = HEAP8[111813]|0;
|
|
$296 = $295&255;
|
|
(_emit_unaryop($296)|0);
|
|
$297 = HEAP32[$12>>2]|0;
|
|
$298 = HEAP32[$17>>2]|0;
|
|
$299 = HEAP32[$11>>2]|0;
|
|
_emit_saw($297,$298,$299);
|
|
break L7;
|
|
}
|
|
}
|
|
}
|
|
$252 = (_parse_expr()|0);
|
|
$253 = ($252|0)!=(0);
|
|
if (!($253)) {
|
|
_parse_error(4020);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$254 = HEAP32[$11>>2]|0;
|
|
$255 = $254 & 64;
|
|
$256 = ($255|0)!=(0);
|
|
$257 = HEAP32[$16>>2]|0;
|
|
$258 = $257 & 4;
|
|
$259 = ($258|0)!=(0);
|
|
$260 = HEAP32[$12>>2]|0;
|
|
$261 = HEAP32[$17>>2]|0;
|
|
if ($256) {
|
|
$262 = (($260) + ($261))|0;
|
|
if ($259) {
|
|
_emit_slb($262);
|
|
break L7;
|
|
} else {
|
|
_emit_slw($262);
|
|
break L7;
|
|
}
|
|
} else {
|
|
$263 = HEAP32[$11>>2]|0;
|
|
if ($259) {
|
|
_emit_sab($260,$261,$263);
|
|
break L7;
|
|
} else {
|
|
_emit_saw($260,$261,$263);
|
|
break L7;
|
|
}
|
|
}
|
|
} else {
|
|
$300 = $236 & 8216;
|
|
$301 = ($300|0)!=(0);
|
|
if ($301) {
|
|
$302 = (_scan()|0);
|
|
$303 = $302&255;
|
|
$304 = ($303|0)==(128);
|
|
if ($304) {
|
|
$305 = HEAP32[$12>>2]|0;
|
|
$306 = HEAP32[$11>>2]|0;
|
|
_emit_call($305,$306);
|
|
_emit_drop();
|
|
break L7;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$307 = HEAP32[$14>>2]|0;
|
|
HEAP32[9255] = $307;
|
|
label = 146;
|
|
break;
|
|
}
|
|
default: {
|
|
label = 146;
|
|
}
|
|
}
|
|
} while(0);
|
|
do {
|
|
if ((label|0) == 146) {
|
|
$308 = HEAP32[9255]|0;
|
|
_scan_rewind($308);
|
|
$309 = (_parse_value(0)|0);
|
|
HEAP32[$11>>2] = $309;
|
|
$310 = ($309|0)!=(0);
|
|
if (!($310)) {
|
|
_parse_error(4346);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$311 = HEAP8[111813]|0;
|
|
$312 = $311&255;
|
|
$313 = ($312|0)==(189);
|
|
if ($313) {
|
|
$314 = (_parse_expr()|0);
|
|
$315 = ($314|0)!=(0);
|
|
if (!($315)) {
|
|
_parse_error(4020);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
$316 = HEAP32[$11>>2]|0;
|
|
$317 = $316 & 64;
|
|
$318 = ($317|0)!=(0);
|
|
$319 = HEAP32[$11>>2]|0;
|
|
$320 = $319 & 516;
|
|
$321 = ($320|0)!=(0);
|
|
if ($318) {
|
|
if ($321) {
|
|
_emit_sb();
|
|
break;
|
|
} else {
|
|
_emit_sw();
|
|
break;
|
|
}
|
|
} else {
|
|
if ($321) {
|
|
_emit_sb();
|
|
break;
|
|
} else {
|
|
_emit_sw();
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$322 = HEAP8[111813]|0;
|
|
$323 = $322&255;
|
|
$324 = ($323|0)==(208);
|
|
if (!($324)) {
|
|
$325 = HEAP8[111813]|0;
|
|
$326 = $325&255;
|
|
$327 = ($326|0)==(203);
|
|
if (!($327)) {
|
|
$335 = HEAP32[$11>>2]|0;
|
|
$336 = $335 & 512;
|
|
$337 = ($336|0)!=(0);
|
|
if ($337) {
|
|
_emit_lb();
|
|
} else {
|
|
$338 = HEAP32[$11>>2]|0;
|
|
$339 = $338 & 256;
|
|
$340 = ($339|0)!=(0);
|
|
if ($340) {
|
|
_emit_lw();
|
|
}
|
|
}
|
|
_emit_drop();
|
|
break;
|
|
}
|
|
}
|
|
$328 = HEAP32[$11>>2]|0;
|
|
$329 = $328 & 516;
|
|
$330 = ($329|0)!=(0);
|
|
_emit_dup();
|
|
if ($330) {
|
|
_emit_lb();
|
|
$331 = HEAP8[111813]|0;
|
|
$332 = $331&255;
|
|
(_emit_unaryop($332)|0);
|
|
_emit_sb();
|
|
break;
|
|
} else {
|
|
_emit_lw();
|
|
$333 = HEAP8[111813]|0;
|
|
$334 = $333&255;
|
|
(_emit_unaryop($334)|0);
|
|
_emit_sw();
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$341 = (_scan()|0);
|
|
$342 = $341&255;
|
|
$343 = ($342|0)!=(128);
|
|
if ($343) {
|
|
$344 = HEAP8[111813]|0;
|
|
$345 = $344&255;
|
|
$346 = ($345|0)!=(187);
|
|
if ($346) {
|
|
_parse_error(4359);
|
|
HEAP32[$0>>2] = 0;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
}
|
|
HEAP32[$0>>2] = 1;
|
|
$347 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($347|0);
|
|
}
|
|
function _parse_var($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
|
|
var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
|
|
var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$1 = sp + 32|0;
|
|
$2 = sp + 28|0;
|
|
$3 = sp + 24|0;
|
|
$4 = sp + 20|0;
|
|
$5 = sp + 16|0;
|
|
$6 = sp + 12|0;
|
|
$7 = sp + 8|0;
|
|
$8 = sp + 4|0;
|
|
$9 = sp;
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$8>>2] = 0;
|
|
HEAP32[$9>>2] = 1;
|
|
$10 = (_scan()|0);
|
|
$11 = $10&255;
|
|
$12 = ($11|0)==(219);
|
|
do {
|
|
if ($12) {
|
|
HEAP32[$9>>2] = 0;
|
|
(_parse_constexpr($9,$6)|0);
|
|
$13 = HEAP8[111813]|0;
|
|
$14 = $13&255;
|
|
$15 = ($14|0)!=(221);
|
|
if (!($15)) {
|
|
(_scan()|0);
|
|
break;
|
|
}
|
|
_parse_error(3970);
|
|
HEAP32[$1>>2] = 0;
|
|
$73 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
} while(0);
|
|
$16 = HEAP8[111813]|0;
|
|
$17 = $16&255;
|
|
$18 = ($17|0)==(214);
|
|
do {
|
|
if ($18) {
|
|
$19 = HEAP32[9255]|0;
|
|
HEAP32[$3>>2] = $19;
|
|
$20 = HEAP32[9256]|0;
|
|
HEAP32[$8>>2] = $20;
|
|
$21 = (_scan()|0);
|
|
$22 = $21&255;
|
|
$23 = ($22|0)==(219);
|
|
if ($23) {
|
|
HEAP32[$9>>2] = 0;
|
|
(_parse_constexpr($9,$6)|0);
|
|
$24 = HEAP8[111813]|0;
|
|
$25 = $24&255;
|
|
$26 = ($25|0)!=(221);
|
|
if (!($26)) {
|
|
(_scan()|0);
|
|
break;
|
|
}
|
|
_parse_error(3970);
|
|
HEAP32[$1>>2] = 0;
|
|
$73 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
}
|
|
} while(0);
|
|
$27 = HEAP32[$2>>2]|0;
|
|
$28 = $27 & 2;
|
|
$29 = ($28|0)!=(0);
|
|
if ($29) {
|
|
$30 = HEAP32[$9>>2]|0;
|
|
$31 = $30<<1;
|
|
HEAP32[$9>>2] = $31;
|
|
}
|
|
$32 = HEAP8[111813]|0;
|
|
$33 = $32&255;
|
|
$34 = ($33|0)==(189);
|
|
do {
|
|
if ($34) {
|
|
$35 = HEAP32[$2>>2]|0;
|
|
$36 = $35 & 192;
|
|
$37 = ($36|0)!=(0);
|
|
if ($37) {
|
|
_parse_error(4381);
|
|
HEAP32[$1>>2] = 0;
|
|
$73 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
$38 = HEAP32[$8>>2]|0;
|
|
$39 = ($38|0)!=(0);
|
|
if ($39) {
|
|
$40 = HEAP32[$3>>2]|0;
|
|
$41 = HEAP32[$8>>2]|0;
|
|
$42 = HEAP32[$2>>2]|0;
|
|
(_idglobal_add($40,$41,$42,0)|0);
|
|
}
|
|
$43 = (_parse_constexpr($4,$6)|0);
|
|
HEAP32[$5>>2] = $43;
|
|
$44 = ($43|0)!=(0);
|
|
if (!($44)) {
|
|
_parse_error(4447);
|
|
HEAP32[$1>>2] = 0;
|
|
$73 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
$45 = HEAP32[$2>>2]|0;
|
|
$46 = HEAP32[$5>>2]|0;
|
|
$47 = HEAP32[$4>>2]|0;
|
|
$48 = HEAP32[$6>>2]|0;
|
|
$49 = (_emit_data($45,$46,$47,$48)|0);
|
|
HEAP32[$7>>2] = $49;
|
|
while(1) {
|
|
$50 = HEAP8[111813]|0;
|
|
$51 = $50&255;
|
|
$52 = ($51|0)==(172);
|
|
if (!($52)) {
|
|
label = 23;
|
|
break;
|
|
}
|
|
$53 = (_parse_constexpr($4,$6)|0);
|
|
HEAP32[$5>>2] = $53;
|
|
$54 = ($53|0)!=(0);
|
|
if (!($54)) {
|
|
label = 22;
|
|
break;
|
|
}
|
|
$55 = HEAP32[$2>>2]|0;
|
|
$56 = HEAP32[$5>>2]|0;
|
|
$57 = HEAP32[$4>>2]|0;
|
|
$58 = HEAP32[$6>>2]|0;
|
|
$59 = (_emit_data($55,$56,$57,$58)|0);
|
|
$60 = HEAP32[$7>>2]|0;
|
|
$61 = (($60) + ($59))|0;
|
|
HEAP32[$7>>2] = $61;
|
|
}
|
|
if ((label|0) == 22) {
|
|
_parse_error(4425);
|
|
HEAP32[$1>>2] = 0;
|
|
$73 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
else if ((label|0) == 23) {
|
|
$62 = HEAP32[$9>>2]|0;
|
|
$63 = HEAP32[$7>>2]|0;
|
|
$64 = ($62|0)>($63|0);
|
|
if (!($64)) {
|
|
break;
|
|
}
|
|
$65 = HEAP32[$9>>2]|0;
|
|
$66 = HEAP32[$7>>2]|0;
|
|
_idglobal_size(768,$65,$66);
|
|
break;
|
|
}
|
|
} else {
|
|
$67 = HEAP32[$8>>2]|0;
|
|
$68 = ($67|0)!=(0);
|
|
if ($68) {
|
|
$69 = HEAP32[$3>>2]|0;
|
|
$70 = HEAP32[$8>>2]|0;
|
|
$71 = HEAP32[$2>>2]|0;
|
|
$72 = HEAP32[$9>>2]|0;
|
|
(_id_add($69,$70,$71,$72)|0);
|
|
}
|
|
}
|
|
} while(0);
|
|
HEAP32[$1>>2] = 1;
|
|
$73 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($73|0);
|
|
}
|
|
function _parse_struc() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
|
|
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
|
|
var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 112|0;
|
|
$0 = sp + 28|0;
|
|
$1 = sp + 24|0;
|
|
$2 = sp + 20|0;
|
|
$3 = sp + 16|0;
|
|
$4 = sp + 12|0;
|
|
$5 = sp + 8|0;
|
|
$6 = sp + 32|0;
|
|
$7 = sp + 4|0;
|
|
$8 = sp;
|
|
HEAP32[$4>>2] = 0;
|
|
HEAP32[$7>>2] = 0;
|
|
HEAP32[$8>>2] = 0;
|
|
$9 = (_scan()|0);
|
|
$10 = $9&255;
|
|
$11 = ($10|0)==(214);
|
|
L1: do {
|
|
if ($11) {
|
|
$12 = HEAP32[9256]|0;
|
|
HEAP32[$8>>2] = $12;
|
|
HEAP32[$7>>2] = 0;
|
|
while(1) {
|
|
$13 = HEAP32[$7>>2]|0;
|
|
$14 = HEAP32[$8>>2]|0;
|
|
$15 = ($13|0)<($14|0);
|
|
if (!($15)) {
|
|
break L1;
|
|
}
|
|
$16 = HEAP32[$7>>2]|0;
|
|
$17 = HEAP32[9255]|0;
|
|
$18 = (($17) + ($16)|0);
|
|
$19 = HEAP8[$18>>0]|0;
|
|
$20 = HEAP32[$7>>2]|0;
|
|
$21 = (($6) + ($20)|0);
|
|
HEAP8[$21>>0] = $19;
|
|
$22 = HEAP32[$7>>2]|0;
|
|
$23 = (($22) + 1)|0;
|
|
HEAP32[$7>>2] = $23;
|
|
}
|
|
}
|
|
} while(0);
|
|
L6: while(1) {
|
|
$24 = (_next_line()|0);
|
|
$25 = ($24|0)==(130);
|
|
if (!($25)) {
|
|
$26 = HEAP8[111813]|0;
|
|
$27 = $26&255;
|
|
$28 = ($27|0)==(131);
|
|
if (!($28)) {
|
|
$29 = HEAP8[111813]|0;
|
|
$30 = $29&255;
|
|
$31 = ($30|0)==(128);
|
|
if (!($31)) {
|
|
label = 26;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$32 = HEAP8[111813]|0;
|
|
$33 = $32&255;
|
|
$34 = ($33|0)==(128);
|
|
if ($34) {
|
|
continue;
|
|
}
|
|
HEAP32[$1>>2] = 1;
|
|
$35 = HEAP8[111813]|0;
|
|
$36 = $35&255;
|
|
$37 = ($36|0)==(130);
|
|
$38 = $37 ? 4 : 2;
|
|
HEAP32[$2>>2] = $38;
|
|
$39 = (_scan()|0);
|
|
$40 = $39&255;
|
|
$41 = ($40|0)==(219);
|
|
if ($41) {
|
|
HEAP32[$1>>2] = 0;
|
|
(_parse_constexpr($1,$3)|0);
|
|
$42 = HEAP8[111813]|0;
|
|
$43 = $42&255;
|
|
$44 = ($43|0)!=(221);
|
|
if ($44) {
|
|
label = 11;
|
|
break;
|
|
}
|
|
(_scan()|0);
|
|
}
|
|
while(1) {
|
|
HEAP32[$7>>2] = 0;
|
|
$45 = HEAP8[111813]|0;
|
|
$46 = $45&255;
|
|
$47 = ($46|0)==(214);
|
|
if ($47) {
|
|
$48 = HEAP32[9255]|0;
|
|
HEAP32[$5>>2] = $48;
|
|
$49 = HEAP32[9256]|0;
|
|
HEAP32[$7>>2] = $49;
|
|
$50 = (_scan()|0);
|
|
$51 = $50&255;
|
|
$52 = ($51|0)==(219);
|
|
if ($52) {
|
|
HEAP32[$1>>2] = 0;
|
|
(_parse_constexpr($1,$3)|0);
|
|
$53 = HEAP8[111813]|0;
|
|
$54 = $53&255;
|
|
$55 = ($54|0)!=(221);
|
|
if ($55) {
|
|
label = 16;
|
|
break L6;
|
|
}
|
|
(_scan()|0);
|
|
}
|
|
}
|
|
$56 = HEAP32[$2>>2]|0;
|
|
$57 = $56 & 2;
|
|
$58 = ($57|0)!=(0);
|
|
if ($58) {
|
|
$59 = HEAP32[$1>>2]|0;
|
|
$60 = $59<<1;
|
|
HEAP32[$1>>2] = $60;
|
|
}
|
|
$61 = HEAP32[$7>>2]|0;
|
|
$62 = ($61|0)!=(0);
|
|
if ($62) {
|
|
$63 = HEAP32[$5>>2]|0;
|
|
$64 = HEAP32[$7>>2]|0;
|
|
$65 = HEAP32[$4>>2]|0;
|
|
(_idconst_add($63,$64,$65)|0);
|
|
}
|
|
$66 = HEAP32[$1>>2]|0;
|
|
$67 = HEAP32[$4>>2]|0;
|
|
$68 = (($67) + ($66))|0;
|
|
HEAP32[$4>>2] = $68;
|
|
$69 = HEAP8[111813]|0;
|
|
$70 = $69&255;
|
|
$71 = ($70|0)==(172);
|
|
if (!($71)) {
|
|
break;
|
|
}
|
|
}
|
|
$72 = HEAP8[111813]|0;
|
|
$73 = $72&255;
|
|
$74 = ($73|0)!=(128);
|
|
if (!($74)) {
|
|
continue;
|
|
}
|
|
$75 = HEAP8[111813]|0;
|
|
$76 = $75&255;
|
|
$77 = ($76|0)!=(187);
|
|
if ($77) {
|
|
label = 25;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 11) {
|
|
_parse_error(3970);
|
|
HEAP32[$0>>2] = 0;
|
|
$86 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($86|0);
|
|
}
|
|
else if ((label|0) == 16) {
|
|
_parse_error(3970);
|
|
HEAP32[$0>>2] = 0;
|
|
$86 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($86|0);
|
|
}
|
|
else if ((label|0) == 25) {
|
|
HEAP32[$0>>2] = 0;
|
|
$86 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($86|0);
|
|
}
|
|
else if ((label|0) == 26) {
|
|
$78 = HEAP32[$8>>2]|0;
|
|
$79 = ($78|0)!=(0);
|
|
if ($79) {
|
|
$80 = HEAP32[$8>>2]|0;
|
|
$81 = HEAP32[$4>>2]|0;
|
|
(_idconst_add($6,$80,$81)|0);
|
|
}
|
|
$82 = HEAP8[111813]|0;
|
|
$83 = $82&255;
|
|
$84 = ($83|0)==(136);
|
|
$85 = $84&1;
|
|
HEAP32[$0>>2] = $85;
|
|
$86 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($86|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _parse_vars($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
|
|
var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
|
|
var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$1 = sp + 20|0;
|
|
$2 = sp + 16|0;
|
|
$3 = sp + 12|0;
|
|
$4 = sp + 8|0;
|
|
$5 = sp + 4|0;
|
|
$6 = sp;
|
|
HEAP32[$2>>2] = $0;
|
|
$7 = HEAP8[111813]|0;
|
|
$8 = $7&255;
|
|
L1: do {
|
|
switch ($8|0) {
|
|
case 158: {
|
|
$9 = HEAP32[$2>>2]|0;
|
|
$10 = $9 & 192;
|
|
$11 = ($10|0)!=(0);
|
|
if ($11) {
|
|
_parse_error(4472);
|
|
HEAP32[$1>>2] = 0;
|
|
break L1;
|
|
}
|
|
$12 = (_parse_constexpr($3,$5)|0);
|
|
$13 = ($12|0)!=(0);
|
|
if ($13) {
|
|
$14 = HEAP32[$3>>2]|0;
|
|
_emit_sysflags($14);
|
|
label = 35;
|
|
break L1;
|
|
} else {
|
|
_parse_error(4496);
|
|
HEAP32[$1>>2] = 0;
|
|
break L1;
|
|
}
|
|
break;
|
|
}
|
|
case 129: {
|
|
$15 = (_scan()|0);
|
|
$16 = $15&255;
|
|
$17 = ($16|0)!=(214);
|
|
if ($17) {
|
|
_parse_error(4509);
|
|
HEAP32[$1>>2] = 0;
|
|
break L1;
|
|
}
|
|
$18 = HEAP32[9255]|0;
|
|
HEAP32[$6>>2] = $18;
|
|
$19 = HEAP32[9256]|0;
|
|
HEAP32[$4>>2] = $19;
|
|
$20 = (_scan()|0);
|
|
$21 = $20&255;
|
|
$22 = ($21|0)!=(189);
|
|
if ($22) {
|
|
_parse_error(4526);
|
|
HEAP32[$1>>2] = 0;
|
|
break L1;
|
|
}
|
|
$23 = (_parse_constexpr($3,$5)|0);
|
|
$24 = ($23|0)!=(0);
|
|
if ($24) {
|
|
$25 = HEAP32[$6>>2]|0;
|
|
$26 = HEAP32[$4>>2]|0;
|
|
$27 = HEAP32[$3>>2]|0;
|
|
(_idconst_add($25,$26,$27)|0);
|
|
label = 35;
|
|
break L1;
|
|
} else {
|
|
_parse_error(4496);
|
|
HEAP32[$1>>2] = 0;
|
|
break L1;
|
|
}
|
|
break;
|
|
}
|
|
case 159: {
|
|
$28 = (_parse_struc()|0);
|
|
$29 = ($28|0)!=(0);
|
|
if ($29) {
|
|
label = 35;
|
|
} else {
|
|
_parse_error(4537);
|
|
HEAP32[$1>>2] = 0;
|
|
}
|
|
break;
|
|
}
|
|
case 154: {
|
|
$30 = HEAP32[$2>>2]|0;
|
|
$31 = $30 & 192;
|
|
$32 = ($31|0)!=(0);
|
|
if ($32) {
|
|
_parse_error(4562);
|
|
HEAP32[$1>>2] = 0;
|
|
break L1;
|
|
}
|
|
HEAP32[$2>>2] = 4096;
|
|
$33 = HEAP32[9255]|0;
|
|
HEAP32[$6>>2] = $33;
|
|
$34 = (_scan()|0);
|
|
$35 = $34&255;
|
|
$36 = ($35|0)!=(130);
|
|
if ($36) {
|
|
$37 = HEAP8[111813]|0;
|
|
$38 = $37&255;
|
|
$39 = ($38|0)!=(131);
|
|
if ($39) {
|
|
$40 = HEAP32[$6>>2]|0;
|
|
_scan_rewind($40);
|
|
(_scan()|0);
|
|
HEAP32[$1>>2] = 0;
|
|
} else {
|
|
label = 21;
|
|
}
|
|
} else {
|
|
label = 21;
|
|
}
|
|
break;
|
|
}
|
|
case 131: case 130: {
|
|
label = 21;
|
|
break;
|
|
}
|
|
case 150: {
|
|
$56 = (_scan()|0);
|
|
$57 = $56&255;
|
|
$58 = ($57|0)==(214);
|
|
if (!($58)) {
|
|
_parse_error(4601);
|
|
HEAP32[$1>>2] = 0;
|
|
break L1;
|
|
}
|
|
$59 = HEAP32[$2>>2]|0;
|
|
$60 = $59 | 8192;
|
|
HEAP32[$2>>2] = $60;
|
|
$61 = HEAP32[9255]|0;
|
|
HEAP32[$6>>2] = $61;
|
|
$62 = HEAP32[9256]|0;
|
|
HEAP32[$4>>2] = $62;
|
|
$63 = HEAP32[9255]|0;
|
|
$64 = HEAP32[9256]|0;
|
|
$65 = HEAP32[$2>>2]|0;
|
|
$66 = HEAP32[$2>>2]|0;
|
|
$67 = (_tag_new($66)|0);
|
|
(_idfunc_add($63,$64,$65,$67)|0);
|
|
while(1) {
|
|
$68 = (_scan()|0);
|
|
$69 = $68&255;
|
|
$70 = ($69|0)==(172);
|
|
if (!($70)) {
|
|
label = 33;
|
|
break L1;
|
|
}
|
|
$71 = (_scan()|0);
|
|
$72 = $71&255;
|
|
$73 = ($72|0)==(214);
|
|
if (!($73)) {
|
|
break;
|
|
}
|
|
$74 = HEAP32[9255]|0;
|
|
HEAP32[$6>>2] = $74;
|
|
$75 = HEAP32[9256]|0;
|
|
HEAP32[$4>>2] = $75;
|
|
$76 = HEAP32[9255]|0;
|
|
$77 = HEAP32[9256]|0;
|
|
$78 = HEAP32[$2>>2]|0;
|
|
$79 = HEAP32[$2>>2]|0;
|
|
$80 = (_tag_new($79)|0);
|
|
(_idfunc_add($76,$77,$78,$80)|0);
|
|
}
|
|
_parse_error(4601);
|
|
HEAP32[$1>>2] = 0;
|
|
break;
|
|
}
|
|
case 187: case 128: {
|
|
label = 33;
|
|
break;
|
|
}
|
|
default: {
|
|
HEAP32[$1>>2] = 0;
|
|
}
|
|
}
|
|
} while(0);
|
|
L37: do {
|
|
if ((label|0) == 21) {
|
|
$41 = HEAP8[111813]|0;
|
|
$42 = $41&255;
|
|
$43 = ($42|0)==(130);
|
|
$44 = $43 ? 4 : 2;
|
|
$45 = HEAP32[$2>>2]|0;
|
|
$46 = $45 | $44;
|
|
HEAP32[$2>>2] = $46;
|
|
$47 = HEAP32[$2>>2]|0;
|
|
$48 = (_parse_var($47)|0);
|
|
$49 = ($48|0)!=(0);
|
|
if (!($49)) {
|
|
HEAP32[$1>>2] = 0;
|
|
break;
|
|
}
|
|
while(1) {
|
|
$50 = HEAP8[111813]|0;
|
|
$51 = $50&255;
|
|
$52 = ($51|0)==(172);
|
|
if (!($52)) {
|
|
label = 35;
|
|
break L37;
|
|
}
|
|
$53 = HEAP32[$2>>2]|0;
|
|
$54 = (_parse_var($53)|0);
|
|
$55 = ($54|0)!=(0);
|
|
if (!($55)) {
|
|
break;
|
|
}
|
|
}
|
|
HEAP32[$1>>2] = 0;
|
|
}
|
|
else if ((label|0) == 33) {
|
|
HEAP32[$1>>2] = 1;
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 35) {
|
|
HEAP32[$1>>2] = 1;
|
|
}
|
|
$81 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($81|0);
|
|
}
|
|
function _parse_mods() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$0 = sp;
|
|
$1 = HEAP8[111813]|0;
|
|
$2 = $1&255;
|
|
$3 = ($2|0)==(153);
|
|
do {
|
|
if ($3) {
|
|
$4 = (_scan()|0);
|
|
$5 = $4&255;
|
|
$6 = ($5|0)!=(214);
|
|
if ($6) {
|
|
_parse_error(4630);
|
|
HEAP32[$0>>2] = 0;
|
|
break;
|
|
}
|
|
$7 = HEAP32[9255]|0;
|
|
$8 = HEAP32[9256]|0;
|
|
_emit_moddep($7,$8);
|
|
(_scan()|0);
|
|
while(1) {
|
|
$9 = (_parse_vars(128)|0);
|
|
$10 = ($9|0)!=(0);
|
|
if (!($10)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$11 = HEAP8[111813]|0;
|
|
$12 = $11&255;
|
|
$13 = ($12|0)!=(136);
|
|
if ($13) {
|
|
_parse_error(4346);
|
|
HEAP32[$0>>2] = 0;
|
|
break;
|
|
}
|
|
$14 = (_scan()|0);
|
|
$15 = $14&255;
|
|
$16 = ($15|0)!=(128);
|
|
if ($16) {
|
|
$17 = HEAP8[111813]|0;
|
|
$18 = $17&255;
|
|
$19 = ($18|0)!=(187);
|
|
if ($19) {
|
|
_parse_error(4359);
|
|
HEAP32[$0>>2] = 0;
|
|
} else {
|
|
label = 12;
|
|
}
|
|
} else {
|
|
label = 12;
|
|
}
|
|
} else {
|
|
label = 12;
|
|
}
|
|
} while(0);
|
|
do {
|
|
if ((label|0) == 12) {
|
|
$20 = HEAP8[111813]|0;
|
|
$21 = $20&255;
|
|
$22 = ($21|0)==(128);
|
|
if (!($22)) {
|
|
$23 = HEAP8[111813]|0;
|
|
$24 = $23&255;
|
|
$25 = ($24|0)==(187);
|
|
if (!($25)) {
|
|
_emit_moddep(0,0);
|
|
HEAP32[$0>>2] = 0;
|
|
break;
|
|
}
|
|
}
|
|
HEAP32[$0>>2] = 1;
|
|
}
|
|
} while(0);
|
|
$26 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($26|0);
|
|
}
|
|
function _parse_defs() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
|
|
var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
|
|
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
|
|
var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
|
|
var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
|
|
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
|
|
var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$0 = sp + 12|0;
|
|
$1 = sp + 16|0;
|
|
$2 = sp + 8|0;
|
|
$3 = sp + 4|0;
|
|
$4 = sp;
|
|
HEAP32[$4>>2] = 0;
|
|
$5 = HEAP8[111813]|0;
|
|
$6 = $5&255;
|
|
$7 = ($6|0)==(154);
|
|
if ($7) {
|
|
$8 = (_scan()|0);
|
|
$9 = $8&255;
|
|
$10 = ($9|0)!=(151);
|
|
if ($10) {
|
|
$11 = HEAP8[111813]|0;
|
|
$12 = $11&255;
|
|
$13 = ($12|0)!=(152);
|
|
if ($13) {
|
|
_parse_error(4652);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
}
|
|
HEAP32[$4>>2] = 4096;
|
|
}
|
|
$14 = HEAP8[111813]|0;
|
|
$15 = $14&255;
|
|
$16 = ($15|0)==(151);
|
|
if ($16) {
|
|
$17 = (_scan()|0);
|
|
$18 = $17&255;
|
|
$19 = ($18|0)!=(214);
|
|
if ($19) {
|
|
_parse_error(4674);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
_emit_bytecode_seg();
|
|
HEAP8[112343] = 1;
|
|
HEAP32[$3>>2] = 0;
|
|
HEAP32[9261] = 1;
|
|
$20 = HEAP32[$4>>2]|0;
|
|
$21 = $20 | 16;
|
|
HEAP32[$4>>2] = $21;
|
|
$22 = HEAP32[9255]|0;
|
|
$23 = HEAP32[9256]|0;
|
|
$24 = (_idglobal_lookup($22,$23)|0);
|
|
$25 = ($24|0)>=(0);
|
|
do {
|
|
if ($25) {
|
|
$26 = HEAP32[9255]|0;
|
|
$27 = HEAP32[9256]|0;
|
|
$28 = (_id_type($26,$27)|0);
|
|
$29 = $28 & 8192;
|
|
$30 = ($29|0)!=(0);
|
|
if ($30) {
|
|
$31 = HEAP32[9255]|0;
|
|
$32 = HEAP32[9256]|0;
|
|
$33 = (_id_tag($31,$32)|0);
|
|
$34 = HEAP32[9255]|0;
|
|
_emit_idfunc($33,8192,$34);
|
|
$35 = HEAP32[$4>>2]|0;
|
|
$36 = (_tag_new($35)|0);
|
|
HEAP32[$2>>2] = $36;
|
|
$37 = HEAP32[9255]|0;
|
|
$38 = HEAP32[9256]|0;
|
|
$39 = HEAP32[$4>>2]|0;
|
|
$40 = HEAP32[$2>>2]|0;
|
|
(_idfunc_set($37,$38,$39,$40)|0);
|
|
break;
|
|
}
|
|
_parse_error(4696);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
} else {
|
|
$41 = HEAP32[$4>>2]|0;
|
|
$42 = (_tag_new($41)|0);
|
|
HEAP32[$2>>2] = $42;
|
|
$43 = HEAP32[9255]|0;
|
|
$44 = HEAP32[9256]|0;
|
|
$45 = HEAP32[$4>>2]|0;
|
|
$46 = HEAP32[$2>>2]|0;
|
|
(_idfunc_add($43,$44,$45,$46)|0);
|
|
}
|
|
} while(0);
|
|
$47 = HEAP32[9256]|0;
|
|
$48 = HEAP32[9255]|0;
|
|
$49 = (($48) + ($47)|0);
|
|
$50 = HEAP8[$49>>0]|0;
|
|
HEAP8[$1>>0] = $50;
|
|
$51 = HEAP32[9256]|0;
|
|
$52 = HEAP32[9255]|0;
|
|
$53 = (($52) + ($51)|0);
|
|
HEAP8[$53>>0] = 0;
|
|
$54 = HEAP32[$2>>2]|0;
|
|
$55 = HEAP32[$4>>2]|0;
|
|
$56 = HEAP32[9255]|0;
|
|
_emit_idfunc($54,$55,$56);
|
|
$57 = HEAP32[9255]|0;
|
|
_emit_def($57,1);
|
|
$58 = HEAP8[$1>>0]|0;
|
|
$59 = HEAP32[9256]|0;
|
|
$60 = HEAP32[9255]|0;
|
|
$61 = (($60) + ($59)|0);
|
|
HEAP8[$61>>0] = $58;
|
|
$62 = (_scan()|0);
|
|
$63 = $62&255;
|
|
$64 = ($63|0)==(168);
|
|
do {
|
|
if ($64) {
|
|
while(1) {
|
|
$65 = (_scan()|0);
|
|
$66 = $65&255;
|
|
$67 = ($66|0)==(214);
|
|
if ($67) {
|
|
$68 = HEAP32[$3>>2]|0;
|
|
$69 = (($68) + 1)|0;
|
|
HEAP32[$3>>2] = $69;
|
|
$70 = HEAP32[9255]|0;
|
|
$71 = HEAP32[9256]|0;
|
|
(_idlocal_add($70,$71,2,2)|0);
|
|
(_scan()|0);
|
|
}
|
|
$72 = HEAP8[111813]|0;
|
|
$73 = $72&255;
|
|
$74 = ($73|0)==(172);
|
|
if (!($74)) {
|
|
break;
|
|
}
|
|
}
|
|
$75 = HEAP8[111813]|0;
|
|
$76 = $75&255;
|
|
$77 = ($76|0)!=(169);
|
|
if (!($77)) {
|
|
(_scan()|0);
|
|
break;
|
|
}
|
|
_parse_error(4719);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
} while(0);
|
|
while(1) {
|
|
$78 = (_parse_vars(64)|0);
|
|
$79 = ($78|0)!=(0);
|
|
if (!($79)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$80 = HEAP32[$3>>2]|0;
|
|
_emit_enter($80);
|
|
HEAP8[112342] = 0;
|
|
while(1) {
|
|
$81 = (_parse_stmnt()|0);
|
|
$82 = ($81|0)!=(0);
|
|
if (!($82)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
HEAP32[9261] = 0;
|
|
$83 = HEAP8[111813]|0;
|
|
$84 = $83&255;
|
|
$85 = ($84|0)!=(136);
|
|
if ($85) {
|
|
_parse_error(4346);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
$86 = (_scan()|0);
|
|
$87 = $86&255;
|
|
$88 = ($87|0)!=(128);
|
|
if ($88) {
|
|
$89 = HEAP8[111813]|0;
|
|
$90 = $89&255;
|
|
$91 = ($90|0)!=(187);
|
|
if ($91) {
|
|
_parse_error(4359);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
}
|
|
$92 = HEAP8[112342]|0;
|
|
$93 = $92&255;
|
|
$94 = ($93|0)!=(156);
|
|
if ($94) {
|
|
_emit_const(0);
|
|
_emit_leave();
|
|
}
|
|
HEAP32[$0>>2] = 1;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
$95 = HEAP8[111813]|0;
|
|
$96 = $95&255;
|
|
$97 = ($96|0)==(152);
|
|
if (!($97)) {
|
|
$173 = HEAP8[111813]|0;
|
|
$174 = $173&255;
|
|
$175 = ($174|0)==(128);
|
|
if (!($175)) {
|
|
$176 = HEAP8[111813]|0;
|
|
$177 = $176&255;
|
|
$178 = ($177|0)==(187);
|
|
if (!($178)) {
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
}
|
|
HEAP32[$0>>2] = 1;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
$98 = (_scan()|0);
|
|
$99 = $98&255;
|
|
$100 = ($99|0)!=(214);
|
|
if ($100) {
|
|
_parse_error(4674);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
$101 = HEAP8[112343]|0;
|
|
$102 = ($101<<24>>24)!=(0);
|
|
if ($102) {
|
|
_parse_error(4747);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
HEAP32[$3>>2] = 0;
|
|
HEAP32[9261] = 1;
|
|
$103 = HEAP32[$4>>2]|0;
|
|
$104 = $103 | 8;
|
|
HEAP32[$4>>2] = $104;
|
|
$105 = HEAP32[9255]|0;
|
|
$106 = HEAP32[9256]|0;
|
|
$107 = (_idglobal_lookup($105,$106)|0);
|
|
$108 = ($107|0)>=(0);
|
|
do {
|
|
if ($108) {
|
|
$109 = HEAP32[9255]|0;
|
|
$110 = HEAP32[9256]|0;
|
|
$111 = (_id_type($109,$110)|0);
|
|
$112 = $111 & 8192;
|
|
$113 = ($112|0)!=(0);
|
|
if ($113) {
|
|
$114 = HEAP32[9255]|0;
|
|
$115 = HEAP32[9256]|0;
|
|
$116 = (_id_tag($114,$115)|0);
|
|
$117 = HEAP32[9255]|0;
|
|
_emit_idfunc($116,8192,$117);
|
|
$118 = HEAP32[$4>>2]|0;
|
|
$119 = (_tag_new($118)|0);
|
|
HEAP32[$2>>2] = $119;
|
|
$120 = HEAP32[9255]|0;
|
|
$121 = HEAP32[9256]|0;
|
|
$122 = HEAP32[$4>>2]|0;
|
|
$123 = HEAP32[$2>>2]|0;
|
|
(_idfunc_set($120,$121,$122,$123)|0);
|
|
break;
|
|
}
|
|
_parse_error(4696);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
} else {
|
|
$124 = HEAP32[$4>>2]|0;
|
|
$125 = (_tag_new($124)|0);
|
|
HEAP32[$2>>2] = $125;
|
|
$126 = HEAP32[9255]|0;
|
|
$127 = HEAP32[9256]|0;
|
|
$128 = HEAP32[$4>>2]|0;
|
|
$129 = HEAP32[$2>>2]|0;
|
|
(_idfunc_add($126,$127,$128,$129)|0);
|
|
}
|
|
} while(0);
|
|
$130 = HEAP32[9256]|0;
|
|
$131 = HEAP32[9255]|0;
|
|
$132 = (($131) + ($130)|0);
|
|
$133 = HEAP8[$132>>0]|0;
|
|
HEAP8[$1>>0] = $133;
|
|
$134 = HEAP32[9256]|0;
|
|
$135 = HEAP32[9255]|0;
|
|
$136 = (($135) + ($134)|0);
|
|
HEAP8[$136>>0] = 0;
|
|
$137 = HEAP32[$2>>2]|0;
|
|
$138 = HEAP32[$4>>2]|0;
|
|
$139 = HEAP32[9255]|0;
|
|
_emit_idfunc($137,$138,$139);
|
|
$140 = HEAP32[9255]|0;
|
|
_emit_def($140,0);
|
|
$141 = HEAP8[$1>>0]|0;
|
|
$142 = HEAP32[9256]|0;
|
|
$143 = HEAP32[9255]|0;
|
|
$144 = (($143) + ($142)|0);
|
|
HEAP8[$144>>0] = $141;
|
|
$145 = (_scan()|0);
|
|
$146 = $145&255;
|
|
$147 = ($146|0)==(168);
|
|
do {
|
|
if ($147) {
|
|
while(1) {
|
|
$148 = (_scan()|0);
|
|
$149 = $148&255;
|
|
$150 = ($149|0)==(214);
|
|
if ($150) {
|
|
$151 = HEAP32[$3>>2]|0;
|
|
$152 = (($151) + 1)|0;
|
|
HEAP32[$3>>2] = $152;
|
|
$153 = HEAP32[9255]|0;
|
|
$154 = HEAP32[9256]|0;
|
|
(_idlocal_add($153,$154,2,2)|0);
|
|
(_scan()|0);
|
|
}
|
|
$155 = HEAP8[111813]|0;
|
|
$156 = $155&255;
|
|
$157 = ($156|0)==(172);
|
|
if (!($157)) {
|
|
break;
|
|
}
|
|
}
|
|
$158 = HEAP8[111813]|0;
|
|
$159 = $158&255;
|
|
$160 = ($159|0)!=(169);
|
|
if (!($160)) {
|
|
(_scan()|0);
|
|
break;
|
|
}
|
|
_parse_error(4719);
|
|
HEAP32[$0>>2] = 0;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
} while(0);
|
|
while(1) {
|
|
$161 = HEAP8[111813]|0;
|
|
$162 = $161&255;
|
|
$163 = ($162|0)==(128);
|
|
if ($163) {
|
|
label = 53;
|
|
} else {
|
|
$164 = HEAP8[111813]|0;
|
|
$165 = $164&255;
|
|
$166 = ($165|0)==(187);
|
|
if ($166) {
|
|
label = 53;
|
|
} else {
|
|
$167 = HEAP8[111813]|0;
|
|
$168 = $167&255;
|
|
$169 = ($168|0)!=(136);
|
|
if ($169) {
|
|
_emit_asm(111814);
|
|
(_next_line()|0);
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 53) {
|
|
label = 0;
|
|
(_next_line()|0);
|
|
}
|
|
$170 = HEAP8[111813]|0;
|
|
$171 = $170&255;
|
|
$172 = ($171|0)!=(136);
|
|
if (!($172)) {
|
|
break;
|
|
}
|
|
}
|
|
HEAP32[$0>>2] = 1;
|
|
$179 = HEAP32[$0>>2]|0;
|
|
STACKTOP = sp;return ($179|0);
|
|
}
|
|
function _parse_module() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
|
|
var $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_emit_header();
|
|
$0 = (_next_line()|0);
|
|
$1 = ($0|0)!=(0);
|
|
if (!($1)) {
|
|
_emit_trailer();
|
|
return 0;
|
|
}
|
|
while(1) {
|
|
$2 = (_parse_mods()|0);
|
|
$3 = ($2|0)!=(0);
|
|
if (!($3)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
while(1) {
|
|
$4 = (_parse_vars(0)|0);
|
|
$5 = ($4|0)!=(0);
|
|
if (!($5)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
while(1) {
|
|
$6 = (_parse_defs()|0);
|
|
$7 = ($6|0)!=(0);
|
|
if (!($7)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$8 = HEAP8[111813]|0;
|
|
$9 = $8&255;
|
|
$10 = ($9|0)!=(155);
|
|
if (!($10)) {
|
|
_emit_trailer();
|
|
return 0;
|
|
}
|
|
$11 = HEAP8[111813]|0;
|
|
$12 = $11&255;
|
|
$13 = ($12|0)!=(255);
|
|
if (!($13)) {
|
|
_emit_trailer();
|
|
return 0;
|
|
}
|
|
_emit_bytecode_seg();
|
|
_emit_start();
|
|
_emit_def(4785,1);
|
|
HEAP8[112342] = 0;
|
|
while(1) {
|
|
$14 = (_parse_stmnt()|0);
|
|
$15 = ($14|0)!=(0);
|
|
if (!($15)) {
|
|
break;
|
|
}
|
|
(_next_line()|0);
|
|
}
|
|
$16 = HEAP8[111813]|0;
|
|
$17 = $16&255;
|
|
$18 = ($17|0)!=(155);
|
|
if ($18) {
|
|
_parse_error(4791);
|
|
}
|
|
$19 = HEAP8[112342]|0;
|
|
$20 = $19&255;
|
|
$21 = ($20|0)!=(156);
|
|
if (!($21)) {
|
|
_emit_trailer();
|
|
return 0;
|
|
}
|
|
_emit_const(0);
|
|
_emit_ret();
|
|
_emit_trailer();
|
|
return 0;
|
|
}
|
|
function _main($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0$lcssa = 0, $$01821 = 0, $$019 = 0, $$019$ph = 0, $$022 = 0, $$1$ph = 0, $$2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ($0|0)>(1);
|
|
if ($2) {
|
|
$$01821 = 1;$$022 = 0;
|
|
while(1) {
|
|
$3 = (($1) + ($$01821<<2)|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = HEAP8[$4>>0]|0;
|
|
$6 = ($5<<24>>24)==(45);
|
|
L4: do {
|
|
if ($6) {
|
|
$7 = HEAP32[$3>>2]|0;
|
|
$$019$ph = 1;$$1$ph = $$022;
|
|
while(1) {
|
|
$$019 = $$019$ph;
|
|
L8: while(1) {
|
|
$8 = (($7) + ($$019)|0);
|
|
$9 = HEAP8[$8>>0]|0;
|
|
$10 = ($9<<24>>24)==(0);
|
|
if ($10) {
|
|
$$2 = $$1$ph;
|
|
break L4;
|
|
}
|
|
$11 = (($$019) + 1)|0;
|
|
$12 = $9 << 24 >> 24;
|
|
switch ($12|0) {
|
|
case 65: {
|
|
label = 7;
|
|
break L8;
|
|
break;
|
|
}
|
|
case 77: {
|
|
label = 8;
|
|
break L8;
|
|
break;
|
|
}
|
|
default: {
|
|
$$019 = $11;
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 7) {
|
|
label = 0;
|
|
$13 = $$1$ph | 1;
|
|
$$019$ph = $11;$$1$ph = $13;
|
|
continue;
|
|
}
|
|
else if ((label|0) == 8) {
|
|
label = 0;
|
|
$14 = $$1$ph | 2;
|
|
$$019$ph = $11;$$1$ph = $14;
|
|
continue;
|
|
}
|
|
}
|
|
} else {
|
|
$$2 = $$022;
|
|
}
|
|
} while(0);
|
|
$15 = (($$01821) + 1)|0;
|
|
$exitcond = ($15|0)==($0|0);
|
|
if ($exitcond) {
|
|
$$0$lcssa = $$2;
|
|
break;
|
|
} else {
|
|
$$01821 = $15;$$022 = $$2;
|
|
}
|
|
}
|
|
} else {
|
|
$$0$lcssa = 0;
|
|
}
|
|
_emit_flags($$0$lcssa);
|
|
$16 = (_parse_module()|0);
|
|
$17 = ($16|0)==(0);
|
|
if ($17) {
|
|
return 0;
|
|
}
|
|
$18 = HEAP32[9]|0;
|
|
(_fwrite(4814,22,1,$18)|0);
|
|
return 0;
|
|
}
|
|
function ___stdio_close($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$vararg_buffer = sp;
|
|
$1 = ((($0)) + 60|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $2;
|
|
$3 = (___syscall6(6,($vararg_buffer|0))|0);
|
|
$4 = (___syscall_ret($3)|0);
|
|
STACKTOP = sp;return ($4|0);
|
|
}
|
|
function ___stdio_write($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0 = 0, $$056 = 0, $$058 = 0, $$059 = 0, $$061 = 0, $$1 = 0, $$157 = 0, $$160 = 0, $$phi$trans$insert = 0, $$pre = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
|
|
var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
|
|
var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 32|0;
|
|
$4 = ((($0)) + 28|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
HEAP32[$3>>2] = $5;
|
|
$6 = ((($3)) + 4|0);
|
|
$7 = ((($0)) + 20|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = (($8) - ($5))|0;
|
|
HEAP32[$6>>2] = $9;
|
|
$10 = ((($3)) + 8|0);
|
|
HEAP32[$10>>2] = $1;
|
|
$11 = ((($3)) + 12|0);
|
|
HEAP32[$11>>2] = $2;
|
|
$12 = (($9) + ($2))|0;
|
|
$13 = ((($0)) + 60|0);
|
|
$14 = ((($0)) + 44|0);
|
|
$$056 = 2;$$058 = $12;$$059 = $3;
|
|
while(1) {
|
|
$15 = HEAP32[9329]|0;
|
|
$16 = ($15|0)==(0|0);
|
|
if ($16) {
|
|
$20 = HEAP32[$13>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $20;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $$059;
|
|
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
|
|
HEAP32[$vararg_ptr7>>2] = $$056;
|
|
$21 = (___syscall146(146,($vararg_buffer3|0))|0);
|
|
$22 = (___syscall_ret($21)|0);
|
|
$$0 = $22;
|
|
} else {
|
|
_pthread_cleanup_push((1|0),($0|0));
|
|
$17 = HEAP32[$13>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $17;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $$059;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $$056;
|
|
$18 = (___syscall146(146,($vararg_buffer|0))|0);
|
|
$19 = (___syscall_ret($18)|0);
|
|
_pthread_cleanup_pop(0);
|
|
$$0 = $19;
|
|
}
|
|
$23 = ($$058|0)==($$0|0);
|
|
if ($23) {
|
|
label = 6;
|
|
break;
|
|
}
|
|
$30 = ($$0|0)<(0);
|
|
if ($30) {
|
|
label = 8;
|
|
break;
|
|
}
|
|
$38 = (($$058) - ($$0))|0;
|
|
$39 = ((($$059)) + 4|0);
|
|
$40 = HEAP32[$39>>2]|0;
|
|
$41 = ($$0>>>0)>($40>>>0);
|
|
if ($41) {
|
|
$42 = HEAP32[$14>>2]|0;
|
|
HEAP32[$4>>2] = $42;
|
|
HEAP32[$7>>2] = $42;
|
|
$43 = (($$0) - ($40))|0;
|
|
$44 = ((($$059)) + 8|0);
|
|
$45 = (($$056) + -1)|0;
|
|
$$phi$trans$insert = ((($$059)) + 12|0);
|
|
$$pre = HEAP32[$$phi$trans$insert>>2]|0;
|
|
$$1 = $43;$$157 = $45;$$160 = $44;$53 = $$pre;
|
|
} else {
|
|
$46 = ($$056|0)==(2);
|
|
if ($46) {
|
|
$47 = HEAP32[$4>>2]|0;
|
|
$48 = (($47) + ($$0)|0);
|
|
HEAP32[$4>>2] = $48;
|
|
$$1 = $$0;$$157 = 2;$$160 = $$059;$53 = $40;
|
|
} else {
|
|
$$1 = $$0;$$157 = $$056;$$160 = $$059;$53 = $40;
|
|
}
|
|
}
|
|
$49 = HEAP32[$$160>>2]|0;
|
|
$50 = (($49) + ($$1)|0);
|
|
HEAP32[$$160>>2] = $50;
|
|
$51 = ((($$160)) + 4|0);
|
|
$52 = (($53) - ($$1))|0;
|
|
HEAP32[$51>>2] = $52;
|
|
$$056 = $$157;$$058 = $38;$$059 = $$160;
|
|
}
|
|
if ((label|0) == 6) {
|
|
$24 = HEAP32[$14>>2]|0;
|
|
$25 = ((($0)) + 48|0);
|
|
$26 = HEAP32[$25>>2]|0;
|
|
$27 = (($24) + ($26)|0);
|
|
$28 = ((($0)) + 16|0);
|
|
HEAP32[$28>>2] = $27;
|
|
$29 = $24;
|
|
HEAP32[$4>>2] = $29;
|
|
HEAP32[$7>>2] = $29;
|
|
$$061 = $2;
|
|
}
|
|
else if ((label|0) == 8) {
|
|
$31 = ((($0)) + 16|0);
|
|
HEAP32[$31>>2] = 0;
|
|
HEAP32[$4>>2] = 0;
|
|
HEAP32[$7>>2] = 0;
|
|
$32 = HEAP32[$0>>2]|0;
|
|
$33 = $32 | 32;
|
|
HEAP32[$0>>2] = $33;
|
|
$34 = ($$056|0)==(2);
|
|
if ($34) {
|
|
$$061 = 0;
|
|
} else {
|
|
$35 = ((($$059)) + 4|0);
|
|
$36 = HEAP32[$35>>2]|0;
|
|
$37 = (($2) - ($36))|0;
|
|
$$061 = $37;
|
|
}
|
|
}
|
|
STACKTOP = sp;return ($$061|0);
|
|
}
|
|
function ___stdio_seek($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$pre = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 20|0;
|
|
$4 = ((($0)) + 60|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $5;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = 0;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $1;
|
|
$vararg_ptr3 = ((($vararg_buffer)) + 12|0);
|
|
HEAP32[$vararg_ptr3>>2] = $3;
|
|
$vararg_ptr4 = ((($vararg_buffer)) + 16|0);
|
|
HEAP32[$vararg_ptr4>>2] = $2;
|
|
$6 = (___syscall140(140,($vararg_buffer|0))|0);
|
|
$7 = (___syscall_ret($6)|0);
|
|
$8 = ($7|0)<(0);
|
|
if ($8) {
|
|
HEAP32[$3>>2] = -1;
|
|
$9 = -1;
|
|
} else {
|
|
$$pre = HEAP32[$3>>2]|0;
|
|
$9 = $$pre;
|
|
}
|
|
STACKTOP = sp;return ($9|0);
|
|
}
|
|
function ___syscall_ret($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ($0>>>0)>(4294963200);
|
|
if ($1) {
|
|
$2 = (0 - ($0))|0;
|
|
$3 = (___errno_location()|0);
|
|
HEAP32[$3>>2] = $2;
|
|
$$0 = -1;
|
|
} else {
|
|
$$0 = $0;
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function ___errno_location() {
|
|
var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[9329]|0;
|
|
$1 = ($0|0)==(0|0);
|
|
if ($1) {
|
|
$$0 = 37360;
|
|
} else {
|
|
$2 = (_pthread_self()|0);
|
|
$3 = ((($2)) + 64|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$$0 = $4;
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function _cleanup_88($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 68|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ($2|0)==(0);
|
|
if ($3) {
|
|
___unlockfile($0);
|
|
}
|
|
return;
|
|
}
|
|
function ___unlockfile($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return;
|
|
}
|
|
function ___stdout_write($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 80|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 12|0;
|
|
$4 = ((($0)) + 36|0);
|
|
HEAP32[$4>>2] = 1;
|
|
$5 = HEAP32[$0>>2]|0;
|
|
$6 = $5 & 64;
|
|
$7 = ($6|0)==(0);
|
|
if ($7) {
|
|
$8 = ((($0)) + 60|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $9;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = 21505;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $3;
|
|
$10 = (___syscall54(54,($vararg_buffer|0))|0);
|
|
$11 = ($10|0)==(0);
|
|
if (!($11)) {
|
|
$12 = ((($0)) + 75|0);
|
|
HEAP8[$12>>0] = -1;
|
|
}
|
|
}
|
|
$13 = (___stdio_write($0,$1,$2)|0);
|
|
STACKTOP = sp;return ($13|0);
|
|
}
|
|
function ___stdio_read($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0 = 0, $$026 = 0, $$cast = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 32|0;
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = ((($3)) + 4|0);
|
|
$5 = ((($0)) + 48|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = ($6|0)!=(0);
|
|
$8 = $7&1;
|
|
$9 = (($2) - ($8))|0;
|
|
HEAP32[$4>>2] = $9;
|
|
$10 = ((($3)) + 8|0);
|
|
$11 = ((($0)) + 44|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
HEAP32[$10>>2] = $12;
|
|
$13 = ((($3)) + 12|0);
|
|
HEAP32[$13>>2] = $6;
|
|
$14 = HEAP32[9329]|0;
|
|
$15 = ($14|0)==(0|0);
|
|
if ($15) {
|
|
$20 = ((($0)) + 60|0);
|
|
$21 = HEAP32[$20>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $21;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $3;
|
|
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
|
|
HEAP32[$vararg_ptr7>>2] = 2;
|
|
$22 = (___syscall145(145,($vararg_buffer3|0))|0);
|
|
$23 = (___syscall_ret($22)|0);
|
|
$$0 = $23;
|
|
} else {
|
|
_pthread_cleanup_push((2|0),($0|0));
|
|
$16 = ((($0)) + 60|0);
|
|
$17 = HEAP32[$16>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $17;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $3;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = 2;
|
|
$18 = (___syscall145(145,($vararg_buffer|0))|0);
|
|
$19 = (___syscall_ret($18)|0);
|
|
_pthread_cleanup_pop(0);
|
|
$$0 = $19;
|
|
}
|
|
$24 = ($$0|0)<(1);
|
|
if ($24) {
|
|
$25 = $$0 & 48;
|
|
$26 = $25 ^ 16;
|
|
$27 = HEAP32[$0>>2]|0;
|
|
$28 = $27 | $26;
|
|
HEAP32[$0>>2] = $28;
|
|
$29 = ((($0)) + 8|0);
|
|
HEAP32[$29>>2] = 0;
|
|
$30 = ((($0)) + 4|0);
|
|
HEAP32[$30>>2] = 0;
|
|
$$026 = $$0;
|
|
} else {
|
|
$31 = HEAP32[$4>>2]|0;
|
|
$32 = ($$0>>>0)>($31>>>0);
|
|
if ($32) {
|
|
$33 = (($$0) - ($31))|0;
|
|
$34 = HEAP32[$11>>2]|0;
|
|
$35 = ((($0)) + 4|0);
|
|
HEAP32[$35>>2] = $34;
|
|
$$cast = $34;
|
|
$36 = (($$cast) + ($33)|0);
|
|
$37 = ((($0)) + 8|0);
|
|
HEAP32[$37>>2] = $36;
|
|
$38 = HEAP32[$5>>2]|0;
|
|
$39 = ($38|0)==(0);
|
|
if ($39) {
|
|
$$026 = $2;
|
|
} else {
|
|
$40 = ((($$cast)) + 1|0);
|
|
HEAP32[$35>>2] = $40;
|
|
$41 = HEAP8[$$cast>>0]|0;
|
|
$42 = (($2) + -1)|0;
|
|
$43 = (($1) + ($42)|0);
|
|
HEAP8[$43>>0] = $41;
|
|
$$026 = $2;
|
|
}
|
|
} else {
|
|
$$026 = $$0;
|
|
}
|
|
}
|
|
STACKTOP = sp;return ($$026|0);
|
|
}
|
|
function _cleanup($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 68|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ($2|0)==(0);
|
|
if ($3) {
|
|
___unlockfile($0);
|
|
}
|
|
return;
|
|
}
|
|
function _strerror($0) {
|
|
$0 = $0|0;
|
|
var $$011$lcssa = 0, $$01113 = 0, $$015 = 0, $$112 = 0, $$114 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$$015 = 0;
|
|
while(1) {
|
|
$2 = (4837 + ($$015)|0);
|
|
$3 = HEAP8[$2>>0]|0;
|
|
$4 = $3&255;
|
|
$5 = ($4|0)==($0|0);
|
|
if ($5) {
|
|
label = 2;
|
|
break;
|
|
}
|
|
$6 = (($$015) + 1)|0;
|
|
$7 = ($6|0)==(87);
|
|
if ($7) {
|
|
$$01113 = 4925;$$114 = 87;
|
|
label = 5;
|
|
break;
|
|
} else {
|
|
$$015 = $6;
|
|
}
|
|
}
|
|
if ((label|0) == 2) {
|
|
$1 = ($$015|0)==(0);
|
|
if ($1) {
|
|
$$011$lcssa = 4925;
|
|
} else {
|
|
$$01113 = 4925;$$114 = $$015;
|
|
label = 5;
|
|
}
|
|
}
|
|
if ((label|0) == 5) {
|
|
while(1) {
|
|
label = 0;
|
|
$$112 = $$01113;
|
|
while(1) {
|
|
$8 = HEAP8[$$112>>0]|0;
|
|
$9 = ($8<<24>>24)==(0);
|
|
$10 = ((($$112)) + 1|0);
|
|
if ($9) {
|
|
break;
|
|
} else {
|
|
$$112 = $10;
|
|
}
|
|
}
|
|
$11 = (($$114) + -1)|0;
|
|
$12 = ($11|0)==(0);
|
|
if ($12) {
|
|
$$011$lcssa = $10;
|
|
break;
|
|
} else {
|
|
$$01113 = $10;$$114 = $11;
|
|
label = 5;
|
|
}
|
|
}
|
|
}
|
|
return ($$011$lcssa|0);
|
|
}
|
|
function _wcrtomb($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
|
|
var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
|
|
var $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ($0|0)==(0|0);
|
|
do {
|
|
if ($3) {
|
|
$$0 = 1;
|
|
} else {
|
|
$4 = ($1>>>0)<(128);
|
|
if ($4) {
|
|
$5 = $1&255;
|
|
HEAP8[$0>>0] = $5;
|
|
$$0 = 1;
|
|
break;
|
|
}
|
|
$6 = ($1>>>0)<(2048);
|
|
if ($6) {
|
|
$7 = $1 >>> 6;
|
|
$8 = $7 | 192;
|
|
$9 = $8&255;
|
|
$10 = ((($0)) + 1|0);
|
|
HEAP8[$0>>0] = $9;
|
|
$11 = $1 & 63;
|
|
$12 = $11 | 128;
|
|
$13 = $12&255;
|
|
HEAP8[$10>>0] = $13;
|
|
$$0 = 2;
|
|
break;
|
|
}
|
|
$14 = ($1>>>0)<(55296);
|
|
$15 = $1 & -8192;
|
|
$16 = ($15|0)==(57344);
|
|
$or$cond = $14 | $16;
|
|
if ($or$cond) {
|
|
$17 = $1 >>> 12;
|
|
$18 = $17 | 224;
|
|
$19 = $18&255;
|
|
$20 = ((($0)) + 1|0);
|
|
HEAP8[$0>>0] = $19;
|
|
$21 = $1 >>> 6;
|
|
$22 = $21 & 63;
|
|
$23 = $22 | 128;
|
|
$24 = $23&255;
|
|
$25 = ((($0)) + 2|0);
|
|
HEAP8[$20>>0] = $24;
|
|
$26 = $1 & 63;
|
|
$27 = $26 | 128;
|
|
$28 = $27&255;
|
|
HEAP8[$25>>0] = $28;
|
|
$$0 = 3;
|
|
break;
|
|
}
|
|
$29 = (($1) + -65536)|0;
|
|
$30 = ($29>>>0)<(1048576);
|
|
if ($30) {
|
|
$31 = $1 >>> 18;
|
|
$32 = $31 | 240;
|
|
$33 = $32&255;
|
|
$34 = ((($0)) + 1|0);
|
|
HEAP8[$0>>0] = $33;
|
|
$35 = $1 >>> 12;
|
|
$36 = $35 & 63;
|
|
$37 = $36 | 128;
|
|
$38 = $37&255;
|
|
$39 = ((($0)) + 2|0);
|
|
HEAP8[$34>>0] = $38;
|
|
$40 = $1 >>> 6;
|
|
$41 = $40 & 63;
|
|
$42 = $41 | 128;
|
|
$43 = $42&255;
|
|
$44 = ((($0)) + 3|0);
|
|
HEAP8[$39>>0] = $43;
|
|
$45 = $1 & 63;
|
|
$46 = $45 | 128;
|
|
$47 = $46&255;
|
|
HEAP8[$44>>0] = $47;
|
|
$$0 = 4;
|
|
break;
|
|
} else {
|
|
$48 = (___errno_location()|0);
|
|
HEAP32[$48>>2] = 84;
|
|
$$0 = -1;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
return ($$0|0);
|
|
}
|
|
function _wctomb($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ($0|0)==(0|0);
|
|
if ($2) {
|
|
$$0 = 0;
|
|
} else {
|
|
$3 = (_wcrtomb($0,$1,0)|0);
|
|
$$0 = $3;
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function ___lockfile($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return 0;
|
|
}
|
|
function ___uflow($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp;
|
|
$2 = ((($0)) + 8|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = ($3|0)==(0|0);
|
|
if ($4) {
|
|
$5 = (___toread($0)|0);
|
|
$6 = ($5|0)==(0);
|
|
if ($6) {
|
|
label = 3;
|
|
} else {
|
|
$$0 = -1;
|
|
}
|
|
} else {
|
|
label = 3;
|
|
}
|
|
if ((label|0) == 3) {
|
|
$7 = ((($0)) + 32|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = (FUNCTION_TABLE_iiii[$8 & 7]($0,$1,1)|0);
|
|
$10 = ($9|0)==(1);
|
|
if ($10) {
|
|
$11 = HEAP8[$1>>0]|0;
|
|
$12 = $11&255;
|
|
$$0 = $12;
|
|
} else {
|
|
$$0 = -1;
|
|
}
|
|
}
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function ___toread($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0;
|
|
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 74|0);
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = $2 << 24 >> 24;
|
|
$4 = (($3) + 255)|0;
|
|
$5 = $4 | $3;
|
|
$6 = $5&255;
|
|
HEAP8[$1>>0] = $6;
|
|
$7 = ((($0)) + 20|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ((($0)) + 44|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = ($8>>>0)>($10>>>0);
|
|
if ($11) {
|
|
$12 = ((($0)) + 36|0);
|
|
$13 = HEAP32[$12>>2]|0;
|
|
(FUNCTION_TABLE_iiii[$13 & 7]($0,0,0)|0);
|
|
}
|
|
$14 = ((($0)) + 16|0);
|
|
HEAP32[$14>>2] = 0;
|
|
$15 = ((($0)) + 28|0);
|
|
HEAP32[$15>>2] = 0;
|
|
HEAP32[$7>>2] = 0;
|
|
$16 = HEAP32[$0>>2]|0;
|
|
$17 = $16 & 20;
|
|
$18 = ($17|0)==(0);
|
|
if ($18) {
|
|
$22 = HEAP32[$9>>2]|0;
|
|
$23 = ((($0)) + 8|0);
|
|
HEAP32[$23>>2] = $22;
|
|
$24 = ((($0)) + 4|0);
|
|
HEAP32[$24>>2] = $22;
|
|
$$0 = 0;
|
|
} else {
|
|
$19 = $16 & 4;
|
|
$20 = ($19|0)==(0);
|
|
if ($20) {
|
|
$$0 = -1;
|
|
} else {
|
|
$21 = $16 | 32;
|
|
HEAP32[$0>>2] = $21;
|
|
$$0 = -1;
|
|
}
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function _strchr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = (___strchrnul($0,$1)|0);
|
|
$3 = HEAP8[$2>>0]|0;
|
|
$4 = $1&255;
|
|
$5 = ($3<<24>>24)==($4<<24>>24);
|
|
$6 = $5 ? $2 : 0;
|
|
return ($6|0);
|
|
}
|
|
function _fclose($0) {
|
|
$0 = $0|0;
|
|
var $$pre = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 76|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ($2|0)>(-1);
|
|
if ($3) {
|
|
(___lockfile($0)|0);
|
|
}
|
|
$4 = HEAP32[$0>>2]|0;
|
|
$5 = $4 & 1;
|
|
$6 = ($5|0)!=(0);
|
|
if (!($6)) {
|
|
___lock(((37344)|0));
|
|
$7 = ((($0)) + 52|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ($8|0)==(0|0);
|
|
$10 = $8;
|
|
$$pre = ((($0)) + 56|0);
|
|
if (!($9)) {
|
|
$11 = HEAP32[$$pre>>2]|0;
|
|
$12 = ((($8)) + 56|0);
|
|
HEAP32[$12>>2] = $11;
|
|
}
|
|
$13 = HEAP32[$$pre>>2]|0;
|
|
$14 = ($13|0)==(0|0);
|
|
$15 = $13;
|
|
if (!($14)) {
|
|
$16 = ((($13)) + 52|0);
|
|
HEAP32[$16>>2] = $10;
|
|
}
|
|
$17 = HEAP32[(37340)>>2]|0;
|
|
$18 = ($17|0)==($0|0);
|
|
if ($18) {
|
|
HEAP32[(37340)>>2] = $15;
|
|
}
|
|
___unlock(((37344)|0));
|
|
}
|
|
$19 = (_fflush($0)|0);
|
|
$20 = ((($0)) + 12|0);
|
|
$21 = HEAP32[$20>>2]|0;
|
|
$22 = (FUNCTION_TABLE_ii[$21 & 1]($0)|0);
|
|
$23 = $22 | $19;
|
|
$24 = ((($0)) + 92|0);
|
|
$25 = HEAP32[$24>>2]|0;
|
|
$26 = ($25|0)==(0|0);
|
|
if (!($26)) {
|
|
_free($25);
|
|
}
|
|
if (!($6)) {
|
|
_free($0);
|
|
}
|
|
return ($23|0);
|
|
}
|
|
function _fflush($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $$023 = 0, $$02325 = 0, $$02327 = 0, $$024$lcssa = 0, $$02426 = 0, $$1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
|
|
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ($0|0)==(0|0);
|
|
do {
|
|
if ($1) {
|
|
$8 = HEAP32[67]|0;
|
|
$9 = ($8|0)==(0|0);
|
|
if ($9) {
|
|
$28 = 0;
|
|
} else {
|
|
$10 = HEAP32[67]|0;
|
|
$11 = (_fflush($10)|0);
|
|
$28 = $11;
|
|
}
|
|
___lock(((37344)|0));
|
|
$$02325 = HEAP32[(37340)>>2]|0;
|
|
$12 = ($$02325|0)==(0|0);
|
|
if ($12) {
|
|
$$024$lcssa = $28;
|
|
} else {
|
|
$$02327 = $$02325;$$02426 = $28;
|
|
while(1) {
|
|
$13 = ((($$02327)) + 76|0);
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = ($14|0)>(-1);
|
|
if ($15) {
|
|
$16 = (___lockfile($$02327)|0);
|
|
$24 = $16;
|
|
} else {
|
|
$24 = 0;
|
|
}
|
|
$17 = ((($$02327)) + 20|0);
|
|
$18 = HEAP32[$17>>2]|0;
|
|
$19 = ((($$02327)) + 28|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = ($18>>>0)>($20>>>0);
|
|
if ($21) {
|
|
$22 = (___fflush_unlocked($$02327)|0);
|
|
$23 = $22 | $$02426;
|
|
$$1 = $23;
|
|
} else {
|
|
$$1 = $$02426;
|
|
}
|
|
$25 = ($24|0)==(0);
|
|
if (!($25)) {
|
|
___unlockfile($$02327);
|
|
}
|
|
$26 = ((($$02327)) + 56|0);
|
|
$$023 = HEAP32[$26>>2]|0;
|
|
$27 = ($$023|0)==(0|0);
|
|
if ($27) {
|
|
$$024$lcssa = $$1;
|
|
break;
|
|
} else {
|
|
$$02327 = $$023;$$02426 = $$1;
|
|
}
|
|
}
|
|
}
|
|
___unlock(((37344)|0));
|
|
$$0 = $$024$lcssa;
|
|
} else {
|
|
$2 = ((($0)) + 76|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = ($3|0)>(-1);
|
|
if (!($4)) {
|
|
$5 = (___fflush_unlocked($0)|0);
|
|
$$0 = $5;
|
|
break;
|
|
}
|
|
$6 = (___lockfile($0)|0);
|
|
$phitmp = ($6|0)==(0);
|
|
$7 = (___fflush_unlocked($0)|0);
|
|
if ($phitmp) {
|
|
$$0 = $7;
|
|
} else {
|
|
___unlockfile($0);
|
|
$$0 = $7;
|
|
}
|
|
}
|
|
} while(0);
|
|
return ($$0|0);
|
|
}
|
|
function ___fflush_unlocked($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 20|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ((($0)) + 28|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ($2>>>0)>($4>>>0);
|
|
if ($5) {
|
|
$6 = ((($0)) + 36|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
(FUNCTION_TABLE_iiii[$7 & 7]($0,0,0)|0);
|
|
$8 = HEAP32[$1>>2]|0;
|
|
$9 = ($8|0)==(0|0);
|
|
if ($9) {
|
|
$$0 = -1;
|
|
} else {
|
|
label = 3;
|
|
}
|
|
} else {
|
|
label = 3;
|
|
}
|
|
if ((label|0) == 3) {
|
|
$10 = ((($0)) + 4|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = ((($0)) + 8|0);
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = ($11>>>0)<($13>>>0);
|
|
if ($14) {
|
|
$15 = ((($0)) + 40|0);
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $11;
|
|
$18 = $13;
|
|
$19 = (($17) - ($18))|0;
|
|
(FUNCTION_TABLE_iiii[$16 & 7]($0,$19,1)|0);
|
|
}
|
|
$20 = ((($0)) + 16|0);
|
|
HEAP32[$20>>2] = 0;
|
|
HEAP32[$3>>2] = 0;
|
|
HEAP32[$1>>2] = 0;
|
|
HEAP32[$12>>2] = 0;
|
|
HEAP32[$10>>2] = 0;
|
|
$$0 = 0;
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function ___strchrnul($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $$029$lcssa = 0, $$02936 = 0, $$030$lcssa = 0, $$03039 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
|
|
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
|
|
var $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond33 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = $1 & 255;
|
|
$3 = ($2|0)==(0);
|
|
L1: do {
|
|
if ($3) {
|
|
$8 = (_strlen($0)|0);
|
|
$9 = (($0) + ($8)|0);
|
|
$$0 = $9;
|
|
} else {
|
|
$4 = $0;
|
|
$5 = $4 & 3;
|
|
$6 = ($5|0)==(0);
|
|
if ($6) {
|
|
$$030$lcssa = $0;
|
|
} else {
|
|
$7 = $1&255;
|
|
$$03039 = $0;
|
|
while(1) {
|
|
$10 = HEAP8[$$03039>>0]|0;
|
|
$11 = ($10<<24>>24)==(0);
|
|
$12 = ($10<<24>>24)==($7<<24>>24);
|
|
$or$cond = $11 | $12;
|
|
if ($or$cond) {
|
|
$$0 = $$03039;
|
|
break L1;
|
|
}
|
|
$13 = ((($$03039)) + 1|0);
|
|
$14 = $13;
|
|
$15 = $14 & 3;
|
|
$16 = ($15|0)==(0);
|
|
if ($16) {
|
|
$$030$lcssa = $13;
|
|
break;
|
|
} else {
|
|
$$03039 = $13;
|
|
}
|
|
}
|
|
}
|
|
$17 = Math_imul($2, 16843009)|0;
|
|
$18 = HEAP32[$$030$lcssa>>2]|0;
|
|
$19 = (($18) + -16843009)|0;
|
|
$20 = $18 & -2139062144;
|
|
$21 = $20 ^ -2139062144;
|
|
$22 = $21 & $19;
|
|
$23 = ($22|0)==(0);
|
|
L10: do {
|
|
if ($23) {
|
|
$$02936 = $$030$lcssa;$25 = $18;
|
|
while(1) {
|
|
$24 = $25 ^ $17;
|
|
$26 = (($24) + -16843009)|0;
|
|
$27 = $24 & -2139062144;
|
|
$28 = $27 ^ -2139062144;
|
|
$29 = $28 & $26;
|
|
$30 = ($29|0)==(0);
|
|
if (!($30)) {
|
|
$$029$lcssa = $$02936;
|
|
break L10;
|
|
}
|
|
$31 = ((($$02936)) + 4|0);
|
|
$32 = HEAP32[$31>>2]|0;
|
|
$33 = (($32) + -16843009)|0;
|
|
$34 = $32 & -2139062144;
|
|
$35 = $34 ^ -2139062144;
|
|
$36 = $35 & $33;
|
|
$37 = ($36|0)==(0);
|
|
if ($37) {
|
|
$$02936 = $31;$25 = $32;
|
|
} else {
|
|
$$029$lcssa = $31;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$029$lcssa = $$030$lcssa;
|
|
}
|
|
} while(0);
|
|
$38 = $1&255;
|
|
$$1 = $$029$lcssa;
|
|
while(1) {
|
|
$39 = HEAP8[$$1>>0]|0;
|
|
$40 = ($39<<24>>24)==(0);
|
|
$41 = ($39<<24>>24)==($38<<24>>24);
|
|
$or$cond33 = $40 | $41;
|
|
$42 = ((($$1)) + 1|0);
|
|
if ($or$cond33) {
|
|
$$0 = $$1;
|
|
break;
|
|
} else {
|
|
$$1 = $42;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
return ($$0|0);
|
|
}
|
|
function _strlen($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $$014 = 0, $$015$lcssa = 0, $$01518 = 0, $$1$lcssa = 0, $$pn = 0, $$pn29 = 0, $$pre = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
|
|
var $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = $0;
|
|
$2 = $1 & 3;
|
|
$3 = ($2|0)==(0);
|
|
L1: do {
|
|
if ($3) {
|
|
$$015$lcssa = $0;
|
|
label = 4;
|
|
} else {
|
|
$$01518 = $0;$22 = $1;
|
|
while(1) {
|
|
$4 = HEAP8[$$01518>>0]|0;
|
|
$5 = ($4<<24>>24)==(0);
|
|
if ($5) {
|
|
$$pn = $22;
|
|
break L1;
|
|
}
|
|
$6 = ((($$01518)) + 1|0);
|
|
$7 = $6;
|
|
$8 = $7 & 3;
|
|
$9 = ($8|0)==(0);
|
|
if ($9) {
|
|
$$015$lcssa = $6;
|
|
label = 4;
|
|
break;
|
|
} else {
|
|
$$01518 = $6;$22 = $7;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 4) {
|
|
$$0 = $$015$lcssa;
|
|
while(1) {
|
|
$10 = HEAP32[$$0>>2]|0;
|
|
$11 = (($10) + -16843009)|0;
|
|
$12 = $10 & -2139062144;
|
|
$13 = $12 ^ -2139062144;
|
|
$14 = $13 & $11;
|
|
$15 = ($14|0)==(0);
|
|
$16 = ((($$0)) + 4|0);
|
|
if ($15) {
|
|
$$0 = $16;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$17 = $10&255;
|
|
$18 = ($17<<24>>24)==(0);
|
|
if ($18) {
|
|
$$1$lcssa = $$0;
|
|
} else {
|
|
$$pn29 = $$0;
|
|
while(1) {
|
|
$19 = ((($$pn29)) + 1|0);
|
|
$$pre = HEAP8[$19>>0]|0;
|
|
$20 = ($$pre<<24>>24)==(0);
|
|
if ($20) {
|
|
$$1$lcssa = $19;
|
|
break;
|
|
} else {
|
|
$$pn29 = $19;
|
|
}
|
|
}
|
|
}
|
|
$21 = $$1$lcssa;
|
|
$$pn = $21;
|
|
}
|
|
$$014 = (($$pn) - ($1))|0;
|
|
return ($$014|0);
|
|
}
|
|
function ___fdopen($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $$cast = 0, $$pre = 0, $$pre34 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
|
|
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
|
|
var $43 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr16 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, dest = 0, label = 0;
|
|
var sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 112|0;
|
|
$vararg_buffer12 = sp + 40|0;
|
|
$vararg_buffer7 = sp + 24|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 52|0;
|
|
$3 = HEAP8[$1>>0]|0;
|
|
$4 = $3 << 24 >> 24;
|
|
$memchr = (_memchr(7263,$4,4)|0);
|
|
$5 = ($memchr|0)==(0|0);
|
|
if ($5) {
|
|
$6 = (___errno_location()|0);
|
|
HEAP32[$6>>2] = 22;
|
|
$$0 = 0;
|
|
} else {
|
|
$7 = (_malloc(1144)|0);
|
|
$8 = ($7|0)==(0|0);
|
|
if ($8) {
|
|
$$0 = 0;
|
|
} else {
|
|
dest=$7; stop=dest+112|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
$9 = (_strchr($1,43)|0);
|
|
$10 = ($9|0)==(0|0);
|
|
if ($10) {
|
|
$11 = ($3<<24>>24)==(114);
|
|
$12 = $11 ? 8 : 4;
|
|
HEAP32[$7>>2] = $12;
|
|
}
|
|
$13 = (_strchr($1,101)|0);
|
|
$14 = ($13|0)==(0|0);
|
|
if ($14) {
|
|
$15 = $3;
|
|
} else {
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = 2;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = 1;
|
|
(___syscall221(221,($vararg_buffer|0))|0);
|
|
$$pre = HEAP8[$1>>0]|0;
|
|
$15 = $$pre;
|
|
}
|
|
$16 = ($15<<24>>24)==(97);
|
|
if ($16) {
|
|
HEAP32[$vararg_buffer3>>2] = $0;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = 3;
|
|
$17 = (___syscall221(221,($vararg_buffer3|0))|0);
|
|
$18 = $17 & 1024;
|
|
$19 = ($18|0)==(0);
|
|
if ($19) {
|
|
$20 = $17 | 1024;
|
|
HEAP32[$vararg_buffer7>>2] = $0;
|
|
$vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
|
|
HEAP32[$vararg_ptr10>>2] = 4;
|
|
$vararg_ptr11 = ((($vararg_buffer7)) + 8|0);
|
|
HEAP32[$vararg_ptr11>>2] = $20;
|
|
(___syscall221(221,($vararg_buffer7|0))|0);
|
|
}
|
|
$21 = HEAP32[$7>>2]|0;
|
|
$22 = $21 | 128;
|
|
HEAP32[$7>>2] = $22;
|
|
$29 = $22;
|
|
} else {
|
|
$$pre34 = HEAP32[$7>>2]|0;
|
|
$29 = $$pre34;
|
|
}
|
|
$23 = ((($7)) + 60|0);
|
|
HEAP32[$23>>2] = $0;
|
|
$24 = ((($7)) + 120|0);
|
|
$25 = ((($7)) + 44|0);
|
|
HEAP32[$25>>2] = $24;
|
|
$26 = ((($7)) + 48|0);
|
|
HEAP32[$26>>2] = 1024;
|
|
$27 = ((($7)) + 75|0);
|
|
HEAP8[$27>>0] = -1;
|
|
$28 = $29 & 8;
|
|
$30 = ($28|0)==(0);
|
|
if ($30) {
|
|
HEAP32[$vararg_buffer12>>2] = $0;
|
|
$vararg_ptr15 = ((($vararg_buffer12)) + 4|0);
|
|
HEAP32[$vararg_ptr15>>2] = 21505;
|
|
$vararg_ptr16 = ((($vararg_buffer12)) + 8|0);
|
|
HEAP32[$vararg_ptr16>>2] = $2;
|
|
$31 = (___syscall54(54,($vararg_buffer12|0))|0);
|
|
$32 = ($31|0)==(0);
|
|
if ($32) {
|
|
HEAP8[$27>>0] = 10;
|
|
}
|
|
}
|
|
$33 = ((($7)) + 32|0);
|
|
HEAP32[$33>>2] = 4;
|
|
$34 = ((($7)) + 36|0);
|
|
HEAP32[$34>>2] = 1;
|
|
$35 = ((($7)) + 40|0);
|
|
HEAP32[$35>>2] = 2;
|
|
$36 = ((($7)) + 12|0);
|
|
HEAP32[$36>>2] = 1;
|
|
$37 = HEAP32[(37320)>>2]|0;
|
|
$38 = ($37|0)==(0);
|
|
if ($38) {
|
|
$39 = ((($7)) + 76|0);
|
|
HEAP32[$39>>2] = -1;
|
|
}
|
|
___lock(((37344)|0));
|
|
$40 = HEAP32[(37340)>>2]|0;
|
|
$41 = ((($7)) + 56|0);
|
|
HEAP32[$41>>2] = $40;
|
|
$42 = ($40|0)==(0);
|
|
if (!($42)) {
|
|
$$cast = $40;
|
|
$43 = ((($$cast)) + 52|0);
|
|
HEAP32[$43>>2] = $7;
|
|
}
|
|
HEAP32[(37340)>>2] = $7;
|
|
___unlock(((37344)|0));
|
|
$$0 = $7;
|
|
}
|
|
}
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function _memchr($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0$lcssa = 0, $$035$lcssa = 0, $$035$lcssa65 = 0, $$03555 = 0, $$036$lcssa = 0, $$036$lcssa64 = 0, $$03654 = 0, $$046 = 0, $$137$lcssa = 0, $$13745 = 0, $$140 = 0, $$2 = 0, $$23839 = 0, $$3 = 0, $$lcssa = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
|
|
var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
|
|
var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond53 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $1 & 255;
|
|
$4 = $0;
|
|
$5 = $4 & 3;
|
|
$6 = ($5|0)!=(0);
|
|
$7 = ($2|0)!=(0);
|
|
$or$cond53 = $7 & $6;
|
|
L1: do {
|
|
if ($or$cond53) {
|
|
$8 = $1&255;
|
|
$$03555 = $0;$$03654 = $2;
|
|
while(1) {
|
|
$9 = HEAP8[$$03555>>0]|0;
|
|
$10 = ($9<<24>>24)==($8<<24>>24);
|
|
if ($10) {
|
|
$$035$lcssa65 = $$03555;$$036$lcssa64 = $$03654;
|
|
label = 6;
|
|
break L1;
|
|
}
|
|
$11 = ((($$03555)) + 1|0);
|
|
$12 = (($$03654) + -1)|0;
|
|
$13 = $11;
|
|
$14 = $13 & 3;
|
|
$15 = ($14|0)!=(0);
|
|
$16 = ($12|0)!=(0);
|
|
$or$cond = $16 & $15;
|
|
if ($or$cond) {
|
|
$$03555 = $11;$$03654 = $12;
|
|
} else {
|
|
$$035$lcssa = $11;$$036$lcssa = $12;$$lcssa = $16;
|
|
label = 5;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$035$lcssa = $0;$$036$lcssa = $2;$$lcssa = $7;
|
|
label = 5;
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 5) {
|
|
if ($$lcssa) {
|
|
$$035$lcssa65 = $$035$lcssa;$$036$lcssa64 = $$036$lcssa;
|
|
label = 6;
|
|
} else {
|
|
$$2 = $$035$lcssa;$$3 = 0;
|
|
}
|
|
}
|
|
L8: do {
|
|
if ((label|0) == 6) {
|
|
$17 = HEAP8[$$035$lcssa65>>0]|0;
|
|
$18 = $1&255;
|
|
$19 = ($17<<24>>24)==($18<<24>>24);
|
|
if ($19) {
|
|
$$2 = $$035$lcssa65;$$3 = $$036$lcssa64;
|
|
} else {
|
|
$20 = Math_imul($3, 16843009)|0;
|
|
$21 = ($$036$lcssa64>>>0)>(3);
|
|
L11: do {
|
|
if ($21) {
|
|
$$046 = $$035$lcssa65;$$13745 = $$036$lcssa64;
|
|
while(1) {
|
|
$22 = HEAP32[$$046>>2]|0;
|
|
$23 = $22 ^ $20;
|
|
$24 = (($23) + -16843009)|0;
|
|
$25 = $23 & -2139062144;
|
|
$26 = $25 ^ -2139062144;
|
|
$27 = $26 & $24;
|
|
$28 = ($27|0)==(0);
|
|
if (!($28)) {
|
|
break;
|
|
}
|
|
$29 = ((($$046)) + 4|0);
|
|
$30 = (($$13745) + -4)|0;
|
|
$31 = ($30>>>0)>(3);
|
|
if ($31) {
|
|
$$046 = $29;$$13745 = $30;
|
|
} else {
|
|
$$0$lcssa = $29;$$137$lcssa = $30;
|
|
label = 11;
|
|
break L11;
|
|
}
|
|
}
|
|
$$140 = $$046;$$23839 = $$13745;
|
|
} else {
|
|
$$0$lcssa = $$035$lcssa65;$$137$lcssa = $$036$lcssa64;
|
|
label = 11;
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 11) {
|
|
$32 = ($$137$lcssa|0)==(0);
|
|
if ($32) {
|
|
$$2 = $$0$lcssa;$$3 = 0;
|
|
break;
|
|
} else {
|
|
$$140 = $$0$lcssa;$$23839 = $$137$lcssa;
|
|
}
|
|
}
|
|
while(1) {
|
|
$33 = HEAP8[$$140>>0]|0;
|
|
$34 = ($33<<24>>24)==($18<<24>>24);
|
|
if ($34) {
|
|
$$2 = $$140;$$3 = $$23839;
|
|
break L8;
|
|
}
|
|
$35 = ((($$140)) + 1|0);
|
|
$36 = (($$23839) + -1)|0;
|
|
$37 = ($36|0)==(0);
|
|
if ($37) {
|
|
$$2 = $35;$$3 = 0;
|
|
break;
|
|
} else {
|
|
$$140 = $35;$$23839 = $36;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$38 = ($$3|0)!=(0);
|
|
$39 = $38 ? $$2 : 0;
|
|
return ($39|0);
|
|
}
|
|
function _vsnprintf($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $$$015 = 0, $$0 = 0, $$014 = 0, $$015 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 128|0;
|
|
$4 = sp + 112|0;
|
|
$5 = sp;
|
|
dest=$5; src=388; stop=dest+112|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
$6 = (($1) + -1)|0;
|
|
$7 = ($6>>>0)>(2147483646);
|
|
if ($7) {
|
|
$8 = ($1|0)==(0);
|
|
if ($8) {
|
|
$$014 = $4;$$015 = 1;
|
|
label = 4;
|
|
} else {
|
|
$9 = (___errno_location()|0);
|
|
HEAP32[$9>>2] = 75;
|
|
$$0 = -1;
|
|
}
|
|
} else {
|
|
$$014 = $0;$$015 = $1;
|
|
label = 4;
|
|
}
|
|
if ((label|0) == 4) {
|
|
$10 = $$014;
|
|
$11 = (-2 - ($10))|0;
|
|
$12 = ($$015>>>0)>($11>>>0);
|
|
$$$015 = $12 ? $11 : $$015;
|
|
$13 = ((($5)) + 48|0);
|
|
HEAP32[$13>>2] = $$$015;
|
|
$14 = ((($5)) + 20|0);
|
|
HEAP32[$14>>2] = $$014;
|
|
$15 = ((($5)) + 44|0);
|
|
HEAP32[$15>>2] = $$014;
|
|
$16 = (($$014) + ($$$015)|0);
|
|
$17 = ((($5)) + 16|0);
|
|
HEAP32[$17>>2] = $16;
|
|
$18 = ((($5)) + 28|0);
|
|
HEAP32[$18>>2] = $16;
|
|
$19 = (_vfprintf($5,$2,$3)|0);
|
|
$20 = ($$$015|0)==(0);
|
|
if ($20) {
|
|
$$0 = $19;
|
|
} else {
|
|
$21 = HEAP32[$14>>2]|0;
|
|
$22 = HEAP32[$17>>2]|0;
|
|
$23 = ($21|0)==($22|0);
|
|
$24 = $23 << 31 >> 31;
|
|
$25 = (($21) + ($24)|0);
|
|
HEAP8[$25>>0] = 0;
|
|
$$0 = $19;
|
|
}
|
|
}
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function _vfprintf($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$ = 0, $$0 = 0, $$1 = 0, $$1$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0;
|
|
var $8 = 0, $9 = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 224|0;
|
|
$3 = sp + 120|0;
|
|
$4 = sp + 80|0;
|
|
$5 = sp;
|
|
$6 = sp + 136|0;
|
|
dest=$4; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
$vacopy_currentptr = HEAP32[$2>>2]|0;
|
|
HEAP32[$3>>2] = $vacopy_currentptr;
|
|
$7 = (_printf_core(0,$1,$3,$5,$4)|0);
|
|
$8 = ($7|0)<(0);
|
|
if ($8) {
|
|
$$0 = -1;
|
|
} else {
|
|
$9 = ((($0)) + 76|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = ($10|0)>(-1);
|
|
if ($11) {
|
|
$12 = (___lockfile($0)|0);
|
|
$39 = $12;
|
|
} else {
|
|
$39 = 0;
|
|
}
|
|
$13 = HEAP32[$0>>2]|0;
|
|
$14 = $13 & 32;
|
|
$15 = ((($0)) + 74|0);
|
|
$16 = HEAP8[$15>>0]|0;
|
|
$17 = ($16<<24>>24)<(1);
|
|
if ($17) {
|
|
$18 = $13 & -33;
|
|
HEAP32[$0>>2] = $18;
|
|
}
|
|
$19 = ((($0)) + 48|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = ($20|0)==(0);
|
|
if ($21) {
|
|
$23 = ((($0)) + 44|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
HEAP32[$23>>2] = $6;
|
|
$25 = ((($0)) + 28|0);
|
|
HEAP32[$25>>2] = $6;
|
|
$26 = ((($0)) + 20|0);
|
|
HEAP32[$26>>2] = $6;
|
|
HEAP32[$19>>2] = 80;
|
|
$27 = ((($6)) + 80|0);
|
|
$28 = ((($0)) + 16|0);
|
|
HEAP32[$28>>2] = $27;
|
|
$29 = (_printf_core($0,$1,$3,$5,$4)|0);
|
|
$30 = ($24|0)==(0|0);
|
|
if ($30) {
|
|
$$1 = $29;
|
|
} else {
|
|
$31 = ((($0)) + 36|0);
|
|
$32 = HEAP32[$31>>2]|0;
|
|
(FUNCTION_TABLE_iiii[$32 & 7]($0,0,0)|0);
|
|
$33 = HEAP32[$26>>2]|0;
|
|
$34 = ($33|0)==(0|0);
|
|
$$ = $34 ? -1 : $29;
|
|
HEAP32[$23>>2] = $24;
|
|
HEAP32[$19>>2] = 0;
|
|
HEAP32[$28>>2] = 0;
|
|
HEAP32[$25>>2] = 0;
|
|
HEAP32[$26>>2] = 0;
|
|
$$1 = $$;
|
|
}
|
|
} else {
|
|
$22 = (_printf_core($0,$1,$3,$5,$4)|0);
|
|
$$1 = $22;
|
|
}
|
|
$35 = HEAP32[$0>>2]|0;
|
|
$36 = $35 & 32;
|
|
$37 = ($36|0)==(0);
|
|
$$1$ = $37 ? $$1 : -1;
|
|
$38 = $35 | $14;
|
|
HEAP32[$0>>2] = $38;
|
|
$40 = ($39|0)==(0);
|
|
if (!($40)) {
|
|
___unlockfile($0);
|
|
}
|
|
$$0 = $$1$;
|
|
}
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function _printf_core($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $$ = 0, $$$0259 = 0, $$$0262 = 0, $$$0269 = 0, $$$3484$i = 0, $$$3484705$i = 0, $$$3484706$i = 0, $$$3501$i = 0, $$$4266 = 0, $$$4502$i = 0, $$$5 = 0, $$$i = 0, $$0 = 0, $$0$i = 0, $$0$lcssa$i300 = 0, $$0228 = 0, $$0229396 = 0, $$0232 = 0, $$0235 = 0, $$0237 = 0;
|
|
var $$0240$lcssa = 0, $$0240$lcssa460 = 0, $$0240395 = 0, $$0243 = 0, $$0247 = 0, $$0249$lcssa = 0, $$0249383 = 0, $$0252 = 0, $$0253 = 0, $$0254 = 0, $$0254$ = 0, $$0259 = 0, $$0262342 = 0, $$0262390 = 0, $$0269 = 0, $$0269$phi = 0, $$0321 = 0, $$0463$lcssa$i = 0, $$0463594$i = 0, $$0464603$i = 0;
|
|
var $$0466$i = 0.0, $$0470$i = 0, $$0471$i = 0.0, $$0479$i = 0, $$0487652$i = 0, $$0488$i = 0, $$0488663$i = 0, $$0488665$i = 0, $$0496$$9$i = 0, $$0497664$i = 0, $$0498$i = 0, $$05$lcssa$i = 0, $$0509592$i = 0.0, $$0510$i = 0, $$0511$i = 0, $$0514647$i = 0, $$0520$i = 0, $$0522$$i = 0, $$0522$i = 0, $$0524$i = 0;
|
|
var $$0526$i = 0, $$0528$i = 0, $$0528639$i = 0, $$0528641$i = 0, $$0531646$i = 0, $$056$i = 0, $$06$i = 0, $$06$i290 = 0, $$06$i298 = 0, $$1 = 0, $$1230407 = 0, $$1233 = 0, $$1236 = 0, $$1238 = 0, $$1241406 = 0, $$1244394 = 0, $$1248 = 0, $$1250 = 0, $$1255 = 0, $$1260 = 0;
|
|
var $$1263 = 0, $$1263$ = 0, $$1270 = 0, $$1322 = 0, $$1465$i = 0, $$1467$i = 0.0, $$1469$i = 0.0, $$1472$i = 0.0, $$1480$i = 0, $$1482$lcssa$i = 0, $$1482671$i = 0, $$1489651$i = 0, $$1499$lcssa$i = 0, $$1499670$i = 0, $$1508593$i = 0, $$1512$lcssa$i = 0, $$1512617$i = 0, $$1515$i = 0, $$1521$i = 0, $$1525$i = 0;
|
|
var $$1527$i = 0, $$1529624$i = 0, $$1532$lcssa$i = 0, $$1532640$i = 0, $$1607$i = 0, $$2 = 0, $$2$i = 0, $$2234 = 0, $$2239 = 0, $$2242381 = 0, $$2245 = 0, $$2251 = 0, $$2256 = 0, $$2256$ = 0, $$2261 = 0, $$2271 = 0, $$2323$lcssa = 0, $$2323382 = 0, $$2473$i = 0.0, $$2476$$545$i = 0;
|
|
var $$2476$$547$i = 0, $$2476$i = 0, $$2483$ph$i = 0, $$2490$lcssa$i = 0, $$2490632$i = 0, $$2500$i = 0, $$2513$i = 0, $$2516628$i = 0, $$2530$i = 0, $$2533627$i = 0, $$3$i = 0.0, $$3257 = 0, $$3265 = 0, $$3272 = 0, $$331 = 0, $$332 = 0, $$333 = 0, $$3379 = 0, $$3477$i = 0, $$3484$lcssa$i = 0;
|
|
var $$3484658$i = 0, $$3501$lcssa$i = 0, $$3501657$i = 0, $$3534623$i = 0, $$4$i = 0.0, $$4258458 = 0, $$4266 = 0, $$4325 = 0, $$4478$lcssa$i = 0, $$4478600$i = 0, $$4492$i = 0, $$4502$i = 0, $$4518$i = 0, $$5 = 0, $$5$lcssa$i = 0, $$537$i = 0, $$538$$i = 0, $$538$i = 0, $$541$i = 0.0, $$544$i = 0;
|
|
var $$546$i = 0, $$5486$lcssa$i = 0, $$5486633$i = 0, $$5493606$i = 0, $$5519$ph$i = 0, $$553$i = 0, $$554$i = 0, $$557$i = 0.0, $$5611$i = 0, $$6 = 0, $$6$i = 0, $$6268 = 0, $$6494599$i = 0, $$7 = 0, $$7495610$i = 0, $$7505$$i = 0, $$7505$i = 0, $$7505$ph$i = 0, $$8$i = 0, $$9$ph$i = 0;
|
|
var $$lcssa683$i = 0, $$neg$i = 0, $$neg572$i = 0, $$pn$i = 0, $$pr = 0, $$pr$i = 0, $$pr571$i = 0, $$pre = 0, $$pre$i = 0, $$pre$phi704$iZ2D = 0, $$pre452 = 0, $$pre453 = 0, $$pre454 = 0, $$pre697$i = 0, $$pre700$i = 0, $$pre703$i = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0;
|
|
var $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0;
|
|
var $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0;
|
|
var $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0;
|
|
var $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0;
|
|
var $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0;
|
|
var $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0;
|
|
var $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0;
|
|
var $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0;
|
|
var $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0;
|
|
var $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0;
|
|
var $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
|
|
var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
|
|
var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0;
|
|
var $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0;
|
|
var $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0.0, $372 = 0, $373 = 0, $374 = 0, $375 = 0.0;
|
|
var $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0;
|
|
var $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0.0, $404 = 0.0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0;
|
|
var $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0.0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0.0, $424 = 0.0, $425 = 0.0, $426 = 0.0, $427 = 0.0, $428 = 0.0, $429 = 0, $43 = 0;
|
|
var $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0;
|
|
var $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0.0, $455 = 0.0, $456 = 0.0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0;
|
|
var $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0;
|
|
var $485 = 0, $486 = 0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0.0, $494 = 0.0, $495 = 0.0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0;
|
|
var $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0;
|
|
var $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0;
|
|
var $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0;
|
|
var $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0;
|
|
var $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0;
|
|
var $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0.0, $606 = 0.0, $607 = 0, $608 = 0.0, $609 = 0, $61 = 0;
|
|
var $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0;
|
|
var $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0;
|
|
var $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0;
|
|
var $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0;
|
|
var $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0;
|
|
var $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0;
|
|
var $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0;
|
|
var $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0;
|
|
var $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0;
|
|
var $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0;
|
|
var $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0;
|
|
var $809 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
|
|
var $99 = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $exitcond$i = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $isdigit = 0, $isdigit$i = 0, $isdigit$i292 = 0, $isdigit275 = 0;
|
|
var $isdigit277 = 0, $isdigit5$i = 0, $isdigit5$i288 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp$i = 0, $isdigittmp$i291 = 0, $isdigittmp274 = 0, $isdigittmp276 = 0, $isdigittmp4$i = 0, $isdigittmp4$i287 = 0, $isdigittmp7$i = 0, $isdigittmp7$i289 = 0, $notlhs$i = 0, $notrhs$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond280 = 0, $or$cond282 = 0, $or$cond285 = 0;
|
|
var $or$cond3$not$i = 0, $or$cond412 = 0, $or$cond540$i = 0, $or$cond543$i = 0, $or$cond552$i = 0, $or$cond6$i = 0, $scevgep694$i = 0, $scevgep694695$i = 0, $storemerge = 0, $storemerge273345 = 0, $storemerge273389 = 0, $storemerge278 = 0, $sum = 0, $trunc = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 624|0;
|
|
$5 = sp + 24|0;
|
|
$6 = sp + 16|0;
|
|
$7 = sp + 588|0;
|
|
$8 = sp + 576|0;
|
|
$9 = sp;
|
|
$10 = sp + 536|0;
|
|
$11 = sp + 8|0;
|
|
$12 = sp + 528|0;
|
|
$13 = ($0|0)!=(0|0);
|
|
$14 = ((($10)) + 40|0);
|
|
$15 = $14;
|
|
$16 = ((($10)) + 39|0);
|
|
$17 = ((($11)) + 4|0);
|
|
$18 = $7;
|
|
$19 = (0 - ($18))|0;
|
|
$20 = ((($8)) + 12|0);
|
|
$21 = ((($8)) + 11|0);
|
|
$22 = $20;
|
|
$23 = (($22) - ($18))|0;
|
|
$24 = (-2 - ($18))|0;
|
|
$25 = (($22) + 2)|0;
|
|
$26 = ((($5)) + 288|0);
|
|
$27 = ((($7)) + 9|0);
|
|
$28 = $27;
|
|
$29 = ((($7)) + 8|0);
|
|
$$0243 = 0;$$0247 = 0;$$0269 = 0;$$0321 = $1;
|
|
L1: while(1) {
|
|
$30 = ($$0247|0)>(-1);
|
|
do {
|
|
if ($30) {
|
|
$31 = (2147483647 - ($$0247))|0;
|
|
$32 = ($$0243|0)>($31|0);
|
|
if ($32) {
|
|
$33 = (___errno_location()|0);
|
|
HEAP32[$33>>2] = 75;
|
|
$$1248 = -1;
|
|
break;
|
|
} else {
|
|
$34 = (($$0243) + ($$0247))|0;
|
|
$$1248 = $34;
|
|
break;
|
|
}
|
|
} else {
|
|
$$1248 = $$0247;
|
|
}
|
|
} while(0);
|
|
$35 = HEAP8[$$0321>>0]|0;
|
|
$36 = ($35<<24>>24)==(0);
|
|
if ($36) {
|
|
label = 243;
|
|
break;
|
|
} else {
|
|
$$1322 = $$0321;$37 = $35;
|
|
}
|
|
L9: while(1) {
|
|
switch ($37<<24>>24) {
|
|
case 37: {
|
|
$$0249383 = $$1322;$$2323382 = $$1322;
|
|
label = 9;
|
|
break L9;
|
|
break;
|
|
}
|
|
case 0: {
|
|
$$0249$lcssa = $$1322;$$2323$lcssa = $$1322;
|
|
break L9;
|
|
break;
|
|
}
|
|
default: {
|
|
}
|
|
}
|
|
$38 = ((($$1322)) + 1|0);
|
|
$$pre = HEAP8[$38>>0]|0;
|
|
$$1322 = $38;$37 = $$pre;
|
|
}
|
|
L12: do {
|
|
if ((label|0) == 9) {
|
|
while(1) {
|
|
label = 0;
|
|
$39 = ((($$2323382)) + 1|0);
|
|
$40 = HEAP8[$39>>0]|0;
|
|
$41 = ($40<<24>>24)==(37);
|
|
if (!($41)) {
|
|
$$0249$lcssa = $$0249383;$$2323$lcssa = $$2323382;
|
|
break L12;
|
|
}
|
|
$42 = ((($$0249383)) + 1|0);
|
|
$43 = ((($$2323382)) + 2|0);
|
|
$44 = HEAP8[$43>>0]|0;
|
|
$45 = ($44<<24>>24)==(37);
|
|
if ($45) {
|
|
$$0249383 = $42;$$2323382 = $43;
|
|
label = 9;
|
|
} else {
|
|
$$0249$lcssa = $42;$$2323$lcssa = $43;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$46 = $$0249$lcssa;
|
|
$47 = $$0321;
|
|
$48 = (($46) - ($47))|0;
|
|
if ($13) {
|
|
$49 = HEAP32[$0>>2]|0;
|
|
$50 = $49 & 32;
|
|
$51 = ($50|0)==(0);
|
|
if ($51) {
|
|
(___fwritex($$0321,$48,$0)|0);
|
|
}
|
|
}
|
|
$52 = ($48|0)==(0);
|
|
if (!($52)) {
|
|
$$0269$phi = $$0269;$$0243 = $48;$$0247 = $$1248;$$0321 = $$2323$lcssa;$$0269 = $$0269$phi;
|
|
continue;
|
|
}
|
|
$53 = ((($$2323$lcssa)) + 1|0);
|
|
$54 = HEAP8[$53>>0]|0;
|
|
$55 = $54 << 24 >> 24;
|
|
$isdigittmp = (($55) + -48)|0;
|
|
$isdigit = ($isdigittmp>>>0)<(10);
|
|
if ($isdigit) {
|
|
$56 = ((($$2323$lcssa)) + 2|0);
|
|
$57 = HEAP8[$56>>0]|0;
|
|
$58 = ($57<<24>>24)==(36);
|
|
$59 = ((($$2323$lcssa)) + 3|0);
|
|
$$331 = $58 ? $59 : $53;
|
|
$$$0269 = $58 ? 1 : $$0269;
|
|
$isdigittmp$ = $58 ? $isdigittmp : -1;
|
|
$$pre452 = HEAP8[$$331>>0]|0;
|
|
$$0253 = $isdigittmp$;$$1270 = $$$0269;$61 = $$pre452;$storemerge = $$331;
|
|
} else {
|
|
$$0253 = -1;$$1270 = $$0269;$61 = $54;$storemerge = $53;
|
|
}
|
|
$60 = $61 << 24 >> 24;
|
|
$62 = (($60) + -32)|0;
|
|
$63 = ($62>>>0)<(32);
|
|
L25: do {
|
|
if ($63) {
|
|
$$0262390 = 0;$65 = $62;$69 = $61;$storemerge273389 = $storemerge;
|
|
while(1) {
|
|
$64 = 1 << $65;
|
|
$66 = $64 & 75913;
|
|
$67 = ($66|0)==(0);
|
|
if ($67) {
|
|
$$0262342 = $$0262390;$78 = $69;$storemerge273345 = $storemerge273389;
|
|
break L25;
|
|
}
|
|
$68 = $69 << 24 >> 24;
|
|
$70 = (($68) + -32)|0;
|
|
$71 = 1 << $70;
|
|
$72 = $71 | $$0262390;
|
|
$73 = ((($storemerge273389)) + 1|0);
|
|
$74 = HEAP8[$73>>0]|0;
|
|
$75 = $74 << 24 >> 24;
|
|
$76 = (($75) + -32)|0;
|
|
$77 = ($76>>>0)<(32);
|
|
if ($77) {
|
|
$$0262390 = $72;$65 = $76;$69 = $74;$storemerge273389 = $73;
|
|
} else {
|
|
$$0262342 = $72;$78 = $74;$storemerge273345 = $73;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$0262342 = 0;$78 = $61;$storemerge273345 = $storemerge;
|
|
}
|
|
} while(0);
|
|
$79 = ($78<<24>>24)==(42);
|
|
do {
|
|
if ($79) {
|
|
$80 = ((($storemerge273345)) + 1|0);
|
|
$81 = HEAP8[$80>>0]|0;
|
|
$82 = $81 << 24 >> 24;
|
|
$isdigittmp276 = (($82) + -48)|0;
|
|
$isdigit277 = ($isdigittmp276>>>0)<(10);
|
|
if ($isdigit277) {
|
|
$83 = ((($storemerge273345)) + 2|0);
|
|
$84 = HEAP8[$83>>0]|0;
|
|
$85 = ($84<<24>>24)==(36);
|
|
if ($85) {
|
|
$86 = (($4) + ($isdigittmp276<<2)|0);
|
|
HEAP32[$86>>2] = 10;
|
|
$87 = HEAP8[$80>>0]|0;
|
|
$88 = $87 << 24 >> 24;
|
|
$89 = (($88) + -48)|0;
|
|
$90 = (($3) + ($89<<3)|0);
|
|
$91 = $90;
|
|
$92 = $91;
|
|
$93 = HEAP32[$92>>2]|0;
|
|
$94 = (($91) + 4)|0;
|
|
$95 = $94;
|
|
$96 = HEAP32[$95>>2]|0;
|
|
$97 = ((($storemerge273345)) + 3|0);
|
|
$$0259 = $93;$$2271 = 1;$storemerge278 = $97;
|
|
} else {
|
|
label = 24;
|
|
}
|
|
} else {
|
|
label = 24;
|
|
}
|
|
if ((label|0) == 24) {
|
|
label = 0;
|
|
$98 = ($$1270|0)==(0);
|
|
if (!($98)) {
|
|
$$0 = -1;
|
|
break L1;
|
|
}
|
|
if (!($13)) {
|
|
$$1260 = 0;$$1263 = $$0262342;$$3272 = 0;$$4325 = $80;$$pr = $81;
|
|
break;
|
|
}
|
|
$arglist_current = HEAP32[$2>>2]|0;
|
|
$99 = $arglist_current;
|
|
$100 = ((0) + 4|0);
|
|
$expanded4 = $100;
|
|
$expanded = (($expanded4) - 1)|0;
|
|
$101 = (($99) + ($expanded))|0;
|
|
$102 = ((0) + 4|0);
|
|
$expanded8 = $102;
|
|
$expanded7 = (($expanded8) - 1)|0;
|
|
$expanded6 = $expanded7 ^ -1;
|
|
$103 = $101 & $expanded6;
|
|
$104 = $103;
|
|
$105 = HEAP32[$104>>2]|0;
|
|
$arglist_next = ((($104)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next;
|
|
$$0259 = $105;$$2271 = 0;$storemerge278 = $80;
|
|
}
|
|
$106 = ($$0259|0)<(0);
|
|
$107 = $$0262342 | 8192;
|
|
$108 = (0 - ($$0259))|0;
|
|
$$$0262 = $106 ? $107 : $$0262342;
|
|
$$$0259 = $106 ? $108 : $$0259;
|
|
$$pre453 = HEAP8[$storemerge278>>0]|0;
|
|
$$1260 = $$$0259;$$1263 = $$$0262;$$3272 = $$2271;$$4325 = $storemerge278;$$pr = $$pre453;
|
|
} else {
|
|
$109 = $78 << 24 >> 24;
|
|
$isdigittmp4$i = (($109) + -48)|0;
|
|
$isdigit5$i = ($isdigittmp4$i>>>0)<(10);
|
|
if ($isdigit5$i) {
|
|
$$06$i = 0;$113 = $storemerge273345;$isdigittmp7$i = $isdigittmp4$i;
|
|
while(1) {
|
|
$110 = ($$06$i*10)|0;
|
|
$111 = (($110) + ($isdigittmp7$i))|0;
|
|
$112 = ((($113)) + 1|0);
|
|
$114 = HEAP8[$112>>0]|0;
|
|
$115 = $114 << 24 >> 24;
|
|
$isdigittmp$i = (($115) + -48)|0;
|
|
$isdigit$i = ($isdigittmp$i>>>0)<(10);
|
|
if ($isdigit$i) {
|
|
$$06$i = $111;$113 = $112;$isdigittmp7$i = $isdigittmp$i;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$116 = ($111|0)<(0);
|
|
if ($116) {
|
|
$$0 = -1;
|
|
break L1;
|
|
} else {
|
|
$$1260 = $111;$$1263 = $$0262342;$$3272 = $$1270;$$4325 = $112;$$pr = $114;
|
|
}
|
|
} else {
|
|
$$1260 = 0;$$1263 = $$0262342;$$3272 = $$1270;$$4325 = $storemerge273345;$$pr = $78;
|
|
}
|
|
}
|
|
} while(0);
|
|
$117 = ($$pr<<24>>24)==(46);
|
|
L45: do {
|
|
if ($117) {
|
|
$118 = ((($$4325)) + 1|0);
|
|
$119 = HEAP8[$118>>0]|0;
|
|
$120 = ($119<<24>>24)==(42);
|
|
if (!($120)) {
|
|
$147 = $119 << 24 >> 24;
|
|
$isdigittmp4$i287 = (($147) + -48)|0;
|
|
$isdigit5$i288 = ($isdigittmp4$i287>>>0)<(10);
|
|
if ($isdigit5$i288) {
|
|
$$06$i290 = 0;$151 = $118;$isdigittmp7$i289 = $isdigittmp4$i287;
|
|
} else {
|
|
$$0254 = 0;$$6 = $118;
|
|
break;
|
|
}
|
|
while(1) {
|
|
$148 = ($$06$i290*10)|0;
|
|
$149 = (($148) + ($isdigittmp7$i289))|0;
|
|
$150 = ((($151)) + 1|0);
|
|
$152 = HEAP8[$150>>0]|0;
|
|
$153 = $152 << 24 >> 24;
|
|
$isdigittmp$i291 = (($153) + -48)|0;
|
|
$isdigit$i292 = ($isdigittmp$i291>>>0)<(10);
|
|
if ($isdigit$i292) {
|
|
$$06$i290 = $149;$151 = $150;$isdigittmp7$i289 = $isdigittmp$i291;
|
|
} else {
|
|
$$0254 = $149;$$6 = $150;
|
|
break L45;
|
|
}
|
|
}
|
|
}
|
|
$121 = ((($$4325)) + 2|0);
|
|
$122 = HEAP8[$121>>0]|0;
|
|
$123 = $122 << 24 >> 24;
|
|
$isdigittmp274 = (($123) + -48)|0;
|
|
$isdigit275 = ($isdigittmp274>>>0)<(10);
|
|
if ($isdigit275) {
|
|
$124 = ((($$4325)) + 3|0);
|
|
$125 = HEAP8[$124>>0]|0;
|
|
$126 = ($125<<24>>24)==(36);
|
|
if ($126) {
|
|
$127 = (($4) + ($isdigittmp274<<2)|0);
|
|
HEAP32[$127>>2] = 10;
|
|
$128 = HEAP8[$121>>0]|0;
|
|
$129 = $128 << 24 >> 24;
|
|
$130 = (($129) + -48)|0;
|
|
$131 = (($3) + ($130<<3)|0);
|
|
$132 = $131;
|
|
$133 = $132;
|
|
$134 = HEAP32[$133>>2]|0;
|
|
$135 = (($132) + 4)|0;
|
|
$136 = $135;
|
|
$137 = HEAP32[$136>>2]|0;
|
|
$138 = ((($$4325)) + 4|0);
|
|
$$0254 = $134;$$6 = $138;
|
|
break;
|
|
}
|
|
}
|
|
$139 = ($$3272|0)==(0);
|
|
if (!($139)) {
|
|
$$0 = -1;
|
|
break L1;
|
|
}
|
|
if ($13) {
|
|
$arglist_current2 = HEAP32[$2>>2]|0;
|
|
$140 = $arglist_current2;
|
|
$141 = ((0) + 4|0);
|
|
$expanded11 = $141;
|
|
$expanded10 = (($expanded11) - 1)|0;
|
|
$142 = (($140) + ($expanded10))|0;
|
|
$143 = ((0) + 4|0);
|
|
$expanded15 = $143;
|
|
$expanded14 = (($expanded15) - 1)|0;
|
|
$expanded13 = $expanded14 ^ -1;
|
|
$144 = $142 & $expanded13;
|
|
$145 = $144;
|
|
$146 = HEAP32[$145>>2]|0;
|
|
$arglist_next3 = ((($145)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next3;
|
|
$$0254 = $146;$$6 = $121;
|
|
} else {
|
|
$$0254 = 0;$$6 = $121;
|
|
}
|
|
} else {
|
|
$$0254 = -1;$$6 = $$4325;
|
|
}
|
|
} while(0);
|
|
$$0252 = 0;$$7 = $$6;
|
|
while(1) {
|
|
$154 = HEAP8[$$7>>0]|0;
|
|
$155 = $154 << 24 >> 24;
|
|
$156 = (($155) + -65)|0;
|
|
$157 = ($156>>>0)>(57);
|
|
if ($157) {
|
|
$$0 = -1;
|
|
break L1;
|
|
}
|
|
$158 = ((($$7)) + 1|0);
|
|
$159 = ((6729 + (($$0252*58)|0)|0) + ($156)|0);
|
|
$160 = HEAP8[$159>>0]|0;
|
|
$161 = $160&255;
|
|
$162 = (($161) + -1)|0;
|
|
$163 = ($162>>>0)<(8);
|
|
if ($163) {
|
|
$$0252 = $161;$$7 = $158;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$164 = ($160<<24>>24)==(0);
|
|
if ($164) {
|
|
$$0 = -1;
|
|
break;
|
|
}
|
|
$165 = ($160<<24>>24)==(19);
|
|
$166 = ($$0253|0)>(-1);
|
|
do {
|
|
if ($165) {
|
|
if ($166) {
|
|
$$0 = -1;
|
|
break L1;
|
|
} else {
|
|
label = 51;
|
|
}
|
|
} else {
|
|
if ($166) {
|
|
$167 = (($4) + ($$0253<<2)|0);
|
|
HEAP32[$167>>2] = $161;
|
|
$168 = (($3) + ($$0253<<3)|0);
|
|
$169 = $168;
|
|
$170 = $169;
|
|
$171 = HEAP32[$170>>2]|0;
|
|
$172 = (($169) + 4)|0;
|
|
$173 = $172;
|
|
$174 = HEAP32[$173>>2]|0;
|
|
$175 = $9;
|
|
$176 = $175;
|
|
HEAP32[$176>>2] = $171;
|
|
$177 = (($175) + 4)|0;
|
|
$178 = $177;
|
|
HEAP32[$178>>2] = $174;
|
|
label = 51;
|
|
break;
|
|
}
|
|
if (!($13)) {
|
|
$$0 = 0;
|
|
break L1;
|
|
}
|
|
_pop_arg_24($9,$161,$2);
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 51) {
|
|
label = 0;
|
|
if (!($13)) {
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue;
|
|
}
|
|
}
|
|
$179 = HEAP8[$$7>>0]|0;
|
|
$180 = $179 << 24 >> 24;
|
|
$181 = ($$0252|0)!=(0);
|
|
$182 = $180 & 15;
|
|
$183 = ($182|0)==(3);
|
|
$or$cond280 = $181 & $183;
|
|
$184 = $180 & -33;
|
|
$$0235 = $or$cond280 ? $184 : $180;
|
|
$185 = $$1263 & 8192;
|
|
$186 = ($185|0)==(0);
|
|
$187 = $$1263 & -65537;
|
|
$$1263$ = $186 ? $$1263 : $187;
|
|
L74: do {
|
|
switch ($$0235|0) {
|
|
case 110: {
|
|
$trunc = $$0252&255;
|
|
switch ($trunc<<24>>24) {
|
|
case 0: {
|
|
$194 = HEAP32[$9>>2]|0;
|
|
HEAP32[$194>>2] = $$1248;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 1: {
|
|
$195 = HEAP32[$9>>2]|0;
|
|
HEAP32[$195>>2] = $$1248;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 2: {
|
|
$196 = ($$1248|0)<(0);
|
|
$197 = $196 << 31 >> 31;
|
|
$198 = HEAP32[$9>>2]|0;
|
|
$199 = $198;
|
|
$200 = $199;
|
|
HEAP32[$200>>2] = $$1248;
|
|
$201 = (($199) + 4)|0;
|
|
$202 = $201;
|
|
HEAP32[$202>>2] = $197;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 3: {
|
|
$203 = $$1248&65535;
|
|
$204 = HEAP32[$9>>2]|0;
|
|
HEAP16[$204>>1] = $203;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 4: {
|
|
$205 = $$1248&255;
|
|
$206 = HEAP32[$9>>2]|0;
|
|
HEAP8[$206>>0] = $205;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 6: {
|
|
$207 = HEAP32[$9>>2]|0;
|
|
HEAP32[$207>>2] = $$1248;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 7: {
|
|
$208 = ($$1248|0)<(0);
|
|
$209 = $208 << 31 >> 31;
|
|
$210 = HEAP32[$9>>2]|0;
|
|
$211 = $210;
|
|
$212 = $211;
|
|
HEAP32[$212>>2] = $$1248;
|
|
$213 = (($211) + 4)|0;
|
|
$214 = $213;
|
|
HEAP32[$214>>2] = $209;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue L1;
|
|
break;
|
|
}
|
|
default: {
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue L1;
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 112: {
|
|
$215 = ($$0254>>>0)>(8);
|
|
$216 = $215 ? $$0254 : 8;
|
|
$217 = $$1263$ | 8;
|
|
$$1236 = 120;$$1255 = $216;$$3265 = $217;
|
|
label = 63;
|
|
break;
|
|
}
|
|
case 88: case 120: {
|
|
$$1236 = $$0235;$$1255 = $$0254;$$3265 = $$1263$;
|
|
label = 63;
|
|
break;
|
|
}
|
|
case 111: {
|
|
$257 = $9;
|
|
$258 = $257;
|
|
$259 = HEAP32[$258>>2]|0;
|
|
$260 = (($257) + 4)|0;
|
|
$261 = $260;
|
|
$262 = HEAP32[$261>>2]|0;
|
|
$263 = ($259|0)==(0);
|
|
$264 = ($262|0)==(0);
|
|
$265 = $263 & $264;
|
|
if ($265) {
|
|
$$0$lcssa$i300 = $14;
|
|
} else {
|
|
$$06$i298 = $14;$267 = $259;$271 = $262;
|
|
while(1) {
|
|
$266 = $267 & 7;
|
|
$268 = $266 | 48;
|
|
$269 = $268&255;
|
|
$270 = ((($$06$i298)) + -1|0);
|
|
HEAP8[$270>>0] = $269;
|
|
$272 = (_bitshift64Lshr(($267|0),($271|0),3)|0);
|
|
$273 = tempRet0;
|
|
$274 = ($272|0)==(0);
|
|
$275 = ($273|0)==(0);
|
|
$276 = $274 & $275;
|
|
if ($276) {
|
|
$$0$lcssa$i300 = $270;
|
|
break;
|
|
} else {
|
|
$$06$i298 = $270;$267 = $272;$271 = $273;
|
|
}
|
|
}
|
|
}
|
|
$277 = $$1263$ & 8;
|
|
$278 = ($277|0)==(0);
|
|
if ($278) {
|
|
$$0228 = $$0$lcssa$i300;$$1233 = 0;$$1238 = 7209;$$2256 = $$0254;$$4266 = $$1263$;
|
|
label = 76;
|
|
} else {
|
|
$279 = $$0$lcssa$i300;
|
|
$280 = (($15) - ($279))|0;
|
|
$281 = ($$0254|0)>($280|0);
|
|
$282 = (($280) + 1)|0;
|
|
$$0254$ = $281 ? $$0254 : $282;
|
|
$$0228 = $$0$lcssa$i300;$$1233 = 0;$$1238 = 7209;$$2256 = $$0254$;$$4266 = $$1263$;
|
|
label = 76;
|
|
}
|
|
break;
|
|
}
|
|
case 105: case 100: {
|
|
$283 = $9;
|
|
$284 = $283;
|
|
$285 = HEAP32[$284>>2]|0;
|
|
$286 = (($283) + 4)|0;
|
|
$287 = $286;
|
|
$288 = HEAP32[$287>>2]|0;
|
|
$289 = ($288|0)<(0);
|
|
if ($289) {
|
|
$290 = (_i64Subtract(0,0,($285|0),($288|0))|0);
|
|
$291 = tempRet0;
|
|
$292 = $9;
|
|
$293 = $292;
|
|
HEAP32[$293>>2] = $290;
|
|
$294 = (($292) + 4)|0;
|
|
$295 = $294;
|
|
HEAP32[$295>>2] = $291;
|
|
$$0232 = 1;$$0237 = 7209;$300 = $290;$301 = $291;
|
|
label = 75;
|
|
break L74;
|
|
}
|
|
$296 = $$1263$ & 2048;
|
|
$297 = ($296|0)==(0);
|
|
if ($297) {
|
|
$298 = $$1263$ & 1;
|
|
$299 = ($298|0)==(0);
|
|
$$ = $299 ? 7209 : (7211);
|
|
$$0232 = $298;$$0237 = $$;$300 = $285;$301 = $288;
|
|
label = 75;
|
|
} else {
|
|
$$0232 = 1;$$0237 = (7210);$300 = $285;$301 = $288;
|
|
label = 75;
|
|
}
|
|
break;
|
|
}
|
|
case 117: {
|
|
$188 = $9;
|
|
$189 = $188;
|
|
$190 = HEAP32[$189>>2]|0;
|
|
$191 = (($188) + 4)|0;
|
|
$192 = $191;
|
|
$193 = HEAP32[$192>>2]|0;
|
|
$$0232 = 0;$$0237 = 7209;$300 = $190;$301 = $193;
|
|
label = 75;
|
|
break;
|
|
}
|
|
case 99: {
|
|
$321 = $9;
|
|
$322 = $321;
|
|
$323 = HEAP32[$322>>2]|0;
|
|
$324 = (($321) + 4)|0;
|
|
$325 = $324;
|
|
$326 = HEAP32[$325>>2]|0;
|
|
$327 = $323&255;
|
|
HEAP8[$16>>0] = $327;
|
|
$$2 = $16;$$2234 = 0;$$2239 = 7209;$$2251 = $14;$$5 = 1;$$6268 = $187;
|
|
break;
|
|
}
|
|
case 109: {
|
|
$328 = (___errno_location()|0);
|
|
$329 = HEAP32[$328>>2]|0;
|
|
$330 = (_strerror($329)|0);
|
|
$$1 = $330;
|
|
label = 81;
|
|
break;
|
|
}
|
|
case 115: {
|
|
$331 = HEAP32[$9>>2]|0;
|
|
$332 = ($331|0)!=(0|0);
|
|
$333 = $332 ? $331 : 7219;
|
|
$$1 = $333;
|
|
label = 81;
|
|
break;
|
|
}
|
|
case 67: {
|
|
$340 = $9;
|
|
$341 = $340;
|
|
$342 = HEAP32[$341>>2]|0;
|
|
$343 = (($340) + 4)|0;
|
|
$344 = $343;
|
|
$345 = HEAP32[$344>>2]|0;
|
|
HEAP32[$11>>2] = $342;
|
|
HEAP32[$17>>2] = 0;
|
|
HEAP32[$9>>2] = $11;
|
|
$$4258458 = -1;$809 = $11;
|
|
label = 85;
|
|
break;
|
|
}
|
|
case 83: {
|
|
$$pre454 = HEAP32[$9>>2]|0;
|
|
$346 = ($$0254|0)==(0);
|
|
if ($346) {
|
|
_pad($0,32,$$1260,0,$$1263$);
|
|
$$0240$lcssa460 = 0;
|
|
label = 96;
|
|
} else {
|
|
$$4258458 = $$0254;$809 = $$pre454;
|
|
label = 85;
|
|
}
|
|
break;
|
|
}
|
|
case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101: {
|
|
$371 = +HEAPF64[$9>>3];
|
|
HEAP32[$6>>2] = 0;
|
|
HEAPF64[tempDoublePtr>>3] = $371;$372 = HEAP32[tempDoublePtr>>2]|0;
|
|
$373 = HEAP32[tempDoublePtr+4>>2]|0;
|
|
$374 = ($373|0)<(0);
|
|
if ($374) {
|
|
$375 = -$371;
|
|
$$0471$i = $375;$$0520$i = 1;$$0522$i = 7226;
|
|
} else {
|
|
$376 = $$1263$ & 2048;
|
|
$377 = ($376|0)==(0);
|
|
$378 = $$1263$ & 1;
|
|
if ($377) {
|
|
$379 = ($378|0)==(0);
|
|
$$$i = $379 ? (7227) : (7232);
|
|
$$0471$i = $371;$$0520$i = $378;$$0522$i = $$$i;
|
|
} else {
|
|
$$0471$i = $371;$$0520$i = 1;$$0522$i = (7229);
|
|
}
|
|
}
|
|
HEAPF64[tempDoublePtr>>3] = $$0471$i;$380 = HEAP32[tempDoublePtr>>2]|0;
|
|
$381 = HEAP32[tempDoublePtr+4>>2]|0;
|
|
$382 = $381 & 2146435072;
|
|
$383 = ($382>>>0)<(2146435072);
|
|
$384 = (0)<(0);
|
|
$385 = ($382|0)==(2146435072);
|
|
$386 = $385 & $384;
|
|
$387 = $383 | $386;
|
|
do {
|
|
if ($387) {
|
|
$403 = (+_frexpl($$0471$i,$6));
|
|
$404 = $403 * 2.0;
|
|
$405 = $404 != 0.0;
|
|
if ($405) {
|
|
$406 = HEAP32[$6>>2]|0;
|
|
$407 = (($406) + -1)|0;
|
|
HEAP32[$6>>2] = $407;
|
|
}
|
|
$408 = $$0235 | 32;
|
|
$409 = ($408|0)==(97);
|
|
if ($409) {
|
|
$410 = $$0235 & 32;
|
|
$411 = ($410|0)==(0);
|
|
$412 = ((($$0522$i)) + 9|0);
|
|
$$0522$$i = $411 ? $$0522$i : $412;
|
|
$413 = $$0520$i | 2;
|
|
$414 = ($$0254>>>0)>(11);
|
|
$415 = (12 - ($$0254))|0;
|
|
$416 = ($415|0)==(0);
|
|
$417 = $414 | $416;
|
|
do {
|
|
if ($417) {
|
|
$$1472$i = $404;
|
|
} else {
|
|
$$0509592$i = 8.0;$$1508593$i = $415;
|
|
while(1) {
|
|
$418 = (($$1508593$i) + -1)|0;
|
|
$419 = $$0509592$i * 16.0;
|
|
$420 = ($418|0)==(0);
|
|
if ($420) {
|
|
break;
|
|
} else {
|
|
$$0509592$i = $419;$$1508593$i = $418;
|
|
}
|
|
}
|
|
$421 = HEAP8[$$0522$$i>>0]|0;
|
|
$422 = ($421<<24>>24)==(45);
|
|
if ($422) {
|
|
$423 = -$404;
|
|
$424 = $423 - $419;
|
|
$425 = $419 + $424;
|
|
$426 = -$425;
|
|
$$1472$i = $426;
|
|
break;
|
|
} else {
|
|
$427 = $404 + $419;
|
|
$428 = $427 - $419;
|
|
$$1472$i = $428;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$429 = HEAP32[$6>>2]|0;
|
|
$430 = ($429|0)<(0);
|
|
$431 = (0 - ($429))|0;
|
|
$432 = $430 ? $431 : $429;
|
|
$433 = ($432|0)<(0);
|
|
$434 = $433 << 31 >> 31;
|
|
$435 = (_fmt_u($432,$434,$20)|0);
|
|
$436 = ($435|0)==($20|0);
|
|
if ($436) {
|
|
HEAP8[$21>>0] = 48;
|
|
$$0511$i = $21;
|
|
} else {
|
|
$$0511$i = $435;
|
|
}
|
|
$437 = $429 >> 31;
|
|
$438 = $437 & 2;
|
|
$439 = (($438) + 43)|0;
|
|
$440 = $439&255;
|
|
$441 = ((($$0511$i)) + -1|0);
|
|
HEAP8[$441>>0] = $440;
|
|
$442 = (($$0235) + 15)|0;
|
|
$443 = $442&255;
|
|
$444 = ((($$0511$i)) + -2|0);
|
|
HEAP8[$444>>0] = $443;
|
|
$notrhs$i = ($$0254|0)<(1);
|
|
$445 = $$1263$ & 8;
|
|
$446 = ($445|0)==(0);
|
|
$$0524$i = $7;$$2473$i = $$1472$i;
|
|
while(1) {
|
|
$447 = (~~(($$2473$i)));
|
|
$448 = (7193 + ($447)|0);
|
|
$449 = HEAP8[$448>>0]|0;
|
|
$450 = $449&255;
|
|
$451 = $450 | $410;
|
|
$452 = $451&255;
|
|
$453 = ((($$0524$i)) + 1|0);
|
|
HEAP8[$$0524$i>>0] = $452;
|
|
$454 = (+($447|0));
|
|
$455 = $$2473$i - $454;
|
|
$456 = $455 * 16.0;
|
|
$457 = $453;
|
|
$458 = (($457) - ($18))|0;
|
|
$459 = ($458|0)==(1);
|
|
do {
|
|
if ($459) {
|
|
$notlhs$i = $456 == 0.0;
|
|
$or$cond3$not$i = $notrhs$i & $notlhs$i;
|
|
$or$cond$i = $446 & $or$cond3$not$i;
|
|
if ($or$cond$i) {
|
|
$$1525$i = $453;
|
|
break;
|
|
}
|
|
$460 = ((($$0524$i)) + 2|0);
|
|
HEAP8[$453>>0] = 46;
|
|
$$1525$i = $460;
|
|
} else {
|
|
$$1525$i = $453;
|
|
}
|
|
} while(0);
|
|
$461 = $456 != 0.0;
|
|
if ($461) {
|
|
$$0524$i = $$1525$i;$$2473$i = $456;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$462 = ($$0254|0)!=(0);
|
|
$$pre700$i = $$1525$i;
|
|
$463 = (($24) + ($$pre700$i))|0;
|
|
$464 = ($463|0)<($$0254|0);
|
|
$or$cond412 = $462 & $464;
|
|
$465 = $444;
|
|
$466 = (($25) + ($$0254))|0;
|
|
$467 = (($466) - ($465))|0;
|
|
$468 = (($23) - ($465))|0;
|
|
$469 = (($468) + ($$pre700$i))|0;
|
|
$$0526$i = $or$cond412 ? $467 : $469;
|
|
$470 = (($$0526$i) + ($413))|0;
|
|
_pad($0,32,$$1260,$470,$$1263$);
|
|
$471 = HEAP32[$0>>2]|0;
|
|
$472 = $471 & 32;
|
|
$473 = ($472|0)==(0);
|
|
if ($473) {
|
|
(___fwritex($$0522$$i,$413,$0)|0);
|
|
}
|
|
$474 = $$1263$ ^ 65536;
|
|
_pad($0,48,$$1260,$470,$474);
|
|
$475 = (($$pre700$i) - ($18))|0;
|
|
$476 = HEAP32[$0>>2]|0;
|
|
$477 = $476 & 32;
|
|
$478 = ($477|0)==(0);
|
|
if ($478) {
|
|
(___fwritex($7,$475,$0)|0);
|
|
}
|
|
$479 = (($22) - ($465))|0;
|
|
$sum = (($475) + ($479))|0;
|
|
$480 = (($$0526$i) - ($sum))|0;
|
|
_pad($0,48,$480,0,0);
|
|
$481 = HEAP32[$0>>2]|0;
|
|
$482 = $481 & 32;
|
|
$483 = ($482|0)==(0);
|
|
if ($483) {
|
|
(___fwritex($444,$479,$0)|0);
|
|
}
|
|
$484 = $$1263$ ^ 8192;
|
|
_pad($0,32,$$1260,$470,$484);
|
|
$485 = ($470|0)<($$1260|0);
|
|
$$537$i = $485 ? $$1260 : $470;
|
|
$$0470$i = $$537$i;
|
|
break;
|
|
}
|
|
$486 = ($$0254|0)<(0);
|
|
$$538$i = $486 ? 6 : $$0254;
|
|
if ($405) {
|
|
$487 = $404 * 268435456.0;
|
|
$488 = HEAP32[$6>>2]|0;
|
|
$489 = (($488) + -28)|0;
|
|
HEAP32[$6>>2] = $489;
|
|
$$3$i = $487;$$pr$i = $489;
|
|
} else {
|
|
$$pre697$i = HEAP32[$6>>2]|0;
|
|
$$3$i = $404;$$pr$i = $$pre697$i;
|
|
}
|
|
$490 = ($$pr$i|0)<(0);
|
|
$$554$i = $490 ? $5 : $26;
|
|
$$0498$i = $$554$i;$$4$i = $$3$i;
|
|
while(1) {
|
|
$491 = (~~(($$4$i))>>>0);
|
|
HEAP32[$$0498$i>>2] = $491;
|
|
$492 = ((($$0498$i)) + 4|0);
|
|
$493 = (+($491>>>0));
|
|
$494 = $$4$i - $493;
|
|
$495 = $494 * 1.0E+9;
|
|
$496 = $495 != 0.0;
|
|
if ($496) {
|
|
$$0498$i = $492;$$4$i = $495;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$497 = ($$pr$i|0)>(0);
|
|
if ($497) {
|
|
$$1482671$i = $$554$i;$$1499670$i = $492;$498 = $$pr$i;
|
|
while(1) {
|
|
$499 = ($498|0)>(29);
|
|
$500 = $499 ? 29 : $498;
|
|
$$0488663$i = ((($$1499670$i)) + -4|0);
|
|
$501 = ($$0488663$i>>>0)<($$1482671$i>>>0);
|
|
do {
|
|
if ($501) {
|
|
$$2483$ph$i = $$1482671$i;
|
|
} else {
|
|
$$0488665$i = $$0488663$i;$$0497664$i = 0;
|
|
while(1) {
|
|
$502 = HEAP32[$$0488665$i>>2]|0;
|
|
$503 = (_bitshift64Shl(($502|0),0,($500|0))|0);
|
|
$504 = tempRet0;
|
|
$505 = (_i64Add(($503|0),($504|0),($$0497664$i|0),0)|0);
|
|
$506 = tempRet0;
|
|
$507 = (___uremdi3(($505|0),($506|0),1000000000,0)|0);
|
|
$508 = tempRet0;
|
|
HEAP32[$$0488665$i>>2] = $507;
|
|
$509 = (___udivdi3(($505|0),($506|0),1000000000,0)|0);
|
|
$510 = tempRet0;
|
|
$$0488$i = ((($$0488665$i)) + -4|0);
|
|
$511 = ($$0488$i>>>0)<($$1482671$i>>>0);
|
|
if ($511) {
|
|
break;
|
|
} else {
|
|
$$0488665$i = $$0488$i;$$0497664$i = $509;
|
|
}
|
|
}
|
|
$512 = ($509|0)==(0);
|
|
if ($512) {
|
|
$$2483$ph$i = $$1482671$i;
|
|
break;
|
|
}
|
|
$513 = ((($$1482671$i)) + -4|0);
|
|
HEAP32[$513>>2] = $509;
|
|
$$2483$ph$i = $513;
|
|
}
|
|
} while(0);
|
|
$$2500$i = $$1499670$i;
|
|
while(1) {
|
|
$514 = ($$2500$i>>>0)>($$2483$ph$i>>>0);
|
|
if (!($514)) {
|
|
break;
|
|
}
|
|
$515 = ((($$2500$i)) + -4|0);
|
|
$516 = HEAP32[$515>>2]|0;
|
|
$517 = ($516|0)==(0);
|
|
if ($517) {
|
|
$$2500$i = $515;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$518 = HEAP32[$6>>2]|0;
|
|
$519 = (($518) - ($500))|0;
|
|
HEAP32[$6>>2] = $519;
|
|
$520 = ($519|0)>(0);
|
|
if ($520) {
|
|
$$1482671$i = $$2483$ph$i;$$1499670$i = $$2500$i;$498 = $519;
|
|
} else {
|
|
$$1482$lcssa$i = $$2483$ph$i;$$1499$lcssa$i = $$2500$i;$$pr571$i = $519;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$1482$lcssa$i = $$554$i;$$1499$lcssa$i = $492;$$pr571$i = $$pr$i;
|
|
}
|
|
$521 = ($$pr571$i|0)<(0);
|
|
if ($521) {
|
|
$522 = (($$538$i) + 25)|0;
|
|
$523 = (($522|0) / 9)&-1;
|
|
$524 = (($523) + 1)|0;
|
|
$525 = ($408|0)==(102);
|
|
$$3484658$i = $$1482$lcssa$i;$$3501657$i = $$1499$lcssa$i;$527 = $$pr571$i;
|
|
while(1) {
|
|
$526 = (0 - ($527))|0;
|
|
$528 = ($526|0)>(9);
|
|
$529 = $528 ? 9 : $526;
|
|
$530 = ($$3484658$i>>>0)<($$3501657$i>>>0);
|
|
do {
|
|
if ($530) {
|
|
$534 = 1 << $529;
|
|
$535 = (($534) + -1)|0;
|
|
$536 = 1000000000 >>> $529;
|
|
$$0487652$i = 0;$$1489651$i = $$3484658$i;
|
|
while(1) {
|
|
$537 = HEAP32[$$1489651$i>>2]|0;
|
|
$538 = $537 & $535;
|
|
$539 = $537 >>> $529;
|
|
$540 = (($539) + ($$0487652$i))|0;
|
|
HEAP32[$$1489651$i>>2] = $540;
|
|
$541 = Math_imul($538, $536)|0;
|
|
$542 = ((($$1489651$i)) + 4|0);
|
|
$543 = ($542>>>0)<($$3501657$i>>>0);
|
|
if ($543) {
|
|
$$0487652$i = $541;$$1489651$i = $542;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$544 = HEAP32[$$3484658$i>>2]|0;
|
|
$545 = ($544|0)==(0);
|
|
$546 = ((($$3484658$i)) + 4|0);
|
|
$$$3484$i = $545 ? $546 : $$3484658$i;
|
|
$547 = ($541|0)==(0);
|
|
if ($547) {
|
|
$$$3484706$i = $$$3484$i;$$4502$i = $$3501657$i;
|
|
break;
|
|
}
|
|
$548 = ((($$3501657$i)) + 4|0);
|
|
HEAP32[$$3501657$i>>2] = $541;
|
|
$$$3484706$i = $$$3484$i;$$4502$i = $548;
|
|
} else {
|
|
$531 = HEAP32[$$3484658$i>>2]|0;
|
|
$532 = ($531|0)==(0);
|
|
$533 = ((($$3484658$i)) + 4|0);
|
|
$$$3484705$i = $532 ? $533 : $$3484658$i;
|
|
$$$3484706$i = $$$3484705$i;$$4502$i = $$3501657$i;
|
|
}
|
|
} while(0);
|
|
$549 = $525 ? $$554$i : $$$3484706$i;
|
|
$550 = $$4502$i;
|
|
$551 = $549;
|
|
$552 = (($550) - ($551))|0;
|
|
$553 = $552 >> 2;
|
|
$554 = ($553|0)>($524|0);
|
|
$555 = (($549) + ($524<<2)|0);
|
|
$$$4502$i = $554 ? $555 : $$4502$i;
|
|
$556 = HEAP32[$6>>2]|0;
|
|
$557 = (($556) + ($529))|0;
|
|
HEAP32[$6>>2] = $557;
|
|
$558 = ($557|0)<(0);
|
|
if ($558) {
|
|
$$3484658$i = $$$3484706$i;$$3501657$i = $$$4502$i;$527 = $557;
|
|
} else {
|
|
$$3484$lcssa$i = $$$3484706$i;$$3501$lcssa$i = $$$4502$i;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$3484$lcssa$i = $$1482$lcssa$i;$$3501$lcssa$i = $$1499$lcssa$i;
|
|
}
|
|
$559 = ($$3484$lcssa$i>>>0)<($$3501$lcssa$i>>>0);
|
|
$560 = $$554$i;
|
|
do {
|
|
if ($559) {
|
|
$561 = $$3484$lcssa$i;
|
|
$562 = (($560) - ($561))|0;
|
|
$563 = $562 >> 2;
|
|
$564 = ($563*9)|0;
|
|
$565 = HEAP32[$$3484$lcssa$i>>2]|0;
|
|
$566 = ($565>>>0)<(10);
|
|
if ($566) {
|
|
$$1515$i = $564;
|
|
break;
|
|
} else {
|
|
$$0514647$i = $564;$$0531646$i = 10;
|
|
}
|
|
while(1) {
|
|
$567 = ($$0531646$i*10)|0;
|
|
$568 = (($$0514647$i) + 1)|0;
|
|
$569 = ($565>>>0)<($567>>>0);
|
|
if ($569) {
|
|
$$1515$i = $568;
|
|
break;
|
|
} else {
|
|
$$0514647$i = $568;$$0531646$i = $567;
|
|
}
|
|
}
|
|
} else {
|
|
$$1515$i = 0;
|
|
}
|
|
} while(0);
|
|
$570 = ($408|0)!=(102);
|
|
$571 = $570 ? $$1515$i : 0;
|
|
$572 = (($$538$i) - ($571))|0;
|
|
$573 = ($408|0)==(103);
|
|
$574 = ($$538$i|0)!=(0);
|
|
$575 = $574 & $573;
|
|
$$neg$i = $575 << 31 >> 31;
|
|
$576 = (($572) + ($$neg$i))|0;
|
|
$577 = $$3501$lcssa$i;
|
|
$578 = (($577) - ($560))|0;
|
|
$579 = $578 >> 2;
|
|
$580 = ($579*9)|0;
|
|
$581 = (($580) + -9)|0;
|
|
$582 = ($576|0)<($581|0);
|
|
if ($582) {
|
|
$583 = ((($$554$i)) + 4|0);
|
|
$584 = (($576) + 9216)|0;
|
|
$585 = (($584|0) / 9)&-1;
|
|
$586 = (($585) + -1024)|0;
|
|
$587 = (($583) + ($586<<2)|0);
|
|
$588 = (($584|0) % 9)&-1;
|
|
$$0528639$i = (($588) + 1)|0;
|
|
$589 = ($$0528639$i|0)<(9);
|
|
if ($589) {
|
|
$$0528641$i = $$0528639$i;$$1532640$i = 10;
|
|
while(1) {
|
|
$590 = ($$1532640$i*10)|0;
|
|
$$0528$i = (($$0528641$i) + 1)|0;
|
|
$exitcond$i = ($$0528$i|0)==(9);
|
|
if ($exitcond$i) {
|
|
$$1532$lcssa$i = $590;
|
|
break;
|
|
} else {
|
|
$$0528641$i = $$0528$i;$$1532640$i = $590;
|
|
}
|
|
}
|
|
} else {
|
|
$$1532$lcssa$i = 10;
|
|
}
|
|
$591 = HEAP32[$587>>2]|0;
|
|
$592 = (($591>>>0) % ($$1532$lcssa$i>>>0))&-1;
|
|
$593 = ($592|0)==(0);
|
|
$594 = ((($587)) + 4|0);
|
|
$595 = ($594|0)==($$3501$lcssa$i|0);
|
|
$or$cond540$i = $595 & $593;
|
|
do {
|
|
if ($or$cond540$i) {
|
|
$$4492$i = $587;$$4518$i = $$1515$i;$$8$i = $$3484$lcssa$i;
|
|
} else {
|
|
$596 = (($591>>>0) / ($$1532$lcssa$i>>>0))&-1;
|
|
$597 = $596 & 1;
|
|
$598 = ($597|0)==(0);
|
|
$$541$i = $598 ? 9007199254740992.0 : 9007199254740994.0;
|
|
$599 = (($$1532$lcssa$i|0) / 2)&-1;
|
|
$600 = ($592>>>0)<($599>>>0);
|
|
if ($600) {
|
|
$$0466$i = 0.5;
|
|
} else {
|
|
$601 = ($592|0)==($599|0);
|
|
$or$cond543$i = $595 & $601;
|
|
$$557$i = $or$cond543$i ? 1.0 : 1.5;
|
|
$$0466$i = $$557$i;
|
|
}
|
|
$602 = ($$0520$i|0)==(0);
|
|
do {
|
|
if ($602) {
|
|
$$1467$i = $$0466$i;$$1469$i = $$541$i;
|
|
} else {
|
|
$603 = HEAP8[$$0522$i>>0]|0;
|
|
$604 = ($603<<24>>24)==(45);
|
|
if (!($604)) {
|
|
$$1467$i = $$0466$i;$$1469$i = $$541$i;
|
|
break;
|
|
}
|
|
$605 = -$$541$i;
|
|
$606 = -$$0466$i;
|
|
$$1467$i = $606;$$1469$i = $605;
|
|
}
|
|
} while(0);
|
|
$607 = (($591) - ($592))|0;
|
|
HEAP32[$587>>2] = $607;
|
|
$608 = $$1469$i + $$1467$i;
|
|
$609 = $608 != $$1469$i;
|
|
if (!($609)) {
|
|
$$4492$i = $587;$$4518$i = $$1515$i;$$8$i = $$3484$lcssa$i;
|
|
break;
|
|
}
|
|
$610 = (($607) + ($$1532$lcssa$i))|0;
|
|
HEAP32[$587>>2] = $610;
|
|
$611 = ($610>>>0)>(999999999);
|
|
if ($611) {
|
|
$$2490632$i = $587;$$5486633$i = $$3484$lcssa$i;
|
|
while(1) {
|
|
$612 = ((($$2490632$i)) + -4|0);
|
|
HEAP32[$$2490632$i>>2] = 0;
|
|
$613 = ($612>>>0)<($$5486633$i>>>0);
|
|
if ($613) {
|
|
$614 = ((($$5486633$i)) + -4|0);
|
|
HEAP32[$614>>2] = 0;
|
|
$$6$i = $614;
|
|
} else {
|
|
$$6$i = $$5486633$i;
|
|
}
|
|
$615 = HEAP32[$612>>2]|0;
|
|
$616 = (($615) + 1)|0;
|
|
HEAP32[$612>>2] = $616;
|
|
$617 = ($616>>>0)>(999999999);
|
|
if ($617) {
|
|
$$2490632$i = $612;$$5486633$i = $$6$i;
|
|
} else {
|
|
$$2490$lcssa$i = $612;$$5486$lcssa$i = $$6$i;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$2490$lcssa$i = $587;$$5486$lcssa$i = $$3484$lcssa$i;
|
|
}
|
|
$618 = $$5486$lcssa$i;
|
|
$619 = (($560) - ($618))|0;
|
|
$620 = $619 >> 2;
|
|
$621 = ($620*9)|0;
|
|
$622 = HEAP32[$$5486$lcssa$i>>2]|0;
|
|
$623 = ($622>>>0)<(10);
|
|
if ($623) {
|
|
$$4492$i = $$2490$lcssa$i;$$4518$i = $621;$$8$i = $$5486$lcssa$i;
|
|
break;
|
|
} else {
|
|
$$2516628$i = $621;$$2533627$i = 10;
|
|
}
|
|
while(1) {
|
|
$624 = ($$2533627$i*10)|0;
|
|
$625 = (($$2516628$i) + 1)|0;
|
|
$626 = ($622>>>0)<($624>>>0);
|
|
if ($626) {
|
|
$$4492$i = $$2490$lcssa$i;$$4518$i = $625;$$8$i = $$5486$lcssa$i;
|
|
break;
|
|
} else {
|
|
$$2516628$i = $625;$$2533627$i = $624;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$627 = ((($$4492$i)) + 4|0);
|
|
$628 = ($$3501$lcssa$i>>>0)>($627>>>0);
|
|
$$$3501$i = $628 ? $627 : $$3501$lcssa$i;
|
|
$$5519$ph$i = $$4518$i;$$7505$ph$i = $$$3501$i;$$9$ph$i = $$8$i;
|
|
} else {
|
|
$$5519$ph$i = $$1515$i;$$7505$ph$i = $$3501$lcssa$i;$$9$ph$i = $$3484$lcssa$i;
|
|
}
|
|
$629 = (0 - ($$5519$ph$i))|0;
|
|
$$7505$i = $$7505$ph$i;
|
|
while(1) {
|
|
$630 = ($$7505$i>>>0)>($$9$ph$i>>>0);
|
|
if (!($630)) {
|
|
$$lcssa683$i = 0;
|
|
break;
|
|
}
|
|
$631 = ((($$7505$i)) + -4|0);
|
|
$632 = HEAP32[$631>>2]|0;
|
|
$633 = ($632|0)==(0);
|
|
if ($633) {
|
|
$$7505$i = $631;
|
|
} else {
|
|
$$lcssa683$i = 1;
|
|
break;
|
|
}
|
|
}
|
|
do {
|
|
if ($573) {
|
|
$634 = $574&1;
|
|
$635 = $634 ^ 1;
|
|
$$538$$i = (($635) + ($$538$i))|0;
|
|
$636 = ($$538$$i|0)>($$5519$ph$i|0);
|
|
$637 = ($$5519$ph$i|0)>(-5);
|
|
$or$cond6$i = $636 & $637;
|
|
if ($or$cond6$i) {
|
|
$638 = (($$0235) + -1)|0;
|
|
$$neg572$i = (($$538$$i) + -1)|0;
|
|
$639 = (($$neg572$i) - ($$5519$ph$i))|0;
|
|
$$0479$i = $638;$$2476$i = $639;
|
|
} else {
|
|
$640 = (($$0235) + -2)|0;
|
|
$641 = (($$538$$i) + -1)|0;
|
|
$$0479$i = $640;$$2476$i = $641;
|
|
}
|
|
$642 = $$1263$ & 8;
|
|
$643 = ($642|0)==(0);
|
|
if (!($643)) {
|
|
$$1480$i = $$0479$i;$$3477$i = $$2476$i;$$pre$phi704$iZ2D = $642;
|
|
break;
|
|
}
|
|
do {
|
|
if ($$lcssa683$i) {
|
|
$644 = ((($$7505$i)) + -4|0);
|
|
$645 = HEAP32[$644>>2]|0;
|
|
$646 = ($645|0)==(0);
|
|
if ($646) {
|
|
$$2530$i = 9;
|
|
break;
|
|
}
|
|
$647 = (($645>>>0) % 10)&-1;
|
|
$648 = ($647|0)==(0);
|
|
if ($648) {
|
|
$$1529624$i = 0;$$3534623$i = 10;
|
|
} else {
|
|
$$2530$i = 0;
|
|
break;
|
|
}
|
|
while(1) {
|
|
$649 = ($$3534623$i*10)|0;
|
|
$650 = (($$1529624$i) + 1)|0;
|
|
$651 = (($645>>>0) % ($649>>>0))&-1;
|
|
$652 = ($651|0)==(0);
|
|
if ($652) {
|
|
$$1529624$i = $650;$$3534623$i = $649;
|
|
} else {
|
|
$$2530$i = $650;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$2530$i = 9;
|
|
}
|
|
} while(0);
|
|
$653 = $$0479$i | 32;
|
|
$654 = ($653|0)==(102);
|
|
$655 = $$7505$i;
|
|
$656 = (($655) - ($560))|0;
|
|
$657 = $656 >> 2;
|
|
$658 = ($657*9)|0;
|
|
$659 = (($658) + -9)|0;
|
|
if ($654) {
|
|
$660 = (($659) - ($$2530$i))|0;
|
|
$661 = ($660|0)<(0);
|
|
$$544$i = $661 ? 0 : $660;
|
|
$662 = ($$2476$i|0)<($$544$i|0);
|
|
$$2476$$545$i = $662 ? $$2476$i : $$544$i;
|
|
$$1480$i = $$0479$i;$$3477$i = $$2476$$545$i;$$pre$phi704$iZ2D = 0;
|
|
break;
|
|
} else {
|
|
$663 = (($659) + ($$5519$ph$i))|0;
|
|
$664 = (($663) - ($$2530$i))|0;
|
|
$665 = ($664|0)<(0);
|
|
$$546$i = $665 ? 0 : $664;
|
|
$666 = ($$2476$i|0)<($$546$i|0);
|
|
$$2476$$547$i = $666 ? $$2476$i : $$546$i;
|
|
$$1480$i = $$0479$i;$$3477$i = $$2476$$547$i;$$pre$phi704$iZ2D = 0;
|
|
break;
|
|
}
|
|
} else {
|
|
$$pre703$i = $$1263$ & 8;
|
|
$$1480$i = $$0235;$$3477$i = $$538$i;$$pre$phi704$iZ2D = $$pre703$i;
|
|
}
|
|
} while(0);
|
|
$667 = $$3477$i | $$pre$phi704$iZ2D;
|
|
$668 = ($667|0)!=(0);
|
|
$669 = $668&1;
|
|
$670 = $$1480$i | 32;
|
|
$671 = ($670|0)==(102);
|
|
if ($671) {
|
|
$672 = ($$5519$ph$i|0)>(0);
|
|
$673 = $672 ? $$5519$ph$i : 0;
|
|
$$2513$i = 0;$$pn$i = $673;
|
|
} else {
|
|
$674 = ($$5519$ph$i|0)<(0);
|
|
$675 = $674 ? $629 : $$5519$ph$i;
|
|
$676 = ($675|0)<(0);
|
|
$677 = $676 << 31 >> 31;
|
|
$678 = (_fmt_u($675,$677,$20)|0);
|
|
$679 = $678;
|
|
$680 = (($22) - ($679))|0;
|
|
$681 = ($680|0)<(2);
|
|
if ($681) {
|
|
$$1512617$i = $678;
|
|
while(1) {
|
|
$682 = ((($$1512617$i)) + -1|0);
|
|
HEAP8[$682>>0] = 48;
|
|
$683 = $682;
|
|
$684 = (($22) - ($683))|0;
|
|
$685 = ($684|0)<(2);
|
|
if ($685) {
|
|
$$1512617$i = $682;
|
|
} else {
|
|
$$1512$lcssa$i = $682;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$1512$lcssa$i = $678;
|
|
}
|
|
$686 = $$5519$ph$i >> 31;
|
|
$687 = $686 & 2;
|
|
$688 = (($687) + 43)|0;
|
|
$689 = $688&255;
|
|
$690 = ((($$1512$lcssa$i)) + -1|0);
|
|
HEAP8[$690>>0] = $689;
|
|
$691 = $$1480$i&255;
|
|
$692 = ((($$1512$lcssa$i)) + -2|0);
|
|
HEAP8[$692>>0] = $691;
|
|
$693 = $692;
|
|
$694 = (($22) - ($693))|0;
|
|
$$2513$i = $692;$$pn$i = $694;
|
|
}
|
|
$695 = (($$0520$i) + 1)|0;
|
|
$696 = (($695) + ($$3477$i))|0;
|
|
$$1527$i = (($696) + ($669))|0;
|
|
$697 = (($$1527$i) + ($$pn$i))|0;
|
|
_pad($0,32,$$1260,$697,$$1263$);
|
|
$698 = HEAP32[$0>>2]|0;
|
|
$699 = $698 & 32;
|
|
$700 = ($699|0)==(0);
|
|
if ($700) {
|
|
(___fwritex($$0522$i,$$0520$i,$0)|0);
|
|
}
|
|
$701 = $$1263$ ^ 65536;
|
|
_pad($0,48,$$1260,$697,$701);
|
|
do {
|
|
if ($671) {
|
|
$702 = ($$9$ph$i>>>0)>($$554$i>>>0);
|
|
$$0496$$9$i = $702 ? $$554$i : $$9$ph$i;
|
|
$$5493606$i = $$0496$$9$i;
|
|
while(1) {
|
|
$703 = HEAP32[$$5493606$i>>2]|0;
|
|
$704 = (_fmt_u($703,0,$27)|0);
|
|
$705 = ($$5493606$i|0)==($$0496$$9$i|0);
|
|
do {
|
|
if ($705) {
|
|
$711 = ($704|0)==($27|0);
|
|
if (!($711)) {
|
|
$$1465$i = $704;
|
|
break;
|
|
}
|
|
HEAP8[$29>>0] = 48;
|
|
$$1465$i = $29;
|
|
} else {
|
|
$706 = ($704>>>0)>($7>>>0);
|
|
if (!($706)) {
|
|
$$1465$i = $704;
|
|
break;
|
|
}
|
|
$707 = $704;
|
|
$708 = (($707) - ($18))|0;
|
|
_memset(($7|0),48,($708|0))|0;
|
|
$$0464603$i = $704;
|
|
while(1) {
|
|
$709 = ((($$0464603$i)) + -1|0);
|
|
$710 = ($709>>>0)>($7>>>0);
|
|
if ($710) {
|
|
$$0464603$i = $709;
|
|
} else {
|
|
$$1465$i = $709;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$712 = HEAP32[$0>>2]|0;
|
|
$713 = $712 & 32;
|
|
$714 = ($713|0)==(0);
|
|
if ($714) {
|
|
$715 = $$1465$i;
|
|
$716 = (($28) - ($715))|0;
|
|
(___fwritex($$1465$i,$716,$0)|0);
|
|
}
|
|
$717 = ((($$5493606$i)) + 4|0);
|
|
$718 = ($717>>>0)>($$554$i>>>0);
|
|
if ($718) {
|
|
break;
|
|
} else {
|
|
$$5493606$i = $717;
|
|
}
|
|
}
|
|
$719 = ($667|0)==(0);
|
|
do {
|
|
if (!($719)) {
|
|
$720 = HEAP32[$0>>2]|0;
|
|
$721 = $720 & 32;
|
|
$722 = ($721|0)==(0);
|
|
if (!($722)) {
|
|
break;
|
|
}
|
|
(___fwritex(7261,1,$0)|0);
|
|
}
|
|
} while(0);
|
|
$723 = ($717>>>0)<($$7505$i>>>0);
|
|
$724 = ($$3477$i|0)>(0);
|
|
$725 = $724 & $723;
|
|
if ($725) {
|
|
$$4478600$i = $$3477$i;$$6494599$i = $717;
|
|
while(1) {
|
|
$726 = HEAP32[$$6494599$i>>2]|0;
|
|
$727 = (_fmt_u($726,0,$27)|0);
|
|
$728 = ($727>>>0)>($7>>>0);
|
|
if ($728) {
|
|
$729 = $727;
|
|
$730 = (($729) - ($18))|0;
|
|
_memset(($7|0),48,($730|0))|0;
|
|
$$0463594$i = $727;
|
|
while(1) {
|
|
$731 = ((($$0463594$i)) + -1|0);
|
|
$732 = ($731>>>0)>($7>>>0);
|
|
if ($732) {
|
|
$$0463594$i = $731;
|
|
} else {
|
|
$$0463$lcssa$i = $731;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$0463$lcssa$i = $727;
|
|
}
|
|
$733 = HEAP32[$0>>2]|0;
|
|
$734 = $733 & 32;
|
|
$735 = ($734|0)==(0);
|
|
if ($735) {
|
|
$736 = ($$4478600$i|0)>(9);
|
|
$737 = $736 ? 9 : $$4478600$i;
|
|
(___fwritex($$0463$lcssa$i,$737,$0)|0);
|
|
}
|
|
$738 = ((($$6494599$i)) + 4|0);
|
|
$739 = (($$4478600$i) + -9)|0;
|
|
$740 = ($738>>>0)<($$7505$i>>>0);
|
|
$741 = ($$4478600$i|0)>(9);
|
|
$742 = $741 & $740;
|
|
if ($742) {
|
|
$$4478600$i = $739;$$6494599$i = $738;
|
|
} else {
|
|
$$4478$lcssa$i = $739;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$4478$lcssa$i = $$3477$i;
|
|
}
|
|
$743 = (($$4478$lcssa$i) + 9)|0;
|
|
_pad($0,48,$743,9,0);
|
|
} else {
|
|
$744 = ((($$9$ph$i)) + 4|0);
|
|
$$7505$$i = $$lcssa683$i ? $$7505$i : $744;
|
|
$745 = ($$3477$i|0)>(-1);
|
|
if ($745) {
|
|
$746 = ($$pre$phi704$iZ2D|0)==(0);
|
|
$$5611$i = $$3477$i;$$7495610$i = $$9$ph$i;
|
|
while(1) {
|
|
$747 = HEAP32[$$7495610$i>>2]|0;
|
|
$748 = (_fmt_u($747,0,$27)|0);
|
|
$749 = ($748|0)==($27|0);
|
|
if ($749) {
|
|
HEAP8[$29>>0] = 48;
|
|
$$0$i = $29;
|
|
} else {
|
|
$$0$i = $748;
|
|
}
|
|
$750 = ($$7495610$i|0)==($$9$ph$i|0);
|
|
do {
|
|
if ($750) {
|
|
$754 = ((($$0$i)) + 1|0);
|
|
$755 = HEAP32[$0>>2]|0;
|
|
$756 = $755 & 32;
|
|
$757 = ($756|0)==(0);
|
|
if ($757) {
|
|
(___fwritex($$0$i,1,$0)|0);
|
|
}
|
|
$758 = ($$5611$i|0)<(1);
|
|
$or$cond552$i = $746 & $758;
|
|
if ($or$cond552$i) {
|
|
$$2$i = $754;
|
|
break;
|
|
}
|
|
$759 = HEAP32[$0>>2]|0;
|
|
$760 = $759 & 32;
|
|
$761 = ($760|0)==(0);
|
|
if (!($761)) {
|
|
$$2$i = $754;
|
|
break;
|
|
}
|
|
(___fwritex(7261,1,$0)|0);
|
|
$$2$i = $754;
|
|
} else {
|
|
$751 = ($$0$i>>>0)>($7>>>0);
|
|
if (!($751)) {
|
|
$$2$i = $$0$i;
|
|
break;
|
|
}
|
|
$scevgep694$i = (($$0$i) + ($19)|0);
|
|
$scevgep694695$i = $scevgep694$i;
|
|
_memset(($7|0),48,($scevgep694695$i|0))|0;
|
|
$$1607$i = $$0$i;
|
|
while(1) {
|
|
$752 = ((($$1607$i)) + -1|0);
|
|
$753 = ($752>>>0)>($7>>>0);
|
|
if ($753) {
|
|
$$1607$i = $752;
|
|
} else {
|
|
$$2$i = $752;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$762 = $$2$i;
|
|
$763 = (($28) - ($762))|0;
|
|
$764 = HEAP32[$0>>2]|0;
|
|
$765 = $764 & 32;
|
|
$766 = ($765|0)==(0);
|
|
if ($766) {
|
|
$767 = ($$5611$i|0)>($763|0);
|
|
$768 = $767 ? $763 : $$5611$i;
|
|
(___fwritex($$2$i,$768,$0)|0);
|
|
}
|
|
$769 = (($$5611$i) - ($763))|0;
|
|
$770 = ((($$7495610$i)) + 4|0);
|
|
$771 = ($770>>>0)<($$7505$$i>>>0);
|
|
$772 = ($769|0)>(-1);
|
|
$773 = $771 & $772;
|
|
if ($773) {
|
|
$$5611$i = $769;$$7495610$i = $770;
|
|
} else {
|
|
$$5$lcssa$i = $769;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$5$lcssa$i = $$3477$i;
|
|
}
|
|
$774 = (($$5$lcssa$i) + 18)|0;
|
|
_pad($0,48,$774,18,0);
|
|
$775 = HEAP32[$0>>2]|0;
|
|
$776 = $775 & 32;
|
|
$777 = ($776|0)==(0);
|
|
if (!($777)) {
|
|
break;
|
|
}
|
|
$778 = $$2513$i;
|
|
$779 = (($22) - ($778))|0;
|
|
(___fwritex($$2513$i,$779,$0)|0);
|
|
}
|
|
} while(0);
|
|
$780 = $$1263$ ^ 8192;
|
|
_pad($0,32,$$1260,$697,$780);
|
|
$781 = ($697|0)<($$1260|0);
|
|
$$553$i = $781 ? $$1260 : $697;
|
|
$$0470$i = $$553$i;
|
|
} else {
|
|
$388 = $$0235 & 32;
|
|
$389 = ($388|0)!=(0);
|
|
$390 = $389 ? 7245 : 7249;
|
|
$391 = ($$0471$i != $$0471$i) | (0.0 != 0.0);
|
|
$392 = $389 ? 7253 : 7257;
|
|
$$1521$i = $391 ? 0 : $$0520$i;
|
|
$$0510$i = $391 ? $392 : $390;
|
|
$393 = (($$1521$i) + 3)|0;
|
|
_pad($0,32,$$1260,$393,$187);
|
|
$394 = HEAP32[$0>>2]|0;
|
|
$395 = $394 & 32;
|
|
$396 = ($395|0)==(0);
|
|
if ($396) {
|
|
(___fwritex($$0522$i,$$1521$i,$0)|0);
|
|
$$pre$i = HEAP32[$0>>2]|0;
|
|
$398 = $$pre$i;
|
|
} else {
|
|
$398 = $394;
|
|
}
|
|
$397 = $398 & 32;
|
|
$399 = ($397|0)==(0);
|
|
if ($399) {
|
|
(___fwritex($$0510$i,3,$0)|0);
|
|
}
|
|
$400 = $$1263$ ^ 8192;
|
|
_pad($0,32,$$1260,$393,$400);
|
|
$401 = ($393|0)<($$1260|0);
|
|
$402 = $401 ? $$1260 : $393;
|
|
$$0470$i = $402;
|
|
}
|
|
} while(0);
|
|
$$0243 = $$0470$i;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue L1;
|
|
break;
|
|
}
|
|
default: {
|
|
$$2 = $$0321;$$2234 = 0;$$2239 = 7209;$$2251 = $14;$$5 = $$0254;$$6268 = $$1263$;
|
|
}
|
|
}
|
|
} while(0);
|
|
L310: do {
|
|
if ((label|0) == 63) {
|
|
label = 0;
|
|
$218 = $9;
|
|
$219 = $218;
|
|
$220 = HEAP32[$219>>2]|0;
|
|
$221 = (($218) + 4)|0;
|
|
$222 = $221;
|
|
$223 = HEAP32[$222>>2]|0;
|
|
$224 = $$1236 & 32;
|
|
$225 = ($220|0)==(0);
|
|
$226 = ($223|0)==(0);
|
|
$227 = $225 & $226;
|
|
if ($227) {
|
|
$$05$lcssa$i = $14;$248 = 0;$250 = 0;
|
|
} else {
|
|
$$056$i = $14;$229 = $220;$236 = $223;
|
|
while(1) {
|
|
$228 = $229 & 15;
|
|
$230 = (7193 + ($228)|0);
|
|
$231 = HEAP8[$230>>0]|0;
|
|
$232 = $231&255;
|
|
$233 = $232 | $224;
|
|
$234 = $233&255;
|
|
$235 = ((($$056$i)) + -1|0);
|
|
HEAP8[$235>>0] = $234;
|
|
$237 = (_bitshift64Lshr(($229|0),($236|0),4)|0);
|
|
$238 = tempRet0;
|
|
$239 = ($237|0)==(0);
|
|
$240 = ($238|0)==(0);
|
|
$241 = $239 & $240;
|
|
if ($241) {
|
|
break;
|
|
} else {
|
|
$$056$i = $235;$229 = $237;$236 = $238;
|
|
}
|
|
}
|
|
$242 = $9;
|
|
$243 = $242;
|
|
$244 = HEAP32[$243>>2]|0;
|
|
$245 = (($242) + 4)|0;
|
|
$246 = $245;
|
|
$247 = HEAP32[$246>>2]|0;
|
|
$$05$lcssa$i = $235;$248 = $244;$250 = $247;
|
|
}
|
|
$249 = ($248|0)==(0);
|
|
$251 = ($250|0)==(0);
|
|
$252 = $249 & $251;
|
|
$253 = $$3265 & 8;
|
|
$254 = ($253|0)==(0);
|
|
$or$cond282 = $254 | $252;
|
|
$255 = $$1236 >> 4;
|
|
$256 = (7209 + ($255)|0);
|
|
$$332 = $or$cond282 ? 7209 : $256;
|
|
$$333 = $or$cond282 ? 0 : 2;
|
|
$$0228 = $$05$lcssa$i;$$1233 = $$333;$$1238 = $$332;$$2256 = $$1255;$$4266 = $$3265;
|
|
label = 76;
|
|
}
|
|
else if ((label|0) == 75) {
|
|
label = 0;
|
|
$302 = (_fmt_u($300,$301,$14)|0);
|
|
$$0228 = $302;$$1233 = $$0232;$$1238 = $$0237;$$2256 = $$0254;$$4266 = $$1263$;
|
|
label = 76;
|
|
}
|
|
else if ((label|0) == 81) {
|
|
label = 0;
|
|
$334 = (_memchr($$1,0,$$0254)|0);
|
|
$335 = ($334|0)==(0|0);
|
|
$336 = $334;
|
|
$337 = $$1;
|
|
$338 = (($336) - ($337))|0;
|
|
$339 = (($$1) + ($$0254)|0);
|
|
$$3257 = $335 ? $$0254 : $338;
|
|
$$1250 = $335 ? $339 : $334;
|
|
$$2 = $$1;$$2234 = 0;$$2239 = 7209;$$2251 = $$1250;$$5 = $$3257;$$6268 = $187;
|
|
}
|
|
else if ((label|0) == 85) {
|
|
label = 0;
|
|
$$0229396 = $809;$$0240395 = 0;$$1244394 = 0;
|
|
while(1) {
|
|
$347 = HEAP32[$$0229396>>2]|0;
|
|
$348 = ($347|0)==(0);
|
|
if ($348) {
|
|
$$0240$lcssa = $$0240395;$$2245 = $$1244394;
|
|
break;
|
|
}
|
|
$349 = (_wctomb($12,$347)|0);
|
|
$350 = ($349|0)<(0);
|
|
$351 = (($$4258458) - ($$0240395))|0;
|
|
$352 = ($349>>>0)>($351>>>0);
|
|
$or$cond285 = $350 | $352;
|
|
if ($or$cond285) {
|
|
$$0240$lcssa = $$0240395;$$2245 = $349;
|
|
break;
|
|
}
|
|
$353 = ((($$0229396)) + 4|0);
|
|
$354 = (($349) + ($$0240395))|0;
|
|
$355 = ($$4258458>>>0)>($354>>>0);
|
|
if ($355) {
|
|
$$0229396 = $353;$$0240395 = $354;$$1244394 = $349;
|
|
} else {
|
|
$$0240$lcssa = $354;$$2245 = $349;
|
|
break;
|
|
}
|
|
}
|
|
$356 = ($$2245|0)<(0);
|
|
if ($356) {
|
|
$$0 = -1;
|
|
break L1;
|
|
}
|
|
_pad($0,32,$$1260,$$0240$lcssa,$$1263$);
|
|
$357 = ($$0240$lcssa|0)==(0);
|
|
if ($357) {
|
|
$$0240$lcssa460 = 0;
|
|
label = 96;
|
|
} else {
|
|
$$1230407 = $809;$$1241406 = 0;
|
|
while(1) {
|
|
$358 = HEAP32[$$1230407>>2]|0;
|
|
$359 = ($358|0)==(0);
|
|
if ($359) {
|
|
$$0240$lcssa460 = $$0240$lcssa;
|
|
label = 96;
|
|
break L310;
|
|
}
|
|
$360 = ((($$1230407)) + 4|0);
|
|
$361 = (_wctomb($12,$358)|0);
|
|
$362 = (($361) + ($$1241406))|0;
|
|
$363 = ($362|0)>($$0240$lcssa|0);
|
|
if ($363) {
|
|
$$0240$lcssa460 = $$0240$lcssa;
|
|
label = 96;
|
|
break L310;
|
|
}
|
|
$364 = HEAP32[$0>>2]|0;
|
|
$365 = $364 & 32;
|
|
$366 = ($365|0)==(0);
|
|
if ($366) {
|
|
(___fwritex($12,$361,$0)|0);
|
|
}
|
|
$367 = ($362>>>0)<($$0240$lcssa>>>0);
|
|
if ($367) {
|
|
$$1230407 = $360;$$1241406 = $362;
|
|
} else {
|
|
$$0240$lcssa460 = $$0240$lcssa;
|
|
label = 96;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 96) {
|
|
label = 0;
|
|
$368 = $$1263$ ^ 8192;
|
|
_pad($0,32,$$1260,$$0240$lcssa460,$368);
|
|
$369 = ($$1260|0)>($$0240$lcssa460|0);
|
|
$370 = $369 ? $$1260 : $$0240$lcssa460;
|
|
$$0243 = $370;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
continue;
|
|
}
|
|
if ((label|0) == 76) {
|
|
label = 0;
|
|
$303 = ($$2256|0)>(-1);
|
|
$304 = $$4266 & -65537;
|
|
$$$4266 = $303 ? $304 : $$4266;
|
|
$305 = $9;
|
|
$306 = $305;
|
|
$307 = HEAP32[$306>>2]|0;
|
|
$308 = (($305) + 4)|0;
|
|
$309 = $308;
|
|
$310 = HEAP32[$309>>2]|0;
|
|
$311 = ($307|0)!=(0);
|
|
$312 = ($310|0)!=(0);
|
|
$313 = $311 | $312;
|
|
$314 = ($$2256|0)!=(0);
|
|
$or$cond = $314 | $313;
|
|
if ($or$cond) {
|
|
$315 = $$0228;
|
|
$316 = (($15) - ($315))|0;
|
|
$317 = $313&1;
|
|
$318 = $317 ^ 1;
|
|
$319 = (($318) + ($316))|0;
|
|
$320 = ($$2256|0)>($319|0);
|
|
$$2256$ = $320 ? $$2256 : $319;
|
|
$$2 = $$0228;$$2234 = $$1233;$$2239 = $$1238;$$2251 = $14;$$5 = $$2256$;$$6268 = $$$4266;
|
|
} else {
|
|
$$2 = $14;$$2234 = $$1233;$$2239 = $$1238;$$2251 = $14;$$5 = 0;$$6268 = $$$4266;
|
|
}
|
|
}
|
|
$782 = $$2251;
|
|
$783 = $$2;
|
|
$784 = (($782) - ($783))|0;
|
|
$785 = ($$5|0)<($784|0);
|
|
$$$5 = $785 ? $784 : $$5;
|
|
$786 = (($$$5) + ($$2234))|0;
|
|
$787 = ($$1260|0)<($786|0);
|
|
$$2261 = $787 ? $786 : $$1260;
|
|
_pad($0,32,$$2261,$786,$$6268);
|
|
$788 = HEAP32[$0>>2]|0;
|
|
$789 = $788 & 32;
|
|
$790 = ($789|0)==(0);
|
|
if ($790) {
|
|
(___fwritex($$2239,$$2234,$0)|0);
|
|
}
|
|
$791 = $$6268 ^ 65536;
|
|
_pad($0,48,$$2261,$786,$791);
|
|
_pad($0,48,$$$5,$784,0);
|
|
$792 = HEAP32[$0>>2]|0;
|
|
$793 = $792 & 32;
|
|
$794 = ($793|0)==(0);
|
|
if ($794) {
|
|
(___fwritex($$2,$784,$0)|0);
|
|
}
|
|
$795 = $$6268 ^ 8192;
|
|
_pad($0,32,$$2261,$786,$795);
|
|
$$0243 = $$2261;$$0247 = $$1248;$$0269 = $$3272;$$0321 = $158;
|
|
}
|
|
L345: do {
|
|
if ((label|0) == 243) {
|
|
$796 = ($0|0)==(0|0);
|
|
if ($796) {
|
|
$797 = ($$0269|0)==(0);
|
|
if ($797) {
|
|
$$0 = 0;
|
|
} else {
|
|
$$2242381 = 1;
|
|
while(1) {
|
|
$798 = (($4) + ($$2242381<<2)|0);
|
|
$799 = HEAP32[$798>>2]|0;
|
|
$800 = ($799|0)==(0);
|
|
if ($800) {
|
|
$$3379 = $$2242381;
|
|
break;
|
|
}
|
|
$801 = (($3) + ($$2242381<<3)|0);
|
|
_pop_arg_24($801,$799,$2);
|
|
$802 = (($$2242381) + 1)|0;
|
|
$803 = ($802|0)<(10);
|
|
if ($803) {
|
|
$$2242381 = $802;
|
|
} else {
|
|
$$0 = 1;
|
|
break L345;
|
|
}
|
|
}
|
|
while(1) {
|
|
$806 = (($4) + ($$3379<<2)|0);
|
|
$807 = HEAP32[$806>>2]|0;
|
|
$808 = ($807|0)==(0);
|
|
$804 = (($$3379) + 1)|0;
|
|
if (!($808)) {
|
|
$$0 = -1;
|
|
break L345;
|
|
}
|
|
$805 = ($804|0)<(10);
|
|
if ($805) {
|
|
$$3379 = $804;
|
|
} else {
|
|
$$0 = 1;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
$$0 = $$1248;
|
|
}
|
|
}
|
|
} while(0);
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function ___fwritex($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0 = 0, $$032 = 0, $$033 = 0, $$034 = 0, $$1 = 0, $$pre = 0, $$pre38 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
|
|
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ((($2)) + 16|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ($4|0)==(0|0);
|
|
if ($5) {
|
|
$7 = (___towrite($2)|0);
|
|
$8 = ($7|0)==(0);
|
|
if ($8) {
|
|
$$pre = HEAP32[$3>>2]|0;
|
|
$12 = $$pre;
|
|
label = 5;
|
|
} else {
|
|
$$032 = 0;
|
|
}
|
|
} else {
|
|
$6 = $4;
|
|
$12 = $6;
|
|
label = 5;
|
|
}
|
|
L5: do {
|
|
if ((label|0) == 5) {
|
|
$9 = ((($2)) + 20|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = (($12) - ($10))|0;
|
|
$13 = ($11>>>0)<($1>>>0);
|
|
$14 = $10;
|
|
if ($13) {
|
|
$15 = ((($2)) + 36|0);
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = (FUNCTION_TABLE_iiii[$16 & 7]($2,$0,$1)|0);
|
|
$$032 = $17;
|
|
break;
|
|
}
|
|
$18 = ((($2)) + 75|0);
|
|
$19 = HEAP8[$18>>0]|0;
|
|
$20 = ($19<<24>>24)>(-1);
|
|
L10: do {
|
|
if ($20) {
|
|
$$0 = $1;
|
|
while(1) {
|
|
$21 = ($$0|0)==(0);
|
|
if ($21) {
|
|
$$033 = $1;$$034 = $0;$$1 = 0;$32 = $14;
|
|
break L10;
|
|
}
|
|
$22 = (($$0) + -1)|0;
|
|
$23 = (($0) + ($22)|0);
|
|
$24 = HEAP8[$23>>0]|0;
|
|
$25 = ($24<<24>>24)==(10);
|
|
if ($25) {
|
|
break;
|
|
} else {
|
|
$$0 = $22;
|
|
}
|
|
}
|
|
$26 = ((($2)) + 36|0);
|
|
$27 = HEAP32[$26>>2]|0;
|
|
$28 = (FUNCTION_TABLE_iiii[$27 & 7]($2,$0,$$0)|0);
|
|
$29 = ($28>>>0)<($$0>>>0);
|
|
if ($29) {
|
|
$$032 = $$0;
|
|
break L5;
|
|
}
|
|
$30 = (($0) + ($$0)|0);
|
|
$31 = (($1) - ($$0))|0;
|
|
$$pre38 = HEAP32[$9>>2]|0;
|
|
$$033 = $31;$$034 = $30;$$1 = $$0;$32 = $$pre38;
|
|
} else {
|
|
$$033 = $1;$$034 = $0;$$1 = 0;$32 = $14;
|
|
}
|
|
} while(0);
|
|
_memcpy(($32|0),($$034|0),($$033|0))|0;
|
|
$33 = HEAP32[$9>>2]|0;
|
|
$34 = (($33) + ($$033)|0);
|
|
HEAP32[$9>>2] = $34;
|
|
$35 = (($$1) + ($$033))|0;
|
|
$$032 = $35;
|
|
}
|
|
} while(0);
|
|
return ($$032|0);
|
|
}
|
|
function _pop_arg_24($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$mask = 0, $$mask31 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
|
|
var $116 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
|
|
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
|
|
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
|
|
var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
|
|
var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0;
|
|
var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0;
|
|
var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0;
|
|
var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0;
|
|
var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ($1>>>0)>(20);
|
|
L1: do {
|
|
if (!($3)) {
|
|
do {
|
|
switch ($1|0) {
|
|
case 9: {
|
|
$arglist_current = HEAP32[$2>>2]|0;
|
|
$4 = $arglist_current;
|
|
$5 = ((0) + 4|0);
|
|
$expanded28 = $5;
|
|
$expanded = (($expanded28) - 1)|0;
|
|
$6 = (($4) + ($expanded))|0;
|
|
$7 = ((0) + 4|0);
|
|
$expanded32 = $7;
|
|
$expanded31 = (($expanded32) - 1)|0;
|
|
$expanded30 = $expanded31 ^ -1;
|
|
$8 = $6 & $expanded30;
|
|
$9 = $8;
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$arglist_next = ((($9)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next;
|
|
HEAP32[$0>>2] = $10;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 10: {
|
|
$arglist_current2 = HEAP32[$2>>2]|0;
|
|
$11 = $arglist_current2;
|
|
$12 = ((0) + 4|0);
|
|
$expanded35 = $12;
|
|
$expanded34 = (($expanded35) - 1)|0;
|
|
$13 = (($11) + ($expanded34))|0;
|
|
$14 = ((0) + 4|0);
|
|
$expanded39 = $14;
|
|
$expanded38 = (($expanded39) - 1)|0;
|
|
$expanded37 = $expanded38 ^ -1;
|
|
$15 = $13 & $expanded37;
|
|
$16 = $15;
|
|
$17 = HEAP32[$16>>2]|0;
|
|
$arglist_next3 = ((($16)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next3;
|
|
$18 = ($17|0)<(0);
|
|
$19 = $18 << 31 >> 31;
|
|
$20 = $0;
|
|
$21 = $20;
|
|
HEAP32[$21>>2] = $17;
|
|
$22 = (($20) + 4)|0;
|
|
$23 = $22;
|
|
HEAP32[$23>>2] = $19;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 11: {
|
|
$arglist_current5 = HEAP32[$2>>2]|0;
|
|
$24 = $arglist_current5;
|
|
$25 = ((0) + 4|0);
|
|
$expanded42 = $25;
|
|
$expanded41 = (($expanded42) - 1)|0;
|
|
$26 = (($24) + ($expanded41))|0;
|
|
$27 = ((0) + 4|0);
|
|
$expanded46 = $27;
|
|
$expanded45 = (($expanded46) - 1)|0;
|
|
$expanded44 = $expanded45 ^ -1;
|
|
$28 = $26 & $expanded44;
|
|
$29 = $28;
|
|
$30 = HEAP32[$29>>2]|0;
|
|
$arglist_next6 = ((($29)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next6;
|
|
$31 = $0;
|
|
$32 = $31;
|
|
HEAP32[$32>>2] = $30;
|
|
$33 = (($31) + 4)|0;
|
|
$34 = $33;
|
|
HEAP32[$34>>2] = 0;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 12: {
|
|
$arglist_current8 = HEAP32[$2>>2]|0;
|
|
$35 = $arglist_current8;
|
|
$36 = ((0) + 8|0);
|
|
$expanded49 = $36;
|
|
$expanded48 = (($expanded49) - 1)|0;
|
|
$37 = (($35) + ($expanded48))|0;
|
|
$38 = ((0) + 8|0);
|
|
$expanded53 = $38;
|
|
$expanded52 = (($expanded53) - 1)|0;
|
|
$expanded51 = $expanded52 ^ -1;
|
|
$39 = $37 & $expanded51;
|
|
$40 = $39;
|
|
$41 = $40;
|
|
$42 = $41;
|
|
$43 = HEAP32[$42>>2]|0;
|
|
$44 = (($41) + 4)|0;
|
|
$45 = $44;
|
|
$46 = HEAP32[$45>>2]|0;
|
|
$arglist_next9 = ((($40)) + 8|0);
|
|
HEAP32[$2>>2] = $arglist_next9;
|
|
$47 = $0;
|
|
$48 = $47;
|
|
HEAP32[$48>>2] = $43;
|
|
$49 = (($47) + 4)|0;
|
|
$50 = $49;
|
|
HEAP32[$50>>2] = $46;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 13: {
|
|
$arglist_current11 = HEAP32[$2>>2]|0;
|
|
$51 = $arglist_current11;
|
|
$52 = ((0) + 4|0);
|
|
$expanded56 = $52;
|
|
$expanded55 = (($expanded56) - 1)|0;
|
|
$53 = (($51) + ($expanded55))|0;
|
|
$54 = ((0) + 4|0);
|
|
$expanded60 = $54;
|
|
$expanded59 = (($expanded60) - 1)|0;
|
|
$expanded58 = $expanded59 ^ -1;
|
|
$55 = $53 & $expanded58;
|
|
$56 = $55;
|
|
$57 = HEAP32[$56>>2]|0;
|
|
$arglist_next12 = ((($56)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next12;
|
|
$58 = $57&65535;
|
|
$59 = $58 << 16 >> 16;
|
|
$60 = ($59|0)<(0);
|
|
$61 = $60 << 31 >> 31;
|
|
$62 = $0;
|
|
$63 = $62;
|
|
HEAP32[$63>>2] = $59;
|
|
$64 = (($62) + 4)|0;
|
|
$65 = $64;
|
|
HEAP32[$65>>2] = $61;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 14: {
|
|
$arglist_current14 = HEAP32[$2>>2]|0;
|
|
$66 = $arglist_current14;
|
|
$67 = ((0) + 4|0);
|
|
$expanded63 = $67;
|
|
$expanded62 = (($expanded63) - 1)|0;
|
|
$68 = (($66) + ($expanded62))|0;
|
|
$69 = ((0) + 4|0);
|
|
$expanded67 = $69;
|
|
$expanded66 = (($expanded67) - 1)|0;
|
|
$expanded65 = $expanded66 ^ -1;
|
|
$70 = $68 & $expanded65;
|
|
$71 = $70;
|
|
$72 = HEAP32[$71>>2]|0;
|
|
$arglist_next15 = ((($71)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next15;
|
|
$$mask31 = $72 & 65535;
|
|
$73 = $0;
|
|
$74 = $73;
|
|
HEAP32[$74>>2] = $$mask31;
|
|
$75 = (($73) + 4)|0;
|
|
$76 = $75;
|
|
HEAP32[$76>>2] = 0;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 15: {
|
|
$arglist_current17 = HEAP32[$2>>2]|0;
|
|
$77 = $arglist_current17;
|
|
$78 = ((0) + 4|0);
|
|
$expanded70 = $78;
|
|
$expanded69 = (($expanded70) - 1)|0;
|
|
$79 = (($77) + ($expanded69))|0;
|
|
$80 = ((0) + 4|0);
|
|
$expanded74 = $80;
|
|
$expanded73 = (($expanded74) - 1)|0;
|
|
$expanded72 = $expanded73 ^ -1;
|
|
$81 = $79 & $expanded72;
|
|
$82 = $81;
|
|
$83 = HEAP32[$82>>2]|0;
|
|
$arglist_next18 = ((($82)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next18;
|
|
$84 = $83&255;
|
|
$85 = $84 << 24 >> 24;
|
|
$86 = ($85|0)<(0);
|
|
$87 = $86 << 31 >> 31;
|
|
$88 = $0;
|
|
$89 = $88;
|
|
HEAP32[$89>>2] = $85;
|
|
$90 = (($88) + 4)|0;
|
|
$91 = $90;
|
|
HEAP32[$91>>2] = $87;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 16: {
|
|
$arglist_current20 = HEAP32[$2>>2]|0;
|
|
$92 = $arglist_current20;
|
|
$93 = ((0) + 4|0);
|
|
$expanded77 = $93;
|
|
$expanded76 = (($expanded77) - 1)|0;
|
|
$94 = (($92) + ($expanded76))|0;
|
|
$95 = ((0) + 4|0);
|
|
$expanded81 = $95;
|
|
$expanded80 = (($expanded81) - 1)|0;
|
|
$expanded79 = $expanded80 ^ -1;
|
|
$96 = $94 & $expanded79;
|
|
$97 = $96;
|
|
$98 = HEAP32[$97>>2]|0;
|
|
$arglist_next21 = ((($97)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next21;
|
|
$$mask = $98 & 255;
|
|
$99 = $0;
|
|
$100 = $99;
|
|
HEAP32[$100>>2] = $$mask;
|
|
$101 = (($99) + 4)|0;
|
|
$102 = $101;
|
|
HEAP32[$102>>2] = 0;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 17: {
|
|
$arglist_current23 = HEAP32[$2>>2]|0;
|
|
$103 = $arglist_current23;
|
|
$104 = ((0) + 8|0);
|
|
$expanded84 = $104;
|
|
$expanded83 = (($expanded84) - 1)|0;
|
|
$105 = (($103) + ($expanded83))|0;
|
|
$106 = ((0) + 8|0);
|
|
$expanded88 = $106;
|
|
$expanded87 = (($expanded88) - 1)|0;
|
|
$expanded86 = $expanded87 ^ -1;
|
|
$107 = $105 & $expanded86;
|
|
$108 = $107;
|
|
$109 = +HEAPF64[$108>>3];
|
|
$arglist_next24 = ((($108)) + 8|0);
|
|
HEAP32[$2>>2] = $arglist_next24;
|
|
HEAPF64[$0>>3] = $109;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 18: {
|
|
$arglist_current26 = HEAP32[$2>>2]|0;
|
|
$110 = $arglist_current26;
|
|
$111 = ((0) + 8|0);
|
|
$expanded91 = $111;
|
|
$expanded90 = (($expanded91) - 1)|0;
|
|
$112 = (($110) + ($expanded90))|0;
|
|
$113 = ((0) + 8|0);
|
|
$expanded95 = $113;
|
|
$expanded94 = (($expanded95) - 1)|0;
|
|
$expanded93 = $expanded94 ^ -1;
|
|
$114 = $112 & $expanded93;
|
|
$115 = $114;
|
|
$116 = +HEAPF64[$115>>3];
|
|
$arglist_next27 = ((($115)) + 8|0);
|
|
HEAP32[$2>>2] = $arglist_next27;
|
|
HEAPF64[$0>>3] = $116;
|
|
break L1;
|
|
break;
|
|
}
|
|
default: {
|
|
break L1;
|
|
}
|
|
}
|
|
} while(0);
|
|
}
|
|
} while(0);
|
|
return;
|
|
}
|
|
function _fmt_u($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$010$lcssa$off0 = 0, $$012 = 0, $$09$lcssa = 0, $$0914 = 0, $$1$lcssa = 0, $$111 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ($1>>>0)>(0);
|
|
$4 = ($0>>>0)>(4294967295);
|
|
$5 = ($1|0)==(0);
|
|
$6 = $5 & $4;
|
|
$7 = $3 | $6;
|
|
if ($7) {
|
|
$$0914 = $2;$8 = $0;$9 = $1;
|
|
while(1) {
|
|
$10 = (___uremdi3(($8|0),($9|0),10,0)|0);
|
|
$11 = tempRet0;
|
|
$12 = $10 | 48;
|
|
$13 = $12&255;
|
|
$14 = ((($$0914)) + -1|0);
|
|
HEAP8[$14>>0] = $13;
|
|
$15 = (___udivdi3(($8|0),($9|0),10,0)|0);
|
|
$16 = tempRet0;
|
|
$17 = ($9>>>0)>(9);
|
|
$18 = ($8>>>0)>(4294967295);
|
|
$19 = ($9|0)==(9);
|
|
$20 = $19 & $18;
|
|
$21 = $17 | $20;
|
|
if ($21) {
|
|
$$0914 = $14;$8 = $15;$9 = $16;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$$010$lcssa$off0 = $15;$$09$lcssa = $14;
|
|
} else {
|
|
$$010$lcssa$off0 = $0;$$09$lcssa = $2;
|
|
}
|
|
$22 = ($$010$lcssa$off0|0)==(0);
|
|
if ($22) {
|
|
$$1$lcssa = $$09$lcssa;
|
|
} else {
|
|
$$012 = $$010$lcssa$off0;$$111 = $$09$lcssa;
|
|
while(1) {
|
|
$23 = (($$012>>>0) % 10)&-1;
|
|
$24 = $23 | 48;
|
|
$25 = $24&255;
|
|
$26 = ((($$111)) + -1|0);
|
|
HEAP8[$26>>0] = $25;
|
|
$27 = (($$012>>>0) / 10)&-1;
|
|
$28 = ($$012>>>0)<(10);
|
|
if ($28) {
|
|
$$1$lcssa = $26;
|
|
break;
|
|
} else {
|
|
$$012 = $27;$$111 = $26;
|
|
}
|
|
}
|
|
}
|
|
return ($$1$lcssa|0);
|
|
}
|
|
function _pad($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $$0$lcssa16 = 0, $$012 = 0, $$pre = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $5 = 0, $6 = 0;
|
|
var $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 256|0;
|
|
$5 = sp;
|
|
$6 = $4 & 73728;
|
|
$7 = ($6|0)==(0);
|
|
$8 = ($2|0)>($3|0);
|
|
$or$cond = $8 & $7;
|
|
do {
|
|
if ($or$cond) {
|
|
$9 = (($2) - ($3))|0;
|
|
$10 = ($9>>>0)>(256);
|
|
$11 = $10 ? 256 : $9;
|
|
_memset(($5|0),($1|0),($11|0))|0;
|
|
$12 = ($9>>>0)>(255);
|
|
$13 = HEAP32[$0>>2]|0;
|
|
$14 = $13 & 32;
|
|
$15 = ($14|0)==(0);
|
|
if ($12) {
|
|
$16 = (($2) - ($3))|0;
|
|
$$012 = $9;$23 = $13;$24 = $15;
|
|
while(1) {
|
|
if ($24) {
|
|
(___fwritex($5,256,$0)|0);
|
|
$$pre = HEAP32[$0>>2]|0;
|
|
$20 = $$pre;
|
|
} else {
|
|
$20 = $23;
|
|
}
|
|
$17 = (($$012) + -256)|0;
|
|
$18 = ($17>>>0)>(255);
|
|
$19 = $20 & 32;
|
|
$21 = ($19|0)==(0);
|
|
if ($18) {
|
|
$$012 = $17;$23 = $20;$24 = $21;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$22 = $16 & 255;
|
|
if ($21) {
|
|
$$0$lcssa16 = $22;
|
|
} else {
|
|
break;
|
|
}
|
|
} else {
|
|
if ($15) {
|
|
$$0$lcssa16 = $9;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
(___fwritex($5,$$0$lcssa16,$0)|0);
|
|
}
|
|
} while(0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _frexpl($0,$1) {
|
|
$0 = +$0;
|
|
$1 = $1|0;
|
|
var $2 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = (+_frexp($0,$1));
|
|
return (+$2);
|
|
}
|
|
function _frexp($0,$1) {
|
|
$0 = +$0;
|
|
$1 = $1|0;
|
|
var $$0 = 0.0, $$016 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, $storemerge = 0, $trunc$clear = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
|
|
$3 = HEAP32[tempDoublePtr+4>>2]|0;
|
|
$4 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
|
|
$5 = tempRet0;
|
|
$6 = $4&65535;
|
|
$trunc$clear = $6 & 2047;
|
|
switch ($trunc$clear<<16>>16) {
|
|
case 0: {
|
|
$7 = $0 != 0.0;
|
|
if ($7) {
|
|
$8 = $0 * 1.8446744073709552E+19;
|
|
$9 = (+_frexp($8,$1));
|
|
$10 = HEAP32[$1>>2]|0;
|
|
$11 = (($10) + -64)|0;
|
|
$$016 = $9;$storemerge = $11;
|
|
} else {
|
|
$$016 = $0;$storemerge = 0;
|
|
}
|
|
HEAP32[$1>>2] = $storemerge;
|
|
$$0 = $$016;
|
|
break;
|
|
}
|
|
case 2047: {
|
|
$$0 = $0;
|
|
break;
|
|
}
|
|
default: {
|
|
$12 = $4 & 2047;
|
|
$13 = (($12) + -1022)|0;
|
|
HEAP32[$1>>2] = $13;
|
|
$14 = $3 & -2146435073;
|
|
$15 = $14 | 1071644672;
|
|
HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $15;$16 = +HEAPF64[tempDoublePtr>>3];
|
|
$$0 = $16;
|
|
}
|
|
}
|
|
return (+$$0);
|
|
}
|
|
function ___towrite($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
|
|
var $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 74|0);
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = $2 << 24 >> 24;
|
|
$4 = (($3) + 255)|0;
|
|
$5 = $4 | $3;
|
|
$6 = $5&255;
|
|
HEAP8[$1>>0] = $6;
|
|
$7 = HEAP32[$0>>2]|0;
|
|
$8 = $7 & 8;
|
|
$9 = ($8|0)==(0);
|
|
if ($9) {
|
|
$11 = ((($0)) + 8|0);
|
|
HEAP32[$11>>2] = 0;
|
|
$12 = ((($0)) + 4|0);
|
|
HEAP32[$12>>2] = 0;
|
|
$13 = ((($0)) + 44|0);
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = ((($0)) + 28|0);
|
|
HEAP32[$15>>2] = $14;
|
|
$16 = ((($0)) + 20|0);
|
|
HEAP32[$16>>2] = $14;
|
|
$17 = $14;
|
|
$18 = ((($0)) + 48|0);
|
|
$19 = HEAP32[$18>>2]|0;
|
|
$20 = (($17) + ($19)|0);
|
|
$21 = ((($0)) + 16|0);
|
|
HEAP32[$21>>2] = $20;
|
|
$$0 = 0;
|
|
} else {
|
|
$10 = $7 | 32;
|
|
HEAP32[$0>>2] = $10;
|
|
$$0 = -1;
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function _sn_write($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$ = 0, $$cast = 0, $10 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ((($0)) + 16|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ((($0)) + 20|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = (($4) - ($6))|0;
|
|
$8 = ($7>>>0)>($2>>>0);
|
|
$$ = $8 ? $2 : $7;
|
|
$$cast = $6;
|
|
_memcpy(($$cast|0),($1|0),($$|0))|0;
|
|
$9 = HEAP32[$5>>2]|0;
|
|
$10 = (($9) + ($$)|0);
|
|
HEAP32[$5>>2] = $10;
|
|
return ($2|0);
|
|
}
|
|
function _printf($0,$varargs) {
|
|
$0 = $0|0;
|
|
$varargs = $varargs|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp;
|
|
HEAP32[$1>>2] = $varargs;
|
|
$2 = HEAP32[38]|0;
|
|
$3 = (_vfprintf($2,$0,$1)|0);
|
|
STACKTOP = sp;return ($3|0);
|
|
}
|
|
function _fopen($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = $2 << 24 >> 24;
|
|
$memchr = (_memchr(7263,$3,4)|0);
|
|
$4 = ($memchr|0)==(0|0);
|
|
if ($4) {
|
|
$5 = (___errno_location()|0);
|
|
HEAP32[$5>>2] = 22;
|
|
$$0 = 0;
|
|
} else {
|
|
$6 = (___fmodeflags($1)|0);
|
|
$7 = $6 | 32768;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $7;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = 438;
|
|
$8 = (___syscall5(5,($vararg_buffer|0))|0);
|
|
$9 = (___syscall_ret($8)|0);
|
|
$10 = ($9|0)<(0);
|
|
if ($10) {
|
|
$$0 = 0;
|
|
} else {
|
|
$11 = (___fdopen($9,$1)|0);
|
|
$12 = ($11|0)==(0|0);
|
|
if ($12) {
|
|
HEAP32[$vararg_buffer3>>2] = $9;
|
|
(___syscall6(6,($vararg_buffer3|0))|0);
|
|
$$0 = 0;
|
|
} else {
|
|
$$0 = $11;
|
|
}
|
|
}
|
|
}
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function ___fmodeflags($0) {
|
|
$0 = $0|0;
|
|
var $$ = 0, $$$4 = 0, $$0 = 0, $$0$ = 0, $$2 = 0, $$2$ = 0, $$4 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
|
|
var $8 = 0, $9 = 0, $not$ = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (_strchr($0,43)|0);
|
|
$2 = ($1|0)==(0|0);
|
|
$3 = HEAP8[$0>>0]|0;
|
|
$not$ = ($3<<24>>24)!=(114);
|
|
$$ = $not$&1;
|
|
$$0 = $2 ? $$ : 2;
|
|
$4 = (_strchr($0,120)|0);
|
|
$5 = ($4|0)==(0|0);
|
|
$6 = $$0 | 128;
|
|
$$0$ = $5 ? $$0 : $6;
|
|
$7 = (_strchr($0,101)|0);
|
|
$8 = ($7|0)==(0|0);
|
|
$9 = $$0$ | 524288;
|
|
$$2 = $8 ? $$0$ : $9;
|
|
$10 = ($3<<24>>24)==(114);
|
|
$11 = $$2 | 64;
|
|
$$2$ = $10 ? $$2 : $11;
|
|
$12 = ($3<<24>>24)==(119);
|
|
$13 = $$2$ | 512;
|
|
$$4 = $12 ? $13 : $$2$;
|
|
$14 = ($3<<24>>24)==(97);
|
|
$15 = $$4 | 1024;
|
|
$$$4 = $14 ? $15 : $$4;
|
|
return ($$$4|0);
|
|
}
|
|
function ___overflow($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $$pre = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0;
|
|
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp;
|
|
$3 = $1&255;
|
|
HEAP8[$2>>0] = $3;
|
|
$4 = ((($0)) + 16|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = ($5|0)==(0|0);
|
|
if ($6) {
|
|
$7 = (___towrite($0)|0);
|
|
$8 = ($7|0)==(0);
|
|
if ($8) {
|
|
$$pre = HEAP32[$4>>2]|0;
|
|
$12 = $$pre;
|
|
label = 4;
|
|
} else {
|
|
$$0 = -1;
|
|
}
|
|
} else {
|
|
$12 = $5;
|
|
label = 4;
|
|
}
|
|
do {
|
|
if ((label|0) == 4) {
|
|
$9 = ((($0)) + 20|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = ($10>>>0)<($12>>>0);
|
|
if ($11) {
|
|
$13 = $1 & 255;
|
|
$14 = ((($0)) + 75|0);
|
|
$15 = HEAP8[$14>>0]|0;
|
|
$16 = $15 << 24 >> 24;
|
|
$17 = ($13|0)==($16|0);
|
|
if (!($17)) {
|
|
$18 = ((($10)) + 1|0);
|
|
HEAP32[$9>>2] = $18;
|
|
HEAP8[$10>>0] = $3;
|
|
$$0 = $13;
|
|
break;
|
|
}
|
|
}
|
|
$19 = ((($0)) + 36|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = (FUNCTION_TABLE_iiii[$20 & 7]($0,$2,1)|0);
|
|
$22 = ($21|0)==(1);
|
|
if ($22) {
|
|
$23 = HEAP8[$2>>0]|0;
|
|
$24 = $23&255;
|
|
$$0 = $24;
|
|
} else {
|
|
$$0 = -1;
|
|
}
|
|
}
|
|
} while(0);
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function _fprintf($0,$1,$varargs) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$varargs = $varargs|0;
|
|
var $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp;
|
|
HEAP32[$2>>2] = $varargs;
|
|
$3 = (_vfprintf($0,$1,$2)|0);
|
|
STACKTOP = sp;return ($3|0);
|
|
}
|
|
function _fgets($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0 = 0, $$06266 = 0, $$063 = 0, $$064 = 0, $$1 = 0, $$old2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
|
|
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0;
|
|
var $or$cond3 = 0, $sext$mask = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ((($2)) + 76|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ($4|0)>(-1);
|
|
if ($5) {
|
|
$6 = (___lockfile($2)|0);
|
|
$15 = $6;
|
|
} else {
|
|
$15 = 0;
|
|
}
|
|
$7 = (($1) + -1)|0;
|
|
$8 = ($1|0)<(2);
|
|
if ($8) {
|
|
$9 = ((($2)) + 74|0);
|
|
$10 = HEAP8[$9>>0]|0;
|
|
$11 = $10 << 24 >> 24;
|
|
$12 = (($11) + 255)|0;
|
|
$13 = $12 | $11;
|
|
$14 = $13&255;
|
|
HEAP8[$9>>0] = $14;
|
|
$16 = ($15|0)==(0);
|
|
if (!($16)) {
|
|
___unlockfile($2);
|
|
}
|
|
$17 = ($7|0)==(0);
|
|
if ($17) {
|
|
HEAP8[$0>>0] = 0;
|
|
$$0 = $0;
|
|
} else {
|
|
$$0 = 0;
|
|
}
|
|
} else {
|
|
$$old2 = ($7|0)==(0);
|
|
L11: do {
|
|
if ($$old2) {
|
|
$$1 = $0;
|
|
label = 17;
|
|
} else {
|
|
$18 = ((($2)) + 4|0);
|
|
$19 = ((($2)) + 8|0);
|
|
$$063 = $7;$$064 = $0;
|
|
while(1) {
|
|
$20 = HEAP32[$18>>2]|0;
|
|
$21 = HEAP32[$19>>2]|0;
|
|
$22 = $20;
|
|
$23 = (($21) - ($22))|0;
|
|
$24 = (_memchr($20,10,$23)|0);
|
|
$25 = ($24|0)==(0|0);
|
|
$26 = $24;
|
|
$27 = (1 - ($22))|0;
|
|
$28 = (($27) + ($26))|0;
|
|
$29 = $25 ? $23 : $28;
|
|
$30 = ($29>>>0)<($$063>>>0);
|
|
$31 = $30 ? $29 : $$063;
|
|
_memcpy(($$064|0),($20|0),($31|0))|0;
|
|
$32 = HEAP32[$18>>2]|0;
|
|
$33 = (($32) + ($31)|0);
|
|
HEAP32[$18>>2] = $33;
|
|
$34 = (($$064) + ($31)|0);
|
|
$35 = (($$063) - ($31))|0;
|
|
$36 = ($35|0)!=(0);
|
|
$or$cond = $25 & $36;
|
|
if (!($or$cond)) {
|
|
$$1 = $34;
|
|
label = 17;
|
|
break L11;
|
|
}
|
|
$37 = HEAP32[$19>>2]|0;
|
|
$38 = ($33>>>0)<($37>>>0);
|
|
if ($38) {
|
|
$39 = ((($33)) + 1|0);
|
|
HEAP32[$18>>2] = $39;
|
|
$40 = HEAP8[$33>>0]|0;
|
|
$41 = $40&255;
|
|
$50 = $41;
|
|
} else {
|
|
$42 = (___uflow($2)|0);
|
|
$43 = ($42|0)<(0);
|
|
if ($43) {
|
|
break;
|
|
} else {
|
|
$50 = $42;
|
|
}
|
|
}
|
|
$48 = (($35) + -1)|0;
|
|
$49 = $50&255;
|
|
$51 = ((($34)) + 1|0);
|
|
HEAP8[$34>>0] = $49;
|
|
$sext$mask = $50 & 255;
|
|
$52 = ($sext$mask|0)!=(10);
|
|
$53 = ($48|0)!=(0);
|
|
$or$cond3 = $53 & $52;
|
|
if ($or$cond3) {
|
|
$$063 = $48;$$064 = $51;
|
|
} else {
|
|
$$1 = $51;
|
|
label = 17;
|
|
break L11;
|
|
}
|
|
}
|
|
$44 = ($34|0)==($0|0);
|
|
if ($44) {
|
|
$$06266 = 0;
|
|
} else {
|
|
$45 = HEAP32[$2>>2]|0;
|
|
$46 = $45 & 16;
|
|
$47 = ($46|0)==(0);
|
|
if ($47) {
|
|
$$06266 = 0;
|
|
} else {
|
|
$$1 = $34;
|
|
label = 17;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 17) {
|
|
$54 = ($0|0)==(0|0);
|
|
if ($54) {
|
|
$$06266 = 0;
|
|
} else {
|
|
HEAP8[$$1>>0] = 0;
|
|
$$06266 = $0;
|
|
}
|
|
}
|
|
$55 = ($15|0)==(0);
|
|
if ($55) {
|
|
$$0 = $$06266;
|
|
} else {
|
|
___unlockfile($2);
|
|
$$0 = $$06266;
|
|
}
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function _fwrite($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$4 = Math_imul($2, $1)|0;
|
|
$5 = ((($3)) + 76|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = ($6|0)>(-1);
|
|
if ($7) {
|
|
$9 = (___lockfile($3)|0);
|
|
$phitmp = ($9|0)==(0);
|
|
$10 = (___fwritex($0,$4,$3)|0);
|
|
if ($phitmp) {
|
|
$11 = $10;
|
|
} else {
|
|
___unlockfile($3);
|
|
$11 = $10;
|
|
}
|
|
} else {
|
|
$8 = (___fwritex($0,$4,$3)|0);
|
|
$11 = $8;
|
|
}
|
|
$12 = ($11|0)==($4|0);
|
|
if ($12) {
|
|
$14 = $2;
|
|
} else {
|
|
$13 = (($11>>>0) / ($1>>>0))&-1;
|
|
$14 = $13;
|
|
}
|
|
return ($14|0);
|
|
}
|
|
function _sprintf($0,$1,$varargs) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$varargs = $varargs|0;
|
|
var $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$2 = sp;
|
|
HEAP32[$2>>2] = $varargs;
|
|
$3 = (_vsprintf($0,$1,$2)|0);
|
|
STACKTOP = sp;return ($3|0);
|
|
}
|
|
function _vsprintf($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = (_vsnprintf($0,2147483647,$1,$2)|0);
|
|
return ($3|0);
|
|
}
|
|
function _putc($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ((($1)) + 76|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = ($3|0)<(0);
|
|
if ($4) {
|
|
label = 3;
|
|
} else {
|
|
$5 = (___lockfile($1)|0);
|
|
$6 = ($5|0)==(0);
|
|
if ($6) {
|
|
label = 3;
|
|
} else {
|
|
$20 = ((($1)) + 75|0);
|
|
$21 = HEAP8[$20>>0]|0;
|
|
$22 = $21 << 24 >> 24;
|
|
$23 = ($22|0)==($0|0);
|
|
if ($23) {
|
|
label = 10;
|
|
} else {
|
|
$24 = ((($1)) + 20|0);
|
|
$25 = HEAP32[$24>>2]|0;
|
|
$26 = ((($1)) + 16|0);
|
|
$27 = HEAP32[$26>>2]|0;
|
|
$28 = ($25>>>0)<($27>>>0);
|
|
if ($28) {
|
|
$29 = $0&255;
|
|
$30 = ((($25)) + 1|0);
|
|
HEAP32[$24>>2] = $30;
|
|
HEAP8[$25>>0] = $29;
|
|
$31 = $0 & 255;
|
|
$33 = $31;
|
|
} else {
|
|
label = 10;
|
|
}
|
|
}
|
|
if ((label|0) == 10) {
|
|
$32 = (___overflow($1,$0)|0);
|
|
$33 = $32;
|
|
}
|
|
___unlockfile($1);
|
|
$$0 = $33;
|
|
}
|
|
}
|
|
do {
|
|
if ((label|0) == 3) {
|
|
$7 = ((($1)) + 75|0);
|
|
$8 = HEAP8[$7>>0]|0;
|
|
$9 = $8 << 24 >> 24;
|
|
$10 = ($9|0)==($0|0);
|
|
if (!($10)) {
|
|
$11 = ((($1)) + 20|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
$13 = ((($1)) + 16|0);
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = ($12>>>0)<($14>>>0);
|
|
if ($15) {
|
|
$16 = $0&255;
|
|
$17 = ((($12)) + 1|0);
|
|
HEAP32[$11>>2] = $17;
|
|
HEAP8[$12>>0] = $16;
|
|
$18 = $0 & 255;
|
|
$$0 = $18;
|
|
break;
|
|
}
|
|
}
|
|
$19 = (___overflow($1,$0)|0);
|
|
$$0 = $19;
|
|
}
|
|
} while(0);
|
|
return ($$0|0);
|
|
}
|
|
function _strncpy($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
(___stpncpy($0,$1,$2)|0);
|
|
return ($0|0);
|
|
}
|
|
function ___stpncpy($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0$lcssa = 0, $$037$lcssa = 0, $$03753 = 0, $$038$lcssa = 0, $$038$lcssa79 = 0, $$03866 = 0, $$039$lcssa = 0, $$039$lcssa78 = 0, $$03965 = 0, $$041$lcssa = 0, $$041$lcssa77 = 0, $$04164 = 0, $$054 = 0, $$1$lcssa = 0, $$140$ph = 0, $$14046 = 0, $$142$ph = 0, $$14245 = 0, $$152 = 0, $$2$ph = 0;
|
|
var $$243 = 0, $$247 = 0, $$3 = 0, $$lcssa = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, $or$cond = 0, $or$cond63 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $1;
|
|
$4 = $0;
|
|
$5 = $3 ^ $4;
|
|
$6 = $5 & 3;
|
|
$7 = ($6|0)==(0);
|
|
do {
|
|
if ($7) {
|
|
$8 = $3 & 3;
|
|
$9 = ($8|0)!=(0);
|
|
$10 = ($2|0)!=(0);
|
|
$or$cond63 = $10 & $9;
|
|
L3: do {
|
|
if ($or$cond63) {
|
|
$$03866 = $2;$$03965 = $1;$$04164 = $0;
|
|
while(1) {
|
|
$11 = HEAP8[$$03965>>0]|0;
|
|
HEAP8[$$04164>>0] = $11;
|
|
$12 = ($11<<24>>24)==(0);
|
|
if ($12) {
|
|
$$038$lcssa79 = $$03866;$$039$lcssa78 = $$03965;$$041$lcssa77 = $$04164;
|
|
break L3;
|
|
}
|
|
$13 = (($$03866) + -1)|0;
|
|
$14 = ((($$03965)) + 1|0);
|
|
$15 = ((($$04164)) + 1|0);
|
|
$16 = $14;
|
|
$17 = $16 & 3;
|
|
$18 = ($17|0)!=(0);
|
|
$19 = ($13|0)!=(0);
|
|
$or$cond = $19 & $18;
|
|
if ($or$cond) {
|
|
$$03866 = $13;$$03965 = $14;$$04164 = $15;
|
|
} else {
|
|
$$038$lcssa = $13;$$039$lcssa = $14;$$041$lcssa = $15;$$lcssa = $19;
|
|
label = 5;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$038$lcssa = $2;$$039$lcssa = $1;$$041$lcssa = $0;$$lcssa = $10;
|
|
label = 5;
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 5) {
|
|
if ($$lcssa) {
|
|
$$038$lcssa79 = $$038$lcssa;$$039$lcssa78 = $$039$lcssa;$$041$lcssa77 = $$041$lcssa;
|
|
} else {
|
|
$$243 = $$041$lcssa;$$3 = 0;
|
|
break;
|
|
}
|
|
}
|
|
$20 = HEAP8[$$039$lcssa78>>0]|0;
|
|
$21 = ($20<<24>>24)==(0);
|
|
if ($21) {
|
|
$$243 = $$041$lcssa77;$$3 = $$038$lcssa79;
|
|
} else {
|
|
$22 = ($$038$lcssa79>>>0)>(3);
|
|
L11: do {
|
|
if ($22) {
|
|
$$03753 = $$041$lcssa77;$$054 = $$039$lcssa78;$$152 = $$038$lcssa79;
|
|
while(1) {
|
|
$23 = HEAP32[$$054>>2]|0;
|
|
$24 = (($23) + -16843009)|0;
|
|
$25 = $23 & -2139062144;
|
|
$26 = $25 ^ -2139062144;
|
|
$27 = $26 & $24;
|
|
$28 = ($27|0)==(0);
|
|
if (!($28)) {
|
|
$$0$lcssa = $$054;$$037$lcssa = $$03753;$$1$lcssa = $$152;
|
|
break L11;
|
|
}
|
|
HEAP32[$$03753>>2] = $23;
|
|
$29 = (($$152) + -4)|0;
|
|
$30 = ((($$054)) + 4|0);
|
|
$31 = ((($$03753)) + 4|0);
|
|
$32 = ($29>>>0)>(3);
|
|
if ($32) {
|
|
$$03753 = $31;$$054 = $30;$$152 = $29;
|
|
} else {
|
|
$$0$lcssa = $30;$$037$lcssa = $31;$$1$lcssa = $29;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$0$lcssa = $$039$lcssa78;$$037$lcssa = $$041$lcssa77;$$1$lcssa = $$038$lcssa79;
|
|
}
|
|
} while(0);
|
|
$$140$ph = $$0$lcssa;$$142$ph = $$037$lcssa;$$2$ph = $$1$lcssa;
|
|
label = 11;
|
|
}
|
|
} else {
|
|
$$140$ph = $1;$$142$ph = $0;$$2$ph = $2;
|
|
label = 11;
|
|
}
|
|
} while(0);
|
|
L16: do {
|
|
if ((label|0) == 11) {
|
|
$33 = ($$2$ph|0)==(0);
|
|
if ($33) {
|
|
$$243 = $$142$ph;$$3 = 0;
|
|
} else {
|
|
$$14046 = $$140$ph;$$14245 = $$142$ph;$$247 = $$2$ph;
|
|
while(1) {
|
|
$34 = HEAP8[$$14046>>0]|0;
|
|
HEAP8[$$14245>>0] = $34;
|
|
$35 = ($34<<24>>24)==(0);
|
|
if ($35) {
|
|
$$243 = $$14245;$$3 = $$247;
|
|
break L16;
|
|
}
|
|
$36 = (($$247) + -1)|0;
|
|
$37 = ((($$14046)) + 1|0);
|
|
$38 = ((($$14245)) + 1|0);
|
|
$39 = ($36|0)==(0);
|
|
if ($39) {
|
|
$$243 = $38;$$3 = 0;
|
|
break;
|
|
} else {
|
|
$$14046 = $37;$$14245 = $38;$$247 = $36;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
_memset(($$243|0),0,($$3|0))|0;
|
|
return ($$243|0);
|
|
}
|
|
function _toupper($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (_islower($0)|0);
|
|
$2 = ($1|0)==(0);
|
|
$3 = $0 & 95;
|
|
$$0 = $2 ? $0 : $3;
|
|
return ($$0|0);
|
|
}
|
|
function _islower($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (($0) + -97)|0;
|
|
$2 = ($1>>>0)<(26);
|
|
$3 = $2&1;
|
|
return ($3|0);
|
|
}
|
|
function _malloc($0) {
|
|
$0 = $0|0;
|
|
var $$$0190$i = 0, $$$0191$i = 0, $$$4349$i = 0, $$$i = 0, $$0 = 0, $$0$i$i = 0, $$0$i$i$i = 0, $$0$i17$i = 0, $$0$i18$i = 0, $$01$i$i = 0, $$0187$i = 0, $$0189$i = 0, $$0190$i = 0, $$0191$i = 0, $$0197 = 0, $$0199 = 0, $$0206$i$i = 0, $$0207$i$i = 0, $$0211$i$i = 0, $$0212$i$i = 0;
|
|
var $$024370$i = 0, $$0286$i$i = 0, $$0287$i$i = 0, $$0288$i$i = 0, $$0294$i$i = 0, $$0295$i$i = 0, $$0340$i = 0, $$0342$i = 0, $$0343$i = 0, $$0345$i = 0, $$0351$i = 0, $$0356$i = 0, $$0357$$i = 0, $$0357$i = 0, $$0359$i = 0, $$0360$i = 0, $$0366$i = 0, $$1194$i = 0, $$1196$i = 0, $$124469$i = 0;
|
|
var $$1290$i$i = 0, $$1292$i$i = 0, $$1341$i = 0, $$1346$i = 0, $$1361$i = 0, $$1368$i = 0, $$1372$i = 0, $$2247$ph$i = 0, $$2253$ph$i = 0, $$2353$i = 0, $$3$i = 0, $$3$i$i = 0, $$3$i201 = 0, $$3348$i = 0, $$3370$i = 0, $$4$lcssa$i = 0, $$413$i = 0, $$4349$lcssa$i = 0, $$434912$i = 0, $$4355$$4$i = 0;
|
|
var $$4355$ph$i = 0, $$435511$i = 0, $$5256$i = 0, $$723947$i = 0, $$748$i = 0, $$not$i = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i19$i = 0, $$pre$i205 = 0, $$pre$i208 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i20$iZ2D = 0, $$pre$phi$i206Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi10$i$iZ2D = 0, $$pre$phiZ2D = 0, $$pre9$i$i = 0, $1 = 0;
|
|
var $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0, $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0;
|
|
var $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0, $1028 = 0, $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0;
|
|
var $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0, $1046 = 0, $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0;
|
|
var $1053 = 0, $1054 = 0, $1055 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0;
|
|
var $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0;
|
|
var $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0;
|
|
var $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0;
|
|
var $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0;
|
|
var $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0;
|
|
var $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0;
|
|
var $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0;
|
|
var $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0;
|
|
var $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0;
|
|
var $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0;
|
|
var $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0;
|
|
var $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0;
|
|
var $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0;
|
|
var $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0;
|
|
var $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0;
|
|
var $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0;
|
|
var $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0;
|
|
var $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0;
|
|
var $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0;
|
|
var $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0;
|
|
var $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0;
|
|
var $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0;
|
|
var $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0;
|
|
var $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0;
|
|
var $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0;
|
|
var $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0;
|
|
var $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0;
|
|
var $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0;
|
|
var $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0;
|
|
var $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0;
|
|
var $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0;
|
|
var $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0;
|
|
var $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0;
|
|
var $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0;
|
|
var $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0;
|
|
var $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0;
|
|
var $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0;
|
|
var $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0;
|
|
var $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0;
|
|
var $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0;
|
|
var $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0;
|
|
var $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0;
|
|
var $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0;
|
|
var $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0;
|
|
var $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0;
|
|
var $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0;
|
|
var $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $967 = 0, $968 = 0;
|
|
var $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0, $985 = 0, $986 = 0;
|
|
var $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $cond$i = 0, $cond$i$i = 0, $cond$i204 = 0, $exitcond$i$i = 0, $not$$i$i = 0, $not$$i22$i = 0;
|
|
var $not$7$i = 0, $or$cond$i = 0, $or$cond$i211 = 0, $or$cond1$i = 0, $or$cond1$i210 = 0, $or$cond10$i = 0, $or$cond11$i = 0, $or$cond12$i = 0, $or$cond2$i = 0, $or$cond5$i = 0, $or$cond50$i = 0, $or$cond7$i = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0;
|
|
$1 = sp;
|
|
$2 = ($0>>>0)<(245);
|
|
do {
|
|
if ($2) {
|
|
$3 = ($0>>>0)<(11);
|
|
$4 = (($0) + 11)|0;
|
|
$5 = $4 & -8;
|
|
$6 = $3 ? 16 : $5;
|
|
$7 = $6 >>> 3;
|
|
$8 = HEAP32[9341]|0;
|
|
$9 = $8 >>> $7;
|
|
$10 = $9 & 3;
|
|
$11 = ($10|0)==(0);
|
|
if (!($11)) {
|
|
$12 = $9 & 1;
|
|
$13 = $12 ^ 1;
|
|
$14 = (($13) + ($7))|0;
|
|
$15 = $14 << 1;
|
|
$16 = (37404 + ($15<<2)|0);
|
|
$17 = ((($16)) + 8|0);
|
|
$18 = HEAP32[$17>>2]|0;
|
|
$19 = ((($18)) + 8|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = ($16|0)==($20|0);
|
|
do {
|
|
if ($21) {
|
|
$22 = 1 << $14;
|
|
$23 = $22 ^ -1;
|
|
$24 = $8 & $23;
|
|
HEAP32[9341] = $24;
|
|
} else {
|
|
$25 = HEAP32[(37380)>>2]|0;
|
|
$26 = ($20>>>0)<($25>>>0);
|
|
if ($26) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$27 = ((($20)) + 12|0);
|
|
$28 = HEAP32[$27>>2]|0;
|
|
$29 = ($28|0)==($18|0);
|
|
if ($29) {
|
|
HEAP32[$27>>2] = $16;
|
|
HEAP32[$17>>2] = $20;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$30 = $14 << 3;
|
|
$31 = $30 | 3;
|
|
$32 = ((($18)) + 4|0);
|
|
HEAP32[$32>>2] = $31;
|
|
$33 = (($18) + ($30)|0);
|
|
$34 = ((($33)) + 4|0);
|
|
$35 = HEAP32[$34>>2]|0;
|
|
$36 = $35 | 1;
|
|
HEAP32[$34>>2] = $36;
|
|
$$0 = $19;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
$37 = HEAP32[(37372)>>2]|0;
|
|
$38 = ($6>>>0)>($37>>>0);
|
|
if ($38) {
|
|
$39 = ($9|0)==(0);
|
|
if (!($39)) {
|
|
$40 = $9 << $7;
|
|
$41 = 2 << $7;
|
|
$42 = (0 - ($41))|0;
|
|
$43 = $41 | $42;
|
|
$44 = $40 & $43;
|
|
$45 = (0 - ($44))|0;
|
|
$46 = $44 & $45;
|
|
$47 = (($46) + -1)|0;
|
|
$48 = $47 >>> 12;
|
|
$49 = $48 & 16;
|
|
$50 = $47 >>> $49;
|
|
$51 = $50 >>> 5;
|
|
$52 = $51 & 8;
|
|
$53 = $52 | $49;
|
|
$54 = $50 >>> $52;
|
|
$55 = $54 >>> 2;
|
|
$56 = $55 & 4;
|
|
$57 = $53 | $56;
|
|
$58 = $54 >>> $56;
|
|
$59 = $58 >>> 1;
|
|
$60 = $59 & 2;
|
|
$61 = $57 | $60;
|
|
$62 = $58 >>> $60;
|
|
$63 = $62 >>> 1;
|
|
$64 = $63 & 1;
|
|
$65 = $61 | $64;
|
|
$66 = $62 >>> $64;
|
|
$67 = (($65) + ($66))|0;
|
|
$68 = $67 << 1;
|
|
$69 = (37404 + ($68<<2)|0);
|
|
$70 = ((($69)) + 8|0);
|
|
$71 = HEAP32[$70>>2]|0;
|
|
$72 = ((($71)) + 8|0);
|
|
$73 = HEAP32[$72>>2]|0;
|
|
$74 = ($69|0)==($73|0);
|
|
do {
|
|
if ($74) {
|
|
$75 = 1 << $67;
|
|
$76 = $75 ^ -1;
|
|
$77 = $8 & $76;
|
|
HEAP32[9341] = $77;
|
|
$98 = $77;
|
|
} else {
|
|
$78 = HEAP32[(37380)>>2]|0;
|
|
$79 = ($73>>>0)<($78>>>0);
|
|
if ($79) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$80 = ((($73)) + 12|0);
|
|
$81 = HEAP32[$80>>2]|0;
|
|
$82 = ($81|0)==($71|0);
|
|
if ($82) {
|
|
HEAP32[$80>>2] = $69;
|
|
HEAP32[$70>>2] = $73;
|
|
$98 = $8;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$83 = $67 << 3;
|
|
$84 = (($83) - ($6))|0;
|
|
$85 = $6 | 3;
|
|
$86 = ((($71)) + 4|0);
|
|
HEAP32[$86>>2] = $85;
|
|
$87 = (($71) + ($6)|0);
|
|
$88 = $84 | 1;
|
|
$89 = ((($87)) + 4|0);
|
|
HEAP32[$89>>2] = $88;
|
|
$90 = (($87) + ($84)|0);
|
|
HEAP32[$90>>2] = $84;
|
|
$91 = ($37|0)==(0);
|
|
if (!($91)) {
|
|
$92 = HEAP32[(37384)>>2]|0;
|
|
$93 = $37 >>> 3;
|
|
$94 = $93 << 1;
|
|
$95 = (37404 + ($94<<2)|0);
|
|
$96 = 1 << $93;
|
|
$97 = $98 & $96;
|
|
$99 = ($97|0)==(0);
|
|
if ($99) {
|
|
$100 = $98 | $96;
|
|
HEAP32[9341] = $100;
|
|
$$pre = ((($95)) + 8|0);
|
|
$$0199 = $95;$$pre$phiZ2D = $$pre;
|
|
} else {
|
|
$101 = ((($95)) + 8|0);
|
|
$102 = HEAP32[$101>>2]|0;
|
|
$103 = HEAP32[(37380)>>2]|0;
|
|
$104 = ($102>>>0)<($103>>>0);
|
|
if ($104) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$$0199 = $102;$$pre$phiZ2D = $101;
|
|
}
|
|
}
|
|
HEAP32[$$pre$phiZ2D>>2] = $92;
|
|
$105 = ((($$0199)) + 12|0);
|
|
HEAP32[$105>>2] = $92;
|
|
$106 = ((($92)) + 8|0);
|
|
HEAP32[$106>>2] = $$0199;
|
|
$107 = ((($92)) + 12|0);
|
|
HEAP32[$107>>2] = $95;
|
|
}
|
|
HEAP32[(37372)>>2] = $84;
|
|
HEAP32[(37384)>>2] = $87;
|
|
$$0 = $72;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
$108 = HEAP32[(37368)>>2]|0;
|
|
$109 = ($108|0)==(0);
|
|
if ($109) {
|
|
$$0197 = $6;
|
|
} else {
|
|
$110 = (0 - ($108))|0;
|
|
$111 = $108 & $110;
|
|
$112 = (($111) + -1)|0;
|
|
$113 = $112 >>> 12;
|
|
$114 = $113 & 16;
|
|
$115 = $112 >>> $114;
|
|
$116 = $115 >>> 5;
|
|
$117 = $116 & 8;
|
|
$118 = $117 | $114;
|
|
$119 = $115 >>> $117;
|
|
$120 = $119 >>> 2;
|
|
$121 = $120 & 4;
|
|
$122 = $118 | $121;
|
|
$123 = $119 >>> $121;
|
|
$124 = $123 >>> 1;
|
|
$125 = $124 & 2;
|
|
$126 = $122 | $125;
|
|
$127 = $123 >>> $125;
|
|
$128 = $127 >>> 1;
|
|
$129 = $128 & 1;
|
|
$130 = $126 | $129;
|
|
$131 = $127 >>> $129;
|
|
$132 = (($130) + ($131))|0;
|
|
$133 = (37668 + ($132<<2)|0);
|
|
$134 = HEAP32[$133>>2]|0;
|
|
$135 = ((($134)) + 4|0);
|
|
$136 = HEAP32[$135>>2]|0;
|
|
$137 = $136 & -8;
|
|
$138 = (($137) - ($6))|0;
|
|
$$0189$i = $134;$$0190$i = $134;$$0191$i = $138;
|
|
while(1) {
|
|
$139 = ((($$0189$i)) + 16|0);
|
|
$140 = HEAP32[$139>>2]|0;
|
|
$141 = ($140|0)==(0|0);
|
|
if ($141) {
|
|
$142 = ((($$0189$i)) + 20|0);
|
|
$143 = HEAP32[$142>>2]|0;
|
|
$144 = ($143|0)==(0|0);
|
|
if ($144) {
|
|
break;
|
|
} else {
|
|
$146 = $143;
|
|
}
|
|
} else {
|
|
$146 = $140;
|
|
}
|
|
$145 = ((($146)) + 4|0);
|
|
$147 = HEAP32[$145>>2]|0;
|
|
$148 = $147 & -8;
|
|
$149 = (($148) - ($6))|0;
|
|
$150 = ($149>>>0)<($$0191$i>>>0);
|
|
$$$0191$i = $150 ? $149 : $$0191$i;
|
|
$$$0190$i = $150 ? $146 : $$0190$i;
|
|
$$0189$i = $146;$$0190$i = $$$0190$i;$$0191$i = $$$0191$i;
|
|
}
|
|
$151 = HEAP32[(37380)>>2]|0;
|
|
$152 = ($$0190$i>>>0)<($151>>>0);
|
|
if ($152) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$153 = (($$0190$i) + ($6)|0);
|
|
$154 = ($$0190$i>>>0)<($153>>>0);
|
|
if (!($154)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$155 = ((($$0190$i)) + 24|0);
|
|
$156 = HEAP32[$155>>2]|0;
|
|
$157 = ((($$0190$i)) + 12|0);
|
|
$158 = HEAP32[$157>>2]|0;
|
|
$159 = ($158|0)==($$0190$i|0);
|
|
do {
|
|
if ($159) {
|
|
$169 = ((($$0190$i)) + 20|0);
|
|
$170 = HEAP32[$169>>2]|0;
|
|
$171 = ($170|0)==(0|0);
|
|
if ($171) {
|
|
$172 = ((($$0190$i)) + 16|0);
|
|
$173 = HEAP32[$172>>2]|0;
|
|
$174 = ($173|0)==(0|0);
|
|
if ($174) {
|
|
$$3$i = 0;
|
|
break;
|
|
} else {
|
|
$$1194$i = $173;$$1196$i = $172;
|
|
}
|
|
} else {
|
|
$$1194$i = $170;$$1196$i = $169;
|
|
}
|
|
while(1) {
|
|
$175 = ((($$1194$i)) + 20|0);
|
|
$176 = HEAP32[$175>>2]|0;
|
|
$177 = ($176|0)==(0|0);
|
|
if (!($177)) {
|
|
$$1194$i = $176;$$1196$i = $175;
|
|
continue;
|
|
}
|
|
$178 = ((($$1194$i)) + 16|0);
|
|
$179 = HEAP32[$178>>2]|0;
|
|
$180 = ($179|0)==(0|0);
|
|
if ($180) {
|
|
break;
|
|
} else {
|
|
$$1194$i = $179;$$1196$i = $178;
|
|
}
|
|
}
|
|
$181 = ($$1196$i>>>0)<($151>>>0);
|
|
if ($181) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1196$i>>2] = 0;
|
|
$$3$i = $$1194$i;
|
|
break;
|
|
}
|
|
} else {
|
|
$160 = ((($$0190$i)) + 8|0);
|
|
$161 = HEAP32[$160>>2]|0;
|
|
$162 = ($161>>>0)<($151>>>0);
|
|
if ($162) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$163 = ((($161)) + 12|0);
|
|
$164 = HEAP32[$163>>2]|0;
|
|
$165 = ($164|0)==($$0190$i|0);
|
|
if (!($165)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$166 = ((($158)) + 8|0);
|
|
$167 = HEAP32[$166>>2]|0;
|
|
$168 = ($167|0)==($$0190$i|0);
|
|
if ($168) {
|
|
HEAP32[$163>>2] = $158;
|
|
HEAP32[$166>>2] = $161;
|
|
$$3$i = $158;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$182 = ($156|0)==(0|0);
|
|
do {
|
|
if (!($182)) {
|
|
$183 = ((($$0190$i)) + 28|0);
|
|
$184 = HEAP32[$183>>2]|0;
|
|
$185 = (37668 + ($184<<2)|0);
|
|
$186 = HEAP32[$185>>2]|0;
|
|
$187 = ($$0190$i|0)==($186|0);
|
|
if ($187) {
|
|
HEAP32[$185>>2] = $$3$i;
|
|
$cond$i = ($$3$i|0)==(0|0);
|
|
if ($cond$i) {
|
|
$188 = 1 << $184;
|
|
$189 = $188 ^ -1;
|
|
$190 = $108 & $189;
|
|
HEAP32[(37368)>>2] = $190;
|
|
break;
|
|
}
|
|
} else {
|
|
$191 = HEAP32[(37380)>>2]|0;
|
|
$192 = ($156>>>0)<($191>>>0);
|
|
if ($192) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$193 = ((($156)) + 16|0);
|
|
$194 = HEAP32[$193>>2]|0;
|
|
$195 = ($194|0)==($$0190$i|0);
|
|
if ($195) {
|
|
HEAP32[$193>>2] = $$3$i;
|
|
} else {
|
|
$196 = ((($156)) + 20|0);
|
|
HEAP32[$196>>2] = $$3$i;
|
|
}
|
|
$197 = ($$3$i|0)==(0|0);
|
|
if ($197) {
|
|
break;
|
|
}
|
|
}
|
|
$198 = HEAP32[(37380)>>2]|0;
|
|
$199 = ($$3$i>>>0)<($198>>>0);
|
|
if ($199) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$200 = ((($$3$i)) + 24|0);
|
|
HEAP32[$200>>2] = $156;
|
|
$201 = ((($$0190$i)) + 16|0);
|
|
$202 = HEAP32[$201>>2]|0;
|
|
$203 = ($202|0)==(0|0);
|
|
do {
|
|
if (!($203)) {
|
|
$204 = ($202>>>0)<($198>>>0);
|
|
if ($204) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$205 = ((($$3$i)) + 16|0);
|
|
HEAP32[$205>>2] = $202;
|
|
$206 = ((($202)) + 24|0);
|
|
HEAP32[$206>>2] = $$3$i;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$207 = ((($$0190$i)) + 20|0);
|
|
$208 = HEAP32[$207>>2]|0;
|
|
$209 = ($208|0)==(0|0);
|
|
if (!($209)) {
|
|
$210 = HEAP32[(37380)>>2]|0;
|
|
$211 = ($208>>>0)<($210>>>0);
|
|
if ($211) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$212 = ((($$3$i)) + 20|0);
|
|
HEAP32[$212>>2] = $208;
|
|
$213 = ((($208)) + 24|0);
|
|
HEAP32[$213>>2] = $$3$i;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$214 = ($$0191$i>>>0)<(16);
|
|
if ($214) {
|
|
$215 = (($$0191$i) + ($6))|0;
|
|
$216 = $215 | 3;
|
|
$217 = ((($$0190$i)) + 4|0);
|
|
HEAP32[$217>>2] = $216;
|
|
$218 = (($$0190$i) + ($215)|0);
|
|
$219 = ((($218)) + 4|0);
|
|
$220 = HEAP32[$219>>2]|0;
|
|
$221 = $220 | 1;
|
|
HEAP32[$219>>2] = $221;
|
|
} else {
|
|
$222 = $6 | 3;
|
|
$223 = ((($$0190$i)) + 4|0);
|
|
HEAP32[$223>>2] = $222;
|
|
$224 = $$0191$i | 1;
|
|
$225 = ((($153)) + 4|0);
|
|
HEAP32[$225>>2] = $224;
|
|
$226 = (($153) + ($$0191$i)|0);
|
|
HEAP32[$226>>2] = $$0191$i;
|
|
$227 = ($37|0)==(0);
|
|
if (!($227)) {
|
|
$228 = HEAP32[(37384)>>2]|0;
|
|
$229 = $37 >>> 3;
|
|
$230 = $229 << 1;
|
|
$231 = (37404 + ($230<<2)|0);
|
|
$232 = 1 << $229;
|
|
$233 = $8 & $232;
|
|
$234 = ($233|0)==(0);
|
|
if ($234) {
|
|
$235 = $8 | $232;
|
|
HEAP32[9341] = $235;
|
|
$$pre$i = ((($231)) + 8|0);
|
|
$$0187$i = $231;$$pre$phi$iZ2D = $$pre$i;
|
|
} else {
|
|
$236 = ((($231)) + 8|0);
|
|
$237 = HEAP32[$236>>2]|0;
|
|
$238 = HEAP32[(37380)>>2]|0;
|
|
$239 = ($237>>>0)<($238>>>0);
|
|
if ($239) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$$0187$i = $237;$$pre$phi$iZ2D = $236;
|
|
}
|
|
}
|
|
HEAP32[$$pre$phi$iZ2D>>2] = $228;
|
|
$240 = ((($$0187$i)) + 12|0);
|
|
HEAP32[$240>>2] = $228;
|
|
$241 = ((($228)) + 8|0);
|
|
HEAP32[$241>>2] = $$0187$i;
|
|
$242 = ((($228)) + 12|0);
|
|
HEAP32[$242>>2] = $231;
|
|
}
|
|
HEAP32[(37372)>>2] = $$0191$i;
|
|
HEAP32[(37384)>>2] = $153;
|
|
}
|
|
$243 = ((($$0190$i)) + 8|0);
|
|
$$0 = $243;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
} else {
|
|
$$0197 = $6;
|
|
}
|
|
} else {
|
|
$244 = ($0>>>0)>(4294967231);
|
|
if ($244) {
|
|
$$0197 = -1;
|
|
} else {
|
|
$245 = (($0) + 11)|0;
|
|
$246 = $245 & -8;
|
|
$247 = HEAP32[(37368)>>2]|0;
|
|
$248 = ($247|0)==(0);
|
|
if ($248) {
|
|
$$0197 = $246;
|
|
} else {
|
|
$249 = (0 - ($246))|0;
|
|
$250 = $245 >>> 8;
|
|
$251 = ($250|0)==(0);
|
|
if ($251) {
|
|
$$0356$i = 0;
|
|
} else {
|
|
$252 = ($246>>>0)>(16777215);
|
|
if ($252) {
|
|
$$0356$i = 31;
|
|
} else {
|
|
$253 = (($250) + 1048320)|0;
|
|
$254 = $253 >>> 16;
|
|
$255 = $254 & 8;
|
|
$256 = $250 << $255;
|
|
$257 = (($256) + 520192)|0;
|
|
$258 = $257 >>> 16;
|
|
$259 = $258 & 4;
|
|
$260 = $259 | $255;
|
|
$261 = $256 << $259;
|
|
$262 = (($261) + 245760)|0;
|
|
$263 = $262 >>> 16;
|
|
$264 = $263 & 2;
|
|
$265 = $260 | $264;
|
|
$266 = (14 - ($265))|0;
|
|
$267 = $261 << $264;
|
|
$268 = $267 >>> 15;
|
|
$269 = (($266) + ($268))|0;
|
|
$270 = $269 << 1;
|
|
$271 = (($269) + 7)|0;
|
|
$272 = $246 >>> $271;
|
|
$273 = $272 & 1;
|
|
$274 = $273 | $270;
|
|
$$0356$i = $274;
|
|
}
|
|
}
|
|
$275 = (37668 + ($$0356$i<<2)|0);
|
|
$276 = HEAP32[$275>>2]|0;
|
|
$277 = ($276|0)==(0|0);
|
|
L123: do {
|
|
if ($277) {
|
|
$$2353$i = 0;$$3$i201 = 0;$$3348$i = $249;
|
|
label = 86;
|
|
} else {
|
|
$278 = ($$0356$i|0)==(31);
|
|
$279 = $$0356$i >>> 1;
|
|
$280 = (25 - ($279))|0;
|
|
$281 = $278 ? 0 : $280;
|
|
$282 = $246 << $281;
|
|
$$0340$i = 0;$$0345$i = $249;$$0351$i = $276;$$0357$i = $282;$$0360$i = 0;
|
|
while(1) {
|
|
$283 = ((($$0351$i)) + 4|0);
|
|
$284 = HEAP32[$283>>2]|0;
|
|
$285 = $284 & -8;
|
|
$286 = (($285) - ($246))|0;
|
|
$287 = ($286>>>0)<($$0345$i>>>0);
|
|
if ($287) {
|
|
$288 = ($286|0)==(0);
|
|
if ($288) {
|
|
$$413$i = $$0351$i;$$434912$i = 0;$$435511$i = $$0351$i;
|
|
label = 90;
|
|
break L123;
|
|
} else {
|
|
$$1341$i = $$0351$i;$$1346$i = $286;
|
|
}
|
|
} else {
|
|
$$1341$i = $$0340$i;$$1346$i = $$0345$i;
|
|
}
|
|
$289 = ((($$0351$i)) + 20|0);
|
|
$290 = HEAP32[$289>>2]|0;
|
|
$291 = $$0357$i >>> 31;
|
|
$292 = (((($$0351$i)) + 16|0) + ($291<<2)|0);
|
|
$293 = HEAP32[$292>>2]|0;
|
|
$294 = ($290|0)==(0|0);
|
|
$295 = ($290|0)==($293|0);
|
|
$or$cond1$i = $294 | $295;
|
|
$$1361$i = $or$cond1$i ? $$0360$i : $290;
|
|
$296 = ($293|0)==(0|0);
|
|
$297 = $296&1;
|
|
$298 = $297 ^ 1;
|
|
$$0357$$i = $$0357$i << $298;
|
|
if ($296) {
|
|
$$2353$i = $$1361$i;$$3$i201 = $$1341$i;$$3348$i = $$1346$i;
|
|
label = 86;
|
|
break;
|
|
} else {
|
|
$$0340$i = $$1341$i;$$0345$i = $$1346$i;$$0351$i = $293;$$0357$i = $$0357$$i;$$0360$i = $$1361$i;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 86) {
|
|
$299 = ($$2353$i|0)==(0|0);
|
|
$300 = ($$3$i201|0)==(0|0);
|
|
$or$cond$i = $299 & $300;
|
|
if ($or$cond$i) {
|
|
$301 = 2 << $$0356$i;
|
|
$302 = (0 - ($301))|0;
|
|
$303 = $301 | $302;
|
|
$304 = $247 & $303;
|
|
$305 = ($304|0)==(0);
|
|
if ($305) {
|
|
$$0197 = $246;
|
|
break;
|
|
}
|
|
$306 = (0 - ($304))|0;
|
|
$307 = $304 & $306;
|
|
$308 = (($307) + -1)|0;
|
|
$309 = $308 >>> 12;
|
|
$310 = $309 & 16;
|
|
$311 = $308 >>> $310;
|
|
$312 = $311 >>> 5;
|
|
$313 = $312 & 8;
|
|
$314 = $313 | $310;
|
|
$315 = $311 >>> $313;
|
|
$316 = $315 >>> 2;
|
|
$317 = $316 & 4;
|
|
$318 = $314 | $317;
|
|
$319 = $315 >>> $317;
|
|
$320 = $319 >>> 1;
|
|
$321 = $320 & 2;
|
|
$322 = $318 | $321;
|
|
$323 = $319 >>> $321;
|
|
$324 = $323 >>> 1;
|
|
$325 = $324 & 1;
|
|
$326 = $322 | $325;
|
|
$327 = $323 >>> $325;
|
|
$328 = (($326) + ($327))|0;
|
|
$329 = (37668 + ($328<<2)|0);
|
|
$330 = HEAP32[$329>>2]|0;
|
|
$$4355$ph$i = $330;
|
|
} else {
|
|
$$4355$ph$i = $$2353$i;
|
|
}
|
|
$331 = ($$4355$ph$i|0)==(0|0);
|
|
if ($331) {
|
|
$$4$lcssa$i = $$3$i201;$$4349$lcssa$i = $$3348$i;
|
|
} else {
|
|
$$413$i = $$3$i201;$$434912$i = $$3348$i;$$435511$i = $$4355$ph$i;
|
|
label = 90;
|
|
}
|
|
}
|
|
if ((label|0) == 90) {
|
|
while(1) {
|
|
label = 0;
|
|
$332 = ((($$435511$i)) + 4|0);
|
|
$333 = HEAP32[$332>>2]|0;
|
|
$334 = $333 & -8;
|
|
$335 = (($334) - ($246))|0;
|
|
$336 = ($335>>>0)<($$434912$i>>>0);
|
|
$$$4349$i = $336 ? $335 : $$434912$i;
|
|
$$4355$$4$i = $336 ? $$435511$i : $$413$i;
|
|
$337 = ((($$435511$i)) + 16|0);
|
|
$338 = HEAP32[$337>>2]|0;
|
|
$339 = ($338|0)==(0|0);
|
|
if (!($339)) {
|
|
$$413$i = $$4355$$4$i;$$434912$i = $$$4349$i;$$435511$i = $338;
|
|
label = 90;
|
|
continue;
|
|
}
|
|
$340 = ((($$435511$i)) + 20|0);
|
|
$341 = HEAP32[$340>>2]|0;
|
|
$342 = ($341|0)==(0|0);
|
|
if ($342) {
|
|
$$4$lcssa$i = $$4355$$4$i;$$4349$lcssa$i = $$$4349$i;
|
|
break;
|
|
} else {
|
|
$$413$i = $$4355$$4$i;$$434912$i = $$$4349$i;$$435511$i = $341;
|
|
label = 90;
|
|
}
|
|
}
|
|
}
|
|
$343 = ($$4$lcssa$i|0)==(0|0);
|
|
if ($343) {
|
|
$$0197 = $246;
|
|
} else {
|
|
$344 = HEAP32[(37372)>>2]|0;
|
|
$345 = (($344) - ($246))|0;
|
|
$346 = ($$4349$lcssa$i>>>0)<($345>>>0);
|
|
if ($346) {
|
|
$347 = HEAP32[(37380)>>2]|0;
|
|
$348 = ($$4$lcssa$i>>>0)<($347>>>0);
|
|
if ($348) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$349 = (($$4$lcssa$i) + ($246)|0);
|
|
$350 = ($$4$lcssa$i>>>0)<($349>>>0);
|
|
if (!($350)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$351 = ((($$4$lcssa$i)) + 24|0);
|
|
$352 = HEAP32[$351>>2]|0;
|
|
$353 = ((($$4$lcssa$i)) + 12|0);
|
|
$354 = HEAP32[$353>>2]|0;
|
|
$355 = ($354|0)==($$4$lcssa$i|0);
|
|
do {
|
|
if ($355) {
|
|
$365 = ((($$4$lcssa$i)) + 20|0);
|
|
$366 = HEAP32[$365>>2]|0;
|
|
$367 = ($366|0)==(0|0);
|
|
if ($367) {
|
|
$368 = ((($$4$lcssa$i)) + 16|0);
|
|
$369 = HEAP32[$368>>2]|0;
|
|
$370 = ($369|0)==(0|0);
|
|
if ($370) {
|
|
$$3370$i = 0;
|
|
break;
|
|
} else {
|
|
$$1368$i = $369;$$1372$i = $368;
|
|
}
|
|
} else {
|
|
$$1368$i = $366;$$1372$i = $365;
|
|
}
|
|
while(1) {
|
|
$371 = ((($$1368$i)) + 20|0);
|
|
$372 = HEAP32[$371>>2]|0;
|
|
$373 = ($372|0)==(0|0);
|
|
if (!($373)) {
|
|
$$1368$i = $372;$$1372$i = $371;
|
|
continue;
|
|
}
|
|
$374 = ((($$1368$i)) + 16|0);
|
|
$375 = HEAP32[$374>>2]|0;
|
|
$376 = ($375|0)==(0|0);
|
|
if ($376) {
|
|
break;
|
|
} else {
|
|
$$1368$i = $375;$$1372$i = $374;
|
|
}
|
|
}
|
|
$377 = ($$1372$i>>>0)<($347>>>0);
|
|
if ($377) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1372$i>>2] = 0;
|
|
$$3370$i = $$1368$i;
|
|
break;
|
|
}
|
|
} else {
|
|
$356 = ((($$4$lcssa$i)) + 8|0);
|
|
$357 = HEAP32[$356>>2]|0;
|
|
$358 = ($357>>>0)<($347>>>0);
|
|
if ($358) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$359 = ((($357)) + 12|0);
|
|
$360 = HEAP32[$359>>2]|0;
|
|
$361 = ($360|0)==($$4$lcssa$i|0);
|
|
if (!($361)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$362 = ((($354)) + 8|0);
|
|
$363 = HEAP32[$362>>2]|0;
|
|
$364 = ($363|0)==($$4$lcssa$i|0);
|
|
if ($364) {
|
|
HEAP32[$359>>2] = $354;
|
|
HEAP32[$362>>2] = $357;
|
|
$$3370$i = $354;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$378 = ($352|0)==(0|0);
|
|
do {
|
|
if ($378) {
|
|
$470 = $247;
|
|
} else {
|
|
$379 = ((($$4$lcssa$i)) + 28|0);
|
|
$380 = HEAP32[$379>>2]|0;
|
|
$381 = (37668 + ($380<<2)|0);
|
|
$382 = HEAP32[$381>>2]|0;
|
|
$383 = ($$4$lcssa$i|0)==($382|0);
|
|
if ($383) {
|
|
HEAP32[$381>>2] = $$3370$i;
|
|
$cond$i204 = ($$3370$i|0)==(0|0);
|
|
if ($cond$i204) {
|
|
$384 = 1 << $380;
|
|
$385 = $384 ^ -1;
|
|
$386 = $247 & $385;
|
|
HEAP32[(37368)>>2] = $386;
|
|
$470 = $386;
|
|
break;
|
|
}
|
|
} else {
|
|
$387 = HEAP32[(37380)>>2]|0;
|
|
$388 = ($352>>>0)<($387>>>0);
|
|
if ($388) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$389 = ((($352)) + 16|0);
|
|
$390 = HEAP32[$389>>2]|0;
|
|
$391 = ($390|0)==($$4$lcssa$i|0);
|
|
if ($391) {
|
|
HEAP32[$389>>2] = $$3370$i;
|
|
} else {
|
|
$392 = ((($352)) + 20|0);
|
|
HEAP32[$392>>2] = $$3370$i;
|
|
}
|
|
$393 = ($$3370$i|0)==(0|0);
|
|
if ($393) {
|
|
$470 = $247;
|
|
break;
|
|
}
|
|
}
|
|
$394 = HEAP32[(37380)>>2]|0;
|
|
$395 = ($$3370$i>>>0)<($394>>>0);
|
|
if ($395) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$396 = ((($$3370$i)) + 24|0);
|
|
HEAP32[$396>>2] = $352;
|
|
$397 = ((($$4$lcssa$i)) + 16|0);
|
|
$398 = HEAP32[$397>>2]|0;
|
|
$399 = ($398|0)==(0|0);
|
|
do {
|
|
if (!($399)) {
|
|
$400 = ($398>>>0)<($394>>>0);
|
|
if ($400) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$401 = ((($$3370$i)) + 16|0);
|
|
HEAP32[$401>>2] = $398;
|
|
$402 = ((($398)) + 24|0);
|
|
HEAP32[$402>>2] = $$3370$i;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$403 = ((($$4$lcssa$i)) + 20|0);
|
|
$404 = HEAP32[$403>>2]|0;
|
|
$405 = ($404|0)==(0|0);
|
|
if ($405) {
|
|
$470 = $247;
|
|
} else {
|
|
$406 = HEAP32[(37380)>>2]|0;
|
|
$407 = ($404>>>0)<($406>>>0);
|
|
if ($407) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$408 = ((($$3370$i)) + 20|0);
|
|
HEAP32[$408>>2] = $404;
|
|
$409 = ((($404)) + 24|0);
|
|
HEAP32[$409>>2] = $$3370$i;
|
|
$470 = $247;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$410 = ($$4349$lcssa$i>>>0)<(16);
|
|
do {
|
|
if ($410) {
|
|
$411 = (($$4349$lcssa$i) + ($246))|0;
|
|
$412 = $411 | 3;
|
|
$413 = ((($$4$lcssa$i)) + 4|0);
|
|
HEAP32[$413>>2] = $412;
|
|
$414 = (($$4$lcssa$i) + ($411)|0);
|
|
$415 = ((($414)) + 4|0);
|
|
$416 = HEAP32[$415>>2]|0;
|
|
$417 = $416 | 1;
|
|
HEAP32[$415>>2] = $417;
|
|
} else {
|
|
$418 = $246 | 3;
|
|
$419 = ((($$4$lcssa$i)) + 4|0);
|
|
HEAP32[$419>>2] = $418;
|
|
$420 = $$4349$lcssa$i | 1;
|
|
$421 = ((($349)) + 4|0);
|
|
HEAP32[$421>>2] = $420;
|
|
$422 = (($349) + ($$4349$lcssa$i)|0);
|
|
HEAP32[$422>>2] = $$4349$lcssa$i;
|
|
$423 = $$4349$lcssa$i >>> 3;
|
|
$424 = ($$4349$lcssa$i>>>0)<(256);
|
|
if ($424) {
|
|
$425 = $423 << 1;
|
|
$426 = (37404 + ($425<<2)|0);
|
|
$427 = HEAP32[9341]|0;
|
|
$428 = 1 << $423;
|
|
$429 = $427 & $428;
|
|
$430 = ($429|0)==(0);
|
|
if ($430) {
|
|
$431 = $427 | $428;
|
|
HEAP32[9341] = $431;
|
|
$$pre$i205 = ((($426)) + 8|0);
|
|
$$0366$i = $426;$$pre$phi$i206Z2D = $$pre$i205;
|
|
} else {
|
|
$432 = ((($426)) + 8|0);
|
|
$433 = HEAP32[$432>>2]|0;
|
|
$434 = HEAP32[(37380)>>2]|0;
|
|
$435 = ($433>>>0)<($434>>>0);
|
|
if ($435) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$$0366$i = $433;$$pre$phi$i206Z2D = $432;
|
|
}
|
|
}
|
|
HEAP32[$$pre$phi$i206Z2D>>2] = $349;
|
|
$436 = ((($$0366$i)) + 12|0);
|
|
HEAP32[$436>>2] = $349;
|
|
$437 = ((($349)) + 8|0);
|
|
HEAP32[$437>>2] = $$0366$i;
|
|
$438 = ((($349)) + 12|0);
|
|
HEAP32[$438>>2] = $426;
|
|
break;
|
|
}
|
|
$439 = $$4349$lcssa$i >>> 8;
|
|
$440 = ($439|0)==(0);
|
|
if ($440) {
|
|
$$0359$i = 0;
|
|
} else {
|
|
$441 = ($$4349$lcssa$i>>>0)>(16777215);
|
|
if ($441) {
|
|
$$0359$i = 31;
|
|
} else {
|
|
$442 = (($439) + 1048320)|0;
|
|
$443 = $442 >>> 16;
|
|
$444 = $443 & 8;
|
|
$445 = $439 << $444;
|
|
$446 = (($445) + 520192)|0;
|
|
$447 = $446 >>> 16;
|
|
$448 = $447 & 4;
|
|
$449 = $448 | $444;
|
|
$450 = $445 << $448;
|
|
$451 = (($450) + 245760)|0;
|
|
$452 = $451 >>> 16;
|
|
$453 = $452 & 2;
|
|
$454 = $449 | $453;
|
|
$455 = (14 - ($454))|0;
|
|
$456 = $450 << $453;
|
|
$457 = $456 >>> 15;
|
|
$458 = (($455) + ($457))|0;
|
|
$459 = $458 << 1;
|
|
$460 = (($458) + 7)|0;
|
|
$461 = $$4349$lcssa$i >>> $460;
|
|
$462 = $461 & 1;
|
|
$463 = $462 | $459;
|
|
$$0359$i = $463;
|
|
}
|
|
}
|
|
$464 = (37668 + ($$0359$i<<2)|0);
|
|
$465 = ((($349)) + 28|0);
|
|
HEAP32[$465>>2] = $$0359$i;
|
|
$466 = ((($349)) + 16|0);
|
|
$467 = ((($466)) + 4|0);
|
|
HEAP32[$467>>2] = 0;
|
|
HEAP32[$466>>2] = 0;
|
|
$468 = 1 << $$0359$i;
|
|
$469 = $470 & $468;
|
|
$471 = ($469|0)==(0);
|
|
if ($471) {
|
|
$472 = $470 | $468;
|
|
HEAP32[(37368)>>2] = $472;
|
|
HEAP32[$464>>2] = $349;
|
|
$473 = ((($349)) + 24|0);
|
|
HEAP32[$473>>2] = $464;
|
|
$474 = ((($349)) + 12|0);
|
|
HEAP32[$474>>2] = $349;
|
|
$475 = ((($349)) + 8|0);
|
|
HEAP32[$475>>2] = $349;
|
|
break;
|
|
}
|
|
$476 = HEAP32[$464>>2]|0;
|
|
$477 = ($$0359$i|0)==(31);
|
|
$478 = $$0359$i >>> 1;
|
|
$479 = (25 - ($478))|0;
|
|
$480 = $477 ? 0 : $479;
|
|
$481 = $$4349$lcssa$i << $480;
|
|
$$0342$i = $481;$$0343$i = $476;
|
|
while(1) {
|
|
$482 = ((($$0343$i)) + 4|0);
|
|
$483 = HEAP32[$482>>2]|0;
|
|
$484 = $483 & -8;
|
|
$485 = ($484|0)==($$4349$lcssa$i|0);
|
|
if ($485) {
|
|
label = 148;
|
|
break;
|
|
}
|
|
$486 = $$0342$i >>> 31;
|
|
$487 = (((($$0343$i)) + 16|0) + ($486<<2)|0);
|
|
$488 = $$0342$i << 1;
|
|
$489 = HEAP32[$487>>2]|0;
|
|
$490 = ($489|0)==(0|0);
|
|
if ($490) {
|
|
label = 145;
|
|
break;
|
|
} else {
|
|
$$0342$i = $488;$$0343$i = $489;
|
|
}
|
|
}
|
|
if ((label|0) == 145) {
|
|
$491 = HEAP32[(37380)>>2]|0;
|
|
$492 = ($487>>>0)<($491>>>0);
|
|
if ($492) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$487>>2] = $349;
|
|
$493 = ((($349)) + 24|0);
|
|
HEAP32[$493>>2] = $$0343$i;
|
|
$494 = ((($349)) + 12|0);
|
|
HEAP32[$494>>2] = $349;
|
|
$495 = ((($349)) + 8|0);
|
|
HEAP32[$495>>2] = $349;
|
|
break;
|
|
}
|
|
}
|
|
else if ((label|0) == 148) {
|
|
$496 = ((($$0343$i)) + 8|0);
|
|
$497 = HEAP32[$496>>2]|0;
|
|
$498 = HEAP32[(37380)>>2]|0;
|
|
$499 = ($497>>>0)>=($498>>>0);
|
|
$not$7$i = ($$0343$i>>>0)>=($498>>>0);
|
|
$500 = $499 & $not$7$i;
|
|
if ($500) {
|
|
$501 = ((($497)) + 12|0);
|
|
HEAP32[$501>>2] = $349;
|
|
HEAP32[$496>>2] = $349;
|
|
$502 = ((($349)) + 8|0);
|
|
HEAP32[$502>>2] = $497;
|
|
$503 = ((($349)) + 12|0);
|
|
HEAP32[$503>>2] = $$0343$i;
|
|
$504 = ((($349)) + 24|0);
|
|
HEAP32[$504>>2] = 0;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$505 = ((($$4$lcssa$i)) + 8|0);
|
|
$$0 = $505;
|
|
STACKTOP = sp;return ($$0|0);
|
|
} else {
|
|
$$0197 = $246;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$506 = HEAP32[(37372)>>2]|0;
|
|
$507 = ($506>>>0)<($$0197>>>0);
|
|
if (!($507)) {
|
|
$508 = (($506) - ($$0197))|0;
|
|
$509 = HEAP32[(37384)>>2]|0;
|
|
$510 = ($508>>>0)>(15);
|
|
if ($510) {
|
|
$511 = (($509) + ($$0197)|0);
|
|
HEAP32[(37384)>>2] = $511;
|
|
HEAP32[(37372)>>2] = $508;
|
|
$512 = $508 | 1;
|
|
$513 = ((($511)) + 4|0);
|
|
HEAP32[$513>>2] = $512;
|
|
$514 = (($511) + ($508)|0);
|
|
HEAP32[$514>>2] = $508;
|
|
$515 = $$0197 | 3;
|
|
$516 = ((($509)) + 4|0);
|
|
HEAP32[$516>>2] = $515;
|
|
} else {
|
|
HEAP32[(37372)>>2] = 0;
|
|
HEAP32[(37384)>>2] = 0;
|
|
$517 = $506 | 3;
|
|
$518 = ((($509)) + 4|0);
|
|
HEAP32[$518>>2] = $517;
|
|
$519 = (($509) + ($506)|0);
|
|
$520 = ((($519)) + 4|0);
|
|
$521 = HEAP32[$520>>2]|0;
|
|
$522 = $521 | 1;
|
|
HEAP32[$520>>2] = $522;
|
|
}
|
|
$523 = ((($509)) + 8|0);
|
|
$$0 = $523;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
$524 = HEAP32[(37376)>>2]|0;
|
|
$525 = ($524>>>0)>($$0197>>>0);
|
|
if ($525) {
|
|
$526 = (($524) - ($$0197))|0;
|
|
HEAP32[(37376)>>2] = $526;
|
|
$527 = HEAP32[(37388)>>2]|0;
|
|
$528 = (($527) + ($$0197)|0);
|
|
HEAP32[(37388)>>2] = $528;
|
|
$529 = $526 | 1;
|
|
$530 = ((($528)) + 4|0);
|
|
HEAP32[$530>>2] = $529;
|
|
$531 = $$0197 | 3;
|
|
$532 = ((($527)) + 4|0);
|
|
HEAP32[$532>>2] = $531;
|
|
$533 = ((($527)) + 8|0);
|
|
$$0 = $533;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
$534 = HEAP32[9459]|0;
|
|
$535 = ($534|0)==(0);
|
|
if ($535) {
|
|
HEAP32[(37844)>>2] = 4096;
|
|
HEAP32[(37840)>>2] = 4096;
|
|
HEAP32[(37848)>>2] = -1;
|
|
HEAP32[(37852)>>2] = -1;
|
|
HEAP32[(37856)>>2] = 0;
|
|
HEAP32[(37808)>>2] = 0;
|
|
$536 = $1;
|
|
$537 = $536 & -16;
|
|
$538 = $537 ^ 1431655768;
|
|
HEAP32[$1>>2] = $538;
|
|
HEAP32[9459] = $538;
|
|
$542 = 4096;
|
|
} else {
|
|
$$pre$i208 = HEAP32[(37844)>>2]|0;
|
|
$542 = $$pre$i208;
|
|
}
|
|
$539 = (($$0197) + 48)|0;
|
|
$540 = (($$0197) + 47)|0;
|
|
$541 = (($542) + ($540))|0;
|
|
$543 = (0 - ($542))|0;
|
|
$544 = $541 & $543;
|
|
$545 = ($544>>>0)>($$0197>>>0);
|
|
if (!($545)) {
|
|
$$0 = 0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
$546 = HEAP32[(37804)>>2]|0;
|
|
$547 = ($546|0)==(0);
|
|
if (!($547)) {
|
|
$548 = HEAP32[(37796)>>2]|0;
|
|
$549 = (($548) + ($544))|0;
|
|
$550 = ($549>>>0)<=($548>>>0);
|
|
$551 = ($549>>>0)>($546>>>0);
|
|
$or$cond1$i210 = $550 | $551;
|
|
if ($or$cond1$i210) {
|
|
$$0 = 0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
}
|
|
$552 = HEAP32[(37808)>>2]|0;
|
|
$553 = $552 & 4;
|
|
$554 = ($553|0)==(0);
|
|
L255: do {
|
|
if ($554) {
|
|
$555 = HEAP32[(37388)>>2]|0;
|
|
$556 = ($555|0)==(0|0);
|
|
L257: do {
|
|
if ($556) {
|
|
label = 172;
|
|
} else {
|
|
$$0$i17$i = (37812);
|
|
while(1) {
|
|
$557 = HEAP32[$$0$i17$i>>2]|0;
|
|
$558 = ($557>>>0)>($555>>>0);
|
|
if (!($558)) {
|
|
$559 = ((($$0$i17$i)) + 4|0);
|
|
$560 = HEAP32[$559>>2]|0;
|
|
$561 = (($557) + ($560)|0);
|
|
$562 = ($561>>>0)>($555>>>0);
|
|
if ($562) {
|
|
break;
|
|
}
|
|
}
|
|
$563 = ((($$0$i17$i)) + 8|0);
|
|
$564 = HEAP32[$563>>2]|0;
|
|
$565 = ($564|0)==(0|0);
|
|
if ($565) {
|
|
label = 172;
|
|
break L257;
|
|
} else {
|
|
$$0$i17$i = $564;
|
|
}
|
|
}
|
|
$588 = (($541) - ($524))|0;
|
|
$589 = $588 & $543;
|
|
$590 = ($589>>>0)<(2147483647);
|
|
if ($590) {
|
|
$591 = (_sbrk(($589|0))|0);
|
|
$592 = HEAP32[$$0$i17$i>>2]|0;
|
|
$593 = HEAP32[$559>>2]|0;
|
|
$594 = (($592) + ($593)|0);
|
|
$595 = ($591|0)==($594|0);
|
|
if ($595) {
|
|
$596 = ($591|0)==((-1)|0);
|
|
if (!($596)) {
|
|
$$723947$i = $589;$$748$i = $591;
|
|
label = 190;
|
|
break L255;
|
|
}
|
|
} else {
|
|
$$2247$ph$i = $591;$$2253$ph$i = $589;
|
|
label = 180;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
do {
|
|
if ((label|0) == 172) {
|
|
$566 = (_sbrk(0)|0);
|
|
$567 = ($566|0)==((-1)|0);
|
|
if (!($567)) {
|
|
$568 = $566;
|
|
$569 = HEAP32[(37840)>>2]|0;
|
|
$570 = (($569) + -1)|0;
|
|
$571 = $570 & $568;
|
|
$572 = ($571|0)==(0);
|
|
$573 = (($570) + ($568))|0;
|
|
$574 = (0 - ($569))|0;
|
|
$575 = $573 & $574;
|
|
$576 = (($575) - ($568))|0;
|
|
$577 = $572 ? 0 : $576;
|
|
$$$i = (($577) + ($544))|0;
|
|
$578 = HEAP32[(37796)>>2]|0;
|
|
$579 = (($$$i) + ($578))|0;
|
|
$580 = ($$$i>>>0)>($$0197>>>0);
|
|
$581 = ($$$i>>>0)<(2147483647);
|
|
$or$cond$i211 = $580 & $581;
|
|
if ($or$cond$i211) {
|
|
$582 = HEAP32[(37804)>>2]|0;
|
|
$583 = ($582|0)==(0);
|
|
if (!($583)) {
|
|
$584 = ($579>>>0)<=($578>>>0);
|
|
$585 = ($579>>>0)>($582>>>0);
|
|
$or$cond2$i = $584 | $585;
|
|
if ($or$cond2$i) {
|
|
break;
|
|
}
|
|
}
|
|
$586 = (_sbrk(($$$i|0))|0);
|
|
$587 = ($586|0)==($566|0);
|
|
if ($587) {
|
|
$$723947$i = $$$i;$$748$i = $566;
|
|
label = 190;
|
|
break L255;
|
|
} else {
|
|
$$2247$ph$i = $586;$$2253$ph$i = $$$i;
|
|
label = 180;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
L274: do {
|
|
if ((label|0) == 180) {
|
|
$597 = (0 - ($$2253$ph$i))|0;
|
|
$598 = ($$2247$ph$i|0)!=((-1)|0);
|
|
$599 = ($$2253$ph$i>>>0)<(2147483647);
|
|
$or$cond7$i = $599 & $598;
|
|
$600 = ($539>>>0)>($$2253$ph$i>>>0);
|
|
$or$cond10$i = $600 & $or$cond7$i;
|
|
do {
|
|
if ($or$cond10$i) {
|
|
$601 = HEAP32[(37844)>>2]|0;
|
|
$602 = (($540) - ($$2253$ph$i))|0;
|
|
$603 = (($602) + ($601))|0;
|
|
$604 = (0 - ($601))|0;
|
|
$605 = $603 & $604;
|
|
$606 = ($605>>>0)<(2147483647);
|
|
if ($606) {
|
|
$607 = (_sbrk(($605|0))|0);
|
|
$608 = ($607|0)==((-1)|0);
|
|
if ($608) {
|
|
(_sbrk(($597|0))|0);
|
|
break L274;
|
|
} else {
|
|
$609 = (($605) + ($$2253$ph$i))|0;
|
|
$$5256$i = $609;
|
|
break;
|
|
}
|
|
} else {
|
|
$$5256$i = $$2253$ph$i;
|
|
}
|
|
} else {
|
|
$$5256$i = $$2253$ph$i;
|
|
}
|
|
} while(0);
|
|
$610 = ($$2247$ph$i|0)==((-1)|0);
|
|
if (!($610)) {
|
|
$$723947$i = $$5256$i;$$748$i = $$2247$ph$i;
|
|
label = 190;
|
|
break L255;
|
|
}
|
|
}
|
|
} while(0);
|
|
$611 = HEAP32[(37808)>>2]|0;
|
|
$612 = $611 | 4;
|
|
HEAP32[(37808)>>2] = $612;
|
|
label = 187;
|
|
} else {
|
|
label = 187;
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 187) {
|
|
$613 = ($544>>>0)<(2147483647);
|
|
if ($613) {
|
|
$614 = (_sbrk(($544|0))|0);
|
|
$615 = (_sbrk(0)|0);
|
|
$616 = ($614|0)!=((-1)|0);
|
|
$617 = ($615|0)!=((-1)|0);
|
|
$or$cond5$i = $616 & $617;
|
|
$618 = ($614>>>0)<($615>>>0);
|
|
$or$cond11$i = $618 & $or$cond5$i;
|
|
if ($or$cond11$i) {
|
|
$619 = $615;
|
|
$620 = $614;
|
|
$621 = (($619) - ($620))|0;
|
|
$622 = (($$0197) + 40)|0;
|
|
$$not$i = ($621>>>0)>($622>>>0);
|
|
if ($$not$i) {
|
|
$$723947$i = $621;$$748$i = $614;
|
|
label = 190;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 190) {
|
|
$623 = HEAP32[(37796)>>2]|0;
|
|
$624 = (($623) + ($$723947$i))|0;
|
|
HEAP32[(37796)>>2] = $624;
|
|
$625 = HEAP32[(37800)>>2]|0;
|
|
$626 = ($624>>>0)>($625>>>0);
|
|
if ($626) {
|
|
HEAP32[(37800)>>2] = $624;
|
|
}
|
|
$627 = HEAP32[(37388)>>2]|0;
|
|
$628 = ($627|0)==(0|0);
|
|
do {
|
|
if ($628) {
|
|
$629 = HEAP32[(37380)>>2]|0;
|
|
$630 = ($629|0)==(0|0);
|
|
$631 = ($$748$i>>>0)<($629>>>0);
|
|
$or$cond12$i = $630 | $631;
|
|
if ($or$cond12$i) {
|
|
HEAP32[(37380)>>2] = $$748$i;
|
|
}
|
|
HEAP32[(37812)>>2] = $$748$i;
|
|
HEAP32[(37816)>>2] = $$723947$i;
|
|
HEAP32[(37824)>>2] = 0;
|
|
$632 = HEAP32[9459]|0;
|
|
HEAP32[(37400)>>2] = $632;
|
|
HEAP32[(37396)>>2] = -1;
|
|
$$01$i$i = 0;
|
|
while(1) {
|
|
$633 = $$01$i$i << 1;
|
|
$634 = (37404 + ($633<<2)|0);
|
|
$635 = ((($634)) + 12|0);
|
|
HEAP32[$635>>2] = $634;
|
|
$636 = ((($634)) + 8|0);
|
|
HEAP32[$636>>2] = $634;
|
|
$637 = (($$01$i$i) + 1)|0;
|
|
$exitcond$i$i = ($637|0)==(32);
|
|
if ($exitcond$i$i) {
|
|
break;
|
|
} else {
|
|
$$01$i$i = $637;
|
|
}
|
|
}
|
|
$638 = (($$723947$i) + -40)|0;
|
|
$639 = ((($$748$i)) + 8|0);
|
|
$640 = $639;
|
|
$641 = $640 & 7;
|
|
$642 = ($641|0)==(0);
|
|
$643 = (0 - ($640))|0;
|
|
$644 = $643 & 7;
|
|
$645 = $642 ? 0 : $644;
|
|
$646 = (($$748$i) + ($645)|0);
|
|
$647 = (($638) - ($645))|0;
|
|
HEAP32[(37388)>>2] = $646;
|
|
HEAP32[(37376)>>2] = $647;
|
|
$648 = $647 | 1;
|
|
$649 = ((($646)) + 4|0);
|
|
HEAP32[$649>>2] = $648;
|
|
$650 = (($646) + ($647)|0);
|
|
$651 = ((($650)) + 4|0);
|
|
HEAP32[$651>>2] = 40;
|
|
$652 = HEAP32[(37852)>>2]|0;
|
|
HEAP32[(37392)>>2] = $652;
|
|
} else {
|
|
$$024370$i = (37812);
|
|
while(1) {
|
|
$653 = HEAP32[$$024370$i>>2]|0;
|
|
$654 = ((($$024370$i)) + 4|0);
|
|
$655 = HEAP32[$654>>2]|0;
|
|
$656 = (($653) + ($655)|0);
|
|
$657 = ($$748$i|0)==($656|0);
|
|
if ($657) {
|
|
label = 200;
|
|
break;
|
|
}
|
|
$658 = ((($$024370$i)) + 8|0);
|
|
$659 = HEAP32[$658>>2]|0;
|
|
$660 = ($659|0)==(0|0);
|
|
if ($660) {
|
|
break;
|
|
} else {
|
|
$$024370$i = $659;
|
|
}
|
|
}
|
|
if ((label|0) == 200) {
|
|
$661 = ((($$024370$i)) + 12|0);
|
|
$662 = HEAP32[$661>>2]|0;
|
|
$663 = $662 & 8;
|
|
$664 = ($663|0)==(0);
|
|
if ($664) {
|
|
$665 = ($627>>>0)>=($653>>>0);
|
|
$666 = ($627>>>0)<($$748$i>>>0);
|
|
$or$cond50$i = $666 & $665;
|
|
if ($or$cond50$i) {
|
|
$667 = (($655) + ($$723947$i))|0;
|
|
HEAP32[$654>>2] = $667;
|
|
$668 = HEAP32[(37376)>>2]|0;
|
|
$669 = ((($627)) + 8|0);
|
|
$670 = $669;
|
|
$671 = $670 & 7;
|
|
$672 = ($671|0)==(0);
|
|
$673 = (0 - ($670))|0;
|
|
$674 = $673 & 7;
|
|
$675 = $672 ? 0 : $674;
|
|
$676 = (($627) + ($675)|0);
|
|
$677 = (($$723947$i) - ($675))|0;
|
|
$678 = (($677) + ($668))|0;
|
|
HEAP32[(37388)>>2] = $676;
|
|
HEAP32[(37376)>>2] = $678;
|
|
$679 = $678 | 1;
|
|
$680 = ((($676)) + 4|0);
|
|
HEAP32[$680>>2] = $679;
|
|
$681 = (($676) + ($678)|0);
|
|
$682 = ((($681)) + 4|0);
|
|
HEAP32[$682>>2] = 40;
|
|
$683 = HEAP32[(37852)>>2]|0;
|
|
HEAP32[(37392)>>2] = $683;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$684 = HEAP32[(37380)>>2]|0;
|
|
$685 = ($$748$i>>>0)<($684>>>0);
|
|
if ($685) {
|
|
HEAP32[(37380)>>2] = $$748$i;
|
|
$749 = $$748$i;
|
|
} else {
|
|
$749 = $684;
|
|
}
|
|
$686 = (($$748$i) + ($$723947$i)|0);
|
|
$$124469$i = (37812);
|
|
while(1) {
|
|
$687 = HEAP32[$$124469$i>>2]|0;
|
|
$688 = ($687|0)==($686|0);
|
|
if ($688) {
|
|
label = 208;
|
|
break;
|
|
}
|
|
$689 = ((($$124469$i)) + 8|0);
|
|
$690 = HEAP32[$689>>2]|0;
|
|
$691 = ($690|0)==(0|0);
|
|
if ($691) {
|
|
$$0$i$i$i = (37812);
|
|
break;
|
|
} else {
|
|
$$124469$i = $690;
|
|
}
|
|
}
|
|
if ((label|0) == 208) {
|
|
$692 = ((($$124469$i)) + 12|0);
|
|
$693 = HEAP32[$692>>2]|0;
|
|
$694 = $693 & 8;
|
|
$695 = ($694|0)==(0);
|
|
if ($695) {
|
|
HEAP32[$$124469$i>>2] = $$748$i;
|
|
$696 = ((($$124469$i)) + 4|0);
|
|
$697 = HEAP32[$696>>2]|0;
|
|
$698 = (($697) + ($$723947$i))|0;
|
|
HEAP32[$696>>2] = $698;
|
|
$699 = ((($$748$i)) + 8|0);
|
|
$700 = $699;
|
|
$701 = $700 & 7;
|
|
$702 = ($701|0)==(0);
|
|
$703 = (0 - ($700))|0;
|
|
$704 = $703 & 7;
|
|
$705 = $702 ? 0 : $704;
|
|
$706 = (($$748$i) + ($705)|0);
|
|
$707 = ((($686)) + 8|0);
|
|
$708 = $707;
|
|
$709 = $708 & 7;
|
|
$710 = ($709|0)==(0);
|
|
$711 = (0 - ($708))|0;
|
|
$712 = $711 & 7;
|
|
$713 = $710 ? 0 : $712;
|
|
$714 = (($686) + ($713)|0);
|
|
$715 = $714;
|
|
$716 = $706;
|
|
$717 = (($715) - ($716))|0;
|
|
$718 = (($706) + ($$0197)|0);
|
|
$719 = (($717) - ($$0197))|0;
|
|
$720 = $$0197 | 3;
|
|
$721 = ((($706)) + 4|0);
|
|
HEAP32[$721>>2] = $720;
|
|
$722 = ($714|0)==($627|0);
|
|
do {
|
|
if ($722) {
|
|
$723 = HEAP32[(37376)>>2]|0;
|
|
$724 = (($723) + ($719))|0;
|
|
HEAP32[(37376)>>2] = $724;
|
|
HEAP32[(37388)>>2] = $718;
|
|
$725 = $724 | 1;
|
|
$726 = ((($718)) + 4|0);
|
|
HEAP32[$726>>2] = $725;
|
|
} else {
|
|
$727 = HEAP32[(37384)>>2]|0;
|
|
$728 = ($714|0)==($727|0);
|
|
if ($728) {
|
|
$729 = HEAP32[(37372)>>2]|0;
|
|
$730 = (($729) + ($719))|0;
|
|
HEAP32[(37372)>>2] = $730;
|
|
HEAP32[(37384)>>2] = $718;
|
|
$731 = $730 | 1;
|
|
$732 = ((($718)) + 4|0);
|
|
HEAP32[$732>>2] = $731;
|
|
$733 = (($718) + ($730)|0);
|
|
HEAP32[$733>>2] = $730;
|
|
break;
|
|
}
|
|
$734 = ((($714)) + 4|0);
|
|
$735 = HEAP32[$734>>2]|0;
|
|
$736 = $735 & 3;
|
|
$737 = ($736|0)==(1);
|
|
if ($737) {
|
|
$738 = $735 & -8;
|
|
$739 = $735 >>> 3;
|
|
$740 = ($735>>>0)<(256);
|
|
L326: do {
|
|
if ($740) {
|
|
$741 = ((($714)) + 8|0);
|
|
$742 = HEAP32[$741>>2]|0;
|
|
$743 = ((($714)) + 12|0);
|
|
$744 = HEAP32[$743>>2]|0;
|
|
$745 = $739 << 1;
|
|
$746 = (37404 + ($745<<2)|0);
|
|
$747 = ($742|0)==($746|0);
|
|
do {
|
|
if (!($747)) {
|
|
$748 = ($742>>>0)<($749>>>0);
|
|
if ($748) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$750 = ((($742)) + 12|0);
|
|
$751 = HEAP32[$750>>2]|0;
|
|
$752 = ($751|0)==($714|0);
|
|
if ($752) {
|
|
break;
|
|
}
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
} while(0);
|
|
$753 = ($744|0)==($742|0);
|
|
if ($753) {
|
|
$754 = 1 << $739;
|
|
$755 = $754 ^ -1;
|
|
$756 = HEAP32[9341]|0;
|
|
$757 = $756 & $755;
|
|
HEAP32[9341] = $757;
|
|
break;
|
|
}
|
|
$758 = ($744|0)==($746|0);
|
|
do {
|
|
if ($758) {
|
|
$$pre9$i$i = ((($744)) + 8|0);
|
|
$$pre$phi10$i$iZ2D = $$pre9$i$i;
|
|
} else {
|
|
$759 = ($744>>>0)<($749>>>0);
|
|
if ($759) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$760 = ((($744)) + 8|0);
|
|
$761 = HEAP32[$760>>2]|0;
|
|
$762 = ($761|0)==($714|0);
|
|
if ($762) {
|
|
$$pre$phi10$i$iZ2D = $760;
|
|
break;
|
|
}
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
} while(0);
|
|
$763 = ((($742)) + 12|0);
|
|
HEAP32[$763>>2] = $744;
|
|
HEAP32[$$pre$phi10$i$iZ2D>>2] = $742;
|
|
} else {
|
|
$764 = ((($714)) + 24|0);
|
|
$765 = HEAP32[$764>>2]|0;
|
|
$766 = ((($714)) + 12|0);
|
|
$767 = HEAP32[$766>>2]|0;
|
|
$768 = ($767|0)==($714|0);
|
|
do {
|
|
if ($768) {
|
|
$778 = ((($714)) + 16|0);
|
|
$779 = ((($778)) + 4|0);
|
|
$780 = HEAP32[$779>>2]|0;
|
|
$781 = ($780|0)==(0|0);
|
|
if ($781) {
|
|
$782 = HEAP32[$778>>2]|0;
|
|
$783 = ($782|0)==(0|0);
|
|
if ($783) {
|
|
$$3$i$i = 0;
|
|
break;
|
|
} else {
|
|
$$1290$i$i = $782;$$1292$i$i = $778;
|
|
}
|
|
} else {
|
|
$$1290$i$i = $780;$$1292$i$i = $779;
|
|
}
|
|
while(1) {
|
|
$784 = ((($$1290$i$i)) + 20|0);
|
|
$785 = HEAP32[$784>>2]|0;
|
|
$786 = ($785|0)==(0|0);
|
|
if (!($786)) {
|
|
$$1290$i$i = $785;$$1292$i$i = $784;
|
|
continue;
|
|
}
|
|
$787 = ((($$1290$i$i)) + 16|0);
|
|
$788 = HEAP32[$787>>2]|0;
|
|
$789 = ($788|0)==(0|0);
|
|
if ($789) {
|
|
break;
|
|
} else {
|
|
$$1290$i$i = $788;$$1292$i$i = $787;
|
|
}
|
|
}
|
|
$790 = ($$1292$i$i>>>0)<($749>>>0);
|
|
if ($790) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1292$i$i>>2] = 0;
|
|
$$3$i$i = $$1290$i$i;
|
|
break;
|
|
}
|
|
} else {
|
|
$769 = ((($714)) + 8|0);
|
|
$770 = HEAP32[$769>>2]|0;
|
|
$771 = ($770>>>0)<($749>>>0);
|
|
if ($771) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$772 = ((($770)) + 12|0);
|
|
$773 = HEAP32[$772>>2]|0;
|
|
$774 = ($773|0)==($714|0);
|
|
if (!($774)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$775 = ((($767)) + 8|0);
|
|
$776 = HEAP32[$775>>2]|0;
|
|
$777 = ($776|0)==($714|0);
|
|
if ($777) {
|
|
HEAP32[$772>>2] = $767;
|
|
HEAP32[$775>>2] = $770;
|
|
$$3$i$i = $767;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$791 = ($765|0)==(0|0);
|
|
if ($791) {
|
|
break;
|
|
}
|
|
$792 = ((($714)) + 28|0);
|
|
$793 = HEAP32[$792>>2]|0;
|
|
$794 = (37668 + ($793<<2)|0);
|
|
$795 = HEAP32[$794>>2]|0;
|
|
$796 = ($714|0)==($795|0);
|
|
do {
|
|
if ($796) {
|
|
HEAP32[$794>>2] = $$3$i$i;
|
|
$cond$i$i = ($$3$i$i|0)==(0|0);
|
|
if (!($cond$i$i)) {
|
|
break;
|
|
}
|
|
$797 = 1 << $793;
|
|
$798 = $797 ^ -1;
|
|
$799 = HEAP32[(37368)>>2]|0;
|
|
$800 = $799 & $798;
|
|
HEAP32[(37368)>>2] = $800;
|
|
break L326;
|
|
} else {
|
|
$801 = HEAP32[(37380)>>2]|0;
|
|
$802 = ($765>>>0)<($801>>>0);
|
|
if ($802) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$803 = ((($765)) + 16|0);
|
|
$804 = HEAP32[$803>>2]|0;
|
|
$805 = ($804|0)==($714|0);
|
|
if ($805) {
|
|
HEAP32[$803>>2] = $$3$i$i;
|
|
} else {
|
|
$806 = ((($765)) + 20|0);
|
|
HEAP32[$806>>2] = $$3$i$i;
|
|
}
|
|
$807 = ($$3$i$i|0)==(0|0);
|
|
if ($807) {
|
|
break L326;
|
|
}
|
|
}
|
|
} while(0);
|
|
$808 = HEAP32[(37380)>>2]|0;
|
|
$809 = ($$3$i$i>>>0)<($808>>>0);
|
|
if ($809) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$810 = ((($$3$i$i)) + 24|0);
|
|
HEAP32[$810>>2] = $765;
|
|
$811 = ((($714)) + 16|0);
|
|
$812 = HEAP32[$811>>2]|0;
|
|
$813 = ($812|0)==(0|0);
|
|
do {
|
|
if (!($813)) {
|
|
$814 = ($812>>>0)<($808>>>0);
|
|
if ($814) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$815 = ((($$3$i$i)) + 16|0);
|
|
HEAP32[$815>>2] = $812;
|
|
$816 = ((($812)) + 24|0);
|
|
HEAP32[$816>>2] = $$3$i$i;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$817 = ((($811)) + 4|0);
|
|
$818 = HEAP32[$817>>2]|0;
|
|
$819 = ($818|0)==(0|0);
|
|
if ($819) {
|
|
break;
|
|
}
|
|
$820 = HEAP32[(37380)>>2]|0;
|
|
$821 = ($818>>>0)<($820>>>0);
|
|
if ($821) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$822 = ((($$3$i$i)) + 20|0);
|
|
HEAP32[$822>>2] = $818;
|
|
$823 = ((($818)) + 24|0);
|
|
HEAP32[$823>>2] = $$3$i$i;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$824 = (($714) + ($738)|0);
|
|
$825 = (($738) + ($719))|0;
|
|
$$0$i18$i = $824;$$0286$i$i = $825;
|
|
} else {
|
|
$$0$i18$i = $714;$$0286$i$i = $719;
|
|
}
|
|
$826 = ((($$0$i18$i)) + 4|0);
|
|
$827 = HEAP32[$826>>2]|0;
|
|
$828 = $827 & -2;
|
|
HEAP32[$826>>2] = $828;
|
|
$829 = $$0286$i$i | 1;
|
|
$830 = ((($718)) + 4|0);
|
|
HEAP32[$830>>2] = $829;
|
|
$831 = (($718) + ($$0286$i$i)|0);
|
|
HEAP32[$831>>2] = $$0286$i$i;
|
|
$832 = $$0286$i$i >>> 3;
|
|
$833 = ($$0286$i$i>>>0)<(256);
|
|
if ($833) {
|
|
$834 = $832 << 1;
|
|
$835 = (37404 + ($834<<2)|0);
|
|
$836 = HEAP32[9341]|0;
|
|
$837 = 1 << $832;
|
|
$838 = $836 & $837;
|
|
$839 = ($838|0)==(0);
|
|
do {
|
|
if ($839) {
|
|
$840 = $836 | $837;
|
|
HEAP32[9341] = $840;
|
|
$$pre$i19$i = ((($835)) + 8|0);
|
|
$$0294$i$i = $835;$$pre$phi$i20$iZ2D = $$pre$i19$i;
|
|
} else {
|
|
$841 = ((($835)) + 8|0);
|
|
$842 = HEAP32[$841>>2]|0;
|
|
$843 = HEAP32[(37380)>>2]|0;
|
|
$844 = ($842>>>0)<($843>>>0);
|
|
if (!($844)) {
|
|
$$0294$i$i = $842;$$pre$phi$i20$iZ2D = $841;
|
|
break;
|
|
}
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
} while(0);
|
|
HEAP32[$$pre$phi$i20$iZ2D>>2] = $718;
|
|
$845 = ((($$0294$i$i)) + 12|0);
|
|
HEAP32[$845>>2] = $718;
|
|
$846 = ((($718)) + 8|0);
|
|
HEAP32[$846>>2] = $$0294$i$i;
|
|
$847 = ((($718)) + 12|0);
|
|
HEAP32[$847>>2] = $835;
|
|
break;
|
|
}
|
|
$848 = $$0286$i$i >>> 8;
|
|
$849 = ($848|0)==(0);
|
|
do {
|
|
if ($849) {
|
|
$$0295$i$i = 0;
|
|
} else {
|
|
$850 = ($$0286$i$i>>>0)>(16777215);
|
|
if ($850) {
|
|
$$0295$i$i = 31;
|
|
break;
|
|
}
|
|
$851 = (($848) + 1048320)|0;
|
|
$852 = $851 >>> 16;
|
|
$853 = $852 & 8;
|
|
$854 = $848 << $853;
|
|
$855 = (($854) + 520192)|0;
|
|
$856 = $855 >>> 16;
|
|
$857 = $856 & 4;
|
|
$858 = $857 | $853;
|
|
$859 = $854 << $857;
|
|
$860 = (($859) + 245760)|0;
|
|
$861 = $860 >>> 16;
|
|
$862 = $861 & 2;
|
|
$863 = $858 | $862;
|
|
$864 = (14 - ($863))|0;
|
|
$865 = $859 << $862;
|
|
$866 = $865 >>> 15;
|
|
$867 = (($864) + ($866))|0;
|
|
$868 = $867 << 1;
|
|
$869 = (($867) + 7)|0;
|
|
$870 = $$0286$i$i >>> $869;
|
|
$871 = $870 & 1;
|
|
$872 = $871 | $868;
|
|
$$0295$i$i = $872;
|
|
}
|
|
} while(0);
|
|
$873 = (37668 + ($$0295$i$i<<2)|0);
|
|
$874 = ((($718)) + 28|0);
|
|
HEAP32[$874>>2] = $$0295$i$i;
|
|
$875 = ((($718)) + 16|0);
|
|
$876 = ((($875)) + 4|0);
|
|
HEAP32[$876>>2] = 0;
|
|
HEAP32[$875>>2] = 0;
|
|
$877 = HEAP32[(37368)>>2]|0;
|
|
$878 = 1 << $$0295$i$i;
|
|
$879 = $877 & $878;
|
|
$880 = ($879|0)==(0);
|
|
if ($880) {
|
|
$881 = $877 | $878;
|
|
HEAP32[(37368)>>2] = $881;
|
|
HEAP32[$873>>2] = $718;
|
|
$882 = ((($718)) + 24|0);
|
|
HEAP32[$882>>2] = $873;
|
|
$883 = ((($718)) + 12|0);
|
|
HEAP32[$883>>2] = $718;
|
|
$884 = ((($718)) + 8|0);
|
|
HEAP32[$884>>2] = $718;
|
|
break;
|
|
}
|
|
$885 = HEAP32[$873>>2]|0;
|
|
$886 = ($$0295$i$i|0)==(31);
|
|
$887 = $$0295$i$i >>> 1;
|
|
$888 = (25 - ($887))|0;
|
|
$889 = $886 ? 0 : $888;
|
|
$890 = $$0286$i$i << $889;
|
|
$$0287$i$i = $890;$$0288$i$i = $885;
|
|
while(1) {
|
|
$891 = ((($$0288$i$i)) + 4|0);
|
|
$892 = HEAP32[$891>>2]|0;
|
|
$893 = $892 & -8;
|
|
$894 = ($893|0)==($$0286$i$i|0);
|
|
if ($894) {
|
|
label = 278;
|
|
break;
|
|
}
|
|
$895 = $$0287$i$i >>> 31;
|
|
$896 = (((($$0288$i$i)) + 16|0) + ($895<<2)|0);
|
|
$897 = $$0287$i$i << 1;
|
|
$898 = HEAP32[$896>>2]|0;
|
|
$899 = ($898|0)==(0|0);
|
|
if ($899) {
|
|
label = 275;
|
|
break;
|
|
} else {
|
|
$$0287$i$i = $897;$$0288$i$i = $898;
|
|
}
|
|
}
|
|
if ((label|0) == 275) {
|
|
$900 = HEAP32[(37380)>>2]|0;
|
|
$901 = ($896>>>0)<($900>>>0);
|
|
if ($901) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$896>>2] = $718;
|
|
$902 = ((($718)) + 24|0);
|
|
HEAP32[$902>>2] = $$0288$i$i;
|
|
$903 = ((($718)) + 12|0);
|
|
HEAP32[$903>>2] = $718;
|
|
$904 = ((($718)) + 8|0);
|
|
HEAP32[$904>>2] = $718;
|
|
break;
|
|
}
|
|
}
|
|
else if ((label|0) == 278) {
|
|
$905 = ((($$0288$i$i)) + 8|0);
|
|
$906 = HEAP32[$905>>2]|0;
|
|
$907 = HEAP32[(37380)>>2]|0;
|
|
$908 = ($906>>>0)>=($907>>>0);
|
|
$not$$i22$i = ($$0288$i$i>>>0)>=($907>>>0);
|
|
$909 = $908 & $not$$i22$i;
|
|
if ($909) {
|
|
$910 = ((($906)) + 12|0);
|
|
HEAP32[$910>>2] = $718;
|
|
HEAP32[$905>>2] = $718;
|
|
$911 = ((($718)) + 8|0);
|
|
HEAP32[$911>>2] = $906;
|
|
$912 = ((($718)) + 12|0);
|
|
HEAP32[$912>>2] = $$0288$i$i;
|
|
$913 = ((($718)) + 24|0);
|
|
HEAP32[$913>>2] = 0;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$1044 = ((($706)) + 8|0);
|
|
$$0 = $1044;
|
|
STACKTOP = sp;return ($$0|0);
|
|
} else {
|
|
$$0$i$i$i = (37812);
|
|
}
|
|
}
|
|
while(1) {
|
|
$914 = HEAP32[$$0$i$i$i>>2]|0;
|
|
$915 = ($914>>>0)>($627>>>0);
|
|
if (!($915)) {
|
|
$916 = ((($$0$i$i$i)) + 4|0);
|
|
$917 = HEAP32[$916>>2]|0;
|
|
$918 = (($914) + ($917)|0);
|
|
$919 = ($918>>>0)>($627>>>0);
|
|
if ($919) {
|
|
break;
|
|
}
|
|
}
|
|
$920 = ((($$0$i$i$i)) + 8|0);
|
|
$921 = HEAP32[$920>>2]|0;
|
|
$$0$i$i$i = $921;
|
|
}
|
|
$922 = ((($918)) + -47|0);
|
|
$923 = ((($922)) + 8|0);
|
|
$924 = $923;
|
|
$925 = $924 & 7;
|
|
$926 = ($925|0)==(0);
|
|
$927 = (0 - ($924))|0;
|
|
$928 = $927 & 7;
|
|
$929 = $926 ? 0 : $928;
|
|
$930 = (($922) + ($929)|0);
|
|
$931 = ((($627)) + 16|0);
|
|
$932 = ($930>>>0)<($931>>>0);
|
|
$933 = $932 ? $627 : $930;
|
|
$934 = ((($933)) + 8|0);
|
|
$935 = ((($933)) + 24|0);
|
|
$936 = (($$723947$i) + -40)|0;
|
|
$937 = ((($$748$i)) + 8|0);
|
|
$938 = $937;
|
|
$939 = $938 & 7;
|
|
$940 = ($939|0)==(0);
|
|
$941 = (0 - ($938))|0;
|
|
$942 = $941 & 7;
|
|
$943 = $940 ? 0 : $942;
|
|
$944 = (($$748$i) + ($943)|0);
|
|
$945 = (($936) - ($943))|0;
|
|
HEAP32[(37388)>>2] = $944;
|
|
HEAP32[(37376)>>2] = $945;
|
|
$946 = $945 | 1;
|
|
$947 = ((($944)) + 4|0);
|
|
HEAP32[$947>>2] = $946;
|
|
$948 = (($944) + ($945)|0);
|
|
$949 = ((($948)) + 4|0);
|
|
HEAP32[$949>>2] = 40;
|
|
$950 = HEAP32[(37852)>>2]|0;
|
|
HEAP32[(37392)>>2] = $950;
|
|
$951 = ((($933)) + 4|0);
|
|
HEAP32[$951>>2] = 27;
|
|
;HEAP32[$934>>2]=HEAP32[(37812)>>2]|0;HEAP32[$934+4>>2]=HEAP32[(37812)+4>>2]|0;HEAP32[$934+8>>2]=HEAP32[(37812)+8>>2]|0;HEAP32[$934+12>>2]=HEAP32[(37812)+12>>2]|0;
|
|
HEAP32[(37812)>>2] = $$748$i;
|
|
HEAP32[(37816)>>2] = $$723947$i;
|
|
HEAP32[(37824)>>2] = 0;
|
|
HEAP32[(37820)>>2] = $934;
|
|
$$0$i$i = $935;
|
|
while(1) {
|
|
$952 = ((($$0$i$i)) + 4|0);
|
|
HEAP32[$952>>2] = 7;
|
|
$953 = ((($952)) + 4|0);
|
|
$954 = ($953>>>0)<($918>>>0);
|
|
if ($954) {
|
|
$$0$i$i = $952;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$955 = ($933|0)==($627|0);
|
|
if (!($955)) {
|
|
$956 = $933;
|
|
$957 = $627;
|
|
$958 = (($956) - ($957))|0;
|
|
$959 = HEAP32[$951>>2]|0;
|
|
$960 = $959 & -2;
|
|
HEAP32[$951>>2] = $960;
|
|
$961 = $958 | 1;
|
|
$962 = ((($627)) + 4|0);
|
|
HEAP32[$962>>2] = $961;
|
|
HEAP32[$933>>2] = $958;
|
|
$963 = $958 >>> 3;
|
|
$964 = ($958>>>0)<(256);
|
|
if ($964) {
|
|
$965 = $963 << 1;
|
|
$966 = (37404 + ($965<<2)|0);
|
|
$967 = HEAP32[9341]|0;
|
|
$968 = 1 << $963;
|
|
$969 = $967 & $968;
|
|
$970 = ($969|0)==(0);
|
|
if ($970) {
|
|
$971 = $967 | $968;
|
|
HEAP32[9341] = $971;
|
|
$$pre$i$i = ((($966)) + 8|0);
|
|
$$0211$i$i = $966;$$pre$phi$i$iZ2D = $$pre$i$i;
|
|
} else {
|
|
$972 = ((($966)) + 8|0);
|
|
$973 = HEAP32[$972>>2]|0;
|
|
$974 = HEAP32[(37380)>>2]|0;
|
|
$975 = ($973>>>0)<($974>>>0);
|
|
if ($975) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$$0211$i$i = $973;$$pre$phi$i$iZ2D = $972;
|
|
}
|
|
}
|
|
HEAP32[$$pre$phi$i$iZ2D>>2] = $627;
|
|
$976 = ((($$0211$i$i)) + 12|0);
|
|
HEAP32[$976>>2] = $627;
|
|
$977 = ((($627)) + 8|0);
|
|
HEAP32[$977>>2] = $$0211$i$i;
|
|
$978 = ((($627)) + 12|0);
|
|
HEAP32[$978>>2] = $966;
|
|
break;
|
|
}
|
|
$979 = $958 >>> 8;
|
|
$980 = ($979|0)==(0);
|
|
if ($980) {
|
|
$$0212$i$i = 0;
|
|
} else {
|
|
$981 = ($958>>>0)>(16777215);
|
|
if ($981) {
|
|
$$0212$i$i = 31;
|
|
} else {
|
|
$982 = (($979) + 1048320)|0;
|
|
$983 = $982 >>> 16;
|
|
$984 = $983 & 8;
|
|
$985 = $979 << $984;
|
|
$986 = (($985) + 520192)|0;
|
|
$987 = $986 >>> 16;
|
|
$988 = $987 & 4;
|
|
$989 = $988 | $984;
|
|
$990 = $985 << $988;
|
|
$991 = (($990) + 245760)|0;
|
|
$992 = $991 >>> 16;
|
|
$993 = $992 & 2;
|
|
$994 = $989 | $993;
|
|
$995 = (14 - ($994))|0;
|
|
$996 = $990 << $993;
|
|
$997 = $996 >>> 15;
|
|
$998 = (($995) + ($997))|0;
|
|
$999 = $998 << 1;
|
|
$1000 = (($998) + 7)|0;
|
|
$1001 = $958 >>> $1000;
|
|
$1002 = $1001 & 1;
|
|
$1003 = $1002 | $999;
|
|
$$0212$i$i = $1003;
|
|
}
|
|
}
|
|
$1004 = (37668 + ($$0212$i$i<<2)|0);
|
|
$1005 = ((($627)) + 28|0);
|
|
HEAP32[$1005>>2] = $$0212$i$i;
|
|
$1006 = ((($627)) + 20|0);
|
|
HEAP32[$1006>>2] = 0;
|
|
HEAP32[$931>>2] = 0;
|
|
$1007 = HEAP32[(37368)>>2]|0;
|
|
$1008 = 1 << $$0212$i$i;
|
|
$1009 = $1007 & $1008;
|
|
$1010 = ($1009|0)==(0);
|
|
if ($1010) {
|
|
$1011 = $1007 | $1008;
|
|
HEAP32[(37368)>>2] = $1011;
|
|
HEAP32[$1004>>2] = $627;
|
|
$1012 = ((($627)) + 24|0);
|
|
HEAP32[$1012>>2] = $1004;
|
|
$1013 = ((($627)) + 12|0);
|
|
HEAP32[$1013>>2] = $627;
|
|
$1014 = ((($627)) + 8|0);
|
|
HEAP32[$1014>>2] = $627;
|
|
break;
|
|
}
|
|
$1015 = HEAP32[$1004>>2]|0;
|
|
$1016 = ($$0212$i$i|0)==(31);
|
|
$1017 = $$0212$i$i >>> 1;
|
|
$1018 = (25 - ($1017))|0;
|
|
$1019 = $1016 ? 0 : $1018;
|
|
$1020 = $958 << $1019;
|
|
$$0206$i$i = $1020;$$0207$i$i = $1015;
|
|
while(1) {
|
|
$1021 = ((($$0207$i$i)) + 4|0);
|
|
$1022 = HEAP32[$1021>>2]|0;
|
|
$1023 = $1022 & -8;
|
|
$1024 = ($1023|0)==($958|0);
|
|
if ($1024) {
|
|
label = 304;
|
|
break;
|
|
}
|
|
$1025 = $$0206$i$i >>> 31;
|
|
$1026 = (((($$0207$i$i)) + 16|0) + ($1025<<2)|0);
|
|
$1027 = $$0206$i$i << 1;
|
|
$1028 = HEAP32[$1026>>2]|0;
|
|
$1029 = ($1028|0)==(0|0);
|
|
if ($1029) {
|
|
label = 301;
|
|
break;
|
|
} else {
|
|
$$0206$i$i = $1027;$$0207$i$i = $1028;
|
|
}
|
|
}
|
|
if ((label|0) == 301) {
|
|
$1030 = HEAP32[(37380)>>2]|0;
|
|
$1031 = ($1026>>>0)<($1030>>>0);
|
|
if ($1031) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$1026>>2] = $627;
|
|
$1032 = ((($627)) + 24|0);
|
|
HEAP32[$1032>>2] = $$0207$i$i;
|
|
$1033 = ((($627)) + 12|0);
|
|
HEAP32[$1033>>2] = $627;
|
|
$1034 = ((($627)) + 8|0);
|
|
HEAP32[$1034>>2] = $627;
|
|
break;
|
|
}
|
|
}
|
|
else if ((label|0) == 304) {
|
|
$1035 = ((($$0207$i$i)) + 8|0);
|
|
$1036 = HEAP32[$1035>>2]|0;
|
|
$1037 = HEAP32[(37380)>>2]|0;
|
|
$1038 = ($1036>>>0)>=($1037>>>0);
|
|
$not$$i$i = ($$0207$i$i>>>0)>=($1037>>>0);
|
|
$1039 = $1038 & $not$$i$i;
|
|
if ($1039) {
|
|
$1040 = ((($1036)) + 12|0);
|
|
HEAP32[$1040>>2] = $627;
|
|
HEAP32[$1035>>2] = $627;
|
|
$1041 = ((($627)) + 8|0);
|
|
HEAP32[$1041>>2] = $1036;
|
|
$1042 = ((($627)) + 12|0);
|
|
HEAP32[$1042>>2] = $$0207$i$i;
|
|
$1043 = ((($627)) + 24|0);
|
|
HEAP32[$1043>>2] = 0;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$1045 = HEAP32[(37376)>>2]|0;
|
|
$1046 = ($1045>>>0)>($$0197>>>0);
|
|
if ($1046) {
|
|
$1047 = (($1045) - ($$0197))|0;
|
|
HEAP32[(37376)>>2] = $1047;
|
|
$1048 = HEAP32[(37388)>>2]|0;
|
|
$1049 = (($1048) + ($$0197)|0);
|
|
HEAP32[(37388)>>2] = $1049;
|
|
$1050 = $1047 | 1;
|
|
$1051 = ((($1049)) + 4|0);
|
|
HEAP32[$1051>>2] = $1050;
|
|
$1052 = $$0197 | 3;
|
|
$1053 = ((($1048)) + 4|0);
|
|
HEAP32[$1053>>2] = $1052;
|
|
$1054 = ((($1048)) + 8|0);
|
|
$$0 = $1054;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
}
|
|
$1055 = (___errno_location()|0);
|
|
HEAP32[$1055>>2] = 12;
|
|
$$0 = 0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function _free($0) {
|
|
$0 = $0|0;
|
|
var $$0211$i = 0, $$0211$in$i = 0, $$0381 = 0, $$0382 = 0, $$0394 = 0, $$0401 = 0, $$1 = 0, $$1380 = 0, $$1385 = 0, $$1388 = 0, $$1396 = 0, $$1400 = 0, $$2 = 0, $$3 = 0, $$3398 = 0, $$pre = 0, $$pre$phi439Z2D = 0, $$pre$phi441Z2D = 0, $$pre$phiZ2D = 0, $$pre438 = 0;
|
|
var $$pre440 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
|
|
var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
|
|
var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
|
|
var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
|
|
var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
|
|
var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0;
|
|
var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0;
|
|
var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0;
|
|
var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0;
|
|
var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0;
|
|
var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0;
|
|
var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0;
|
|
var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
|
|
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
|
|
var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
|
|
var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
|
|
var $99 = 0, $cond418 = 0, $cond419 = 0, $not$ = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ($0|0)==(0|0);
|
|
if ($1) {
|
|
return;
|
|
}
|
|
$2 = ((($0)) + -8|0);
|
|
$3 = HEAP32[(37380)>>2]|0;
|
|
$4 = ($2>>>0)<($3>>>0);
|
|
if ($4) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$5 = ((($0)) + -4|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = $6 & 3;
|
|
$8 = ($7|0)==(1);
|
|
if ($8) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$9 = $6 & -8;
|
|
$10 = (($2) + ($9)|0);
|
|
$11 = $6 & 1;
|
|
$12 = ($11|0)==(0);
|
|
do {
|
|
if ($12) {
|
|
$13 = HEAP32[$2>>2]|0;
|
|
$14 = ($7|0)==(0);
|
|
if ($14) {
|
|
return;
|
|
}
|
|
$15 = (0 - ($13))|0;
|
|
$16 = (($2) + ($15)|0);
|
|
$17 = (($13) + ($9))|0;
|
|
$18 = ($16>>>0)<($3>>>0);
|
|
if ($18) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$19 = HEAP32[(37384)>>2]|0;
|
|
$20 = ($16|0)==($19|0);
|
|
if ($20) {
|
|
$105 = ((($10)) + 4|0);
|
|
$106 = HEAP32[$105>>2]|0;
|
|
$107 = $106 & 3;
|
|
$108 = ($107|0)==(3);
|
|
if (!($108)) {
|
|
$$1 = $16;$$1380 = $17;
|
|
break;
|
|
}
|
|
HEAP32[(37372)>>2] = $17;
|
|
$109 = $106 & -2;
|
|
HEAP32[$105>>2] = $109;
|
|
$110 = $17 | 1;
|
|
$111 = ((($16)) + 4|0);
|
|
HEAP32[$111>>2] = $110;
|
|
$112 = (($16) + ($17)|0);
|
|
HEAP32[$112>>2] = $17;
|
|
return;
|
|
}
|
|
$21 = $13 >>> 3;
|
|
$22 = ($13>>>0)<(256);
|
|
if ($22) {
|
|
$23 = ((($16)) + 8|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
$25 = ((($16)) + 12|0);
|
|
$26 = HEAP32[$25>>2]|0;
|
|
$27 = $21 << 1;
|
|
$28 = (37404 + ($27<<2)|0);
|
|
$29 = ($24|0)==($28|0);
|
|
if (!($29)) {
|
|
$30 = ($24>>>0)<($3>>>0);
|
|
if ($30) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$31 = ((($24)) + 12|0);
|
|
$32 = HEAP32[$31>>2]|0;
|
|
$33 = ($32|0)==($16|0);
|
|
if (!($33)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
$34 = ($26|0)==($24|0);
|
|
if ($34) {
|
|
$35 = 1 << $21;
|
|
$36 = $35 ^ -1;
|
|
$37 = HEAP32[9341]|0;
|
|
$38 = $37 & $36;
|
|
HEAP32[9341] = $38;
|
|
$$1 = $16;$$1380 = $17;
|
|
break;
|
|
}
|
|
$39 = ($26|0)==($28|0);
|
|
if ($39) {
|
|
$$pre440 = ((($26)) + 8|0);
|
|
$$pre$phi441Z2D = $$pre440;
|
|
} else {
|
|
$40 = ($26>>>0)<($3>>>0);
|
|
if ($40) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$41 = ((($26)) + 8|0);
|
|
$42 = HEAP32[$41>>2]|0;
|
|
$43 = ($42|0)==($16|0);
|
|
if ($43) {
|
|
$$pre$phi441Z2D = $41;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
$44 = ((($24)) + 12|0);
|
|
HEAP32[$44>>2] = $26;
|
|
HEAP32[$$pre$phi441Z2D>>2] = $24;
|
|
$$1 = $16;$$1380 = $17;
|
|
break;
|
|
}
|
|
$45 = ((($16)) + 24|0);
|
|
$46 = HEAP32[$45>>2]|0;
|
|
$47 = ((($16)) + 12|0);
|
|
$48 = HEAP32[$47>>2]|0;
|
|
$49 = ($48|0)==($16|0);
|
|
do {
|
|
if ($49) {
|
|
$59 = ((($16)) + 16|0);
|
|
$60 = ((($59)) + 4|0);
|
|
$61 = HEAP32[$60>>2]|0;
|
|
$62 = ($61|0)==(0|0);
|
|
if ($62) {
|
|
$63 = HEAP32[$59>>2]|0;
|
|
$64 = ($63|0)==(0|0);
|
|
if ($64) {
|
|
$$3 = 0;
|
|
break;
|
|
} else {
|
|
$$1385 = $63;$$1388 = $59;
|
|
}
|
|
} else {
|
|
$$1385 = $61;$$1388 = $60;
|
|
}
|
|
while(1) {
|
|
$65 = ((($$1385)) + 20|0);
|
|
$66 = HEAP32[$65>>2]|0;
|
|
$67 = ($66|0)==(0|0);
|
|
if (!($67)) {
|
|
$$1385 = $66;$$1388 = $65;
|
|
continue;
|
|
}
|
|
$68 = ((($$1385)) + 16|0);
|
|
$69 = HEAP32[$68>>2]|0;
|
|
$70 = ($69|0)==(0|0);
|
|
if ($70) {
|
|
break;
|
|
} else {
|
|
$$1385 = $69;$$1388 = $68;
|
|
}
|
|
}
|
|
$71 = ($$1388>>>0)<($3>>>0);
|
|
if ($71) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1388>>2] = 0;
|
|
$$3 = $$1385;
|
|
break;
|
|
}
|
|
} else {
|
|
$50 = ((($16)) + 8|0);
|
|
$51 = HEAP32[$50>>2]|0;
|
|
$52 = ($51>>>0)<($3>>>0);
|
|
if ($52) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$53 = ((($51)) + 12|0);
|
|
$54 = HEAP32[$53>>2]|0;
|
|
$55 = ($54|0)==($16|0);
|
|
if (!($55)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$56 = ((($48)) + 8|0);
|
|
$57 = HEAP32[$56>>2]|0;
|
|
$58 = ($57|0)==($16|0);
|
|
if ($58) {
|
|
HEAP32[$53>>2] = $48;
|
|
HEAP32[$56>>2] = $51;
|
|
$$3 = $48;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$72 = ($46|0)==(0|0);
|
|
if ($72) {
|
|
$$1 = $16;$$1380 = $17;
|
|
} else {
|
|
$73 = ((($16)) + 28|0);
|
|
$74 = HEAP32[$73>>2]|0;
|
|
$75 = (37668 + ($74<<2)|0);
|
|
$76 = HEAP32[$75>>2]|0;
|
|
$77 = ($16|0)==($76|0);
|
|
if ($77) {
|
|
HEAP32[$75>>2] = $$3;
|
|
$cond418 = ($$3|0)==(0|0);
|
|
if ($cond418) {
|
|
$78 = 1 << $74;
|
|
$79 = $78 ^ -1;
|
|
$80 = HEAP32[(37368)>>2]|0;
|
|
$81 = $80 & $79;
|
|
HEAP32[(37368)>>2] = $81;
|
|
$$1 = $16;$$1380 = $17;
|
|
break;
|
|
}
|
|
} else {
|
|
$82 = HEAP32[(37380)>>2]|0;
|
|
$83 = ($46>>>0)<($82>>>0);
|
|
if ($83) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$84 = ((($46)) + 16|0);
|
|
$85 = HEAP32[$84>>2]|0;
|
|
$86 = ($85|0)==($16|0);
|
|
if ($86) {
|
|
HEAP32[$84>>2] = $$3;
|
|
} else {
|
|
$87 = ((($46)) + 20|0);
|
|
HEAP32[$87>>2] = $$3;
|
|
}
|
|
$88 = ($$3|0)==(0|0);
|
|
if ($88) {
|
|
$$1 = $16;$$1380 = $17;
|
|
break;
|
|
}
|
|
}
|
|
$89 = HEAP32[(37380)>>2]|0;
|
|
$90 = ($$3>>>0)<($89>>>0);
|
|
if ($90) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$91 = ((($$3)) + 24|0);
|
|
HEAP32[$91>>2] = $46;
|
|
$92 = ((($16)) + 16|0);
|
|
$93 = HEAP32[$92>>2]|0;
|
|
$94 = ($93|0)==(0|0);
|
|
do {
|
|
if (!($94)) {
|
|
$95 = ($93>>>0)<($89>>>0);
|
|
if ($95) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$96 = ((($$3)) + 16|0);
|
|
HEAP32[$96>>2] = $93;
|
|
$97 = ((($93)) + 24|0);
|
|
HEAP32[$97>>2] = $$3;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$98 = ((($92)) + 4|0);
|
|
$99 = HEAP32[$98>>2]|0;
|
|
$100 = ($99|0)==(0|0);
|
|
if ($100) {
|
|
$$1 = $16;$$1380 = $17;
|
|
} else {
|
|
$101 = HEAP32[(37380)>>2]|0;
|
|
$102 = ($99>>>0)<($101>>>0);
|
|
if ($102) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$103 = ((($$3)) + 20|0);
|
|
HEAP32[$103>>2] = $99;
|
|
$104 = ((($99)) + 24|0);
|
|
HEAP32[$104>>2] = $$3;
|
|
$$1 = $16;$$1380 = $17;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
$$1 = $2;$$1380 = $9;
|
|
}
|
|
} while(0);
|
|
$113 = ($$1>>>0)<($10>>>0);
|
|
if (!($113)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$114 = ((($10)) + 4|0);
|
|
$115 = HEAP32[$114>>2]|0;
|
|
$116 = $115 & 1;
|
|
$117 = ($116|0)==(0);
|
|
if ($117) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$118 = $115 & 2;
|
|
$119 = ($118|0)==(0);
|
|
if ($119) {
|
|
$120 = HEAP32[(37388)>>2]|0;
|
|
$121 = ($10|0)==($120|0);
|
|
if ($121) {
|
|
$122 = HEAP32[(37376)>>2]|0;
|
|
$123 = (($122) + ($$1380))|0;
|
|
HEAP32[(37376)>>2] = $123;
|
|
HEAP32[(37388)>>2] = $$1;
|
|
$124 = $123 | 1;
|
|
$125 = ((($$1)) + 4|0);
|
|
HEAP32[$125>>2] = $124;
|
|
$126 = HEAP32[(37384)>>2]|0;
|
|
$127 = ($$1|0)==($126|0);
|
|
if (!($127)) {
|
|
return;
|
|
}
|
|
HEAP32[(37384)>>2] = 0;
|
|
HEAP32[(37372)>>2] = 0;
|
|
return;
|
|
}
|
|
$128 = HEAP32[(37384)>>2]|0;
|
|
$129 = ($10|0)==($128|0);
|
|
if ($129) {
|
|
$130 = HEAP32[(37372)>>2]|0;
|
|
$131 = (($130) + ($$1380))|0;
|
|
HEAP32[(37372)>>2] = $131;
|
|
HEAP32[(37384)>>2] = $$1;
|
|
$132 = $131 | 1;
|
|
$133 = ((($$1)) + 4|0);
|
|
HEAP32[$133>>2] = $132;
|
|
$134 = (($$1) + ($131)|0);
|
|
HEAP32[$134>>2] = $131;
|
|
return;
|
|
}
|
|
$135 = $115 & -8;
|
|
$136 = (($135) + ($$1380))|0;
|
|
$137 = $115 >>> 3;
|
|
$138 = ($115>>>0)<(256);
|
|
do {
|
|
if ($138) {
|
|
$139 = ((($10)) + 8|0);
|
|
$140 = HEAP32[$139>>2]|0;
|
|
$141 = ((($10)) + 12|0);
|
|
$142 = HEAP32[$141>>2]|0;
|
|
$143 = $137 << 1;
|
|
$144 = (37404 + ($143<<2)|0);
|
|
$145 = ($140|0)==($144|0);
|
|
if (!($145)) {
|
|
$146 = HEAP32[(37380)>>2]|0;
|
|
$147 = ($140>>>0)<($146>>>0);
|
|
if ($147) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$148 = ((($140)) + 12|0);
|
|
$149 = HEAP32[$148>>2]|0;
|
|
$150 = ($149|0)==($10|0);
|
|
if (!($150)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
$151 = ($142|0)==($140|0);
|
|
if ($151) {
|
|
$152 = 1 << $137;
|
|
$153 = $152 ^ -1;
|
|
$154 = HEAP32[9341]|0;
|
|
$155 = $154 & $153;
|
|
HEAP32[9341] = $155;
|
|
break;
|
|
}
|
|
$156 = ($142|0)==($144|0);
|
|
if ($156) {
|
|
$$pre438 = ((($142)) + 8|0);
|
|
$$pre$phi439Z2D = $$pre438;
|
|
} else {
|
|
$157 = HEAP32[(37380)>>2]|0;
|
|
$158 = ($142>>>0)<($157>>>0);
|
|
if ($158) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$159 = ((($142)) + 8|0);
|
|
$160 = HEAP32[$159>>2]|0;
|
|
$161 = ($160|0)==($10|0);
|
|
if ($161) {
|
|
$$pre$phi439Z2D = $159;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
$162 = ((($140)) + 12|0);
|
|
HEAP32[$162>>2] = $142;
|
|
HEAP32[$$pre$phi439Z2D>>2] = $140;
|
|
} else {
|
|
$163 = ((($10)) + 24|0);
|
|
$164 = HEAP32[$163>>2]|0;
|
|
$165 = ((($10)) + 12|0);
|
|
$166 = HEAP32[$165>>2]|0;
|
|
$167 = ($166|0)==($10|0);
|
|
do {
|
|
if ($167) {
|
|
$178 = ((($10)) + 16|0);
|
|
$179 = ((($178)) + 4|0);
|
|
$180 = HEAP32[$179>>2]|0;
|
|
$181 = ($180|0)==(0|0);
|
|
if ($181) {
|
|
$182 = HEAP32[$178>>2]|0;
|
|
$183 = ($182|0)==(0|0);
|
|
if ($183) {
|
|
$$3398 = 0;
|
|
break;
|
|
} else {
|
|
$$1396 = $182;$$1400 = $178;
|
|
}
|
|
} else {
|
|
$$1396 = $180;$$1400 = $179;
|
|
}
|
|
while(1) {
|
|
$184 = ((($$1396)) + 20|0);
|
|
$185 = HEAP32[$184>>2]|0;
|
|
$186 = ($185|0)==(0|0);
|
|
if (!($186)) {
|
|
$$1396 = $185;$$1400 = $184;
|
|
continue;
|
|
}
|
|
$187 = ((($$1396)) + 16|0);
|
|
$188 = HEAP32[$187>>2]|0;
|
|
$189 = ($188|0)==(0|0);
|
|
if ($189) {
|
|
break;
|
|
} else {
|
|
$$1396 = $188;$$1400 = $187;
|
|
}
|
|
}
|
|
$190 = HEAP32[(37380)>>2]|0;
|
|
$191 = ($$1400>>>0)<($190>>>0);
|
|
if ($191) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1400>>2] = 0;
|
|
$$3398 = $$1396;
|
|
break;
|
|
}
|
|
} else {
|
|
$168 = ((($10)) + 8|0);
|
|
$169 = HEAP32[$168>>2]|0;
|
|
$170 = HEAP32[(37380)>>2]|0;
|
|
$171 = ($169>>>0)<($170>>>0);
|
|
if ($171) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$172 = ((($169)) + 12|0);
|
|
$173 = HEAP32[$172>>2]|0;
|
|
$174 = ($173|0)==($10|0);
|
|
if (!($174)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$175 = ((($166)) + 8|0);
|
|
$176 = HEAP32[$175>>2]|0;
|
|
$177 = ($176|0)==($10|0);
|
|
if ($177) {
|
|
HEAP32[$172>>2] = $166;
|
|
HEAP32[$175>>2] = $169;
|
|
$$3398 = $166;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$192 = ($164|0)==(0|0);
|
|
if (!($192)) {
|
|
$193 = ((($10)) + 28|0);
|
|
$194 = HEAP32[$193>>2]|0;
|
|
$195 = (37668 + ($194<<2)|0);
|
|
$196 = HEAP32[$195>>2]|0;
|
|
$197 = ($10|0)==($196|0);
|
|
if ($197) {
|
|
HEAP32[$195>>2] = $$3398;
|
|
$cond419 = ($$3398|0)==(0|0);
|
|
if ($cond419) {
|
|
$198 = 1 << $194;
|
|
$199 = $198 ^ -1;
|
|
$200 = HEAP32[(37368)>>2]|0;
|
|
$201 = $200 & $199;
|
|
HEAP32[(37368)>>2] = $201;
|
|
break;
|
|
}
|
|
} else {
|
|
$202 = HEAP32[(37380)>>2]|0;
|
|
$203 = ($164>>>0)<($202>>>0);
|
|
if ($203) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$204 = ((($164)) + 16|0);
|
|
$205 = HEAP32[$204>>2]|0;
|
|
$206 = ($205|0)==($10|0);
|
|
if ($206) {
|
|
HEAP32[$204>>2] = $$3398;
|
|
} else {
|
|
$207 = ((($164)) + 20|0);
|
|
HEAP32[$207>>2] = $$3398;
|
|
}
|
|
$208 = ($$3398|0)==(0|0);
|
|
if ($208) {
|
|
break;
|
|
}
|
|
}
|
|
$209 = HEAP32[(37380)>>2]|0;
|
|
$210 = ($$3398>>>0)<($209>>>0);
|
|
if ($210) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$211 = ((($$3398)) + 24|0);
|
|
HEAP32[$211>>2] = $164;
|
|
$212 = ((($10)) + 16|0);
|
|
$213 = HEAP32[$212>>2]|0;
|
|
$214 = ($213|0)==(0|0);
|
|
do {
|
|
if (!($214)) {
|
|
$215 = ($213>>>0)<($209>>>0);
|
|
if ($215) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$216 = ((($$3398)) + 16|0);
|
|
HEAP32[$216>>2] = $213;
|
|
$217 = ((($213)) + 24|0);
|
|
HEAP32[$217>>2] = $$3398;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$218 = ((($212)) + 4|0);
|
|
$219 = HEAP32[$218>>2]|0;
|
|
$220 = ($219|0)==(0|0);
|
|
if (!($220)) {
|
|
$221 = HEAP32[(37380)>>2]|0;
|
|
$222 = ($219>>>0)<($221>>>0);
|
|
if ($222) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$223 = ((($$3398)) + 20|0);
|
|
HEAP32[$223>>2] = $219;
|
|
$224 = ((($219)) + 24|0);
|
|
HEAP32[$224>>2] = $$3398;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$225 = $136 | 1;
|
|
$226 = ((($$1)) + 4|0);
|
|
HEAP32[$226>>2] = $225;
|
|
$227 = (($$1) + ($136)|0);
|
|
HEAP32[$227>>2] = $136;
|
|
$228 = HEAP32[(37384)>>2]|0;
|
|
$229 = ($$1|0)==($228|0);
|
|
if ($229) {
|
|
HEAP32[(37372)>>2] = $136;
|
|
return;
|
|
} else {
|
|
$$2 = $136;
|
|
}
|
|
} else {
|
|
$230 = $115 & -2;
|
|
HEAP32[$114>>2] = $230;
|
|
$231 = $$1380 | 1;
|
|
$232 = ((($$1)) + 4|0);
|
|
HEAP32[$232>>2] = $231;
|
|
$233 = (($$1) + ($$1380)|0);
|
|
HEAP32[$233>>2] = $$1380;
|
|
$$2 = $$1380;
|
|
}
|
|
$234 = $$2 >>> 3;
|
|
$235 = ($$2>>>0)<(256);
|
|
if ($235) {
|
|
$236 = $234 << 1;
|
|
$237 = (37404 + ($236<<2)|0);
|
|
$238 = HEAP32[9341]|0;
|
|
$239 = 1 << $234;
|
|
$240 = $238 & $239;
|
|
$241 = ($240|0)==(0);
|
|
if ($241) {
|
|
$242 = $238 | $239;
|
|
HEAP32[9341] = $242;
|
|
$$pre = ((($237)) + 8|0);
|
|
$$0401 = $237;$$pre$phiZ2D = $$pre;
|
|
} else {
|
|
$243 = ((($237)) + 8|0);
|
|
$244 = HEAP32[$243>>2]|0;
|
|
$245 = HEAP32[(37380)>>2]|0;
|
|
$246 = ($244>>>0)<($245>>>0);
|
|
if ($246) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$$0401 = $244;$$pre$phiZ2D = $243;
|
|
}
|
|
}
|
|
HEAP32[$$pre$phiZ2D>>2] = $$1;
|
|
$247 = ((($$0401)) + 12|0);
|
|
HEAP32[$247>>2] = $$1;
|
|
$248 = ((($$1)) + 8|0);
|
|
HEAP32[$248>>2] = $$0401;
|
|
$249 = ((($$1)) + 12|0);
|
|
HEAP32[$249>>2] = $237;
|
|
return;
|
|
}
|
|
$250 = $$2 >>> 8;
|
|
$251 = ($250|0)==(0);
|
|
if ($251) {
|
|
$$0394 = 0;
|
|
} else {
|
|
$252 = ($$2>>>0)>(16777215);
|
|
if ($252) {
|
|
$$0394 = 31;
|
|
} else {
|
|
$253 = (($250) + 1048320)|0;
|
|
$254 = $253 >>> 16;
|
|
$255 = $254 & 8;
|
|
$256 = $250 << $255;
|
|
$257 = (($256) + 520192)|0;
|
|
$258 = $257 >>> 16;
|
|
$259 = $258 & 4;
|
|
$260 = $259 | $255;
|
|
$261 = $256 << $259;
|
|
$262 = (($261) + 245760)|0;
|
|
$263 = $262 >>> 16;
|
|
$264 = $263 & 2;
|
|
$265 = $260 | $264;
|
|
$266 = (14 - ($265))|0;
|
|
$267 = $261 << $264;
|
|
$268 = $267 >>> 15;
|
|
$269 = (($266) + ($268))|0;
|
|
$270 = $269 << 1;
|
|
$271 = (($269) + 7)|0;
|
|
$272 = $$2 >>> $271;
|
|
$273 = $272 & 1;
|
|
$274 = $273 | $270;
|
|
$$0394 = $274;
|
|
}
|
|
}
|
|
$275 = (37668 + ($$0394<<2)|0);
|
|
$276 = ((($$1)) + 28|0);
|
|
HEAP32[$276>>2] = $$0394;
|
|
$277 = ((($$1)) + 16|0);
|
|
$278 = ((($$1)) + 20|0);
|
|
HEAP32[$278>>2] = 0;
|
|
HEAP32[$277>>2] = 0;
|
|
$279 = HEAP32[(37368)>>2]|0;
|
|
$280 = 1 << $$0394;
|
|
$281 = $279 & $280;
|
|
$282 = ($281|0)==(0);
|
|
do {
|
|
if ($282) {
|
|
$283 = $279 | $280;
|
|
HEAP32[(37368)>>2] = $283;
|
|
HEAP32[$275>>2] = $$1;
|
|
$284 = ((($$1)) + 24|0);
|
|
HEAP32[$284>>2] = $275;
|
|
$285 = ((($$1)) + 12|0);
|
|
HEAP32[$285>>2] = $$1;
|
|
$286 = ((($$1)) + 8|0);
|
|
HEAP32[$286>>2] = $$1;
|
|
} else {
|
|
$287 = HEAP32[$275>>2]|0;
|
|
$288 = ($$0394|0)==(31);
|
|
$289 = $$0394 >>> 1;
|
|
$290 = (25 - ($289))|0;
|
|
$291 = $288 ? 0 : $290;
|
|
$292 = $$2 << $291;
|
|
$$0381 = $292;$$0382 = $287;
|
|
while(1) {
|
|
$293 = ((($$0382)) + 4|0);
|
|
$294 = HEAP32[$293>>2]|0;
|
|
$295 = $294 & -8;
|
|
$296 = ($295|0)==($$2|0);
|
|
if ($296) {
|
|
label = 130;
|
|
break;
|
|
}
|
|
$297 = $$0381 >>> 31;
|
|
$298 = (((($$0382)) + 16|0) + ($297<<2)|0);
|
|
$299 = $$0381 << 1;
|
|
$300 = HEAP32[$298>>2]|0;
|
|
$301 = ($300|0)==(0|0);
|
|
if ($301) {
|
|
label = 127;
|
|
break;
|
|
} else {
|
|
$$0381 = $299;$$0382 = $300;
|
|
}
|
|
}
|
|
if ((label|0) == 127) {
|
|
$302 = HEAP32[(37380)>>2]|0;
|
|
$303 = ($298>>>0)<($302>>>0);
|
|
if ($303) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$298>>2] = $$1;
|
|
$304 = ((($$1)) + 24|0);
|
|
HEAP32[$304>>2] = $$0382;
|
|
$305 = ((($$1)) + 12|0);
|
|
HEAP32[$305>>2] = $$1;
|
|
$306 = ((($$1)) + 8|0);
|
|
HEAP32[$306>>2] = $$1;
|
|
break;
|
|
}
|
|
}
|
|
else if ((label|0) == 130) {
|
|
$307 = ((($$0382)) + 8|0);
|
|
$308 = HEAP32[$307>>2]|0;
|
|
$309 = HEAP32[(37380)>>2]|0;
|
|
$310 = ($308>>>0)>=($309>>>0);
|
|
$not$ = ($$0382>>>0)>=($309>>>0);
|
|
$311 = $310 & $not$;
|
|
if ($311) {
|
|
$312 = ((($308)) + 12|0);
|
|
HEAP32[$312>>2] = $$1;
|
|
HEAP32[$307>>2] = $$1;
|
|
$313 = ((($$1)) + 8|0);
|
|
HEAP32[$313>>2] = $308;
|
|
$314 = ((($$1)) + 12|0);
|
|
HEAP32[$314>>2] = $$0382;
|
|
$315 = ((($$1)) + 24|0);
|
|
HEAP32[$315>>2] = 0;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$316 = HEAP32[(37396)>>2]|0;
|
|
$317 = (($316) + -1)|0;
|
|
HEAP32[(37396)>>2] = $317;
|
|
$318 = ($317|0)==(0);
|
|
if ($318) {
|
|
$$0211$in$i = (37820);
|
|
} else {
|
|
return;
|
|
}
|
|
while(1) {
|
|
$$0211$i = HEAP32[$$0211$in$i>>2]|0;
|
|
$319 = ($$0211$i|0)==(0|0);
|
|
$320 = ((($$0211$i)) + 8|0);
|
|
if ($319) {
|
|
break;
|
|
} else {
|
|
$$0211$in$i = $320;
|
|
}
|
|
}
|
|
HEAP32[(37396)>>2] = -1;
|
|
return;
|
|
}
|
|
function runPostSets() {
|
|
}
|
|
function _i64Subtract(a, b, c, d) {
|
|
a = a|0; b = b|0; c = c|0; d = d|0;
|
|
var l = 0, h = 0;
|
|
l = (a - c)>>>0;
|
|
h = (b - d)>>>0;
|
|
h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow.
|
|
return ((tempRet0 = h,l|0)|0);
|
|
}
|
|
function _i64Add(a, b, c, d) {
|
|
/*
|
|
x = a + b*2^32
|
|
y = c + d*2^32
|
|
result = l + h*2^32
|
|
*/
|
|
a = a|0; b = b|0; c = c|0; d = d|0;
|
|
var l = 0, h = 0;
|
|
l = (a + c)>>>0;
|
|
h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow.
|
|
return ((tempRet0 = h,l|0)|0);
|
|
}
|
|
function _memset(ptr, value, num) {
|
|
ptr = ptr|0; value = value|0; num = num|0;
|
|
var stop = 0, value4 = 0, stop4 = 0, unaligned = 0;
|
|
stop = (ptr + num)|0;
|
|
if ((num|0) >= 20) {
|
|
// This is unaligned, but quite large, so work hard to get to aligned settings
|
|
value = value & 0xff;
|
|
unaligned = ptr & 3;
|
|
value4 = value | (value << 8) | (value << 16) | (value << 24);
|
|
stop4 = stop & ~3;
|
|
if (unaligned) {
|
|
unaligned = (ptr + 4 - unaligned)|0;
|
|
while ((ptr|0) < (unaligned|0)) { // no need to check for stop, since we have large num
|
|
HEAP8[((ptr)>>0)]=value;
|
|
ptr = (ptr+1)|0;
|
|
}
|
|
}
|
|
while ((ptr|0) < (stop4|0)) {
|
|
HEAP32[((ptr)>>2)]=value4;
|
|
ptr = (ptr+4)|0;
|
|
}
|
|
}
|
|
while ((ptr|0) < (stop|0)) {
|
|
HEAP8[((ptr)>>0)]=value;
|
|
ptr = (ptr+1)|0;
|
|
}
|
|
return (ptr-num)|0;
|
|
}
|
|
function _bitshift64Lshr(low, high, bits) {
|
|
low = low|0; high = high|0; bits = bits|0;
|
|
var ander = 0;
|
|
if ((bits|0) < 32) {
|
|
ander = ((1 << bits) - 1)|0;
|
|
tempRet0 = high >>> bits;
|
|
return (low >>> bits) | ((high&ander) << (32 - bits));
|
|
}
|
|
tempRet0 = 0;
|
|
return (high >>> (bits - 32))|0;
|
|
}
|
|
function _bitshift64Shl(low, high, bits) {
|
|
low = low|0; high = high|0; bits = bits|0;
|
|
var ander = 0;
|
|
if ((bits|0) < 32) {
|
|
ander = ((1 << bits) - 1)|0;
|
|
tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits));
|
|
return low << bits;
|
|
}
|
|
tempRet0 = low << (bits - 32);
|
|
return 0;
|
|
}
|
|
function _llvm_cttz_i32(x) {
|
|
x = x|0;
|
|
var ret = 0;
|
|
ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0);
|
|
if ((ret|0) < 8) return ret|0;
|
|
ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0);
|
|
if ((ret|0) < 8) return (ret + 8)|0;
|
|
ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0);
|
|
if ((ret|0) < 8) return (ret + 16)|0;
|
|
return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0;
|
|
}
|
|
function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) {
|
|
$a$0 = $a$0 | 0;
|
|
$a$1 = $a$1 | 0;
|
|
$b$0 = $b$0 | 0;
|
|
$b$1 = $b$1 | 0;
|
|
$rem = $rem | 0;
|
|
var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0;
|
|
$n_sroa_0_0_extract_trunc = $a$0;
|
|
$n_sroa_1_4_extract_shift$0 = $a$1;
|
|
$n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0;
|
|
$d_sroa_0_0_extract_trunc = $b$0;
|
|
$d_sroa_1_4_extract_shift$0 = $b$1;
|
|
$d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0;
|
|
if (($n_sroa_1_4_extract_trunc | 0) == 0) {
|
|
$4 = ($rem | 0) != 0;
|
|
if (($d_sroa_1_4_extract_trunc | 0) == 0) {
|
|
if ($4) {
|
|
HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
|
|
HEAP32[$rem + 4 >> 2] = 0;
|
|
}
|
|
$_0$1 = 0;
|
|
$_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
} else {
|
|
if (!$4) {
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
HEAP32[$rem >> 2] = $a$0 & -1;
|
|
HEAP32[$rem + 4 >> 2] = $a$1 & 0;
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
}
|
|
$17 = ($d_sroa_1_4_extract_trunc | 0) == 0;
|
|
do {
|
|
if (($d_sroa_0_0_extract_trunc | 0) == 0) {
|
|
if ($17) {
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
|
|
HEAP32[$rem + 4 >> 2] = 0;
|
|
}
|
|
$_0$1 = 0;
|
|
$_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
if (($n_sroa_0_0_extract_trunc | 0) == 0) {
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = 0;
|
|
HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0);
|
|
}
|
|
$_0$1 = 0;
|
|
$_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
$37 = $d_sroa_1_4_extract_trunc - 1 | 0;
|
|
if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) {
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = 0 | $a$0 & -1;
|
|
HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0;
|
|
}
|
|
$_0$1 = 0;
|
|
$_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0);
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
$49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
|
|
$51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
|
|
if ($51 >>> 0 <= 30) {
|
|
$57 = $51 + 1 | 0;
|
|
$58 = 31 - $51 | 0;
|
|
$sr_1_ph = $57;
|
|
$r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0);
|
|
$r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0);
|
|
$q_sroa_0_1_ph = 0;
|
|
$q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58;
|
|
break;
|
|
}
|
|
if (($rem | 0) == 0) {
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
HEAP32[$rem >> 2] = 0 | $a$0 & -1;
|
|
HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
} else {
|
|
if (!$17) {
|
|
$117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
|
|
$119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
|
|
if ($119 >>> 0 <= 31) {
|
|
$125 = $119 + 1 | 0;
|
|
$126 = 31 - $119 | 0;
|
|
$130 = $119 - 31 >> 31;
|
|
$sr_1_ph = $125;
|
|
$r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126;
|
|
$r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130;
|
|
$q_sroa_0_1_ph = 0;
|
|
$q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126;
|
|
break;
|
|
}
|
|
if (($rem | 0) == 0) {
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
HEAP32[$rem >> 2] = 0 | $a$0 & -1;
|
|
HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
$66 = $d_sroa_0_0_extract_trunc - 1 | 0;
|
|
if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) {
|
|
$86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0;
|
|
$88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
|
|
$89 = 64 - $88 | 0;
|
|
$91 = 32 - $88 | 0;
|
|
$92 = $91 >> 31;
|
|
$95 = $88 - 32 | 0;
|
|
$105 = $95 >> 31;
|
|
$sr_1_ph = $88;
|
|
$r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105;
|
|
$r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0);
|
|
$q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92;
|
|
$q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31;
|
|
break;
|
|
}
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc;
|
|
HEAP32[$rem + 4 >> 2] = 0;
|
|
}
|
|
if (($d_sroa_0_0_extract_trunc | 0) == 1) {
|
|
$_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
|
|
$_0$0 = 0 | $a$0 & -1;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
} else {
|
|
$78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0;
|
|
$_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0);
|
|
$_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
}
|
|
} while (0);
|
|
if (($sr_1_ph | 0) == 0) {
|
|
$q_sroa_1_1_lcssa = $q_sroa_1_1_ph;
|
|
$q_sroa_0_1_lcssa = $q_sroa_0_1_ph;
|
|
$r_sroa_1_1_lcssa = $r_sroa_1_1_ph;
|
|
$r_sroa_0_1_lcssa = $r_sroa_0_1_ph;
|
|
$carry_0_lcssa$1 = 0;
|
|
$carry_0_lcssa$0 = 0;
|
|
} else {
|
|
$d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1;
|
|
$d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0;
|
|
$137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0;
|
|
$137$1 = tempRet0;
|
|
$q_sroa_1_1198 = $q_sroa_1_1_ph;
|
|
$q_sroa_0_1199 = $q_sroa_0_1_ph;
|
|
$r_sroa_1_1200 = $r_sroa_1_1_ph;
|
|
$r_sroa_0_1201 = $r_sroa_0_1_ph;
|
|
$sr_1202 = $sr_1_ph;
|
|
$carry_0203 = 0;
|
|
while (1) {
|
|
$147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1;
|
|
$149 = $carry_0203 | $q_sroa_0_1199 << 1;
|
|
$r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31);
|
|
$r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0;
|
|
_i64Subtract($137$0 | 0, $137$1 | 0, $r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0) | 0;
|
|
$150$1 = tempRet0;
|
|
$151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1;
|
|
$152 = $151$0 & 1;
|
|
$154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0, $151$0 & $d_sroa_0_0_insert_insert99$0 | 0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1 | 0) | 0;
|
|
$r_sroa_0_0_extract_trunc = $154$0;
|
|
$r_sroa_1_4_extract_trunc = tempRet0;
|
|
$155 = $sr_1202 - 1 | 0;
|
|
if (($155 | 0) == 0) {
|
|
break;
|
|
} else {
|
|
$q_sroa_1_1198 = $147;
|
|
$q_sroa_0_1199 = $149;
|
|
$r_sroa_1_1200 = $r_sroa_1_4_extract_trunc;
|
|
$r_sroa_0_1201 = $r_sroa_0_0_extract_trunc;
|
|
$sr_1202 = $155;
|
|
$carry_0203 = $152;
|
|
}
|
|
}
|
|
$q_sroa_1_1_lcssa = $147;
|
|
$q_sroa_0_1_lcssa = $149;
|
|
$r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc;
|
|
$r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc;
|
|
$carry_0_lcssa$1 = 0;
|
|
$carry_0_lcssa$0 = $152;
|
|
}
|
|
$q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa;
|
|
$q_sroa_0_0_insert_ext75$1 = 0;
|
|
$q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1;
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa;
|
|
HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0;
|
|
}
|
|
$_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1;
|
|
$_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
function ___udivdi3($a$0, $a$1, $b$0, $b$1) {
|
|
$a$0 = $a$0 | 0;
|
|
$a$1 = $a$1 | 0;
|
|
$b$0 = $b$0 | 0;
|
|
$b$1 = $b$1 | 0;
|
|
var $1$0 = 0;
|
|
$1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0;
|
|
return $1$0 | 0;
|
|
}
|
|
function ___uremdi3($a$0, $a$1, $b$0, $b$1) {
|
|
$a$0 = $a$0 | 0;
|
|
$a$1 = $a$1 | 0;
|
|
$b$0 = $b$0 | 0;
|
|
$b$1 = $b$1 | 0;
|
|
var $rem = 0, __stackBase__ = 0;
|
|
__stackBase__ = STACKTOP;
|
|
STACKTOP = STACKTOP + 16 | 0;
|
|
$rem = __stackBase__ | 0;
|
|
___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0;
|
|
STACKTOP = __stackBase__;
|
|
return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0;
|
|
}
|
|
function _memcpy(dest, src, num) {
|
|
dest = dest|0; src = src|0; num = num|0;
|
|
var ret = 0;
|
|
if ((num|0) >= 4096) return _emscripten_memcpy_big(dest|0, src|0, num|0)|0;
|
|
ret = dest|0;
|
|
if ((dest&3) == (src&3)) {
|
|
while (dest & 3) {
|
|
if ((num|0) == 0) return ret|0;
|
|
HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
|
|
dest = (dest+1)|0;
|
|
src = (src+1)|0;
|
|
num = (num-1)|0;
|
|
}
|
|
while ((num|0) >= 4) {
|
|
HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
|
|
dest = (dest+4)|0;
|
|
src = (src+4)|0;
|
|
num = (num-4)|0;
|
|
}
|
|
}
|
|
while ((num|0) > 0) {
|
|
HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
|
|
dest = (dest+1)|0;
|
|
src = (src+1)|0;
|
|
num = (num-1)|0;
|
|
}
|
|
return ret|0;
|
|
}
|
|
function _pthread_self() {
|
|
return 0;
|
|
}
|
|
|
|
|
|
function dynCall_ii(index,a1) {
|
|
index = index|0;
|
|
a1=a1|0;
|
|
return FUNCTION_TABLE_ii[index&1](a1|0)|0;
|
|
}
|
|
|
|
|
|
function dynCall_iiii(index,a1,a2,a3) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=a3|0;
|
|
return FUNCTION_TABLE_iiii[index&7](a1|0,a2|0,a3|0)|0;
|
|
}
|
|
|
|
|
|
function dynCall_vi(index,a1) {
|
|
index = index|0;
|
|
a1=a1|0;
|
|
FUNCTION_TABLE_vi[index&3](a1|0);
|
|
}
|
|
|
|
function b0(p0) {
|
|
p0 = p0|0; abort(0);return 0;
|
|
}
|
|
function b1(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; abort(1);return 0;
|
|
}
|
|
function b2(p0) {
|
|
p0 = p0|0; abort(2);
|
|
}
|
|
|
|
// EMSCRIPTEN_END_FUNCS
|
|
var FUNCTION_TABLE_ii = [b0,___stdio_close];
|
|
var FUNCTION_TABLE_iiii = [b1,___stdio_write,___stdio_seek,___stdout_write,___stdio_read,_sn_write,b1,b1];
|
|
var FUNCTION_TABLE_vi = [b2,_cleanup_88,_cleanup,b2];
|
|
|
|
return { _i64Subtract: _i64Subtract, _free: _free, _main: _main, _i64Add: _i64Add, _pthread_self: _pthread_self, _memset: _memset, _llvm_cttz_i32: _llvm_cttz_i32, _malloc: _malloc, _memcpy: _memcpy, _bitshift64Shl: _bitshift64Shl, _bitshift64Lshr: _bitshift64Lshr, ___udivdi3: ___udivdi3, ___uremdi3: ___uremdi3, ___errno_location: ___errno_location, ___udivmoddi4: ___udivmoddi4, runPostSets: runPostSets, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_ii: dynCall_ii, dynCall_iiii: dynCall_iiii, dynCall_vi: dynCall_vi };
|
|
})
|
|
// EMSCRIPTEN_END_ASM
|
|
(Module.asmGlobalArg, Module.asmLibraryArg, buffer);
|
|
|
|
var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"];
|
|
var _free = Module["_free"] = asm["_free"];
|
|
var _main = Module["_main"] = asm["_main"];
|
|
var _i64Add = Module["_i64Add"] = asm["_i64Add"];
|
|
var runPostSets = Module["runPostSets"] = asm["runPostSets"];
|
|
var ___udivmoddi4 = Module["___udivmoddi4"] = asm["___udivmoddi4"];
|
|
var _pthread_self = Module["_pthread_self"] = asm["_pthread_self"];
|
|
var _memset = Module["_memset"] = asm["_memset"];
|
|
var _llvm_cttz_i32 = Module["_llvm_cttz_i32"] = asm["_llvm_cttz_i32"];
|
|
var _malloc = Module["_malloc"] = asm["_malloc"];
|
|
var _memcpy = Module["_memcpy"] = asm["_memcpy"];
|
|
var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"];
|
|
var ___udivdi3 = Module["___udivdi3"] = asm["___udivdi3"];
|
|
var ___uremdi3 = Module["___uremdi3"] = asm["___uremdi3"];
|
|
var ___errno_location = Module["___errno_location"] = asm["___errno_location"];
|
|
var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"];
|
|
var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"];
|
|
var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"];
|
|
var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"];
|
|
;
|
|
|
|
Runtime.stackAlloc = asm['stackAlloc'];
|
|
Runtime.stackSave = asm['stackSave'];
|
|
Runtime.stackRestore = asm['stackRestore'];
|
|
Runtime.establishStackSpace = asm['establishStackSpace'];
|
|
|
|
Runtime.setTempRet0 = asm['setTempRet0'];
|
|
Runtime.getTempRet0 = asm['getTempRet0'];
|
|
|
|
|
|
|
|
// === Auto-generated postamble setup entry stuff ===
|
|
|
|
Module["FS"] = FS;
|
|
|
|
|
|
|
|
function ExitStatus(status) {
|
|
this.name = "ExitStatus";
|
|
this.message = "Program terminated with exit(" + status + ")";
|
|
this.status = status;
|
|
};
|
|
ExitStatus.prototype = new Error();
|
|
ExitStatus.prototype.constructor = ExitStatus;
|
|
|
|
var initialStackTop;
|
|
var preloadStartTime = null;
|
|
var calledMain = false;
|
|
|
|
dependenciesFulfilled = function runCaller() {
|
|
// If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
|
|
if (!Module['calledRun']) run();
|
|
if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
|
|
}
|
|
|
|
Module['callMain'] = Module.callMain = function callMain(args) {
|
|
|
|
args = args || [];
|
|
|
|
ensureInitRuntime();
|
|
|
|
var argc = args.length+1;
|
|
function pad() {
|
|
for (var i = 0; i < 4-1; i++) {
|
|
argv.push(0);
|
|
}
|
|
}
|
|
var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ];
|
|
pad();
|
|
for (var i = 0; i < argc-1; i = i + 1) {
|
|
argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL));
|
|
pad();
|
|
}
|
|
argv.push(0);
|
|
argv = allocate(argv, 'i32', ALLOC_NORMAL);
|
|
|
|
|
|
try {
|
|
|
|
var ret = Module['_main'](argc, argv, 0);
|
|
|
|
|
|
// if we're not running an evented main loop, it's time to exit
|
|
exit(ret, /* implicit = */ true);
|
|
}
|
|
catch(e) {
|
|
if (e instanceof ExitStatus) {
|
|
// exit() throws this once it's done to make sure execution
|
|
// has been stopped completely
|
|
return;
|
|
} else if (e == 'SimulateInfiniteLoop') {
|
|
// running an evented main loop, don't immediately exit
|
|
Module['noExitRuntime'] = true;
|
|
return;
|
|
} else {
|
|
if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]);
|
|
throw e;
|
|
}
|
|
} finally {
|
|
calledMain = true;
|
|
}
|
|
}
|
|
|
|
|
|
|
|
|
|
function run(args) {
|
|
args = args || Module['arguments'];
|
|
|
|
if (preloadStartTime === null) preloadStartTime = Date.now();
|
|
|
|
if (runDependencies > 0) {
|
|
return;
|
|
}
|
|
|
|
|
|
preRun();
|
|
|
|
if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
|
|
if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
|
|
|
|
function doRun() {
|
|
if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
|
|
Module['calledRun'] = true;
|
|
|
|
if (ABORT) return;
|
|
|
|
ensureInitRuntime();
|
|
|
|
preMain();
|
|
|
|
|
|
if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
|
|
|
|
if (Module['_main'] && shouldRunNow) Module['callMain'](args);
|
|
|
|
postRun();
|
|
}
|
|
|
|
if (Module['setStatus']) {
|
|
Module['setStatus']('Running...');
|
|
setTimeout(function() {
|
|
setTimeout(function() {
|
|
Module['setStatus']('');
|
|
}, 1);
|
|
doRun();
|
|
}, 1);
|
|
} else {
|
|
doRun();
|
|
}
|
|
}
|
|
Module['run'] = Module.run = run;
|
|
|
|
function exit(status, implicit) {
|
|
if (implicit && Module['noExitRuntime']) {
|
|
return;
|
|
}
|
|
|
|
if (Module['noExitRuntime']) {
|
|
} else {
|
|
|
|
ABORT = true;
|
|
EXITSTATUS = status;
|
|
STACKTOP = initialStackTop;
|
|
|
|
exitRuntime();
|
|
|
|
if (Module['onExit']) Module['onExit'](status);
|
|
}
|
|
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
process['exit'](status);
|
|
} else if (ENVIRONMENT_IS_SHELL && typeof quit === 'function') {
|
|
quit(status);
|
|
}
|
|
// if we reach here, we must throw an exception to halt the current execution
|
|
throw new ExitStatus(status);
|
|
}
|
|
Module['exit'] = Module.exit = exit;
|
|
|
|
var abortDecorators = [];
|
|
|
|
function abort(what) {
|
|
if (what !== undefined) {
|
|
Module.print(what);
|
|
Module.printErr(what);
|
|
what = JSON.stringify(what)
|
|
} else {
|
|
what = '';
|
|
}
|
|
|
|
ABORT = true;
|
|
EXITSTATUS = 1;
|
|
|
|
var extra = '\nIf this abort() is unexpected, build with -s ASSERTIONS=1 which can give more information.';
|
|
|
|
var output = 'abort(' + what + ') at ' + stackTrace() + extra;
|
|
if (abortDecorators) {
|
|
abortDecorators.forEach(function(decorator) {
|
|
output = decorator(output, what);
|
|
});
|
|
}
|
|
throw output;
|
|
}
|
|
Module['abort'] = Module.abort = abort;
|
|
|
|
// {{PRE_RUN_ADDITIONS}}
|
|
|
|
if (Module['preInit']) {
|
|
if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
|
|
while (Module['preInit'].length > 0) {
|
|
Module['preInit'].pop()();
|
|
}
|
|
}
|
|
|
|
// shouldRunNow refers to calling main(), not run().
|
|
var shouldRunNow = true;
|
|
if (Module['noInitialRun']) {
|
|
shouldRunNow = false;
|
|
}
|
|
|
|
Module["noExitRuntime"] = true;
|
|
|
|
run();
|
|
|
|
// {{POST_RUN_ADDITIONS}}
|
|
|
|
|
|
|
|
|
|
|
|
// {{MODULE_ADDITIONS}}
|
|
|
|
|
|
|
|
|
|
return Module;
|
|
};
|